/*!*****************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js!./node_modules/bootstrap/dist/css/bootstrap.min.css ***!
  \*****************************************************************************************************/
@charset "UTF-8";/*!
 * Bootstrap  v5.3.3 (https://getbootstrap.com/)
 * Copyright 2011-2024 The Bootstrap Authors
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */:root,[data-bs-theme=light]{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-primary-text-emphasis:#052c65;--bs-secondary-text-emphasis:#2b2f32;--bs-success-text-emphasis:#0a3622;--bs-info-text-emphasis:#055160;--bs-warning-text-emphasis:#664d03;--bs-danger-text-emphasis:#58151c;--bs-light-text-emphasis:#495057;--bs-dark-text-emphasis:#495057;--bs-primary-bg-subtle:#cfe2ff;--bs-secondary-bg-subtle:#e2e3e5;--bs-success-bg-subtle:#d1e7dd;--bs-info-bg-subtle:#cff4fc;--bs-warning-bg-subtle:#fff3cd;--bs-danger-bg-subtle:#f8d7da;--bs-light-bg-subtle:#fcfcfd;--bs-dark-bg-subtle:#ced4da;--bs-primary-border-subtle:#9ec5fe;--bs-secondary-border-subtle:#c4c8cb;--bs-success-border-subtle:#a3cfbb;--bs-info-border-subtle:#9eeaf9;--bs-warning-border-subtle:#ffe69c;--bs-danger-border-subtle:#f1aeb5;--bs-light-border-subtle:#e9ecef;--bs-dark-border-subtle:#adb5bd;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-color-rgb:33,37,41;--bs-body-bg:#fff;--bs-body-bg-rgb:255,255,255;--bs-emphasis-color:#000;--bs-emphasis-color-rgb:0,0,0;--bs-secondary-color:rgba(33, 37, 41, 0.75);--bs-secondary-color-rgb:33,37,41;--bs-secondary-bg:#e9ecef;--bs-secondary-bg-rgb:233,236,239;--bs-tertiary-color:rgba(33, 37, 41, 0.5);--bs-tertiary-color-rgb:33,37,41;--bs-tertiary-bg:#f8f9fa;--bs-tertiary-bg-rgb:248,249,250;--bs-heading-color:inherit;--bs-link-color:#0d6efd;--bs-link-color-rgb:13,110,253;--bs-link-decoration:underline;--bs-link-hover-color:#0a58ca;--bs-link-hover-color-rgb:10,88,202;--bs-code-color:#d63384;--bs-highlight-color:#212529;--bs-highlight-bg:#fff3cd;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-xxl:2rem;--bs-border-radius-2xl:var(--bs-border-radius-xxl);--bs-border-radius-pill:50rem;--bs-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg:0 1rem 3rem rgba(0, 0, 0, 0.175);--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width:0.25rem;--bs-focus-ring-opacity:0.25;--bs-focus-ring-color:rgba(13, 110, 253, 0.25);--bs-form-valid-color:#198754;--bs-form-valid-border-color:#198754;--bs-form-invalid-color:#dc3545;--bs-form-invalid-border-color:#dc3545}[data-bs-theme=dark]{color-scheme:dark;--bs-body-color:#dee2e6;--bs-body-color-rgb:222,226,230;--bs-body-bg:#212529;--bs-body-bg-rgb:33,37,41;--bs-emphasis-color:#fff;--bs-emphasis-color-rgb:255,255,255;--bs-secondary-color:rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb:222,226,230;--bs-secondary-bg:#343a40;--bs-secondary-bg-rgb:52,58,64;--bs-tertiary-color:rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb:222,226,230;--bs-tertiary-bg:#2b3035;--bs-tertiary-bg-rgb:43,48,53;--bs-primary-text-emphasis:#6ea8fe;--bs-secondary-text-emphasis:#a7acb1;--bs-success-text-emphasis:#75b798;--bs-info-text-emphasis:#6edff6;--bs-warning-text-emphasis:#ffda6a;--bs-danger-text-emphasis:#ea868f;--bs-light-text-emphasis:#f8f9fa;--bs-dark-text-emphasis:#dee2e6;--bs-primary-bg-subtle:#031633;--bs-secondary-bg-subtle:#161719;--bs-success-bg-subtle:#051b11;--bs-info-bg-subtle:#032830;--bs-warning-bg-subtle:#332701;--bs-danger-bg-subtle:#2c0b0e;--bs-light-bg-subtle:#343a40;--bs-dark-bg-subtle:#1a1d20;--bs-primary-border-subtle:#084298;--bs-secondary-border-subtle:#41464b;--bs-success-border-subtle:#0f5132;--bs-info-border-subtle:#087990;--bs-warning-border-subtle:#997404;--bs-danger-border-subtle:#842029;--bs-light-border-subtle:#495057;--bs-dark-border-subtle:#343a40;--bs-heading-color:inherit;--bs-link-color:#6ea8fe;--bs-link-hover-color:#8bb9fe;--bs-link-color-rgb:110,168,254;--bs-link-hover-color-rgb:139,185,254;--bs-code-color:#e685b5;--bs-highlight-color:#dee2e6;--bs-highlight-bg:#664d03;--bs-border-color:#495057;--bs-border-color-translucent:rgba(255, 255, 255, 0.15);--bs-form-valid-color:#75b798;--bs-form-valid-border-color:#75b798;--bs-form-invalid-color:#ea868f;--bs-form-invalid-border-color:#ea868f}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,1));text-decoration:underline}a:hover{--bs-link-color-rgb:var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.66666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#a6b5cc;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#b5b6b7;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#a7b9b1;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#a6c3ca;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#ccc2a4;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#c6acae;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::-moz-placeholder{color:var(--bs-secondary-color);opacity:1}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:var(--bs-secondary-bg)}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27%3e%3cpath fill=%27none%27 stroke=%27%23343a40%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%272%27 d=%27m2 5 6 6 6-6%27/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27%3e%3cpath fill=%27none%27 stroke=%27%23dee2e6%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%272%27 d=%27m2 5 6 6 6-6%27/%3e%3c/svg%3e")}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 20 20%27%3e%3cpath fill=%27none%27 stroke=%27%23fff%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%273%27 d=%27m6 10 3 3 6-6%27/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%272%27 fill=%27%23fff%27/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 20 20%27%3e%3cpath fill=%27none%27 stroke=%27%23fff%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%273%27 d=%27M6 10h8%27/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27rgba%280, 0, 0, 0.25%29%27/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27%2386b7fe%27/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27%23fff%27/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27rgba%28255, 255, 255, 0.25%29%27/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;-webkit-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;-moz-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:not(:-moz-placeholder-shown)~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control-plaintext~label::after,.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}.form-floating>.form-control:disabled~label::after,.form-floating>:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 8 8%27%3e%3cpath fill=%27%23198754%27 d=%27M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z%27/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 8 8%27%3e%3cpath fill=%27%23198754%27 d=%27M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z%27/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 12 12%27 width=%2712%27 height=%2712%27 fill=%27none%27 stroke=%27%23dc3545%27%3e%3ccircle cx=%276%27 cy=%276%27 r=%274.5%27/%3e%3cpath stroke-linejoin=%27round%27 d=%27M5.8 3.6h.4L6 6.5z%27/%3e%3ccircle cx=%276%27 cy=%278.2%27 r=%27.6%27 fill=%27%23dc3545%27 stroke=%27none%27/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 12 12%27 width=%2712%27 height=%2712%27 fill=%27none%27 stroke=%27%23dc3545%27%3e%3ccircle cx=%276%27 cy=%276%27 r=%274.5%27/%3e%3cpath stroke-linejoin=%27round%27 d=%27M5.8 3.6h.4L6 6.5z%27/%3e%3ccircle cx=%276%27 cy=%278.2%27 r=%27.6%27 fill=%27%23dc3545%27 stroke=%27none%27/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked:focus-visible+.btn{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:var(--bs-body-color);--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 30 30%27%3e%3cpath stroke=%27rgba%2833, 37, 41, 0.75%29%27 stroke-linecap=%27round%27 stroke-miterlimit=%2710%27 stroke-width=%272%27 d=%27M4 7h22M4 15h22M4 23h22%27/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 30 30%27%3e%3cpath stroke=%27rgba%28255, 255, 255, 0.55%29%27 stroke-linecap=%27round%27 stroke-miterlimit=%2710%27 stroke-width=%272%27 d=%27M4 7h22M4 15h22M4 23h22%27/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 30 30%27%3e%3cpath stroke=%27rgba%28255, 255, 255, 0.55%29%27 stroke-linecap=%27round%27 stroke-miterlimit=%2710%27 stroke-width=%272%27 d=%27M4 7h22M4 15h22M4 23h22%27/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27none%27 stroke=%27%23212529%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27%3e%3cpath d=%27M2 5L8 11L14 5%27/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27none%27 stroke=%27%23052c65%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27%3e%3cpath d=%27M2 5L8 11L14 5%27/%3e%3c/svg%3e");--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type>.accordion-header .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type>.accordion-header .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type>.accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush>.accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush>.accordion-item:first-child{border-top:0}.accordion-flush>.accordion-item:last-child{border-bottom:0}.accordion-flush>.accordion-item>.accordion-header .accordion-button,.accordion-flush>.accordion-item>.accordion-header .accordion-button.collapsed{border-radius:0}.accordion-flush>.accordion-item>.accordion-collapse{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%236ea8fe%27%3e%3cpath fill-rule=%27evenodd%27 d=%27M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z%27/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%236ea8fe%27%3e%3cpath fill-rule=%27evenodd%27 d=%27M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z%27/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:var(--bs-tertiary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:var(--bs-secondary-color);--bs-pagination-disabled-bg:var(--bs-secondary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%23000%27%3e%3cpath d=%27M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z%27/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-secondary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:var(--bs-border-width);--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:inherit;--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%23fff%27%3e%3cpath d=%27M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z%27/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%23fff%27%3e%3cpath d=%27M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z%27/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin:calc(-.5 * var(--bs-offcanvas-padding-y)) calc(-.5 * var(--bs-offcanvas-padding-x)) calc(-.5 * var(--bs-offcanvas-padding-y)) auto}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}.link-primary:focus,.link-primary:hover{color:RGBA(10,88,202,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important}.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}.link-secondary:focus,.link-secondary:hover{color:RGBA(86,94,100,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important}.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}.link-success:focus,.link-success:hover{color:RGBA(20,108,67,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important}.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}.link-info:focus,.link-info:hover{color:RGBA(61,213,243,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important}.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}.link-warning:focus,.link-warning:hover{color:RGBA(255,205,57,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important}.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}.link-danger:focus,.link-danger:hover{color:RGBA(176,42,55,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important}.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;-webkit-backface-visibility:hidden;backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.object-fit-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-none{-o-object-fit:none!important;object-fit:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.overflow-x-auto{overflow-x:auto!important}.overflow-x-hidden{overflow-x:hidden!important}.overflow-x-visible{overflow-x:visible!important}.overflow-x-scroll{overflow-x:scroll!important}.overflow-y-auto{overflow-y:auto!important}.overflow-y-hidden{overflow-y:hidden!important}.overflow-y-visible{overflow-y:visible!important}.overflow-y-scroll{overflow-y:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-inline-grid{display:inline-grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:var(--bs-box-shadow)!important}.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}.shadow-none{box-shadow:none!important}.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}.border-1{border-width:1px!important}.border-2{border-width:2px!important}.border-3{border-width:3px!important}.border-4{border-width:4px!important}.border-5{border-width:5px!important}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.row-gap-0{row-gap:0!important}.row-gap-1{row-gap:.25rem!important}.row-gap-2{row-gap:.5rem!important}.row-gap-3{row-gap:1rem!important}.row-gap-4{row-gap:1.5rem!important}.row-gap-5{row-gap:3rem!important}.column-gap-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-lighter{font-weight:lighter!important}.fw-light{font-weight:300!important}.fw-normal{font-weight:400!important}.fw-medium{font-weight:500!important}.fw-semibold{font-weight:600!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}.link-opacity-10{--bs-link-opacity:0.1}.link-opacity-10-hover:hover{--bs-link-opacity:0.1}.link-opacity-25{--bs-link-opacity:0.25}.link-opacity-25-hover:hover{--bs-link-opacity:0.25}.link-opacity-50{--bs-link-opacity:0.5}.link-opacity-50-hover:hover{--bs-link-opacity:0.5}.link-opacity-75{--bs-link-opacity:0.75}.link-opacity-75-hover:hover{--bs-link-opacity:0.75}.link-opacity-100{--bs-link-opacity:1}.link-opacity-100-hover:hover{--bs-link-opacity:1}.link-offset-1{text-underline-offset:0.125em!important}.link-offset-1-hover:hover{text-underline-offset:0.125em!important}.link-offset-2{text-underline-offset:0.25em!important}.link-offset-2-hover:hover{text-underline-offset:0.25em!important}.link-offset-3{text-underline-offset:0.375em!important}.link-offset-3-hover:hover{text-underline-offset:0.375em!important}.link-underline-primary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-secondary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-success{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}.link-underline-info{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}.link-underline-warning{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}.link-underline-danger{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}.link-underline-light{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}.link-underline-dark{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}.link-underline{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-underline-opacity-0{--bs-link-underline-opacity:0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}.link-underline-opacity-10{--bs-link-underline-opacity:0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}.link-underline-opacity-25{--bs-link-underline-opacity:0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}.link-underline-opacity-50{--bs-link-underline-opacity:0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}.link-underline-opacity-75{--bs-link-underline-opacity:0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}.link-underline-opacity-100{--bs-link-underline-opacity:1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}.z-n1{z-index:-1!important}.z-0{z-index:0!important}.z-1{z-index:1!important}.z-2{z-index:2!important}.z-3{z-index:3!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-sm-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-sm-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-sm-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-sm-none{-o-object-fit:none!important;object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-sm-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-sm-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-sm-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-sm-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-sm-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-md-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-md-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-md-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-md-none{-o-object-fit:none!important;object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-md-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-md-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-md-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-md-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-md-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-lg-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-lg-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-lg-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-lg-none{-o-object-fit:none!important;object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-lg-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-lg-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-lg-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-lg-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-lg-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xl-none{-o-object-fit:none!important;object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xxl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xxl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xxl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xxl-none{-o-object-fit:none!important;object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xxl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xxl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xxl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xxl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xxl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}}
/*!************************************************************************************************************!*\
  !*** css ./node_modules/css-loader/dist/cjs.js!./node_modules/sass-loader/dist/cjs.js!./css/src/main.scss ***!
  \************************************************************************************************************/
@charset "UTF-8";
/*!
 * Bootstrap  v5.3.3 (https://getbootstrap.com/)
 * Copyright 2011-2024 The Bootstrap Authors
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */
:root,
[data-bs-theme=light] {
  --bs-blue: #0d6efd;
  --bs-indigo: #6610f2;
  --bs-purple: #6f42c1;
  --bs-pink: #d63384;
  --bs-red: #dc3545;
  --bs-orange: #fd7e14;
  --bs-yellow: #ffc107;
  --bs-green: #198754;
  --bs-teal: #20c997;
  --bs-cyan: #0dcaf0;
  --bs-black: #000;
  --bs-white: #fff;
  --bs-gray: #6c757d;
  --bs-gray-dark: #343a40;
  --bs-gray-100: #f8f9fa;
  --bs-gray-200: #e9ecef;
  --bs-gray-300: #dee2e6;
  --bs-gray-400: #ced4da;
  --bs-gray-500: #adb5bd;
  --bs-gray-600: #6c757d;
  --bs-gray-700: #495057;
  --bs-gray-800: #343a40;
  --bs-gray-900: #212529;
  --bs-primary: #1CC197;
  --bs-gray-100: #f8f9fa;
  --bs-gray-200: #e9ecef;
  --bs-gray-300: #dee2e6;
  --bs-gray-400: #ced4da;
  --bs-gray-500: #adb5bd;
  --bs-gray-600: #6c757d;
  --bs-gray-700: #495057;
  --bs-gray-800: #343a40;
  --bs-gray-900: #212529;
  --bs-primary-rgb: 28, 193, 151;
  --bs-gray-100-rgb: 248, 249, 250;
  --bs-gray-200-rgb: 233, 236, 239;
  --bs-gray-300-rgb: 222, 226, 230;
  --bs-gray-400-rgb: 206, 212, 218;
  --bs-gray-500-rgb: 173, 181, 189;
  --bs-gray-600-rgb: 108, 117, 125;
  --bs-gray-700-rgb: 73, 80, 87;
  --bs-gray-800-rgb: 52, 58, 64;
  --bs-gray-900-rgb: 33, 37, 41;
  --bs-primary-text-emphasis: #0b4d3c;
  --bs-secondary-text-emphasis: #2b2f32;
  --bs-success-text-emphasis: #0a3622;
  --bs-info-text-emphasis: #055160;
  --bs-warning-text-emphasis: #664d03;
  --bs-danger-text-emphasis: #58151c;
  --bs-light-text-emphasis: #495057;
  --bs-dark-text-emphasis: #495057;
  --bs-primary-bg-subtle: #d2f3ea;
  --bs-secondary-bg-subtle: #e2e3e5;
  --bs-success-bg-subtle: #d1e7dd;
  --bs-info-bg-subtle: #cff4fc;
  --bs-warning-bg-subtle: #fff3cd;
  --bs-danger-bg-subtle: #f8d7da;
  --bs-light-bg-subtle: #fcfcfd;
  --bs-dark-bg-subtle: #ced4da;
  --bs-primary-border-subtle: #a4e6d5;
  --bs-secondary-border-subtle: #c4c8cb;
  --bs-success-border-subtle: #a3cfbb;
  --bs-info-border-subtle: #9eeaf9;
  --bs-warning-border-subtle: #ffe69c;
  --bs-danger-border-subtle: #f1aeb5;
  --bs-light-border-subtle: #e9ecef;
  --bs-dark-border-subtle: #adb5bd;
  --bs-white-rgb: 255, 255, 255;
  --bs-black-rgb: 0, 0, 0;
  --bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  --bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
  --bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));
  --bs-body-font-family: var(--bs-font-sans-serif);
  --bs-body-font-size: 1rem;
  --bs-body-font-weight: 400;
  --bs-body-line-height: 1.5;
  --bs-body-color: #212529;
  --bs-body-color-rgb: 33, 37, 41;
  --bs-body-bg: #fff;
  --bs-body-bg-rgb: 255, 255, 255;
  --bs-emphasis-color: #000;
  --bs-emphasis-color-rgb: 0, 0, 0;
  --bs-secondary-color: rgba(33, 37, 41, 0.75);
  --bs-secondary-color-rgb: 33, 37, 41;
  --bs-secondary-bg: #e9ecef;
  --bs-secondary-bg-rgb: 233, 236, 239;
  --bs-tertiary-color: rgba(33, 37, 41, 0.5);
  --bs-tertiary-color-rgb: 33, 37, 41;
  --bs-tertiary-bg: #f8f9fa;
  --bs-tertiary-bg-rgb: 248, 249, 250;
  --bs-heading-color: inherit;
  --bs-link-color: #1CC197;
  --bs-link-color-rgb: 28, 193, 151;
  --bs-link-decoration: underline;
  --bs-link-hover-color: #169a79;
  --bs-link-hover-color-rgb: 22, 154, 121;
  --bs-code-color: #d63384;
  --bs-highlight-color: #212529;
  --bs-highlight-bg: #fff3cd;
  --bs-border-width: 1px;
  --bs-border-style: solid;
  --bs-border-color: #dee2e6;
  --bs-border-color-translucent: rgba(0, 0, 0, 0.175);
  --bs-border-radius: 0.375rem;
  --bs-border-radius-sm: 0.25rem;
  --bs-border-radius-lg: 0.5rem;
  --bs-border-radius-xl: 1rem;
  --bs-border-radius-xxl: 2rem;
  --bs-border-radius-2xl: var(--bs-border-radius-xxl);
  --bs-border-radius-pill: 50rem;
  --bs-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);
  --bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);
  --bs-box-shadow-lg: 0 1rem 3rem rgba(0, 0, 0, 0.175);
  --bs-box-shadow-inset: inset 0 1px 2px rgba(0, 0, 0, 0.075);
  --bs-focus-ring-width: 0.25rem;
  --bs-focus-ring-opacity: 0.25;
  --bs-focus-ring-color: rgba(28, 193, 151, 0.25);
  --bs-form-valid-color: #198754;
  --bs-form-valid-border-color: #198754;
  --bs-form-invalid-color: #dc3545;
  --bs-form-invalid-border-color: #dc3545;
}

[data-bs-theme=dark] {
  color-scheme: dark;
  --bs-body-color: #dee2e6;
  --bs-body-color-rgb: 222, 226, 230;
  --bs-body-bg: #212529;
  --bs-body-bg-rgb: 33, 37, 41;
  --bs-emphasis-color: #fff;
  --bs-emphasis-color-rgb: 255, 255, 255;
  --bs-secondary-color: rgba(222, 226, 230, 0.75);
  --bs-secondary-color-rgb: 222, 226, 230;
  --bs-secondary-bg: #343a40;
  --bs-secondary-bg-rgb: 52, 58, 64;
  --bs-tertiary-color: rgba(222, 226, 230, 0.5);
  --bs-tertiary-color-rgb: 222, 226, 230;
  --bs-tertiary-bg: #2b3035;
  --bs-tertiary-bg-rgb: 43, 48, 53;
  --bs-primary-text-emphasis: #77dac1;
  --bs-secondary-text-emphasis: #a7acb1;
  --bs-success-text-emphasis: #75b798;
  --bs-info-text-emphasis: #6edff6;
  --bs-warning-text-emphasis: #ffda6a;
  --bs-danger-text-emphasis: #ea868f;
  --bs-light-text-emphasis: #f8f9fa;
  --bs-dark-text-emphasis: #dee2e6;
  --bs-primary-bg-subtle: #06271e;
  --bs-secondary-bg-subtle: #161719;
  --bs-success-bg-subtle: #051b11;
  --bs-info-bg-subtle: #032830;
  --bs-warning-bg-subtle: #332701;
  --bs-danger-bg-subtle: #2c0b0e;
  --bs-light-bg-subtle: #343a40;
  --bs-dark-bg-subtle: #1a1d20;
  --bs-primary-border-subtle: #11745b;
  --bs-secondary-border-subtle: #41464b;
  --bs-success-border-subtle: #0f5132;
  --bs-info-border-subtle: #087990;
  --bs-warning-border-subtle: #997404;
  --bs-danger-border-subtle: #842029;
  --bs-light-border-subtle: #495057;
  --bs-dark-border-subtle: #343a40;
  --bs-heading-color: inherit;
  --bs-link-color: #77dac1;
  --bs-link-hover-color: #92e1cd;
  --bs-link-color-rgb: 119, 218, 193;
  --bs-link-hover-color-rgb: 146, 225, 205;
  --bs-code-color: #e685b5;
  --bs-highlight-color: #dee2e6;
  --bs-highlight-bg: #664d03;
  --bs-border-color: #495057;
  --bs-border-color-translucent: rgba(255, 255, 255, 0.15);
  --bs-form-valid-color: #75b798;
  --bs-form-valid-border-color: #75b798;
  --bs-form-invalid-color: #ea868f;
  --bs-form-invalid-border-color: #ea868f;
}

*,
*::before,
*::after {
  box-sizing: border-box;
}

@media (prefers-reduced-motion: no-preference) {
  :root {
    scroll-behavior: smooth;
  }
}

body {
  margin: 0;
  font-family: var(--bs-body-font-family);
  font-size: var(--bs-body-font-size);
  font-weight: var(--bs-body-font-weight);
  line-height: var(--bs-body-line-height);
  color: var(--bs-body-color);
  text-align: var(--bs-body-text-align);
  background-color: var(--bs-body-bg);
  -webkit-text-size-adjust: 100%;
  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
}

hr {
  margin: 1rem 0;
  color: inherit;
  border: 0;
  border-top: var(--bs-border-width) solid;
  opacity: 0.25;
}

h6, .h6, h5, .h5, h4, .h4, h3, .h3, h2, .h2, h1, .h1 {
  margin-top: 0;
  margin-bottom: 0.5rem;
  font-weight: 500;
  line-height: 1.2;
  color: var(--bs-heading-color);
}

h1, .h1 {
  font-size: calc(1.375rem + 1.5vw);
}
@media (min-width: 1200px) {
  h1, .h1 {
    font-size: 2.5rem;
  }
}

h2, .h2 {
  font-size: calc(1.325rem + 0.9vw);
}
@media (min-width: 1200px) {
  h2, .h2 {
    font-size: 2rem;
  }
}

h3, .h3 {
  font-size: calc(1.3rem + 0.6vw);
}
@media (min-width: 1200px) {
  h3, .h3 {
    font-size: 1.75rem;
  }
}

h4, .h4 {
  font-size: calc(1.275rem + 0.3vw);
}
@media (min-width: 1200px) {
  h4, .h4 {
    font-size: 1.5rem;
  }
}

h5, .h5 {
  font-size: 1.25rem;
}

h6, .h6 {
  font-size: 1rem;
}

p {
  margin-top: 0;
  margin-bottom: 1rem;
}

abbr[title] {
  text-decoration: underline dotted;
  cursor: help;
  text-decoration-skip-ink: none;
}

address {
  margin-bottom: 1rem;
  font-style: normal;
  line-height: inherit;
}

ol,
ul {
  padding-left: 2rem;
}

ol,
ul,
dl {
  margin-top: 0;
  margin-bottom: 1rem;
}

ol ol,
ul ul,
ol ul,
ul ol {
  margin-bottom: 0;
}

dt {
  font-weight: 700;
}

dd {
  margin-bottom: 0.5rem;
  margin-left: 0;
}

blockquote {
  margin: 0 0 1rem;
}

b,
strong {
  font-weight: bolder;
}

small, .small {
  font-size: 0.875em;
}

mark, .mark {
  padding: 0.1875em;
  color: var(--bs-highlight-color);
  background-color: var(--bs-highlight-bg);
}

sub,
sup {
  position: relative;
  font-size: 0.75em;
  line-height: 0;
  vertical-align: baseline;
}

sub {
  bottom: -0.25em;
}

sup {
  top: -0.5em;
}

a {
  color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));
  text-decoration: underline;
}
a:hover {
  --bs-link-color-rgb: var(--bs-link-hover-color-rgb);
}

a:not([href]):not([class]), a:not([href]):not([class]):hover {
  color: inherit;
  text-decoration: none;
}

pre,
code,
kbd,
samp {
  font-family: var(--bs-font-monospace);
  font-size: 1em;
}

pre {
  display: block;
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto;
  font-size: 0.875em;
}
pre code {
  font-size: inherit;
  color: inherit;
  word-break: normal;
}

code {
  font-size: 0.875em;
  color: var(--bs-code-color);
  word-wrap: break-word;
}
a > code {
  color: inherit;
}

kbd {
  padding: 0.1875rem 0.375rem;
  font-size: 0.875em;
  color: var(--bs-body-bg);
  background-color: var(--bs-body-color);
  border-radius: 0.25rem;
}
kbd kbd {
  padding: 0;
  font-size: 1em;
}

figure {
  margin: 0 0 1rem;
}

img,
svg {
  vertical-align: middle;
}

table {
  caption-side: bottom;
  border-collapse: collapse;
}

caption {
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
  color: var(--bs-secondary-color);
  text-align: left;
}

th {
  text-align: inherit;
  text-align: -webkit-match-parent;
}

thead,
tbody,
tfoot,
tr,
td,
th {
  border-color: inherit;
  border-style: solid;
  border-width: 0;
}

label {
  display: inline-block;
}

button {
  border-radius: 0;
}

button:focus:not(:focus-visible) {
  outline: 0;
}

input,
button,
select,
optgroup,
textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
}

button,
select {
  text-transform: none;
}

[role=button] {
  cursor: pointer;
}

select {
  word-wrap: normal;
}
select:disabled {
  opacity: 1;
}

[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator {
  display: none !important;
}

button,
[type=button],
[type=reset],
[type=submit] {
  -webkit-appearance: button;
}
button:not(:disabled),
[type=button]:not(:disabled),
[type=reset]:not(:disabled),
[type=submit]:not(:disabled) {
  cursor: pointer;
}

::-moz-focus-inner {
  padding: 0;
  border-style: none;
}

textarea {
  resize: vertical;
}

fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0;
}

legend {
  float: left;
  width: 100%;
  padding: 0;
  margin-bottom: 0.5rem;
  font-size: calc(1.275rem + 0.3vw);
  line-height: inherit;
}
@media (min-width: 1200px) {
  legend {
    font-size: 1.5rem;
  }
}
legend + * {
  clear: left;
}

::-webkit-datetime-edit-fields-wrapper,
::-webkit-datetime-edit-text,
::-webkit-datetime-edit-minute,
::-webkit-datetime-edit-hour-field,
::-webkit-datetime-edit-day-field,
::-webkit-datetime-edit-month-field,
::-webkit-datetime-edit-year-field {
  padding: 0;
}

::-webkit-inner-spin-button {
  height: auto;
}

[type=search] {
  -webkit-appearance: textfield;
  outline-offset: -2px;
}

/* rtl:raw:
[type="tel"],
[type="url"],
[type="email"],
[type="number"] {
  direction: ltr;
}
*/
::-webkit-search-decoration {
  -webkit-appearance: none;
}

::-webkit-color-swatch-wrapper {
  padding: 0;
}

::file-selector-button {
  font: inherit;
  -webkit-appearance: button;
}

output {
  display: inline-block;
}

iframe {
  border: 0;
}

summary {
  display: list-item;
  cursor: pointer;
}

progress {
  vertical-align: baseline;
}

[hidden] {
  display: none !important;
}

.lead {
  font-size: 1.25rem;
  font-weight: 300;
}

.display-1 {
  font-size: calc(1.625rem + 4.5vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-1 {
    font-size: 5rem;
  }
}

.display-2 {
  font-size: calc(1.575rem + 3.9vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-2 {
    font-size: 4.5rem;
  }
}

.display-3 {
  font-size: calc(1.525rem + 3.3vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-3 {
    font-size: 4rem;
  }
}

.display-4 {
  font-size: calc(1.475rem + 2.7vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-4 {
    font-size: 3.5rem;
  }
}

.display-5 {
  font-size: calc(1.425rem + 2.1vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-5 {
    font-size: 3rem;
  }
}

.display-6 {
  font-size: calc(1.375rem + 1.5vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-6 {
    font-size: 2.5rem;
  }
}

.list-unstyled {
  padding-left: 0;
  list-style: none;
}

.list-inline {
  padding-left: 0;
  list-style: none;
}

.list-inline-item {
  display: inline-block;
}
.list-inline-item:not(:last-child) {
  margin-right: 0.5rem;
}

.initialism {
  font-size: 0.875em;
  text-transform: uppercase;
}

.blockquote {
  margin-bottom: 1rem;
  font-size: 1.25rem;
}
.blockquote > :last-child {
  margin-bottom: 0;
}

.blockquote-footer {
  margin-top: -1rem;
  margin-bottom: 1rem;
  font-size: 0.875em;
  color: #6c757d;
}
.blockquote-footer::before {
  content: "— ";
}

.img-fluid {
  max-width: 100%;
  height: auto;
}

.img-thumbnail {
  padding: 0.25rem;
  background-color: var(--bs-body-bg);
  border: var(--bs-border-width) solid var(--bs-border-color);
  border-radius: var(--bs-border-radius);
  max-width: 100%;
  height: auto;
}

.figure {
  display: inline-block;
}

.figure-img {
  margin-bottom: 0.5rem;
  line-height: 1;
}

.figure-caption {
  font-size: 0.875em;
  color: var(--bs-secondary-color);
}

.container,
.container-fluid,
.container-xxl,
.container-xl,
.container-lg,
.container-md,
.container-sm {
  --bs-gutter-x: 1.5rem;
  --bs-gutter-y: 0;
  width: 100%;
  padding-right: calc(var(--bs-gutter-x) * 0.5);
  padding-left: calc(var(--bs-gutter-x) * 0.5);
  margin-right: auto;
  margin-left: auto;
}

@media (min-width: 576px) {
  .container-sm, .container {
    max-width: 540px;
  }
}
@media (min-width: 768px) {
  .container-md, .container-sm, .container {
    max-width: 720px;
  }
}
@media (min-width: 992px) {
  .container-lg, .container-md, .container-sm, .container {
    max-width: 960px;
  }
}
@media (min-width: 1200px) {
  .container-xl, .container-lg, .container-md, .container-sm, .container {
    max-width: 1140px;
  }
}
@media (min-width: 1400px) {
  .container-xxl, .container-xl, .container-lg, .container-md, .container-sm, .container {
    max-width: 1320px;
  }
}
:root {
  --bs-breakpoint-xs: 0;
  --bs-breakpoint-sm: 576px;
  --bs-breakpoint-md: 768px;
  --bs-breakpoint-lg: 992px;
  --bs-breakpoint-xl: 1200px;
  --bs-breakpoint-xxl: 1400px;
}

.row {
  --bs-gutter-x: 1.5rem;
  --bs-gutter-y: 0;
  display: flex;
  flex-wrap: wrap;
  margin-top: calc(-1 * var(--bs-gutter-y));
  margin-right: calc(-0.5 * var(--bs-gutter-x));
  margin-left: calc(-0.5 * var(--bs-gutter-x));
}
.row > * {
  flex-shrink: 0;
  width: 100%;
  max-width: 100%;
  padding-right: calc(var(--bs-gutter-x) * 0.5);
  padding-left: calc(var(--bs-gutter-x) * 0.5);
  margin-top: var(--bs-gutter-y);
}

.col {
  flex: 1 0 0%;
}

.row-cols-auto > * {
  flex: 0 0 auto;
  width: auto;
}

.row-cols-1 > * {
  flex: 0 0 auto;
  width: 100%;
}

.row-cols-2 > * {
  flex: 0 0 auto;
  width: 50%;
}

.row-cols-3 > * {
  flex: 0 0 auto;
  width: 33.33333333%;
}

.row-cols-4 > * {
  flex: 0 0 auto;
  width: 25%;
}

.row-cols-5 > * {
  flex: 0 0 auto;
  width: 20%;
}

.row-cols-6 > * {
  flex: 0 0 auto;
  width: 16.66666667%;
}

.col-auto {
  flex: 0 0 auto;
  width: auto;
}

.col-1 {
  flex: 0 0 auto;
  width: 8.33333333%;
}

.col-2 {
  flex: 0 0 auto;
  width: 16.66666667%;
}

.col-3 {
  flex: 0 0 auto;
  width: 25%;
}

.col-4 {
  flex: 0 0 auto;
  width: 33.33333333%;
}

.col-5 {
  flex: 0 0 auto;
  width: 41.66666667%;
}

.col-6 {
  flex: 0 0 auto;
  width: 50%;
}

.col-7 {
  flex: 0 0 auto;
  width: 58.33333333%;
}

.col-8 {
  flex: 0 0 auto;
  width: 66.66666667%;
}

.col-9 {
  flex: 0 0 auto;
  width: 75%;
}

.col-10 {
  flex: 0 0 auto;
  width: 83.33333333%;
}

.col-11 {
  flex: 0 0 auto;
  width: 91.66666667%;
}

.col-12 {
  flex: 0 0 auto;
  width: 100%;
}

.offset-1 {
  margin-left: 8.33333333%;
}

.offset-2 {
  margin-left: 16.66666667%;
}

.offset-3 {
  margin-left: 25%;
}

.offset-4 {
  margin-left: 33.33333333%;
}

.offset-5 {
  margin-left: 41.66666667%;
}

.offset-6 {
  margin-left: 50%;
}

.offset-7 {
  margin-left: 58.33333333%;
}

.offset-8 {
  margin-left: 66.66666667%;
}

.offset-9 {
  margin-left: 75%;
}

.offset-10 {
  margin-left: 83.33333333%;
}

.offset-11 {
  margin-left: 91.66666667%;
}

.g-0,
.gx-0 {
  --bs-gutter-x: 0;
}

.g-0,
.gy-0 {
  --bs-gutter-y: 0;
}

.g-1,
.gx-1 {
  --bs-gutter-x: 0.25rem;
}

.g-1,
.gy-1 {
  --bs-gutter-y: 0.25rem;
}

.g-2,
.gx-2 {
  --bs-gutter-x: 0.5rem;
}

.g-2,
.gy-2 {
  --bs-gutter-y: 0.5rem;
}

.g-3,
.gx-3 {
  --bs-gutter-x: 1rem;
}

.g-3,
.gy-3 {
  --bs-gutter-y: 1rem;
}

.g-4,
.gx-4 {
  --bs-gutter-x: 1.5rem;
}

.g-4,
.gy-4 {
  --bs-gutter-y: 1.5rem;
}

.g-5,
.gx-5 {
  --bs-gutter-x: 3rem;
}

.g-5,
.gy-5 {
  --bs-gutter-y: 3rem;
}

.g-6,
.gx-6 {
  --bs-gutter-x: 5rem;
}

.g-6,
.gy-6 {
  --bs-gutter-y: 5rem;
}

.g-7,
.gx-7 {
  --bs-gutter-x: 8rem;
}

.g-7,
.gy-7 {
  --bs-gutter-y: 8rem;
}

.g-8,
.gx-8 {
  --bs-gutter-x: 10rem;
}

.g-8,
.gy-8 {
  --bs-gutter-y: 10rem;
}

.g-9,
.gx-9 {
  --bs-gutter-x: 15rem;
}

.g-9,
.gy-9 {
  --bs-gutter-y: 15rem;
}

.g-10,
.gx-10 {
  --bs-gutter-x: 20rem;
}

.g-10,
.gy-10 {
  --bs-gutter-y: 20rem;
}

@media (min-width: 576px) {
  .col-sm {
    flex: 1 0 0%;
  }
  .row-cols-sm-auto > * {
    flex: 0 0 auto;
    width: auto;
  }
  .row-cols-sm-1 > * {
    flex: 0 0 auto;
    width: 100%;
  }
  .row-cols-sm-2 > * {
    flex: 0 0 auto;
    width: 50%;
  }
  .row-cols-sm-3 > * {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .row-cols-sm-4 > * {
    flex: 0 0 auto;
    width: 25%;
  }
  .row-cols-sm-5 > * {
    flex: 0 0 auto;
    width: 20%;
  }
  .row-cols-sm-6 > * {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-sm-auto {
    flex: 0 0 auto;
    width: auto;
  }
  .col-sm-1 {
    flex: 0 0 auto;
    width: 8.33333333%;
  }
  .col-sm-2 {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-sm-3 {
    flex: 0 0 auto;
    width: 25%;
  }
  .col-sm-4 {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .col-sm-5 {
    flex: 0 0 auto;
    width: 41.66666667%;
  }
  .col-sm-6 {
    flex: 0 0 auto;
    width: 50%;
  }
  .col-sm-7 {
    flex: 0 0 auto;
    width: 58.33333333%;
  }
  .col-sm-8 {
    flex: 0 0 auto;
    width: 66.66666667%;
  }
  .col-sm-9 {
    flex: 0 0 auto;
    width: 75%;
  }
  .col-sm-10 {
    flex: 0 0 auto;
    width: 83.33333333%;
  }
  .col-sm-11 {
    flex: 0 0 auto;
    width: 91.66666667%;
  }
  .col-sm-12 {
    flex: 0 0 auto;
    width: 100%;
  }
  .offset-sm-0 {
    margin-left: 0;
  }
  .offset-sm-1 {
    margin-left: 8.33333333%;
  }
  .offset-sm-2 {
    margin-left: 16.66666667%;
  }
  .offset-sm-3 {
    margin-left: 25%;
  }
  .offset-sm-4 {
    margin-left: 33.33333333%;
  }
  .offset-sm-5 {
    margin-left: 41.66666667%;
  }
  .offset-sm-6 {
    margin-left: 50%;
  }
  .offset-sm-7 {
    margin-left: 58.33333333%;
  }
  .offset-sm-8 {
    margin-left: 66.66666667%;
  }
  .offset-sm-9 {
    margin-left: 75%;
  }
  .offset-sm-10 {
    margin-left: 83.33333333%;
  }
  .offset-sm-11 {
    margin-left: 91.66666667%;
  }
  .g-sm-0,
  .gx-sm-0 {
    --bs-gutter-x: 0;
  }
  .g-sm-0,
  .gy-sm-0 {
    --bs-gutter-y: 0;
  }
  .g-sm-1,
  .gx-sm-1 {
    --bs-gutter-x: 0.25rem;
  }
  .g-sm-1,
  .gy-sm-1 {
    --bs-gutter-y: 0.25rem;
  }
  .g-sm-2,
  .gx-sm-2 {
    --bs-gutter-x: 0.5rem;
  }
  .g-sm-2,
  .gy-sm-2 {
    --bs-gutter-y: 0.5rem;
  }
  .g-sm-3,
  .gx-sm-3 {
    --bs-gutter-x: 1rem;
  }
  .g-sm-3,
  .gy-sm-3 {
    --bs-gutter-y: 1rem;
  }
  .g-sm-4,
  .gx-sm-4 {
    --bs-gutter-x: 1.5rem;
  }
  .g-sm-4,
  .gy-sm-4 {
    --bs-gutter-y: 1.5rem;
  }
  .g-sm-5,
  .gx-sm-5 {
    --bs-gutter-x: 3rem;
  }
  .g-sm-5,
  .gy-sm-5 {
    --bs-gutter-y: 3rem;
  }
  .g-sm-6,
  .gx-sm-6 {
    --bs-gutter-x: 5rem;
  }
  .g-sm-6,
  .gy-sm-6 {
    --bs-gutter-y: 5rem;
  }
  .g-sm-7,
  .gx-sm-7 {
    --bs-gutter-x: 8rem;
  }
  .g-sm-7,
  .gy-sm-7 {
    --bs-gutter-y: 8rem;
  }
  .g-sm-8,
  .gx-sm-8 {
    --bs-gutter-x: 10rem;
  }
  .g-sm-8,
  .gy-sm-8 {
    --bs-gutter-y: 10rem;
  }
  .g-sm-9,
  .gx-sm-9 {
    --bs-gutter-x: 15rem;
  }
  .g-sm-9,
  .gy-sm-9 {
    --bs-gutter-y: 15rem;
  }
  .g-sm-10,
  .gx-sm-10 {
    --bs-gutter-x: 20rem;
  }
  .g-sm-10,
  .gy-sm-10 {
    --bs-gutter-y: 20rem;
  }
}
@media (min-width: 768px) {
  .col-md {
    flex: 1 0 0%;
  }
  .row-cols-md-auto > * {
    flex: 0 0 auto;
    width: auto;
  }
  .row-cols-md-1 > * {
    flex: 0 0 auto;
    width: 100%;
  }
  .row-cols-md-2 > * {
    flex: 0 0 auto;
    width: 50%;
  }
  .row-cols-md-3 > * {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .row-cols-md-4 > * {
    flex: 0 0 auto;
    width: 25%;
  }
  .row-cols-md-5 > * {
    flex: 0 0 auto;
    width: 20%;
  }
  .row-cols-md-6 > * {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-md-auto {
    flex: 0 0 auto;
    width: auto;
  }
  .col-md-1 {
    flex: 0 0 auto;
    width: 8.33333333%;
  }
  .col-md-2 {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-md-3 {
    flex: 0 0 auto;
    width: 25%;
  }
  .col-md-4 {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .col-md-5 {
    flex: 0 0 auto;
    width: 41.66666667%;
  }
  .col-md-6 {
    flex: 0 0 auto;
    width: 50%;
  }
  .col-md-7 {
    flex: 0 0 auto;
    width: 58.33333333%;
  }
  .col-md-8 {
    flex: 0 0 auto;
    width: 66.66666667%;
  }
  .col-md-9 {
    flex: 0 0 auto;
    width: 75%;
  }
  .col-md-10 {
    flex: 0 0 auto;
    width: 83.33333333%;
  }
  .col-md-11 {
    flex: 0 0 auto;
    width: 91.66666667%;
  }
  .col-md-12 {
    flex: 0 0 auto;
    width: 100%;
  }
  .offset-md-0 {
    margin-left: 0;
  }
  .offset-md-1 {
    margin-left: 8.33333333%;
  }
  .offset-md-2 {
    margin-left: 16.66666667%;
  }
  .offset-md-3 {
    margin-left: 25%;
  }
  .offset-md-4 {
    margin-left: 33.33333333%;
  }
  .offset-md-5 {
    margin-left: 41.66666667%;
  }
  .offset-md-6 {
    margin-left: 50%;
  }
  .offset-md-7 {
    margin-left: 58.33333333%;
  }
  .offset-md-8 {
    margin-left: 66.66666667%;
  }
  .offset-md-9 {
    margin-left: 75%;
  }
  .offset-md-10 {
    margin-left: 83.33333333%;
  }
  .offset-md-11 {
    margin-left: 91.66666667%;
  }
  .g-md-0,
  .gx-md-0 {
    --bs-gutter-x: 0;
  }
  .g-md-0,
  .gy-md-0 {
    --bs-gutter-y: 0;
  }
  .g-md-1,
  .gx-md-1 {
    --bs-gutter-x: 0.25rem;
  }
  .g-md-1,
  .gy-md-1 {
    --bs-gutter-y: 0.25rem;
  }
  .g-md-2,
  .gx-md-2 {
    --bs-gutter-x: 0.5rem;
  }
  .g-md-2,
  .gy-md-2 {
    --bs-gutter-y: 0.5rem;
  }
  .g-md-3,
  .gx-md-3 {
    --bs-gutter-x: 1rem;
  }
  .g-md-3,
  .gy-md-3 {
    --bs-gutter-y: 1rem;
  }
  .g-md-4,
  .gx-md-4 {
    --bs-gutter-x: 1.5rem;
  }
  .g-md-4,
  .gy-md-4 {
    --bs-gutter-y: 1.5rem;
  }
  .g-md-5,
  .gx-md-5 {
    --bs-gutter-x: 3rem;
  }
  .g-md-5,
  .gy-md-5 {
    --bs-gutter-y: 3rem;
  }
  .g-md-6,
  .gx-md-6 {
    --bs-gutter-x: 5rem;
  }
  .g-md-6,
  .gy-md-6 {
    --bs-gutter-y: 5rem;
  }
  .g-md-7,
  .gx-md-7 {
    --bs-gutter-x: 8rem;
  }
  .g-md-7,
  .gy-md-7 {
    --bs-gutter-y: 8rem;
  }
  .g-md-8,
  .gx-md-8 {
    --bs-gutter-x: 10rem;
  }
  .g-md-8,
  .gy-md-8 {
    --bs-gutter-y: 10rem;
  }
  .g-md-9,
  .gx-md-9 {
    --bs-gutter-x: 15rem;
  }
  .g-md-9,
  .gy-md-9 {
    --bs-gutter-y: 15rem;
  }
  .g-md-10,
  .gx-md-10 {
    --bs-gutter-x: 20rem;
  }
  .g-md-10,
  .gy-md-10 {
    --bs-gutter-y: 20rem;
  }
}
@media (min-width: 992px) {
  .col-lg {
    flex: 1 0 0%;
  }
  .row-cols-lg-auto > * {
    flex: 0 0 auto;
    width: auto;
  }
  .row-cols-lg-1 > * {
    flex: 0 0 auto;
    width: 100%;
  }
  .row-cols-lg-2 > * {
    flex: 0 0 auto;
    width: 50%;
  }
  .row-cols-lg-3 > * {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .row-cols-lg-4 > * {
    flex: 0 0 auto;
    width: 25%;
  }
  .row-cols-lg-5 > * {
    flex: 0 0 auto;
    width: 20%;
  }
  .row-cols-lg-6 > * {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-lg-auto {
    flex: 0 0 auto;
    width: auto;
  }
  .col-lg-1 {
    flex: 0 0 auto;
    width: 8.33333333%;
  }
  .col-lg-2 {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-lg-3 {
    flex: 0 0 auto;
    width: 25%;
  }
  .col-lg-4 {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .col-lg-5 {
    flex: 0 0 auto;
    width: 41.66666667%;
  }
  .col-lg-6 {
    flex: 0 0 auto;
    width: 50%;
  }
  .col-lg-7 {
    flex: 0 0 auto;
    width: 58.33333333%;
  }
  .col-lg-8 {
    flex: 0 0 auto;
    width: 66.66666667%;
  }
  .col-lg-9 {
    flex: 0 0 auto;
    width: 75%;
  }
  .col-lg-10 {
    flex: 0 0 auto;
    width: 83.33333333%;
  }
  .col-lg-11 {
    flex: 0 0 auto;
    width: 91.66666667%;
  }
  .col-lg-12 {
    flex: 0 0 auto;
    width: 100%;
  }
  .offset-lg-0 {
    margin-left: 0;
  }
  .offset-lg-1 {
    margin-left: 8.33333333%;
  }
  .offset-lg-2 {
    margin-left: 16.66666667%;
  }
  .offset-lg-3 {
    margin-left: 25%;
  }
  .offset-lg-4 {
    margin-left: 33.33333333%;
  }
  .offset-lg-5 {
    margin-left: 41.66666667%;
  }
  .offset-lg-6 {
    margin-left: 50%;
  }
  .offset-lg-7 {
    margin-left: 58.33333333%;
  }
  .offset-lg-8 {
    margin-left: 66.66666667%;
  }
  .offset-lg-9 {
    margin-left: 75%;
  }
  .offset-lg-10 {
    margin-left: 83.33333333%;
  }
  .offset-lg-11 {
    margin-left: 91.66666667%;
  }
  .g-lg-0,
  .gx-lg-0 {
    --bs-gutter-x: 0;
  }
  .g-lg-0,
  .gy-lg-0 {
    --bs-gutter-y: 0;
  }
  .g-lg-1,
  .gx-lg-1 {
    --bs-gutter-x: 0.25rem;
  }
  .g-lg-1,
  .gy-lg-1 {
    --bs-gutter-y: 0.25rem;
  }
  .g-lg-2,
  .gx-lg-2 {
    --bs-gutter-x: 0.5rem;
  }
  .g-lg-2,
  .gy-lg-2 {
    --bs-gutter-y: 0.5rem;
  }
  .g-lg-3,
  .gx-lg-3 {
    --bs-gutter-x: 1rem;
  }
  .g-lg-3,
  .gy-lg-3 {
    --bs-gutter-y: 1rem;
  }
  .g-lg-4,
  .gx-lg-4 {
    --bs-gutter-x: 1.5rem;
  }
  .g-lg-4,
  .gy-lg-4 {
    --bs-gutter-y: 1.5rem;
  }
  .g-lg-5,
  .gx-lg-5 {
    --bs-gutter-x: 3rem;
  }
  .g-lg-5,
  .gy-lg-5 {
    --bs-gutter-y: 3rem;
  }
  .g-lg-6,
  .gx-lg-6 {
    --bs-gutter-x: 5rem;
  }
  .g-lg-6,
  .gy-lg-6 {
    --bs-gutter-y: 5rem;
  }
  .g-lg-7,
  .gx-lg-7 {
    --bs-gutter-x: 8rem;
  }
  .g-lg-7,
  .gy-lg-7 {
    --bs-gutter-y: 8rem;
  }
  .g-lg-8,
  .gx-lg-8 {
    --bs-gutter-x: 10rem;
  }
  .g-lg-8,
  .gy-lg-8 {
    --bs-gutter-y: 10rem;
  }
  .g-lg-9,
  .gx-lg-9 {
    --bs-gutter-x: 15rem;
  }
  .g-lg-9,
  .gy-lg-9 {
    --bs-gutter-y: 15rem;
  }
  .g-lg-10,
  .gx-lg-10 {
    --bs-gutter-x: 20rem;
  }
  .g-lg-10,
  .gy-lg-10 {
    --bs-gutter-y: 20rem;
  }
}
@media (min-width: 1200px) {
  .col-xl {
    flex: 1 0 0%;
  }
  .row-cols-xl-auto > * {
    flex: 0 0 auto;
    width: auto;
  }
  .row-cols-xl-1 > * {
    flex: 0 0 auto;
    width: 100%;
  }
  .row-cols-xl-2 > * {
    flex: 0 0 auto;
    width: 50%;
  }
  .row-cols-xl-3 > * {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .row-cols-xl-4 > * {
    flex: 0 0 auto;
    width: 25%;
  }
  .row-cols-xl-5 > * {
    flex: 0 0 auto;
    width: 20%;
  }
  .row-cols-xl-6 > * {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-xl-auto {
    flex: 0 0 auto;
    width: auto;
  }
  .col-xl-1 {
    flex: 0 0 auto;
    width: 8.33333333%;
  }
  .col-xl-2 {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-xl-3 {
    flex: 0 0 auto;
    width: 25%;
  }
  .col-xl-4 {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .col-xl-5 {
    flex: 0 0 auto;
    width: 41.66666667%;
  }
  .col-xl-6 {
    flex: 0 0 auto;
    width: 50%;
  }
  .col-xl-7 {
    flex: 0 0 auto;
    width: 58.33333333%;
  }
  .col-xl-8 {
    flex: 0 0 auto;
    width: 66.66666667%;
  }
  .col-xl-9 {
    flex: 0 0 auto;
    width: 75%;
  }
  .col-xl-10 {
    flex: 0 0 auto;
    width: 83.33333333%;
  }
  .col-xl-11 {
    flex: 0 0 auto;
    width: 91.66666667%;
  }
  .col-xl-12 {
    flex: 0 0 auto;
    width: 100%;
  }
  .offset-xl-0 {
    margin-left: 0;
  }
  .offset-xl-1 {
    margin-left: 8.33333333%;
  }
  .offset-xl-2 {
    margin-left: 16.66666667%;
  }
  .offset-xl-3 {
    margin-left: 25%;
  }
  .offset-xl-4 {
    margin-left: 33.33333333%;
  }
  .offset-xl-5 {
    margin-left: 41.66666667%;
  }
  .offset-xl-6 {
    margin-left: 50%;
  }
  .offset-xl-7 {
    margin-left: 58.33333333%;
  }
  .offset-xl-8 {
    margin-left: 66.66666667%;
  }
  .offset-xl-9 {
    margin-left: 75%;
  }
  .offset-xl-10 {
    margin-left: 83.33333333%;
  }
  .offset-xl-11 {
    margin-left: 91.66666667%;
  }
  .g-xl-0,
  .gx-xl-0 {
    --bs-gutter-x: 0;
  }
  .g-xl-0,
  .gy-xl-0 {
    --bs-gutter-y: 0;
  }
  .g-xl-1,
  .gx-xl-1 {
    --bs-gutter-x: 0.25rem;
  }
  .g-xl-1,
  .gy-xl-1 {
    --bs-gutter-y: 0.25rem;
  }
  .g-xl-2,
  .gx-xl-2 {
    --bs-gutter-x: 0.5rem;
  }
  .g-xl-2,
  .gy-xl-2 {
    --bs-gutter-y: 0.5rem;
  }
  .g-xl-3,
  .gx-xl-3 {
    --bs-gutter-x: 1rem;
  }
  .g-xl-3,
  .gy-xl-3 {
    --bs-gutter-y: 1rem;
  }
  .g-xl-4,
  .gx-xl-4 {
    --bs-gutter-x: 1.5rem;
  }
  .g-xl-4,
  .gy-xl-4 {
    --bs-gutter-y: 1.5rem;
  }
  .g-xl-5,
  .gx-xl-5 {
    --bs-gutter-x: 3rem;
  }
  .g-xl-5,
  .gy-xl-5 {
    --bs-gutter-y: 3rem;
  }
  .g-xl-6,
  .gx-xl-6 {
    --bs-gutter-x: 5rem;
  }
  .g-xl-6,
  .gy-xl-6 {
    --bs-gutter-y: 5rem;
  }
  .g-xl-7,
  .gx-xl-7 {
    --bs-gutter-x: 8rem;
  }
  .g-xl-7,
  .gy-xl-7 {
    --bs-gutter-y: 8rem;
  }
  .g-xl-8,
  .gx-xl-8 {
    --bs-gutter-x: 10rem;
  }
  .g-xl-8,
  .gy-xl-8 {
    --bs-gutter-y: 10rem;
  }
  .g-xl-9,
  .gx-xl-9 {
    --bs-gutter-x: 15rem;
  }
  .g-xl-9,
  .gy-xl-9 {
    --bs-gutter-y: 15rem;
  }
  .g-xl-10,
  .gx-xl-10 {
    --bs-gutter-x: 20rem;
  }
  .g-xl-10,
  .gy-xl-10 {
    --bs-gutter-y: 20rem;
  }
}
@media (min-width: 1400px) {
  .col-xxl {
    flex: 1 0 0%;
  }
  .row-cols-xxl-auto > * {
    flex: 0 0 auto;
    width: auto;
  }
  .row-cols-xxl-1 > * {
    flex: 0 0 auto;
    width: 100%;
  }
  .row-cols-xxl-2 > * {
    flex: 0 0 auto;
    width: 50%;
  }
  .row-cols-xxl-3 > * {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .row-cols-xxl-4 > * {
    flex: 0 0 auto;
    width: 25%;
  }
  .row-cols-xxl-5 > * {
    flex: 0 0 auto;
    width: 20%;
  }
  .row-cols-xxl-6 > * {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-xxl-auto {
    flex: 0 0 auto;
    width: auto;
  }
  .col-xxl-1 {
    flex: 0 0 auto;
    width: 8.33333333%;
  }
  .col-xxl-2 {
    flex: 0 0 auto;
    width: 16.66666667%;
  }
  .col-xxl-3 {
    flex: 0 0 auto;
    width: 25%;
  }
  .col-xxl-4 {
    flex: 0 0 auto;
    width: 33.33333333%;
  }
  .col-xxl-5 {
    flex: 0 0 auto;
    width: 41.66666667%;
  }
  .col-xxl-6 {
    flex: 0 0 auto;
    width: 50%;
  }
  .col-xxl-7 {
    flex: 0 0 auto;
    width: 58.33333333%;
  }
  .col-xxl-8 {
    flex: 0 0 auto;
    width: 66.66666667%;
  }
  .col-xxl-9 {
    flex: 0 0 auto;
    width: 75%;
  }
  .col-xxl-10 {
    flex: 0 0 auto;
    width: 83.33333333%;
  }
  .col-xxl-11 {
    flex: 0 0 auto;
    width: 91.66666667%;
  }
  .col-xxl-12 {
    flex: 0 0 auto;
    width: 100%;
  }
  .offset-xxl-0 {
    margin-left: 0;
  }
  .offset-xxl-1 {
    margin-left: 8.33333333%;
  }
  .offset-xxl-2 {
    margin-left: 16.66666667%;
  }
  .offset-xxl-3 {
    margin-left: 25%;
  }
  .offset-xxl-4 {
    margin-left: 33.33333333%;
  }
  .offset-xxl-5 {
    margin-left: 41.66666667%;
  }
  .offset-xxl-6 {
    margin-left: 50%;
  }
  .offset-xxl-7 {
    margin-left: 58.33333333%;
  }
  .offset-xxl-8 {
    margin-left: 66.66666667%;
  }
  .offset-xxl-9 {
    margin-left: 75%;
  }
  .offset-xxl-10 {
    margin-left: 83.33333333%;
  }
  .offset-xxl-11 {
    margin-left: 91.66666667%;
  }
  .g-xxl-0,
  .gx-xxl-0 {
    --bs-gutter-x: 0;
  }
  .g-xxl-0,
  .gy-xxl-0 {
    --bs-gutter-y: 0;
  }
  .g-xxl-1,
  .gx-xxl-1 {
    --bs-gutter-x: 0.25rem;
  }
  .g-xxl-1,
  .gy-xxl-1 {
    --bs-gutter-y: 0.25rem;
  }
  .g-xxl-2,
  .gx-xxl-2 {
    --bs-gutter-x: 0.5rem;
  }
  .g-xxl-2,
  .gy-xxl-2 {
    --bs-gutter-y: 0.5rem;
  }
  .g-xxl-3,
  .gx-xxl-3 {
    --bs-gutter-x: 1rem;
  }
  .g-xxl-3,
  .gy-xxl-3 {
    --bs-gutter-y: 1rem;
  }
  .g-xxl-4,
  .gx-xxl-4 {
    --bs-gutter-x: 1.5rem;
  }
  .g-xxl-4,
  .gy-xxl-4 {
    --bs-gutter-y: 1.5rem;
  }
  .g-xxl-5,
  .gx-xxl-5 {
    --bs-gutter-x: 3rem;
  }
  .g-xxl-5,
  .gy-xxl-5 {
    --bs-gutter-y: 3rem;
  }
  .g-xxl-6,
  .gx-xxl-6 {
    --bs-gutter-x: 5rem;
  }
  .g-xxl-6,
  .gy-xxl-6 {
    --bs-gutter-y: 5rem;
  }
  .g-xxl-7,
  .gx-xxl-7 {
    --bs-gutter-x: 8rem;
  }
  .g-xxl-7,
  .gy-xxl-7 {
    --bs-gutter-y: 8rem;
  }
  .g-xxl-8,
  .gx-xxl-8 {
    --bs-gutter-x: 10rem;
  }
  .g-xxl-8,
  .gy-xxl-8 {
    --bs-gutter-y: 10rem;
  }
  .g-xxl-9,
  .gx-xxl-9 {
    --bs-gutter-x: 15rem;
  }
  .g-xxl-9,
  .gy-xxl-9 {
    --bs-gutter-y: 15rem;
  }
  .g-xxl-10,
  .gx-xxl-10 {
    --bs-gutter-x: 20rem;
  }
  .g-xxl-10,
  .gy-xxl-10 {
    --bs-gutter-y: 20rem;
  }
}
.table {
  --bs-table-color-type: initial;
  --bs-table-bg-type: initial;
  --bs-table-color-state: initial;
  --bs-table-bg-state: initial;
  --bs-table-color: var(--bs-emphasis-color);
  --bs-table-bg: var(--bs-body-bg);
  --bs-table-border-color: var(--bs-border-color);
  --bs-table-accent-bg: transparent;
  --bs-table-striped-color: var(--bs-emphasis-color);
  --bs-table-striped-bg: rgba(var(--bs-emphasis-color-rgb), 0.05);
  --bs-table-active-color: var(--bs-emphasis-color);
  --bs-table-active-bg: rgba(var(--bs-emphasis-color-rgb), 0.1);
  --bs-table-hover-color: var(--bs-emphasis-color);
  --bs-table-hover-bg: rgba(var(--bs-emphasis-color-rgb), 0.075);
  width: 100%;
  margin-bottom: 1rem;
  vertical-align: top;
  border-color: var(--bs-table-border-color);
}
.table > :not(caption) > * > * {
  padding: 0.5rem 0.5rem;
  color: var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));
  background-color: var(--bs-table-bg);
  border-bottom-width: var(--bs-border-width);
  box-shadow: inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)));
}
.table > tbody {
  vertical-align: inherit;
}
.table > thead {
  vertical-align: bottom;
}

.table-group-divider {
  border-top: calc(var(--bs-border-width) * 2) solid currentcolor;
}

.caption-top {
  caption-side: top;
}

.table-sm > :not(caption) > * > * {
  padding: 0.25rem 0.25rem;
}

.table-bordered > :not(caption) > * {
  border-width: var(--bs-border-width) 0;
}
.table-bordered > :not(caption) > * > * {
  border-width: 0 var(--bs-border-width);
}

.table-borderless > :not(caption) > * > * {
  border-bottom-width: 0;
}
.table-borderless > :not(:first-child) {
  border-top-width: 0;
}

.table-striped > tbody > tr:nth-of-type(odd) > * {
  --bs-table-color-type: var(--bs-table-striped-color);
  --bs-table-bg-type: var(--bs-table-striped-bg);
}

.table-striped-columns > :not(caption) > tr > :nth-child(even) {
  --bs-table-color-type: var(--bs-table-striped-color);
  --bs-table-bg-type: var(--bs-table-striped-bg);
}

.table-active {
  --bs-table-color-state: var(--bs-table-active-color);
  --bs-table-bg-state: var(--bs-table-active-bg);
}

.table-hover > tbody > tr:hover > * {
  --bs-table-color-state: var(--bs-table-hover-color);
  --bs-table-bg-state: var(--bs-table-hover-bg);
}

.table-primary {
  --bs-table-color: #000;
  --bs-table-bg: #d2f3ea;
  --bs-table-border-color: #a8c2bb;
  --bs-table-striped-bg: #c8e7de;
  --bs-table-striped-color: #000;
  --bs-table-active-bg: #bddbd3;
  --bs-table-active-color: #000;
  --bs-table-hover-bg: #c2e1d8;
  --bs-table-hover-color: #000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-secondary {
  --bs-table-color: #000;
  --bs-table-bg: #e2e3e5;
  --bs-table-border-color: #b5b6b7;
  --bs-table-striped-bg: #d7d8da;
  --bs-table-striped-color: #000;
  --bs-table-active-bg: #cbccce;
  --bs-table-active-color: #000;
  --bs-table-hover-bg: #d1d2d4;
  --bs-table-hover-color: #000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-success {
  --bs-table-color: #000;
  --bs-table-bg: #d1e7dd;
  --bs-table-border-color: #a7b9b1;
  --bs-table-striped-bg: #c7dbd2;
  --bs-table-striped-color: #000;
  --bs-table-active-bg: #bcd0c7;
  --bs-table-active-color: #000;
  --bs-table-hover-bg: #c1d6cc;
  --bs-table-hover-color: #000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-info {
  --bs-table-color: #000;
  --bs-table-bg: #cff4fc;
  --bs-table-border-color: #a6c3ca;
  --bs-table-striped-bg: #c5e8ef;
  --bs-table-striped-color: #000;
  --bs-table-active-bg: #badce3;
  --bs-table-active-color: #000;
  --bs-table-hover-bg: #bfe2e9;
  --bs-table-hover-color: #000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-warning {
  --bs-table-color: #000;
  --bs-table-bg: #fff3cd;
  --bs-table-border-color: #ccc2a4;
  --bs-table-striped-bg: #f2e7c3;
  --bs-table-striped-color: #000;
  --bs-table-active-bg: #e6dbb9;
  --bs-table-active-color: #000;
  --bs-table-hover-bg: #ece1be;
  --bs-table-hover-color: #000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-danger {
  --bs-table-color: #000;
  --bs-table-bg: #f8d7da;
  --bs-table-border-color: #c6acae;
  --bs-table-striped-bg: #eccccf;
  --bs-table-striped-color: #000;
  --bs-table-active-bg: #dfc2c4;
  --bs-table-active-color: #000;
  --bs-table-hover-bg: #e5c7ca;
  --bs-table-hover-color: #000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-light {
  --bs-table-color: #000;
  --bs-table-bg: #f8f9fa;
  --bs-table-border-color: #c6c7c8;
  --bs-table-striped-bg: #ecedee;
  --bs-table-striped-color: #000;
  --bs-table-active-bg: #dfe0e1;
  --bs-table-active-color: #000;
  --bs-table-hover-bg: #e5e6e7;
  --bs-table-hover-color: #000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-dark {
  --bs-table-color: #fff;
  --bs-table-bg: #212529;
  --bs-table-border-color: #4d5154;
  --bs-table-striped-bg: #2c3034;
  --bs-table-striped-color: #fff;
  --bs-table-active-bg: #373b3e;
  --bs-table-active-color: #fff;
  --bs-table-hover-bg: #323539;
  --bs-table-hover-color: #fff;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}

.table-responsive {
  overflow-x: auto;
  -webkit-overflow-scrolling: touch;
}

@media (max-width: 575.98px) {
  .table-responsive-sm {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 767.98px) {
  .table-responsive-md {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 991.98px) {
  .table-responsive-lg {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 1199.98px) {
  .table-responsive-xl {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 1399.98px) {
  .table-responsive-xxl {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
.form-label {
  margin-bottom: 0.5rem;
}

.col-form-label {
  padding-top: calc(0.375rem + var(--bs-border-width));
  padding-bottom: calc(0.375rem + var(--bs-border-width));
  margin-bottom: 0;
  font-size: inherit;
  line-height: 1.5;
}

.col-form-label-lg {
  padding-top: calc(0.5rem + var(--bs-border-width));
  padding-bottom: calc(0.5rem + var(--bs-border-width));
  font-size: 1.25rem;
}

.col-form-label-sm {
  padding-top: calc(0.25rem + var(--bs-border-width));
  padding-bottom: calc(0.25rem + var(--bs-border-width));
  font-size: 0.875rem;
}

.form-text {
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: var(--bs-secondary-color);
}

.form-control {
  display: block;
  width: 100%;
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: var(--bs-body-color);
  appearance: none;
  background-color: var(--bs-body-bg);
  background-clip: padding-box;
  border: var(--bs-border-width) solid var(--bs-border-color);
  border-radius: var(--bs-border-radius);
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-control {
    transition: none;
  }
}
.form-control[type=file] {
  overflow: hidden;
}
.form-control[type=file]:not(:disabled):not([readonly]) {
  cursor: pointer;
}
.form-control:focus {
  color: var(--bs-body-color);
  background-color: var(--bs-body-bg);
  border-color: #8ee0cb;
  outline: 0;
  box-shadow: 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
}
.form-control::-webkit-date-and-time-value {
  min-width: 85px;
  height: 1.5em;
  margin: 0;
}
.form-control::-webkit-datetime-edit {
  display: block;
  padding: 0;
}
.form-control::placeholder {
  color: var(--bs-secondary-color);
  opacity: 1;
}
.form-control:disabled {
  background-color: var(--bs-secondary-bg);
  opacity: 1;
}
.form-control::file-selector-button {
  padding: 0.375rem 0.75rem;
  margin: -0.375rem -0.75rem;
  margin-inline-end: 0.75rem;
  color: var(--bs-body-color);
  background-color: var(--bs-tertiary-bg);
  pointer-events: none;
  border-color: inherit;
  border-style: solid;
  border-width: 0;
  border-inline-end-width: var(--bs-border-width);
  border-radius: 0;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-control::file-selector-button {
    transition: none;
  }
}
.form-control:hover:not(:disabled):not([readonly])::file-selector-button {
  background-color: var(--bs-secondary-bg);
}

.form-control-plaintext {
  display: block;
  width: 100%;
  padding: 0.375rem 0;
  margin-bottom: 0;
  line-height: 1.5;
  color: var(--bs-body-color);
  background-color: transparent;
  border: solid transparent;
  border-width: var(--bs-border-width) 0;
}
.form-control-plaintext:focus {
  outline: 0;
}
.form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg {
  padding-right: 0;
  padding-left: 0;
}

.form-control-sm {
  min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  border-radius: var(--bs-border-radius-sm);
}
.form-control-sm::file-selector-button {
  padding: 0.25rem 0.5rem;
  margin: -0.25rem -0.5rem;
  margin-inline-end: 0.5rem;
}

.form-control-lg {
  min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  border-radius: var(--bs-border-radius-lg);
}
.form-control-lg::file-selector-button {
  padding: 0.5rem 1rem;
  margin: -0.5rem -1rem;
  margin-inline-end: 1rem;
}

textarea.form-control {
  min-height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2));
}
textarea.form-control-sm {
  min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
}
textarea.form-control-lg {
  min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
}

.form-control-color {
  width: 3rem;
  height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2));
  padding: 0.375rem;
}
.form-control-color:not(:disabled):not([readonly]) {
  cursor: pointer;
}
.form-control-color::-moz-color-swatch {
  border: 0 !important;
  border-radius: var(--bs-border-radius);
}
.form-control-color::-webkit-color-swatch {
  border: 0 !important;
  border-radius: var(--bs-border-radius);
}
.form-control-color.form-control-sm {
  height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
}
.form-control-color.form-control-lg {
  height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
}

.form-select {
  --bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27%3e%3cpath fill=%27none%27 stroke=%27%23343a40%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%272%27 d=%27m2 5 6 6 6-6%27/%3e%3c/svg%3e");
  display: block;
  width: 100%;
  padding: 0.375rem 2.25rem 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: var(--bs-body-color);
  appearance: none;
  background-color: var(--bs-body-bg);
  background-image: var(--bs-form-select-bg-img), var(--bs-form-select-bg-icon, none);
  background-repeat: no-repeat;
  background-position: right 0.75rem center;
  background-size: 16px 12px;
  border: var(--bs-border-width) solid var(--bs-border-color);
  border-radius: var(--bs-border-radius);
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-select {
    transition: none;
  }
}
.form-select:focus {
  border-color: #8ee0cb;
  outline: 0;
  box-shadow: 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
}
.form-select[multiple], .form-select[size]:not([size="1"]) {
  padding-right: 0.75rem;
  background-image: none;
}
.form-select:disabled {
  background-color: var(--bs-secondary-bg);
}
.form-select:-moz-focusring {
  color: transparent;
  text-shadow: 0 0 0 var(--bs-body-color);
}

.form-select-sm {
  padding-top: 0.25rem;
  padding-bottom: 0.25rem;
  padding-left: 0.5rem;
  font-size: 0.875rem;
  border-radius: var(--bs-border-radius-sm);
}

.form-select-lg {
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
  padding-left: 1rem;
  font-size: 1.25rem;
  border-radius: var(--bs-border-radius-lg);
}

[data-bs-theme=dark] .form-select {
  --bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27%3e%3cpath fill=%27none%27 stroke=%27%23dee2e6%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%272%27 d=%27m2 5 6 6 6-6%27/%3e%3c/svg%3e");
}

.form-check {
  display: block;
  min-height: 1.5rem;
  padding-left: 1.5em;
  margin-bottom: 0.125rem;
}
.form-check .form-check-input {
  float: left;
  margin-left: -1.5em;
}

.form-check-reverse {
  padding-right: 1.5em;
  padding-left: 0;
  text-align: right;
}
.form-check-reverse .form-check-input {
  float: right;
  margin-right: -1.5em;
  margin-left: 0;
}

.form-check-input {
  --bs-form-check-bg: var(--bs-body-bg);
  flex-shrink: 0;
  width: 1em;
  height: 1em;
  margin-top: 0.25em;
  vertical-align: top;
  appearance: none;
  background-color: var(--bs-form-check-bg);
  background-image: var(--bs-form-check-bg-image);
  background-repeat: no-repeat;
  background-position: center;
  background-size: contain;
  border: var(--bs-border-width) solid var(--bs-border-color);
  print-color-adjust: exact;
}
.form-check-input[type=checkbox] {
  border-radius: 0.25em;
}
.form-check-input[type=radio] {
  border-radius: 50%;
}
.form-check-input:active {
  filter: brightness(90%);
}
.form-check-input:focus {
  border-color: #8ee0cb;
  outline: 0;
  box-shadow: 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
}
.form-check-input:checked {
  background-color: #1CC197;
  border-color: #1CC197;
}
.form-check-input:checked[type=checkbox] {
  --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 20 20%27%3e%3cpath fill=%27none%27 stroke=%27%23fff%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%273%27 d=%27m6 10 3 3 6-6%27/%3e%3c/svg%3e");
}
.form-check-input:checked[type=radio] {
  --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%272%27 fill=%27%23fff%27/%3e%3c/svg%3e");
}
.form-check-input[type=checkbox]:indeterminate {
  background-color: #1CC197;
  border-color: #1CC197;
  --bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 20 20%27%3e%3cpath fill=%27none%27 stroke=%27%23fff%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27 stroke-width=%273%27 d=%27M6 10h8%27/%3e%3c/svg%3e");
}
.form-check-input:disabled {
  pointer-events: none;
  filter: none;
  opacity: 0.5;
}
.form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label {
  cursor: default;
  opacity: 0.5;
}

.form-switch {
  padding-left: 2.5em;
}
.form-switch .form-check-input {
  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27rgba%280, 0, 0, 0.25%29%27/%3e%3c/svg%3e");
  width: 2em;
  margin-left: -2.5em;
  background-image: var(--bs-form-switch-bg);
  background-position: left center;
  border-radius: 2em;
  transition: background-position 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-switch .form-check-input {
    transition: none;
  }
}
.form-switch .form-check-input:focus {
  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27%238ee0cb%27/%3e%3c/svg%3e");
}
.form-switch .form-check-input:checked {
  background-position: right center;
  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27%23fff%27/%3e%3c/svg%3e");
}
.form-switch.form-check-reverse {
  padding-right: 2.5em;
  padding-left: 0;
}
.form-switch.form-check-reverse .form-check-input {
  margin-right: -2.5em;
  margin-left: 0;
}

.form-check-inline {
  display: inline-block;
  margin-right: 1rem;
}

.btn-check {
  position: absolute;
  clip: rect(0, 0, 0, 0);
  pointer-events: none;
}
.btn-check[disabled] + .btn, .btn-check:disabled + .btn {
  pointer-events: none;
  filter: none;
  opacity: 0.65;
}

[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus) {
  --bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%27-4 -4 8 8%27%3e%3ccircle r=%273%27 fill=%27rgba%28255, 255, 255, 0.25%29%27/%3e%3c/svg%3e");
}

.form-range {
  width: 100%;
  height: 1.5rem;
  padding: 0;
  appearance: none;
  background-color: transparent;
}
.form-range:focus {
  outline: 0;
}
.form-range:focus::-webkit-slider-thumb {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
}
.form-range:focus::-moz-range-thumb {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
}
.form-range::-moz-focus-outer {
  border: 0;
}
.form-range::-webkit-slider-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: -0.25rem;
  appearance: none;
  background-color: #1CC197;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-range::-webkit-slider-thumb {
    transition: none;
  }
}
.form-range::-webkit-slider-thumb:active {
  background-color: #bbece0;
}
.form-range::-webkit-slider-runnable-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: var(--bs-secondary-bg);
  border-color: transparent;
  border-radius: 1rem;
}
.form-range::-moz-range-thumb {
  width: 1rem;
  height: 1rem;
  appearance: none;
  background-color: #1CC197;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-range::-moz-range-thumb {
    transition: none;
  }
}
.form-range::-moz-range-thumb:active {
  background-color: #bbece0;
}
.form-range::-moz-range-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: var(--bs-secondary-bg);
  border-color: transparent;
  border-radius: 1rem;
}
.form-range:disabled {
  pointer-events: none;
}
.form-range:disabled::-webkit-slider-thumb {
  background-color: var(--bs-secondary-color);
}
.form-range:disabled::-moz-range-thumb {
  background-color: var(--bs-secondary-color);
}

.form-floating {
  position: relative;
}
.form-floating > .form-control,
.form-floating > .form-control-plaintext,
.form-floating > .form-select {
  height: calc(3.5rem + calc(var(--bs-border-width) * 2));
  min-height: calc(3.5rem + calc(var(--bs-border-width) * 2));
  line-height: 1.25;
}
.form-floating > label {
  position: absolute;
  top: 0;
  left: 0;
  z-index: 2;
  height: 100%;
  padding: 1rem 0.75rem;
  overflow: hidden;
  text-align: start;
  text-overflow: ellipsis;
  white-space: nowrap;
  pointer-events: none;
  border: var(--bs-border-width) solid transparent;
  transform-origin: 0 0;
  transition: opacity 0.1s ease-in-out, transform 0.1s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-floating > label {
    transition: none;
  }
}
.form-floating > .form-control,
.form-floating > .form-control-plaintext {
  padding: 1rem 0.75rem;
}
.form-floating > .form-control::placeholder,
.form-floating > .form-control-plaintext::placeholder {
  color: transparent;
}
.form-floating > .form-control:focus, .form-floating > .form-control:not(:placeholder-shown),
.form-floating > .form-control-plaintext:focus,
.form-floating > .form-control-plaintext:not(:placeholder-shown) {
  padding-top: 1.625rem;
  padding-bottom: 0.625rem;
}
.form-floating > .form-control:-webkit-autofill,
.form-floating > .form-control-plaintext:-webkit-autofill {
  padding-top: 1.625rem;
  padding-bottom: 0.625rem;
}
.form-floating > .form-select {
  padding-top: 1.625rem;
  padding-bottom: 0.625rem;
}
.form-floating > .form-control:focus ~ label,
.form-floating > .form-control:not(:placeholder-shown) ~ label,
.form-floating > .form-control-plaintext ~ label,
.form-floating > .form-select ~ label {
  color: rgba(var(--bs-body-color-rgb), 0.65);
  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
}
.form-floating > .form-control:focus ~ label::after,
.form-floating > .form-control:not(:placeholder-shown) ~ label::after,
.form-floating > .form-control-plaintext ~ label::after,
.form-floating > .form-select ~ label::after {
  position: absolute;
  inset: 1rem 0.375rem;
  z-index: -1;
  height: 1.5em;
  content: "";
  background-color: var(--bs-body-bg);
  border-radius: var(--bs-border-radius);
}
.form-floating > .form-control:-webkit-autofill ~ label {
  color: rgba(var(--bs-body-color-rgb), 0.65);
  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
}
.form-floating > .form-control-plaintext ~ label {
  border-width: var(--bs-border-width) 0;
}
.form-floating > :disabled ~ label,
.form-floating > .form-control:disabled ~ label {
  color: #6c757d;
}
.form-floating > :disabled ~ label::after,
.form-floating > .form-control:disabled ~ label::after {
  background-color: var(--bs-secondary-bg);
}

.input-group {
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: stretch;
  width: 100%;
}
.input-group > .form-control,
.input-group > .form-select,
.input-group > .form-floating {
  position: relative;
  flex: 1 1 auto;
  width: 1%;
  min-width: 0;
}
.input-group > .form-control:focus,
.input-group > .form-select:focus,
.input-group > .form-floating:focus-within {
  z-index: 5;
}
.input-group .btn {
  position: relative;
  z-index: 2;
}
.input-group .btn:focus {
  z-index: 5;
}

.input-group-text {
  display: flex;
  align-items: center;
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: var(--bs-body-color);
  text-align: center;
  white-space: nowrap;
  background-color: var(--bs-tertiary-bg);
  border: var(--bs-border-width) solid var(--bs-border-color);
  border-radius: var(--bs-border-radius);
}

.input-group-lg > .form-control,
.input-group-lg > .form-select,
.input-group-lg > .input-group-text,
.input-group-lg > .btn {
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  border-radius: var(--bs-border-radius-lg);
}

.input-group-sm > .form-control,
.input-group-sm > .form-select,
.input-group-sm > .input-group-text,
.input-group-sm > .btn {
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  border-radius: var(--bs-border-radius-sm);
}

.input-group-lg > .form-select,
.input-group-sm > .form-select {
  padding-right: 3rem;
}

.input-group:not(.has-validation) > :not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),
.input-group:not(.has-validation) > .dropdown-toggle:nth-last-child(n+3),
.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-control,
.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-select {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group.has-validation > :nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),
.input-group.has-validation > .dropdown-toggle:nth-last-child(n+4),
.input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-control,
.input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-select {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group > :not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) {
  margin-left: calc(var(--bs-border-width) * -1);
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.input-group > .form-floating:not(:first-child) > .form-control,
.input-group > .form-floating:not(:first-child) > .form-select {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}

.valid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: var(--bs-form-valid-color);
}

.valid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  color: #fff;
  background-color: var(--bs-success);
  border-radius: var(--bs-border-radius);
}

.was-validated :valid ~ .valid-feedback,
.was-validated :valid ~ .valid-tooltip,
.is-valid ~ .valid-feedback,
.is-valid ~ .valid-tooltip {
  display: block;
}

.was-validated .form-control:valid, .form-control.is-valid {
  border-color: var(--bs-form-valid-border-color);
  padding-right: calc(1.5em + 0.75rem);
  background-image: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 8 8%27%3e%3cpath fill=%27%23198754%27 d=%27M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z%27/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(0.375em + 0.1875rem) center;
  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
}
.was-validated .form-control:valid:focus, .form-control.is-valid:focus {
  border-color: var(--bs-form-valid-border-color);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
}

.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
  padding-right: calc(1.5em + 0.75rem);
  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
}

.was-validated .form-select:valid, .form-select.is-valid {
  border-color: var(--bs-form-valid-border-color);
}
.was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"], .form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"] {
  --bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 8 8%27%3e%3cpath fill=%27%23198754%27 d=%27M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z%27/%3e%3c/svg%3e");
  padding-right: 4.125rem;
  background-position: right 0.75rem center, center right 2.25rem;
  background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
}
.was-validated .form-select:valid:focus, .form-select.is-valid:focus {
  border-color: var(--bs-form-valid-border-color);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
}

.was-validated .form-control-color:valid, .form-control-color.is-valid {
  width: calc(3rem + calc(1.5em + 0.75rem));
}

.was-validated .form-check-input:valid, .form-check-input.is-valid {
  border-color: var(--bs-form-valid-border-color);
}
.was-validated .form-check-input:valid:checked, .form-check-input.is-valid:checked {
  background-color: var(--bs-form-valid-color);
}
.was-validated .form-check-input:valid:focus, .form-check-input.is-valid:focus {
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
}
.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
  color: var(--bs-form-valid-color);
}

.form-check-inline .form-check-input ~ .valid-feedback {
  margin-left: 0.5em;
}

.was-validated .input-group > .form-control:not(:focus):valid, .input-group > .form-control:not(:focus).is-valid,
.was-validated .input-group > .form-select:not(:focus):valid,
.input-group > .form-select:not(:focus).is-valid,
.was-validated .input-group > .form-floating:not(:focus-within):valid,
.input-group > .form-floating:not(:focus-within).is-valid {
  z-index: 3;
}

.invalid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: var(--bs-form-invalid-color);
}

.invalid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  color: #fff;
  background-color: var(--bs-danger);
  border-radius: var(--bs-border-radius);
}

.was-validated :invalid ~ .invalid-feedback,
.was-validated :invalid ~ .invalid-tooltip,
.is-invalid ~ .invalid-feedback,
.is-invalid ~ .invalid-tooltip {
  display: block;
}

.was-validated .form-control:invalid, .form-control.is-invalid {
  border-color: var(--bs-form-invalid-border-color);
  padding-right: calc(1.5em + 0.75rem);
  background-image: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 12 12%27 width=%2712%27 height=%2712%27 fill=%27none%27 stroke=%27%23dc3545%27%3e%3ccircle cx=%276%27 cy=%276%27 r=%274.5%27/%3e%3cpath stroke-linejoin=%27round%27 d=%27M5.8 3.6h.4L6 6.5z%27/%3e%3ccircle cx=%276%27 cy=%278.2%27 r=%27.6%27 fill=%27%23dc3545%27 stroke=%27none%27/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(0.375em + 0.1875rem) center;
  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
}
.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus {
  border-color: var(--bs-form-invalid-border-color);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
}

.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
  padding-right: calc(1.5em + 0.75rem);
  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
}

.was-validated .form-select:invalid, .form-select.is-invalid {
  border-color: var(--bs-form-invalid-border-color);
}
.was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"], .form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"] {
  --bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 12 12%27 width=%2712%27 height=%2712%27 fill=%27none%27 stroke=%27%23dc3545%27%3e%3ccircle cx=%276%27 cy=%276%27 r=%274.5%27/%3e%3cpath stroke-linejoin=%27round%27 d=%27M5.8 3.6h.4L6 6.5z%27/%3e%3ccircle cx=%276%27 cy=%278.2%27 r=%27.6%27 fill=%27%23dc3545%27 stroke=%27none%27/%3e%3c/svg%3e");
  padding-right: 4.125rem;
  background-position: right 0.75rem center, center right 2.25rem;
  background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
}
.was-validated .form-select:invalid:focus, .form-select.is-invalid:focus {
  border-color: var(--bs-form-invalid-border-color);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
}

.was-validated .form-control-color:invalid, .form-control-color.is-invalid {
  width: calc(3rem + calc(1.5em + 0.75rem));
}

.was-validated .form-check-input:invalid, .form-check-input.is-invalid {
  border-color: var(--bs-form-invalid-border-color);
}
.was-validated .form-check-input:invalid:checked, .form-check-input.is-invalid:checked {
  background-color: var(--bs-form-invalid-color);
}
.was-validated .form-check-input:invalid:focus, .form-check-input.is-invalid:focus {
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
}
.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
  color: var(--bs-form-invalid-color);
}

.form-check-inline .form-check-input ~ .invalid-feedback {
  margin-left: 0.5em;
}

.was-validated .input-group > .form-control:not(:focus):invalid, .input-group > .form-control:not(:focus).is-invalid,
.was-validated .input-group > .form-select:not(:focus):invalid,
.input-group > .form-select:not(:focus).is-invalid,
.was-validated .input-group > .form-floating:not(:focus-within):invalid,
.input-group > .form-floating:not(:focus-within).is-invalid {
  z-index: 4;
}

.btn {
  --bs-btn-padding-x: 0.75rem;
  --bs-btn-padding-y: 0.375rem;
  --bs-btn-font-family: ;
  --bs-btn-font-size: 1rem;
  --bs-btn-font-weight: 400;
  --bs-btn-line-height: 1.5;
  --bs-btn-color: var(--bs-body-color);
  --bs-btn-bg: transparent;
  --bs-btn-border-width: var(--bs-border-width);
  --bs-btn-border-color: transparent;
  --bs-btn-border-radius: var(--bs-border-radius);
  --bs-btn-hover-border-color: transparent;
  --bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075);
  --bs-btn-disabled-opacity: 0.65;
  --bs-btn-focus-box-shadow: 0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);
  display: inline-block;
  padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x);
  font-family: var(--bs-btn-font-family);
  font-size: var(--bs-btn-font-size);
  font-weight: var(--bs-btn-font-weight);
  line-height: var(--bs-btn-line-height);
  color: var(--bs-btn-color);
  text-align: center;
  text-decoration: none;
  vertical-align: middle;
  cursor: pointer;
  user-select: none;
  border: var(--bs-btn-border-width) solid var(--bs-btn-border-color);
  border-radius: var(--bs-btn-border-radius);
  background-color: var(--bs-btn-bg);
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .btn {
    transition: none;
  }
}
.btn:hover {
  color: var(--bs-btn-hover-color);
  background-color: var(--bs-btn-hover-bg);
  border-color: var(--bs-btn-hover-border-color);
}
.btn-check + .btn:hover {
  color: var(--bs-btn-color);
  background-color: var(--bs-btn-bg);
  border-color: var(--bs-btn-border-color);
}
.btn:focus-visible {
  color: var(--bs-btn-hover-color);
  background-color: var(--bs-btn-hover-bg);
  border-color: var(--bs-btn-hover-border-color);
  outline: 0;
  box-shadow: var(--bs-btn-focus-box-shadow);
}
.btn-check:focus-visible + .btn {
  border-color: var(--bs-btn-hover-border-color);
  outline: 0;
  box-shadow: var(--bs-btn-focus-box-shadow);
}
.btn-check:checked + .btn, :not(.btn-check) + .btn:active, .btn:first-child:active, .btn.active, .btn.show {
  color: var(--bs-btn-active-color);
  background-color: var(--bs-btn-active-bg);
  border-color: var(--bs-btn-active-border-color);
}
.btn-check:checked + .btn:focus-visible, :not(.btn-check) + .btn:active:focus-visible, .btn:first-child:active:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible {
  box-shadow: var(--bs-btn-focus-box-shadow);
}
.btn-check:checked:focus-visible + .btn {
  box-shadow: var(--bs-btn-focus-box-shadow);
}
.btn:disabled, .btn.disabled, fieldset:disabled .btn {
  color: var(--bs-btn-disabled-color);
  pointer-events: none;
  background-color: var(--bs-btn-disabled-bg);
  border-color: var(--bs-btn-disabled-border-color);
  opacity: var(--bs-btn-disabled-opacity);
}

.btn-primary {
  --bs-btn-color: #000;
  --bs-btn-bg: #1CC197;
  --bs-btn-border-color: #1CC197;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #3ecaa7;
  --bs-btn-hover-border-color: #33c7a1;
  --bs-btn-focus-shadow-rgb: 24, 164, 128;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #49cdac;
  --bs-btn-active-border-color: #33c7a1;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #000;
  --bs-btn-disabled-bg: #1CC197;
  --bs-btn-disabled-border-color: #1CC197;
}

.btn-gray-100 {
  --bs-btn-color: #000;
  --bs-btn-bg: #f8f9fa;
  --bs-btn-border-color: #f8f9fa;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #f9fafb;
  --bs-btn-hover-border-color: #f9fafb;
  --bs-btn-focus-shadow-rgb: 211, 212, 213;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #f9fafb;
  --bs-btn-active-border-color: #f9fafb;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #000;
  --bs-btn-disabled-bg: #f8f9fa;
  --bs-btn-disabled-border-color: #f8f9fa;
}

.btn-gray-200 {
  --bs-btn-color: #000;
  --bs-btn-bg: #e9ecef;
  --bs-btn-border-color: #e9ecef;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #eceff1;
  --bs-btn-hover-border-color: #ebeef1;
  --bs-btn-focus-shadow-rgb: 198, 201, 203;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #edf0f2;
  --bs-btn-active-border-color: #ebeef1;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #000;
  --bs-btn-disabled-bg: #e9ecef;
  --bs-btn-disabled-border-color: #e9ecef;
}

.btn-gray-300 {
  --bs-btn-color: #000;
  --bs-btn-bg: #dee2e6;
  --bs-btn-border-color: #dee2e6;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #e3e6ea;
  --bs-btn-hover-border-color: #e1e5e9;
  --bs-btn-focus-shadow-rgb: 189, 192, 196;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #e5e8eb;
  --bs-btn-active-border-color: #e1e5e9;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #000;
  --bs-btn-disabled-bg: #dee2e6;
  --bs-btn-disabled-border-color: #dee2e6;
}

.btn-gray-400 {
  --bs-btn-color: #000;
  --bs-btn-bg: #ced4da;
  --bs-btn-border-color: #ced4da;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #d5dae0;
  --bs-btn-hover-border-color: #d3d8de;
  --bs-btn-focus-shadow-rgb: 175, 180, 185;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #d8dde1;
  --bs-btn-active-border-color: #d3d8de;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #000;
  --bs-btn-disabled-bg: #ced4da;
  --bs-btn-disabled-border-color: #ced4da;
}

.btn-gray-500 {
  --bs-btn-color: #000;
  --bs-btn-bg: #adb5bd;
  --bs-btn-border-color: #adb5bd;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #b9c0c7;
  --bs-btn-hover-border-color: #b5bcc4;
  --bs-btn-focus-shadow-rgb: 147, 154, 161;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #bdc4ca;
  --bs-btn-active-border-color: #b5bcc4;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #000;
  --bs-btn-disabled-bg: #adb5bd;
  --bs-btn-disabled-border-color: #adb5bd;
}

.btn-gray-600 {
  --bs-btn-color: #fff;
  --bs-btn-bg: #6c757d;
  --bs-btn-border-color: #6c757d;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #5c636a;
  --bs-btn-hover-border-color: #565e64;
  --bs-btn-focus-shadow-rgb: 130, 138, 145;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #565e64;
  --bs-btn-active-border-color: #51585e;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #fff;
  --bs-btn-disabled-bg: #6c757d;
  --bs-btn-disabled-border-color: #6c757d;
}

.btn-gray-700 {
  --bs-btn-color: #fff;
  --bs-btn-bg: #495057;
  --bs-btn-border-color: #495057;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #3e444a;
  --bs-btn-hover-border-color: #3a4046;
  --bs-btn-focus-shadow-rgb: 100, 106, 112;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #3a4046;
  --bs-btn-active-border-color: #373c41;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #fff;
  --bs-btn-disabled-bg: #495057;
  --bs-btn-disabled-border-color: #495057;
}

.btn-gray-800 {
  --bs-btn-color: #fff;
  --bs-btn-bg: #343a40;
  --bs-btn-border-color: #343a40;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #2c3136;
  --bs-btn-hover-border-color: #2a2e33;
  --bs-btn-focus-shadow-rgb: 82, 88, 93;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #2a2e33;
  --bs-btn-active-border-color: #272c30;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #fff;
  --bs-btn-disabled-bg: #343a40;
  --bs-btn-disabled-border-color: #343a40;
}

.btn-gray-900 {
  --bs-btn-color: #fff;
  --bs-btn-bg: #212529;
  --bs-btn-border-color: #212529;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #1c1f23;
  --bs-btn-hover-border-color: #1a1e21;
  --bs-btn-focus-shadow-rgb: 66, 70, 73;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #1a1e21;
  --bs-btn-active-border-color: #191c1f;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #fff;
  --bs-btn-disabled-bg: #212529;
  --bs-btn-disabled-border-color: #212529;
}

.btn-outline-primary {
  --bs-btn-color: #1CC197;
  --bs-btn-border-color: #1CC197;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #1CC197;
  --bs-btn-hover-border-color: #1CC197;
  --bs-btn-focus-shadow-rgb: 28, 193, 151;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #1CC197;
  --bs-btn-active-border-color: #1CC197;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #1CC197;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #1CC197;
  --bs-gradient: none;
}

.btn-outline-gray-100 {
  --bs-btn-color: #f8f9fa;
  --bs-btn-border-color: #f8f9fa;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #f8f9fa;
  --bs-btn-hover-border-color: #f8f9fa;
  --bs-btn-focus-shadow-rgb: 248, 249, 250;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #f8f9fa;
  --bs-btn-active-border-color: #f8f9fa;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #f8f9fa;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #f8f9fa;
  --bs-gradient: none;
}

.btn-outline-gray-200 {
  --bs-btn-color: #e9ecef;
  --bs-btn-border-color: #e9ecef;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #e9ecef;
  --bs-btn-hover-border-color: #e9ecef;
  --bs-btn-focus-shadow-rgb: 233, 236, 239;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #e9ecef;
  --bs-btn-active-border-color: #e9ecef;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #e9ecef;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #e9ecef;
  --bs-gradient: none;
}

.btn-outline-gray-300 {
  --bs-btn-color: #dee2e6;
  --bs-btn-border-color: #dee2e6;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #dee2e6;
  --bs-btn-hover-border-color: #dee2e6;
  --bs-btn-focus-shadow-rgb: 222, 226, 230;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #dee2e6;
  --bs-btn-active-border-color: #dee2e6;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #dee2e6;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #dee2e6;
  --bs-gradient: none;
}

.btn-outline-gray-400 {
  --bs-btn-color: #ced4da;
  --bs-btn-border-color: #ced4da;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #ced4da;
  --bs-btn-hover-border-color: #ced4da;
  --bs-btn-focus-shadow-rgb: 206, 212, 218;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #ced4da;
  --bs-btn-active-border-color: #ced4da;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #ced4da;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #ced4da;
  --bs-gradient: none;
}

.btn-outline-gray-500 {
  --bs-btn-color: #adb5bd;
  --bs-btn-border-color: #adb5bd;
  --bs-btn-hover-color: #000;
  --bs-btn-hover-bg: #adb5bd;
  --bs-btn-hover-border-color: #adb5bd;
  --bs-btn-focus-shadow-rgb: 173, 181, 189;
  --bs-btn-active-color: #000;
  --bs-btn-active-bg: #adb5bd;
  --bs-btn-active-border-color: #adb5bd;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #adb5bd;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #adb5bd;
  --bs-gradient: none;
}

.btn-outline-gray-600 {
  --bs-btn-color: #6c757d;
  --bs-btn-border-color: #6c757d;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #6c757d;
  --bs-btn-hover-border-color: #6c757d;
  --bs-btn-focus-shadow-rgb: 108, 117, 125;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #6c757d;
  --bs-btn-active-border-color: #6c757d;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #6c757d;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #6c757d;
  --bs-gradient: none;
}

.btn-outline-gray-700 {
  --bs-btn-color: #495057;
  --bs-btn-border-color: #495057;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #495057;
  --bs-btn-hover-border-color: #495057;
  --bs-btn-focus-shadow-rgb: 73, 80, 87;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #495057;
  --bs-btn-active-border-color: #495057;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #495057;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #495057;
  --bs-gradient: none;
}

.btn-outline-gray-800 {
  --bs-btn-color: #343a40;
  --bs-btn-border-color: #343a40;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #343a40;
  --bs-btn-hover-border-color: #343a40;
  --bs-btn-focus-shadow-rgb: 52, 58, 64;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #343a40;
  --bs-btn-active-border-color: #343a40;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #343a40;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #343a40;
  --bs-gradient: none;
}

.btn-outline-gray-900 {
  --bs-btn-color: #212529;
  --bs-btn-border-color: #212529;
  --bs-btn-hover-color: #fff;
  --bs-btn-hover-bg: #212529;
  --bs-btn-hover-border-color: #212529;
  --bs-btn-focus-shadow-rgb: 33, 37, 41;
  --bs-btn-active-color: #fff;
  --bs-btn-active-bg: #212529;
  --bs-btn-active-border-color: #212529;
  --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color: #212529;
  --bs-btn-disabled-bg: transparent;
  --bs-btn-disabled-border-color: #212529;
  --bs-gradient: none;
}

.btn-link {
  --bs-btn-font-weight: 400;
  --bs-btn-color: var(--bs-link-color);
  --bs-btn-bg: transparent;
  --bs-btn-border-color: transparent;
  --bs-btn-hover-color: var(--bs-link-hover-color);
  --bs-btn-hover-border-color: transparent;
  --bs-btn-active-color: var(--bs-link-hover-color);
  --bs-btn-active-border-color: transparent;
  --bs-btn-disabled-color: #6c757d;
  --bs-btn-disabled-border-color: transparent;
  --bs-btn-box-shadow: 0 0 0 #000;
  --bs-btn-focus-shadow-rgb: 24, 164, 128;
  text-decoration: underline;
}
.btn-link:focus-visible {
  color: var(--bs-btn-color);
}
.btn-link:hover {
  color: var(--bs-btn-hover-color);
}

.btn-lg, .btn-group-lg > .btn {
  --bs-btn-padding-y: 0.5rem;
  --bs-btn-padding-x: 1rem;
  --bs-btn-font-size: 1.25rem;
  --bs-btn-border-radius: var(--bs-border-radius-lg);
}

.btn-sm, .btn-group-sm > .btn {
  --bs-btn-padding-y: 0.25rem;
  --bs-btn-padding-x: 0.5rem;
  --bs-btn-font-size: 0.875rem;
  --bs-btn-border-radius: var(--bs-border-radius-sm);
}

.fade {
  transition: opacity 0.15s linear;
}
@media (prefers-reduced-motion: reduce) {
  .fade {
    transition: none;
  }
}
.fade:not(.show) {
  opacity: 0;
}

.collapse:not(.show) {
  display: none;
}

.collapsing {
  height: 0;
  overflow: hidden;
  transition: height 0.35s ease;
}
@media (prefers-reduced-motion: reduce) {
  .collapsing {
    transition: none;
  }
}
.collapsing.collapse-horizontal {
  width: 0;
  height: auto;
  transition: width 0.35s ease;
}
@media (prefers-reduced-motion: reduce) {
  .collapsing.collapse-horizontal {
    transition: none;
  }
}

.dropup,
.dropend,
.dropdown,
.dropstart,
.dropup-center,
.dropdown-center {
  position: relative;
}

.dropdown-toggle {
  white-space: nowrap;
}
.dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid;
  border-right: 0.3em solid transparent;
  border-bottom: 0;
  border-left: 0.3em solid transparent;
}
.dropdown-toggle:empty::after {
  margin-left: 0;
}

.dropdown-menu {
  --bs-dropdown-zindex: 1000;
  --bs-dropdown-min-width: 10rem;
  --bs-dropdown-padding-x: 0;
  --bs-dropdown-padding-y: 0.5rem;
  --bs-dropdown-spacer: 0.125rem;
  --bs-dropdown-font-size: 1rem;
  --bs-dropdown-color: var(--bs-body-color);
  --bs-dropdown-bg: var(--bs-body-bg);
  --bs-dropdown-border-color: var(--bs-border-color-translucent);
  --bs-dropdown-border-radius: var(--bs-border-radius);
  --bs-dropdown-border-width: var(--bs-border-width);
  --bs-dropdown-inner-border-radius: calc(var(--bs-border-radius) - var(--bs-border-width));
  --bs-dropdown-divider-bg: var(--bs-border-color-translucent);
  --bs-dropdown-divider-margin-y: 0.5rem;
  --bs-dropdown-box-shadow: var(--bs-box-shadow);
  --bs-dropdown-link-color: var(--bs-body-color);
  --bs-dropdown-link-hover-color: var(--bs-body-color);
  --bs-dropdown-link-hover-bg: var(--bs-tertiary-bg);
  --bs-dropdown-link-active-color: #fff;
  --bs-dropdown-link-active-bg: #1CC197;
  --bs-dropdown-link-disabled-color: var(--bs-tertiary-color);
  --bs-dropdown-item-padding-x: 1rem;
  --bs-dropdown-item-padding-y: 0.25rem;
  --bs-dropdown-header-color: #6c757d;
  --bs-dropdown-header-padding-x: 1rem;
  --bs-dropdown-header-padding-y: 0.5rem;
  position: absolute;
  z-index: var(--bs-dropdown-zindex);
  display: none;
  min-width: var(--bs-dropdown-min-width);
  padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);
  margin: 0;
  font-size: var(--bs-dropdown-font-size);
  color: var(--bs-dropdown-color);
  text-align: left;
  list-style: none;
  background-color: var(--bs-dropdown-bg);
  background-clip: padding-box;
  border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);
  border-radius: var(--bs-dropdown-border-radius);
}
.dropdown-menu[data-bs-popper] {
  top: 100%;
  left: 0;
  margin-top: var(--bs-dropdown-spacer);
}

.dropdown-menu-start {
  --bs-position: start;
}
.dropdown-menu-start[data-bs-popper] {
  right: auto;
  left: 0;
}

.dropdown-menu-end {
  --bs-position: end;
}
.dropdown-menu-end[data-bs-popper] {
  right: 0;
  left: auto;
}

@media (min-width: 576px) {
  .dropdown-menu-sm-start {
    --bs-position: start;
  }
  .dropdown-menu-sm-start[data-bs-popper] {
    right: auto;
    left: 0;
  }
  .dropdown-menu-sm-end {
    --bs-position: end;
  }
  .dropdown-menu-sm-end[data-bs-popper] {
    right: 0;
    left: auto;
  }
}
@media (min-width: 768px) {
  .dropdown-menu-md-start {
    --bs-position: start;
  }
  .dropdown-menu-md-start[data-bs-popper] {
    right: auto;
    left: 0;
  }
  .dropdown-menu-md-end {
    --bs-position: end;
  }
  .dropdown-menu-md-end[data-bs-popper] {
    right: 0;
    left: auto;
  }
}
@media (min-width: 992px) {
  .dropdown-menu-lg-start {
    --bs-position: start;
  }
  .dropdown-menu-lg-start[data-bs-popper] {
    right: auto;
    left: 0;
  }
  .dropdown-menu-lg-end {
    --bs-position: end;
  }
  .dropdown-menu-lg-end[data-bs-popper] {
    right: 0;
    left: auto;
  }
}
@media (min-width: 1200px) {
  .dropdown-menu-xl-start {
    --bs-position: start;
  }
  .dropdown-menu-xl-start[data-bs-popper] {
    right: auto;
    left: 0;
  }
  .dropdown-menu-xl-end {
    --bs-position: end;
  }
  .dropdown-menu-xl-end[data-bs-popper] {
    right: 0;
    left: auto;
  }
}
@media (min-width: 1400px) {
  .dropdown-menu-xxl-start {
    --bs-position: start;
  }
  .dropdown-menu-xxl-start[data-bs-popper] {
    right: auto;
    left: 0;
  }
  .dropdown-menu-xxl-end {
    --bs-position: end;
  }
  .dropdown-menu-xxl-end[data-bs-popper] {
    right: 0;
    left: auto;
  }
}
.dropup .dropdown-menu[data-bs-popper] {
  top: auto;
  bottom: 100%;
  margin-top: 0;
  margin-bottom: var(--bs-dropdown-spacer);
}
.dropup .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0;
  border-right: 0.3em solid transparent;
  border-bottom: 0.3em solid;
  border-left: 0.3em solid transparent;
}
.dropup .dropdown-toggle:empty::after {
  margin-left: 0;
}

.dropend .dropdown-menu[data-bs-popper] {
  top: 0;
  right: auto;
  left: 100%;
  margin-top: 0;
  margin-left: var(--bs-dropdown-spacer);
}
.dropend .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0;
  border-bottom: 0.3em solid transparent;
  border-left: 0.3em solid;
}
.dropend .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropend .dropdown-toggle::after {
  vertical-align: 0;
}

.dropstart .dropdown-menu[data-bs-popper] {
  top: 0;
  right: 100%;
  left: auto;
  margin-top: 0;
  margin-right: var(--bs-dropdown-spacer);
}
.dropstart .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
}
.dropstart .dropdown-toggle::after {
  display: none;
}
.dropstart .dropdown-toggle::before {
  display: inline-block;
  margin-right: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0.3em solid;
  border-bottom: 0.3em solid transparent;
}
.dropstart .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropstart .dropdown-toggle::before {
  vertical-align: 0;
}

.dropdown-divider {
  height: 0;
  margin: var(--bs-dropdown-divider-margin-y) 0;
  overflow: hidden;
  border-top: 1px solid var(--bs-dropdown-divider-bg);
  opacity: 1;
}

.dropdown-item {
  display: block;
  width: 100%;
  padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
  clear: both;
  font-weight: 400;
  color: var(--bs-dropdown-link-color);
  text-align: inherit;
  text-decoration: none;
  white-space: nowrap;
  background-color: transparent;
  border: 0;
  border-radius: var(--bs-dropdown-item-border-radius, 0);
}
.dropdown-item:hover, .dropdown-item:focus {
  color: var(--bs-dropdown-link-hover-color);
  background-color: var(--bs-dropdown-link-hover-bg);
}
.dropdown-item.active, .dropdown-item:active {
  color: var(--bs-dropdown-link-active-color);
  text-decoration: none;
  background-color: var(--bs-dropdown-link-active-bg);
}
.dropdown-item.disabled, .dropdown-item:disabled {
  color: var(--bs-dropdown-link-disabled-color);
  pointer-events: none;
  background-color: transparent;
}

.dropdown-menu.show {
  display: block;
}

.dropdown-header {
  display: block;
  padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);
  margin-bottom: 0;
  font-size: 0.875rem;
  color: var(--bs-dropdown-header-color);
  white-space: nowrap;
}

.dropdown-item-text {
  display: block;
  padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
  color: var(--bs-dropdown-link-color);
}

.dropdown-menu-dark {
  --bs-dropdown-color: #dee2e6;
  --bs-dropdown-bg: #343a40;
  --bs-dropdown-border-color: var(--bs-border-color-translucent);
  --bs-dropdown-box-shadow: ;
  --bs-dropdown-link-color: #dee2e6;
  --bs-dropdown-link-hover-color: #fff;
  --bs-dropdown-divider-bg: var(--bs-border-color-translucent);
  --bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15);
  --bs-dropdown-link-active-color: #fff;
  --bs-dropdown-link-active-bg: #1CC197;
  --bs-dropdown-link-disabled-color: #adb5bd;
  --bs-dropdown-header-color: #adb5bd;
}

.btn-group,
.btn-group-vertical {
  position: relative;
  display: inline-flex;
  vertical-align: middle;
}
.btn-group > .btn,
.btn-group-vertical > .btn {
  position: relative;
  flex: 1 1 auto;
}
.btn-group > .btn-check:checked + .btn,
.btn-group > .btn-check:focus + .btn,
.btn-group > .btn:hover,
.btn-group > .btn:focus,
.btn-group > .btn:active,
.btn-group > .btn.active,
.btn-group-vertical > .btn-check:checked + .btn,
.btn-group-vertical > .btn-check:focus + .btn,
.btn-group-vertical > .btn:hover,
.btn-group-vertical > .btn:focus,
.btn-group-vertical > .btn:active,
.btn-group-vertical > .btn.active {
  z-index: 1;
}

.btn-toolbar {
  display: flex;
  flex-wrap: wrap;
  justify-content: flex-start;
}
.btn-toolbar .input-group {
  width: auto;
}

.btn-group {
  border-radius: var(--bs-border-radius);
}
.btn-group > :not(.btn-check:first-child) + .btn,
.btn-group > .btn-group:not(:first-child) {
  margin-left: calc(var(--bs-border-width) * -1);
}
.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
.btn-group > .btn.dropdown-toggle-split:first-child,
.btn-group > .btn-group:not(:last-child) > .btn {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.btn-group > .btn:nth-child(n+3),
.btn-group > :not(.btn-check) + .btn,
.btn-group > .btn-group:not(:first-child) > .btn {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}

.dropdown-toggle-split {
  padding-right: 0.5625rem;
  padding-left: 0.5625rem;
}
.dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropend .dropdown-toggle-split::after {
  margin-left: 0;
}
.dropstart .dropdown-toggle-split::before {
  margin-right: 0;
}

.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
  padding-right: 0.375rem;
  padding-left: 0.375rem;
}

.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
  padding-right: 0.75rem;
  padding-left: 0.75rem;
}

.btn-group-vertical {
  flex-direction: column;
  align-items: flex-start;
  justify-content: center;
}
.btn-group-vertical > .btn,
.btn-group-vertical > .btn-group {
  width: 100%;
}
.btn-group-vertical > .btn:not(:first-child),
.btn-group-vertical > .btn-group:not(:first-child) {
  margin-top: calc(var(--bs-border-width) * -1);
}
.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
.btn-group-vertical > .btn-group:not(:last-child) > .btn {
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0;
}
.btn-group-vertical > .btn ~ .btn,
.btn-group-vertical > .btn-group:not(:first-child) > .btn {
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.nav {
  --bs-nav-link-padding-x: 1rem;
  --bs-nav-link-padding-y: 0.5rem;
  --bs-nav-link-font-weight: ;
  --bs-nav-link-color: var(--bs-link-color);
  --bs-nav-link-hover-color: var(--bs-link-hover-color);
  --bs-nav-link-disabled-color: var(--bs-secondary-color);
  display: flex;
  flex-wrap: wrap;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}

.nav-link {
  display: block;
  padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);
  font-size: var(--bs-nav-link-font-size);
  font-weight: var(--bs-nav-link-font-weight);
  color: var(--bs-nav-link-color);
  text-decoration: none;
  background: none;
  border: 0;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .nav-link {
    transition: none;
  }
}
.nav-link:hover, .nav-link:focus {
  color: var(--bs-nav-link-hover-color);
}
.nav-link:focus-visible {
  outline: 0;
  box-shadow: 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
}
.nav-link.disabled, .nav-link:disabled {
  color: var(--bs-nav-link-disabled-color);
  pointer-events: none;
  cursor: default;
}

.nav-tabs {
  --bs-nav-tabs-border-width: var(--bs-border-width);
  --bs-nav-tabs-border-color: var(--bs-border-color);
  --bs-nav-tabs-border-radius: var(--bs-border-radius);
  --bs-nav-tabs-link-hover-border-color: var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);
  --bs-nav-tabs-link-active-color: var(--bs-emphasis-color);
  --bs-nav-tabs-link-active-bg: var(--bs-body-bg);
  --bs-nav-tabs-link-active-border-color: var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);
  border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color);
}
.nav-tabs .nav-link {
  margin-bottom: calc(-1 * var(--bs-nav-tabs-border-width));
  border: var(--bs-nav-tabs-border-width) solid transparent;
  border-top-left-radius: var(--bs-nav-tabs-border-radius);
  border-top-right-radius: var(--bs-nav-tabs-border-radius);
}
.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
  isolation: isolate;
  border-color: var(--bs-nav-tabs-link-hover-border-color);
}
.nav-tabs .nav-link.active,
.nav-tabs .nav-item.show .nav-link {
  color: var(--bs-nav-tabs-link-active-color);
  background-color: var(--bs-nav-tabs-link-active-bg);
  border-color: var(--bs-nav-tabs-link-active-border-color);
}
.nav-tabs .dropdown-menu {
  margin-top: calc(-1 * var(--bs-nav-tabs-border-width));
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.nav-pills {
  --bs-nav-pills-border-radius: var(--bs-border-radius);
  --bs-nav-pills-link-active-color: #fff;
  --bs-nav-pills-link-active-bg: #1CC197;
}
.nav-pills .nav-link {
  border-radius: var(--bs-nav-pills-border-radius);
}
.nav-pills .nav-link.active,
.nav-pills .show > .nav-link {
  color: var(--bs-nav-pills-link-active-color);
  background-color: var(--bs-nav-pills-link-active-bg);
}

.nav-underline {
  --bs-nav-underline-gap: 1rem;
  --bs-nav-underline-border-width: 0.125rem;
  --bs-nav-underline-link-active-color: var(--bs-emphasis-color);
  gap: var(--bs-nav-underline-gap);
}
.nav-underline .nav-link {
  padding-right: 0;
  padding-left: 0;
  border-bottom: var(--bs-nav-underline-border-width) solid transparent;
}
.nav-underline .nav-link:hover, .nav-underline .nav-link:focus {
  border-bottom-color: currentcolor;
}
.nav-underline .nav-link.active,
.nav-underline .show > .nav-link {
  font-weight: 700;
  color: var(--bs-nav-underline-link-active-color);
  border-bottom-color: currentcolor;
}

.nav-fill > .nav-link,
.nav-fill .nav-item {
  flex: 1 1 auto;
  text-align: center;
}

.nav-justified > .nav-link,
.nav-justified .nav-item {
  flex-basis: 0;
  flex-grow: 1;
  text-align: center;
}

.nav-fill .nav-item .nav-link,
.nav-justified .nav-item .nav-link {
  width: 100%;
}

.tab-content > .tab-pane {
  display: none;
}
.tab-content > .active {
  display: block;
}

.navbar {
  --bs-navbar-padding-x: 0;
  --bs-navbar-padding-y: 0.5rem;
  --bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);
  --bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);
  --bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);
  --bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);
  --bs-navbar-brand-padding-y: 0.3125rem;
  --bs-navbar-brand-margin-end: 1rem;
  --bs-navbar-brand-font-size: 1.25rem;
  --bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);
  --bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);
  --bs-navbar-nav-link-padding-x: 0.5rem;
  --bs-navbar-toggler-padding-y: 0.25rem;
  --bs-navbar-toggler-padding-x: 0.75rem;
  --bs-navbar-toggler-font-size: 1.25rem;
  --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 30 30%27%3e%3cpath stroke=%27rgba%2833, 37, 41, 0.75%29%27 stroke-linecap=%27round%27 stroke-miterlimit=%2710%27 stroke-width=%272%27 d=%27M4 7h22M4 15h22M4 23h22%27/%3e%3c/svg%3e");
  --bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15);
  --bs-navbar-toggler-border-radius: var(--bs-border-radius);
  --bs-navbar-toggler-focus-width: 0.25rem;
  --bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: space-between;
  padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x);
}
.navbar > .container,
.navbar > .container-fluid,
.navbar > .container-sm,
.navbar > .container-md,
.navbar > .container-lg,
.navbar > .container-xl,
.navbar > .container-xxl {
  display: flex;
  flex-wrap: inherit;
  align-items: center;
  justify-content: space-between;
}
.navbar-brand {
  padding-top: var(--bs-navbar-brand-padding-y);
  padding-bottom: var(--bs-navbar-brand-padding-y);
  margin-right: var(--bs-navbar-brand-margin-end);
  font-size: var(--bs-navbar-brand-font-size);
  color: var(--bs-navbar-brand-color);
  text-decoration: none;
  white-space: nowrap;
}
.navbar-brand:hover, .navbar-brand:focus {
  color: var(--bs-navbar-brand-hover-color);
}

.navbar-nav {
  --bs-nav-link-padding-x: 0;
  --bs-nav-link-padding-y: 0.5rem;
  --bs-nav-link-font-weight: ;
  --bs-nav-link-color: var(--bs-navbar-color);
  --bs-nav-link-hover-color: var(--bs-navbar-hover-color);
  --bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}
.navbar-nav .nav-link.active, .navbar-nav .nav-link.show {
  color: var(--bs-navbar-active-color);
}
.navbar-nav .dropdown-menu {
  position: static;
}

.navbar-text {
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
  color: var(--bs-navbar-color);
}
.navbar-text a,
.navbar-text a:hover,
.navbar-text a:focus {
  color: var(--bs-navbar-active-color);
}

.navbar-collapse {
  flex-basis: 100%;
  flex-grow: 1;
  align-items: center;
}

.navbar-toggler {
  padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);
  font-size: var(--bs-navbar-toggler-font-size);
  line-height: 1;
  color: var(--bs-navbar-color);
  background-color: transparent;
  border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);
  border-radius: var(--bs-navbar-toggler-border-radius);
  transition: var(--bs-navbar-toggler-transition);
}
@media (prefers-reduced-motion: reduce) {
  .navbar-toggler {
    transition: none;
  }
}
.navbar-toggler:hover {
  text-decoration: none;
}
.navbar-toggler:focus {
  text-decoration: none;
  outline: 0;
  box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width);
}

.navbar-toggler-icon {
  display: inline-block;
  width: 1.5em;
  height: 1.5em;
  vertical-align: middle;
  background-image: var(--bs-navbar-toggler-icon-bg);
  background-repeat: no-repeat;
  background-position: center;
  background-size: 100%;
}

.navbar-nav-scroll {
  max-height: var(--bs-scroll-height, 75vh);
  overflow-y: auto;
}

@media (min-width: 576px) {
  .navbar-expand-sm {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-sm .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-sm .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-sm .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-sm .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-sm .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-sm .navbar-toggler {
    display: none;
  }
  .navbar-expand-sm .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-sm .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-sm .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 768px) {
  .navbar-expand-md {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-md .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-md .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-md .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-md .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-md .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-md .navbar-toggler {
    display: none;
  }
  .navbar-expand-md .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-md .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-md .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 992px) {
  .navbar-expand-lg {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-lg .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-lg .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-lg .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-lg .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-lg .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-lg .navbar-toggler {
    display: none;
  }
  .navbar-expand-lg .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-lg .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-lg .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 1200px) {
  .navbar-expand-xl {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-xl .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-xl .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-xl .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-xl .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-xl .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-xl .navbar-toggler {
    display: none;
  }
  .navbar-expand-xl .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-xl .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-xl .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 1400px) {
  .navbar-expand-xxl {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-xxl .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-xxl .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-xxl .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-xxl .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-xxl .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-xxl .navbar-toggler {
    display: none;
  }
  .navbar-expand-xxl .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-xxl .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-xxl .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
.navbar-expand {
  flex-wrap: nowrap;
  justify-content: flex-start;
}
.navbar-expand .navbar-nav {
  flex-direction: row;
}
.navbar-expand .navbar-nav .dropdown-menu {
  position: absolute;
}
.navbar-expand .navbar-nav .nav-link {
  padding-right: var(--bs-navbar-nav-link-padding-x);
  padding-left: var(--bs-navbar-nav-link-padding-x);
}
.navbar-expand .navbar-nav-scroll {
  overflow: visible;
}
.navbar-expand .navbar-collapse {
  display: flex !important;
  flex-basis: auto;
}
.navbar-expand .navbar-toggler {
  display: none;
}
.navbar-expand .offcanvas {
  position: static;
  z-index: auto;
  flex-grow: 1;
  width: auto !important;
  height: auto !important;
  visibility: visible !important;
  background-color: transparent !important;
  border: 0 !important;
  transform: none !important;
  transition: none;
}
.navbar-expand .offcanvas .offcanvas-header {
  display: none;
}
.navbar-expand .offcanvas .offcanvas-body {
  display: flex;
  flex-grow: 0;
  padding: 0;
  overflow-y: visible;
}

.navbar-dark,
.navbar[data-bs-theme=dark] {
  --bs-navbar-color: rgba(255, 255, 255, 0.55);
  --bs-navbar-hover-color: rgba(255, 255, 255, 0.75);
  --bs-navbar-disabled-color: rgba(255, 255, 255, 0.25);
  --bs-navbar-active-color: #fff;
  --bs-navbar-brand-color: #fff;
  --bs-navbar-brand-hover-color: #fff;
  --bs-navbar-toggler-border-color: rgba(255, 255, 255, 0.1);
  --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 30 30%27%3e%3cpath stroke=%27rgba%28255, 255, 255, 0.55%29%27 stroke-linecap=%27round%27 stroke-miterlimit=%2710%27 stroke-width=%272%27 d=%27M4 7h22M4 15h22M4 23h22%27/%3e%3c/svg%3e");
}

[data-bs-theme=dark] .navbar-toggler-icon {
  --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 30 30%27%3e%3cpath stroke=%27rgba%28255, 255, 255, 0.55%29%27 stroke-linecap=%27round%27 stroke-miterlimit=%2710%27 stroke-width=%272%27 d=%27M4 7h22M4 15h22M4 23h22%27/%3e%3c/svg%3e");
}

.card {
  --bs-card-spacer-y: 1rem;
  --bs-card-spacer-x: 1rem;
  --bs-card-title-spacer-y: 0.5rem;
  --bs-card-title-color: ;
  --bs-card-subtitle-color: ;
  --bs-card-border-width: var(--bs-border-width);
  --bs-card-border-color: var(--bs-border-color-translucent);
  --bs-card-border-radius: var(--bs-border-radius);
  --bs-card-box-shadow: ;
  --bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));
  --bs-card-cap-padding-y: 0.5rem;
  --bs-card-cap-padding-x: 1rem;
  --bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.03);
  --bs-card-cap-color: ;
  --bs-card-height: ;
  --bs-card-color: ;
  --bs-card-bg: var(--bs-body-bg);
  --bs-card-img-overlay-padding: 1rem;
  --bs-card-group-margin: 0.75rem;
  position: relative;
  display: flex;
  flex-direction: column;
  min-width: 0;
  height: var(--bs-card-height);
  color: var(--bs-body-color);
  word-wrap: break-word;
  background-color: var(--bs-card-bg);
  background-clip: border-box;
  border: var(--bs-card-border-width) solid var(--bs-card-border-color);
  border-radius: var(--bs-card-border-radius);
}
.card > hr {
  margin-right: 0;
  margin-left: 0;
}
.card > .list-group {
  border-top: inherit;
  border-bottom: inherit;
}
.card > .list-group:first-child {
  border-top-width: 0;
  border-top-left-radius: var(--bs-card-inner-border-radius);
  border-top-right-radius: var(--bs-card-inner-border-radius);
}
.card > .list-group:last-child {
  border-bottom-width: 0;
  border-bottom-right-radius: var(--bs-card-inner-border-radius);
  border-bottom-left-radius: var(--bs-card-inner-border-radius);
}
.card > .card-header + .list-group,
.card > .list-group + .card-footer {
  border-top: 0;
}

.card-body {
  flex: 1 1 auto;
  padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x);
  color: var(--bs-card-color);
}

.card-title {
  margin-bottom: var(--bs-card-title-spacer-y);
  color: var(--bs-card-title-color);
}

.card-subtitle {
  margin-top: calc(-0.5 * var(--bs-card-title-spacer-y));
  margin-bottom: 0;
  color: var(--bs-card-subtitle-color);
}

.card-text:last-child {
  margin-bottom: 0;
}

.card-link + .card-link {
  margin-left: var(--bs-card-spacer-x);
}

.card-header {
  padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
  margin-bottom: 0;
  color: var(--bs-card-cap-color);
  background-color: var(--bs-card-cap-bg);
  border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color);
}
.card-header:first-child {
  border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0;
}

.card-footer {
  padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
  color: var(--bs-card-cap-color);
  background-color: var(--bs-card-cap-bg);
  border-top: var(--bs-card-border-width) solid var(--bs-card-border-color);
}
.card-footer:last-child {
  border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius);
}

.card-header-tabs {
  margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
  margin-bottom: calc(-1 * var(--bs-card-cap-padding-y));
  margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
  border-bottom: 0;
}
.card-header-tabs .nav-link.active {
  background-color: var(--bs-card-bg);
  border-bottom-color: var(--bs-card-bg);
}

.card-header-pills {
  margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
  margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
}

.card-img-overlay {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  padding: var(--bs-card-img-overlay-padding);
  border-radius: var(--bs-card-inner-border-radius);
}

.card-img,
.card-img-top,
.card-img-bottom {
  width: 100%;
}

.card-img,
.card-img-top {
  border-top-left-radius: var(--bs-card-inner-border-radius);
  border-top-right-radius: var(--bs-card-inner-border-radius);
}

.card-img,
.card-img-bottom {
  border-bottom-right-radius: var(--bs-card-inner-border-radius);
  border-bottom-left-radius: var(--bs-card-inner-border-radius);
}

.card-group > .card {
  margin-bottom: var(--bs-card-group-margin);
}
@media (min-width: 576px) {
  .card-group {
    display: flex;
    flex-flow: row wrap;
  }
  .card-group > .card {
    flex: 1 0 0%;
    margin-bottom: 0;
  }
  .card-group > .card + .card {
    margin-left: 0;
    border-left: 0;
  }
  .card-group > .card:not(:last-child) {
    border-top-right-radius: 0;
    border-bottom-right-radius: 0;
  }
  .card-group > .card:not(:last-child) .card-img-top,
  .card-group > .card:not(:last-child) .card-header {
    border-top-right-radius: 0;
  }
  .card-group > .card:not(:last-child) .card-img-bottom,
  .card-group > .card:not(:last-child) .card-footer {
    border-bottom-right-radius: 0;
  }
  .card-group > .card:not(:first-child) {
    border-top-left-radius: 0;
    border-bottom-left-radius: 0;
  }
  .card-group > .card:not(:first-child) .card-img-top,
  .card-group > .card:not(:first-child) .card-header {
    border-top-left-radius: 0;
  }
  .card-group > .card:not(:first-child) .card-img-bottom,
  .card-group > .card:not(:first-child) .card-footer {
    border-bottom-left-radius: 0;
  }
}

.accordion {
  --bs-accordion-color: var(--bs-body-color);
  --bs-accordion-bg: var(--bs-body-bg);
  --bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease;
  --bs-accordion-border-color: var(--bs-border-color);
  --bs-accordion-border-width: var(--bs-border-width);
  --bs-accordion-border-radius: var(--bs-border-radius);
  --bs-accordion-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));
  --bs-accordion-btn-padding-x: 1.25rem;
  --bs-accordion-btn-padding-y: 1rem;
  --bs-accordion-btn-color: var(--bs-body-color);
  --bs-accordion-btn-bg: var(--bs-accordion-bg);
  --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27none%27 stroke=%27%23212529%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27%3e%3cpath d=%27M2 5L8 11L14 5%27/%3e%3c/svg%3e");
  --bs-accordion-btn-icon-width: 1.25rem;
  --bs-accordion-btn-icon-transform: rotate(-180deg);
  --bs-accordion-btn-icon-transition: transform 0.2s ease-in-out;
  --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27none%27 stroke=%27%230b4d3c%27 stroke-linecap=%27round%27 stroke-linejoin=%27round%27%3e%3cpath d=%27M2 5L8 11L14 5%27/%3e%3c/svg%3e");
  --bs-accordion-btn-focus-box-shadow: 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
  --bs-accordion-body-padding-x: 1.25rem;
  --bs-accordion-body-padding-y: 1rem;
  --bs-accordion-active-color: var(--bs-primary-text-emphasis);
  --bs-accordion-active-bg: var(--bs-primary-bg-subtle);
}

.accordion-button {
  position: relative;
  display: flex;
  align-items: center;
  width: 100%;
  padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);
  font-size: 1rem;
  color: var(--bs-accordion-btn-color);
  text-align: left;
  background-color: var(--bs-accordion-btn-bg);
  border: 0;
  border-radius: 0;
  overflow-anchor: none;
  transition: var(--bs-accordion-transition);
}
@media (prefers-reduced-motion: reduce) {
  .accordion-button {
    transition: none;
  }
}
.accordion-button:not(.collapsed) {
  color: var(--bs-accordion-active-color);
  background-color: var(--bs-accordion-active-bg);
  box-shadow: inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color);
}
.accordion-button:not(.collapsed)::after {
  background-image: var(--bs-accordion-btn-active-icon);
  transform: var(--bs-accordion-btn-icon-transform);
}
.accordion-button::after {
  flex-shrink: 0;
  width: var(--bs-accordion-btn-icon-width);
  height: var(--bs-accordion-btn-icon-width);
  margin-left: auto;
  content: "";
  background-image: var(--bs-accordion-btn-icon);
  background-repeat: no-repeat;
  background-size: var(--bs-accordion-btn-icon-width);
  transition: var(--bs-accordion-btn-icon-transition);
}
@media (prefers-reduced-motion: reduce) {
  .accordion-button::after {
    transition: none;
  }
}
.accordion-button:hover {
  z-index: 2;
}
.accordion-button:focus {
  z-index: 3;
  outline: 0;
  box-shadow: var(--bs-accordion-btn-focus-box-shadow);
}

.accordion-header {
  margin-bottom: 0;
}

.accordion-item {
  color: var(--bs-accordion-color);
  background-color: var(--bs-accordion-bg);
  border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color);
}
.accordion-item:first-of-type {
  border-top-left-radius: var(--bs-accordion-border-radius);
  border-top-right-radius: var(--bs-accordion-border-radius);
}
.accordion-item:first-of-type > .accordion-header .accordion-button {
  border-top-left-radius: var(--bs-accordion-inner-border-radius);
  border-top-right-radius: var(--bs-accordion-inner-border-radius);
}
.accordion-item:not(:first-of-type) {
  border-top: 0;
}
.accordion-item:last-of-type {
  border-bottom-right-radius: var(--bs-accordion-border-radius);
  border-bottom-left-radius: var(--bs-accordion-border-radius);
}
.accordion-item:last-of-type > .accordion-header .accordion-button.collapsed {
  border-bottom-right-radius: var(--bs-accordion-inner-border-radius);
  border-bottom-left-radius: var(--bs-accordion-inner-border-radius);
}
.accordion-item:last-of-type > .accordion-collapse {
  border-bottom-right-radius: var(--bs-accordion-border-radius);
  border-bottom-left-radius: var(--bs-accordion-border-radius);
}

.accordion-body {
  padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x);
}

.accordion-flush > .accordion-item {
  border-right: 0;
  border-left: 0;
  border-radius: 0;
}
.accordion-flush > .accordion-item:first-child {
  border-top: 0;
}
.accordion-flush > .accordion-item:last-child {
  border-bottom: 0;
}
.accordion-flush > .accordion-item > .accordion-header .accordion-button, .accordion-flush > .accordion-item > .accordion-header .accordion-button.collapsed {
  border-radius: 0;
}
.accordion-flush > .accordion-item > .accordion-collapse {
  border-radius: 0;
}

[data-bs-theme=dark] .accordion-button::after {
  --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%2377dac1%27%3e%3cpath fill-rule=%27evenodd%27 d=%27M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z%27/%3e%3c/svg%3e");
  --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%2377dac1%27%3e%3cpath fill-rule=%27evenodd%27 d=%27M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z%27/%3e%3c/svg%3e");
}

.breadcrumb {
  --bs-breadcrumb-padding-x: 0;
  --bs-breadcrumb-padding-y: 0;
  --bs-breadcrumb-margin-bottom: 1rem;
  --bs-breadcrumb-bg: ;
  --bs-breadcrumb-border-radius: ;
  --bs-breadcrumb-divider-color: var(--bs-secondary-color);
  --bs-breadcrumb-item-padding-x: 0.5rem;
  --bs-breadcrumb-item-active-color: var(--bs-secondary-color);
  display: flex;
  flex-wrap: wrap;
  padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);
  margin-bottom: var(--bs-breadcrumb-margin-bottom);
  font-size: var(--bs-breadcrumb-font-size);
  list-style: none;
  background-color: var(--bs-breadcrumb-bg);
  border-radius: var(--bs-breadcrumb-border-radius);
}

.breadcrumb-item + .breadcrumb-item {
  padding-left: var(--bs-breadcrumb-item-padding-x);
}
.breadcrumb-item + .breadcrumb-item::before {
  float: left;
  padding-right: var(--bs-breadcrumb-item-padding-x);
  color: var(--bs-breadcrumb-divider-color);
  content: var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */;
}
.breadcrumb-item.active {
  color: var(--bs-breadcrumb-item-active-color);
}

.pagination {
  --bs-pagination-padding-x: 0.75rem;
  --bs-pagination-padding-y: 0.375rem;
  --bs-pagination-font-size: 1rem;
  --bs-pagination-color: var(--bs-link-color);
  --bs-pagination-bg: var(--bs-body-bg);
  --bs-pagination-border-width: var(--bs-border-width);
  --bs-pagination-border-color: var(--bs-border-color);
  --bs-pagination-border-radius: var(--bs-border-radius);
  --bs-pagination-hover-color: var(--bs-link-hover-color);
  --bs-pagination-hover-bg: var(--bs-tertiary-bg);
  --bs-pagination-hover-border-color: var(--bs-border-color);
  --bs-pagination-focus-color: var(--bs-link-hover-color);
  --bs-pagination-focus-bg: var(--bs-secondary-bg);
  --bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
  --bs-pagination-active-color: #fff;
  --bs-pagination-active-bg: #1CC197;
  --bs-pagination-active-border-color: #1CC197;
  --bs-pagination-disabled-color: var(--bs-secondary-color);
  --bs-pagination-disabled-bg: var(--bs-secondary-bg);
  --bs-pagination-disabled-border-color: var(--bs-border-color);
  display: flex;
  padding-left: 0;
  list-style: none;
}

.page-link {
  position: relative;
  display: block;
  padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);
  font-size: var(--bs-pagination-font-size);
  color: var(--bs-pagination-color);
  text-decoration: none;
  background-color: var(--bs-pagination-bg);
  border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .page-link {
    transition: none;
  }
}
.page-link:hover {
  z-index: 2;
  color: var(--bs-pagination-hover-color);
  background-color: var(--bs-pagination-hover-bg);
  border-color: var(--bs-pagination-hover-border-color);
}
.page-link:focus {
  z-index: 3;
  color: var(--bs-pagination-focus-color);
  background-color: var(--bs-pagination-focus-bg);
  outline: 0;
  box-shadow: var(--bs-pagination-focus-box-shadow);
}
.page-link.active, .active > .page-link {
  z-index: 3;
  color: var(--bs-pagination-active-color);
  background-color: var(--bs-pagination-active-bg);
  border-color: var(--bs-pagination-active-border-color);
}
.page-link.disabled, .disabled > .page-link {
  color: var(--bs-pagination-disabled-color);
  pointer-events: none;
  background-color: var(--bs-pagination-disabled-bg);
  border-color: var(--bs-pagination-disabled-border-color);
}

.page-item:not(:first-child) .page-link {
  margin-left: calc(var(--bs-border-width) * -1);
}
.page-item:first-child .page-link {
  border-top-left-radius: var(--bs-pagination-border-radius);
  border-bottom-left-radius: var(--bs-pagination-border-radius);
}
.page-item:last-child .page-link {
  border-top-right-radius: var(--bs-pagination-border-radius);
  border-bottom-right-radius: var(--bs-pagination-border-radius);
}

.pagination-lg {
  --bs-pagination-padding-x: 1.5rem;
  --bs-pagination-padding-y: 0.75rem;
  --bs-pagination-font-size: 1.25rem;
  --bs-pagination-border-radius: var(--bs-border-radius-lg);
}

.pagination-sm {
  --bs-pagination-padding-x: 0.5rem;
  --bs-pagination-padding-y: 0.25rem;
  --bs-pagination-font-size: 0.875rem;
  --bs-pagination-border-radius: var(--bs-border-radius-sm);
}

.badge {
  --bs-badge-padding-x: 0.65em;
  --bs-badge-padding-y: 0.35em;
  --bs-badge-font-size: 0.75em;
  --bs-badge-font-weight: 700;
  --bs-badge-color: #fff;
  --bs-badge-border-radius: var(--bs-border-radius);
  display: inline-block;
  padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x);
  font-size: var(--bs-badge-font-size);
  font-weight: var(--bs-badge-font-weight);
  line-height: 1;
  color: var(--bs-badge-color);
  text-align: center;
  white-space: nowrap;
  vertical-align: baseline;
  border-radius: var(--bs-badge-border-radius);
}
.badge:empty {
  display: none;
}

.btn .badge {
  position: relative;
  top: -1px;
}

.alert {
  --bs-alert-bg: transparent;
  --bs-alert-padding-x: 1rem;
  --bs-alert-padding-y: 1rem;
  --bs-alert-margin-bottom: 1rem;
  --bs-alert-color: inherit;
  --bs-alert-border-color: transparent;
  --bs-alert-border: var(--bs-border-width) solid var(--bs-alert-border-color);
  --bs-alert-border-radius: var(--bs-border-radius);
  --bs-alert-link-color: inherit;
  position: relative;
  padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x);
  margin-bottom: var(--bs-alert-margin-bottom);
  color: var(--bs-alert-color);
  background-color: var(--bs-alert-bg);
  border: var(--bs-alert-border);
  border-radius: var(--bs-alert-border-radius);
}

.alert-heading {
  color: inherit;
}

.alert-link {
  font-weight: 700;
  color: var(--bs-alert-link-color);
}

.alert-dismissible {
  padding-right: 3rem;
}
.alert-dismissible .btn-close {
  position: absolute;
  top: 0;
  right: 0;
  z-index: 2;
  padding: 1.25rem 1rem;
}

.alert-primary {
  --bs-alert-color: var(--bs-primary-text-emphasis);
  --bs-alert-bg: var(--bs-primary-bg-subtle);
  --bs-alert-border-color: var(--bs-primary-border-subtle);
  --bs-alert-link-color: var(--bs-primary-text-emphasis);
}

.alert-gray-100 {
  --bs-alert-color: var(--bs-gray-100-text-emphasis);
  --bs-alert-bg: var(--bs-gray-100-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-100-border-subtle);
  --bs-alert-link-color: var(--bs-gray-100-text-emphasis);
}

.alert-gray-200 {
  --bs-alert-color: var(--bs-gray-200-text-emphasis);
  --bs-alert-bg: var(--bs-gray-200-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-200-border-subtle);
  --bs-alert-link-color: var(--bs-gray-200-text-emphasis);
}

.alert-gray-300 {
  --bs-alert-color: var(--bs-gray-300-text-emphasis);
  --bs-alert-bg: var(--bs-gray-300-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-300-border-subtle);
  --bs-alert-link-color: var(--bs-gray-300-text-emphasis);
}

.alert-gray-400 {
  --bs-alert-color: var(--bs-gray-400-text-emphasis);
  --bs-alert-bg: var(--bs-gray-400-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-400-border-subtle);
  --bs-alert-link-color: var(--bs-gray-400-text-emphasis);
}

.alert-gray-500 {
  --bs-alert-color: var(--bs-gray-500-text-emphasis);
  --bs-alert-bg: var(--bs-gray-500-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-500-border-subtle);
  --bs-alert-link-color: var(--bs-gray-500-text-emphasis);
}

.alert-gray-600 {
  --bs-alert-color: var(--bs-gray-600-text-emphasis);
  --bs-alert-bg: var(--bs-gray-600-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-600-border-subtle);
  --bs-alert-link-color: var(--bs-gray-600-text-emphasis);
}

.alert-gray-700 {
  --bs-alert-color: var(--bs-gray-700-text-emphasis);
  --bs-alert-bg: var(--bs-gray-700-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-700-border-subtle);
  --bs-alert-link-color: var(--bs-gray-700-text-emphasis);
}

.alert-gray-800 {
  --bs-alert-color: var(--bs-gray-800-text-emphasis);
  --bs-alert-bg: var(--bs-gray-800-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-800-border-subtle);
  --bs-alert-link-color: var(--bs-gray-800-text-emphasis);
}

.alert-gray-900 {
  --bs-alert-color: var(--bs-gray-900-text-emphasis);
  --bs-alert-bg: var(--bs-gray-900-bg-subtle);
  --bs-alert-border-color: var(--bs-gray-900-border-subtle);
  --bs-alert-link-color: var(--bs-gray-900-text-emphasis);
}

@keyframes progress-bar-stripes {
  0% {
    background-position-x: 1rem;
  }
}
.progress,
.progress-stacked {
  --bs-progress-height: 1rem;
  --bs-progress-font-size: 0.75rem;
  --bs-progress-bg: var(--bs-secondary-bg);
  --bs-progress-border-radius: var(--bs-border-radius);
  --bs-progress-box-shadow: var(--bs-box-shadow-inset);
  --bs-progress-bar-color: #fff;
  --bs-progress-bar-bg: #1CC197;
  --bs-progress-bar-transition: width 0.6s ease;
  display: flex;
  height: var(--bs-progress-height);
  overflow: hidden;
  font-size: var(--bs-progress-font-size);
  background-color: var(--bs-progress-bg);
  border-radius: var(--bs-progress-border-radius);
}

.progress-bar {
  display: flex;
  flex-direction: column;
  justify-content: center;
  overflow: hidden;
  color: var(--bs-progress-bar-color);
  text-align: center;
  white-space: nowrap;
  background-color: var(--bs-progress-bar-bg);
  transition: var(--bs-progress-bar-transition);
}
@media (prefers-reduced-motion: reduce) {
  .progress-bar {
    transition: none;
  }
}

.progress-bar-striped {
  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
  background-size: var(--bs-progress-height) var(--bs-progress-height);
}

.progress-stacked > .progress {
  overflow: visible;
}

.progress-stacked > .progress > .progress-bar {
  width: 100%;
}

.progress-bar-animated {
  animation: 1s linear infinite progress-bar-stripes;
}
@media (prefers-reduced-motion: reduce) {
  .progress-bar-animated {
    animation: none;
  }
}

.list-group {
  --bs-list-group-color: var(--bs-body-color);
  --bs-list-group-bg: var(--bs-body-bg);
  --bs-list-group-border-color: var(--bs-border-color);
  --bs-list-group-border-width: var(--bs-border-width);
  --bs-list-group-border-radius: var(--bs-border-radius);
  --bs-list-group-item-padding-x: 1rem;
  --bs-list-group-item-padding-y: 0.5rem;
  --bs-list-group-action-color: var(--bs-secondary-color);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-tertiary-bg);
  --bs-list-group-action-active-color: var(--bs-body-color);
  --bs-list-group-action-active-bg: var(--bs-secondary-bg);
  --bs-list-group-disabled-color: var(--bs-secondary-color);
  --bs-list-group-disabled-bg: var(--bs-body-bg);
  --bs-list-group-active-color: #fff;
  --bs-list-group-active-bg: #1CC197;
  --bs-list-group-active-border-color: #1CC197;
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  border-radius: var(--bs-list-group-border-radius);
}

.list-group-numbered {
  list-style-type: none;
  counter-reset: section;
}
.list-group-numbered > .list-group-item::before {
  content: counters(section, ".") ". ";
  counter-increment: section;
}

.list-group-item-action {
  width: 100%;
  color: var(--bs-list-group-action-color);
  text-align: inherit;
}
.list-group-item-action:hover, .list-group-item-action:focus {
  z-index: 1;
  color: var(--bs-list-group-action-hover-color);
  text-decoration: none;
  background-color: var(--bs-list-group-action-hover-bg);
}
.list-group-item-action:active {
  color: var(--bs-list-group-action-active-color);
  background-color: var(--bs-list-group-action-active-bg);
}

.list-group-item {
  position: relative;
  display: block;
  padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);
  color: var(--bs-list-group-color);
  text-decoration: none;
  background-color: var(--bs-list-group-bg);
  border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color);
}
.list-group-item:first-child {
  border-top-left-radius: inherit;
  border-top-right-radius: inherit;
}
.list-group-item:last-child {
  border-bottom-right-radius: inherit;
  border-bottom-left-radius: inherit;
}
.list-group-item.disabled, .list-group-item:disabled {
  color: var(--bs-list-group-disabled-color);
  pointer-events: none;
  background-color: var(--bs-list-group-disabled-bg);
}
.list-group-item.active {
  z-index: 2;
  color: var(--bs-list-group-active-color);
  background-color: var(--bs-list-group-active-bg);
  border-color: var(--bs-list-group-active-border-color);
}
.list-group-item + .list-group-item {
  border-top-width: 0;
}
.list-group-item + .list-group-item.active {
  margin-top: calc(-1 * var(--bs-list-group-border-width));
  border-top-width: var(--bs-list-group-border-width);
}

.list-group-horizontal {
  flex-direction: row;
}
.list-group-horizontal > .list-group-item:first-child:not(:last-child) {
  border-bottom-left-radius: var(--bs-list-group-border-radius);
  border-top-right-radius: 0;
}
.list-group-horizontal > .list-group-item:last-child:not(:first-child) {
  border-top-right-radius: var(--bs-list-group-border-radius);
  border-bottom-left-radius: 0;
}
.list-group-horizontal > .list-group-item.active {
  margin-top: 0;
}
.list-group-horizontal > .list-group-item + .list-group-item {
  border-top-width: var(--bs-list-group-border-width);
  border-left-width: 0;
}
.list-group-horizontal > .list-group-item + .list-group-item.active {
  margin-left: calc(-1 * var(--bs-list-group-border-width));
  border-left-width: var(--bs-list-group-border-width);
}

@media (min-width: 576px) {
  .list-group-horizontal-sm {
    flex-direction: row;
  }
  .list-group-horizontal-sm > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-sm > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-sm > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-sm > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-sm > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 768px) {
  .list-group-horizontal-md {
    flex-direction: row;
  }
  .list-group-horizontal-md > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-md > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-md > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-md > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-md > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 992px) {
  .list-group-horizontal-lg {
    flex-direction: row;
  }
  .list-group-horizontal-lg > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-lg > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-lg > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-lg > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-lg > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 1200px) {
  .list-group-horizontal-xl {
    flex-direction: row;
  }
  .list-group-horizontal-xl > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-xl > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-xl > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-xl > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-xl > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 1400px) {
  .list-group-horizontal-xxl {
    flex-direction: row;
  }
  .list-group-horizontal-xxl > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-xxl > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-xxl > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-xxl > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-xxl > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
.list-group-flush {
  border-radius: 0;
}
.list-group-flush > .list-group-item {
  border-width: 0 0 var(--bs-list-group-border-width);
}
.list-group-flush > .list-group-item:last-child {
  border-bottom-width: 0;
}

.list-group-item-primary {
  --bs-list-group-color: var(--bs-primary-text-emphasis);
  --bs-list-group-bg: var(--bs-primary-bg-subtle);
  --bs-list-group-border-color: var(--bs-primary-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-primary-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-primary-border-subtle);
  --bs-list-group-active-color: var(--bs-primary-bg-subtle);
  --bs-list-group-active-bg: var(--bs-primary-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-primary-text-emphasis);
}

.list-group-item-gray-100 {
  --bs-list-group-color: var(--bs-gray-100-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-100-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-100-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-100-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-100-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-100-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-100-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-100-text-emphasis);
}

.list-group-item-gray-200 {
  --bs-list-group-color: var(--bs-gray-200-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-200-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-200-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-200-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-200-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-200-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-200-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-200-text-emphasis);
}

.list-group-item-gray-300 {
  --bs-list-group-color: var(--bs-gray-300-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-300-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-300-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-300-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-300-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-300-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-300-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-300-text-emphasis);
}

.list-group-item-gray-400 {
  --bs-list-group-color: var(--bs-gray-400-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-400-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-400-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-400-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-400-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-400-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-400-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-400-text-emphasis);
}

.list-group-item-gray-500 {
  --bs-list-group-color: var(--bs-gray-500-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-500-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-500-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-500-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-500-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-500-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-500-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-500-text-emphasis);
}

.list-group-item-gray-600 {
  --bs-list-group-color: var(--bs-gray-600-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-600-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-600-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-600-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-600-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-600-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-600-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-600-text-emphasis);
}

.list-group-item-gray-700 {
  --bs-list-group-color: var(--bs-gray-700-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-700-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-700-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-700-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-700-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-700-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-700-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-700-text-emphasis);
}

.list-group-item-gray-800 {
  --bs-list-group-color: var(--bs-gray-800-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-800-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-800-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-800-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-800-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-800-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-800-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-800-text-emphasis);
}

.list-group-item-gray-900 {
  --bs-list-group-color: var(--bs-gray-900-text-emphasis);
  --bs-list-group-bg: var(--bs-gray-900-bg-subtle);
  --bs-list-group-border-color: var(--bs-gray-900-border-subtle);
  --bs-list-group-action-hover-color: var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg: var(--bs-gray-900-border-subtle);
  --bs-list-group-action-active-color: var(--bs-emphasis-color);
  --bs-list-group-action-active-bg: var(--bs-gray-900-border-subtle);
  --bs-list-group-active-color: var(--bs-gray-900-bg-subtle);
  --bs-list-group-active-bg: var(--bs-gray-900-text-emphasis);
  --bs-list-group-active-border-color: var(--bs-gray-900-text-emphasis);
}

.btn-close {
  --bs-btn-close-color: #000;
  --bs-btn-close-bg: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%23000%27%3e%3cpath d=%27M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z%27/%3e%3c/svg%3e");
  --bs-btn-close-opacity: 0.5;
  --bs-btn-close-hover-opacity: 0.75;
  --bs-btn-close-focus-shadow: 0 0 0 0.25rem rgba(28, 193, 151, 0.25);
  --bs-btn-close-focus-opacity: 1;
  --bs-btn-close-disabled-opacity: 0.25;
  --bs-btn-close-white-filter: invert(1) grayscale(100%) brightness(200%);
  box-sizing: content-box;
  width: 1em;
  height: 1em;
  padding: 0.25em 0.25em;
  color: var(--bs-btn-close-color);
  background: transparent var(--bs-btn-close-bg) center/1em auto no-repeat;
  border: 0;
  border-radius: 0.375rem;
  opacity: var(--bs-btn-close-opacity);
}
.btn-close:hover {
  color: var(--bs-btn-close-color);
  text-decoration: none;
  opacity: var(--bs-btn-close-hover-opacity);
}
.btn-close:focus {
  outline: 0;
  box-shadow: var(--bs-btn-close-focus-shadow);
  opacity: var(--bs-btn-close-focus-opacity);
}
.btn-close:disabled, .btn-close.disabled {
  pointer-events: none;
  user-select: none;
  opacity: var(--bs-btn-close-disabled-opacity);
}

.btn-close-white {
  filter: var(--bs-btn-close-white-filter);
}

[data-bs-theme=dark] .btn-close {
  filter: var(--bs-btn-close-white-filter);
}

.toast {
  --bs-toast-zindex: 1090;
  --bs-toast-padding-x: 0.75rem;
  --bs-toast-padding-y: 0.5rem;
  --bs-toast-spacing: 1.5rem;
  --bs-toast-max-width: 350px;
  --bs-toast-font-size: 0.875rem;
  --bs-toast-color: ;
  --bs-toast-bg: rgba(var(--bs-body-bg-rgb), 0.85);
  --bs-toast-border-width: var(--bs-border-width);
  --bs-toast-border-color: var(--bs-border-color-translucent);
  --bs-toast-border-radius: var(--bs-border-radius);
  --bs-toast-box-shadow: var(--bs-box-shadow);
  --bs-toast-header-color: var(--bs-secondary-color);
  --bs-toast-header-bg: rgba(var(--bs-body-bg-rgb), 0.85);
  --bs-toast-header-border-color: var(--bs-border-color-translucent);
  width: var(--bs-toast-max-width);
  max-width: 100%;
  font-size: var(--bs-toast-font-size);
  color: var(--bs-toast-color);
  pointer-events: auto;
  background-color: var(--bs-toast-bg);
  background-clip: padding-box;
  border: var(--bs-toast-border-width) solid var(--bs-toast-border-color);
  box-shadow: var(--bs-toast-box-shadow);
  border-radius: var(--bs-toast-border-radius);
}
.toast.showing {
  opacity: 0;
}
.toast:not(.show) {
  display: none;
}

.toast-container {
  --bs-toast-zindex: 1090;
  position: absolute;
  z-index: var(--bs-toast-zindex);
  width: max-content;
  max-width: 100%;
  pointer-events: none;
}
.toast-container > :not(:last-child) {
  margin-bottom: var(--bs-toast-spacing);
}

.toast-header {
  display: flex;
  align-items: center;
  padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x);
  color: var(--bs-toast-header-color);
  background-color: var(--bs-toast-header-bg);
  background-clip: padding-box;
  border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);
  border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
  border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
}
.toast-header .btn-close {
  margin-right: calc(-0.5 * var(--bs-toast-padding-x));
  margin-left: var(--bs-toast-padding-x);
}

.toast-body {
  padding: var(--bs-toast-padding-x);
  word-wrap: break-word;
}

.modal {
  --bs-modal-zindex: 1055;
  --bs-modal-width: 500px;
  --bs-modal-padding: 1rem;
  --bs-modal-margin: 0.5rem;
  --bs-modal-color: ;
  --bs-modal-bg: var(--bs-body-bg);
  --bs-modal-border-color: var(--bs-border-color-translucent);
  --bs-modal-border-width: var(--bs-border-width);
  --bs-modal-border-radius: var(--bs-border-radius-lg);
  --bs-modal-box-shadow: var(--bs-box-shadow-sm);
  --bs-modal-inner-border-radius: calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));
  --bs-modal-header-padding-x: 1rem;
  --bs-modal-header-padding-y: 1rem;
  --bs-modal-header-padding: 1rem 1rem;
  --bs-modal-header-border-color: var(--bs-border-color);
  --bs-modal-header-border-width: var(--bs-border-width);
  --bs-modal-title-line-height: 1.5;
  --bs-modal-footer-gap: 0.5rem;
  --bs-modal-footer-bg: ;
  --bs-modal-footer-border-color: var(--bs-border-color);
  --bs-modal-footer-border-width: var(--bs-border-width);
  position: fixed;
  top: 0;
  left: 0;
  z-index: var(--bs-modal-zindex);
  display: none;
  width: 100%;
  height: 100%;
  overflow-x: hidden;
  overflow-y: auto;
  outline: 0;
}

.modal-dialog {
  position: relative;
  width: auto;
  margin: var(--bs-modal-margin);
  pointer-events: none;
}
.modal.fade .modal-dialog {
  transition: transform 0.3s ease-out;
  transform: translate(0, -50px);
}
@media (prefers-reduced-motion: reduce) {
  .modal.fade .modal-dialog {
    transition: none;
  }
}
.modal.show .modal-dialog {
  transform: none;
}
.modal.modal-static .modal-dialog {
  transform: scale(1.02);
}

.modal-dialog-scrollable {
  height: calc(100% - var(--bs-modal-margin) * 2);
}
.modal-dialog-scrollable .modal-content {
  max-height: 100%;
  overflow: hidden;
}
.modal-dialog-scrollable .modal-body {
  overflow-y: auto;
}

.modal-dialog-centered {
  display: flex;
  align-items: center;
  min-height: calc(100% - var(--bs-modal-margin) * 2);
}

.modal-content {
  position: relative;
  display: flex;
  flex-direction: column;
  width: 100%;
  color: var(--bs-modal-color);
  pointer-events: auto;
  background-color: var(--bs-modal-bg);
  background-clip: padding-box;
  border: var(--bs-modal-border-width) solid var(--bs-modal-border-color);
  border-radius: var(--bs-modal-border-radius);
  outline: 0;
}

.modal-backdrop {
  --bs-backdrop-zindex: 1050;
  --bs-backdrop-bg: #000;
  --bs-backdrop-opacity: 0.5;
  position: fixed;
  top: 0;
  left: 0;
  z-index: var(--bs-backdrop-zindex);
  width: 100vw;
  height: 100vh;
  background-color: var(--bs-backdrop-bg);
}
.modal-backdrop.fade {
  opacity: 0;
}
.modal-backdrop.show {
  opacity: var(--bs-backdrop-opacity);
}

.modal-header {
  display: flex;
  flex-shrink: 0;
  align-items: center;
  padding: var(--bs-modal-header-padding);
  border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);
  border-top-left-radius: var(--bs-modal-inner-border-radius);
  border-top-right-radius: var(--bs-modal-inner-border-radius);
}
.modal-header .btn-close {
  padding: calc(var(--bs-modal-header-padding-y) * 0.5) calc(var(--bs-modal-header-padding-x) * 0.5);
  margin: calc(-0.5 * var(--bs-modal-header-padding-y)) calc(-0.5 * var(--bs-modal-header-padding-x)) calc(-0.5 * var(--bs-modal-header-padding-y)) auto;
}

.modal-title {
  margin-bottom: 0;
  line-height: var(--bs-modal-title-line-height);
}

.modal-body {
  position: relative;
  flex: 1 1 auto;
  padding: var(--bs-modal-padding);
}

.modal-footer {
  display: flex;
  flex-shrink: 0;
  flex-wrap: wrap;
  align-items: center;
  justify-content: flex-end;
  padding: calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * 0.5);
  background-color: var(--bs-modal-footer-bg);
  border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);
  border-bottom-right-radius: var(--bs-modal-inner-border-radius);
  border-bottom-left-radius: var(--bs-modal-inner-border-radius);
}
.modal-footer > * {
  margin: calc(var(--bs-modal-footer-gap) * 0.5);
}

@media (min-width: 576px) {
  .modal {
    --bs-modal-margin: 1.75rem;
    --bs-modal-box-shadow: var(--bs-box-shadow);
  }
  .modal-dialog {
    max-width: var(--bs-modal-width);
    margin-right: auto;
    margin-left: auto;
  }
  .modal-sm {
    --bs-modal-width: 300px;
  }
}
@media (min-width: 992px) {
  .modal-lg,
  .modal-xl {
    --bs-modal-width: 800px;
  }
}
@media (min-width: 1200px) {
  .modal-xl {
    --bs-modal-width: 1140px;
  }
}
.modal-fullscreen {
  width: 100vw;
  max-width: none;
  height: 100%;
  margin: 0;
}
.modal-fullscreen .modal-content {
  height: 100%;
  border: 0;
  border-radius: 0;
}
.modal-fullscreen .modal-header,
.modal-fullscreen .modal-footer {
  border-radius: 0;
}
.modal-fullscreen .modal-body {
  overflow-y: auto;
}

@media (max-width: 575.98px) {
  .modal-fullscreen-sm-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-sm-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-sm-down .modal-header,
  .modal-fullscreen-sm-down .modal-footer {
    border-radius: 0;
  }
  .modal-fullscreen-sm-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 767.98px) {
  .modal-fullscreen-md-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-md-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-md-down .modal-header,
  .modal-fullscreen-md-down .modal-footer {
    border-radius: 0;
  }
  .modal-fullscreen-md-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 991.98px) {
  .modal-fullscreen-lg-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-lg-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-lg-down .modal-header,
  .modal-fullscreen-lg-down .modal-footer {
    border-radius: 0;
  }
  .modal-fullscreen-lg-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 1199.98px) {
  .modal-fullscreen-xl-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-xl-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-xl-down .modal-header,
  .modal-fullscreen-xl-down .modal-footer {
    border-radius: 0;
  }
  .modal-fullscreen-xl-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 1399.98px) {
  .modal-fullscreen-xxl-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-xxl-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-xxl-down .modal-header,
  .modal-fullscreen-xxl-down .modal-footer {
    border-radius: 0;
  }
  .modal-fullscreen-xxl-down .modal-body {
    overflow-y: auto;
  }
}
.tooltip {
  --bs-tooltip-zindex: 1080;
  --bs-tooltip-max-width: 200px;
  --bs-tooltip-padding-x: 0.5rem;
  --bs-tooltip-padding-y: 0.25rem;
  --bs-tooltip-margin: ;
  --bs-tooltip-font-size: 0.875rem;
  --bs-tooltip-color: var(--bs-body-bg);
  --bs-tooltip-bg: var(--bs-emphasis-color);
  --bs-tooltip-border-radius: var(--bs-border-radius);
  --bs-tooltip-opacity: 0.9;
  --bs-tooltip-arrow-width: 0.8rem;
  --bs-tooltip-arrow-height: 0.4rem;
  z-index: var(--bs-tooltip-zindex);
  display: block;
  margin: var(--bs-tooltip-margin);
  font-family: var(--bs-font-sans-serif);
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  white-space: normal;
  word-spacing: normal;
  line-break: auto;
  font-size: var(--bs-tooltip-font-size);
  word-wrap: break-word;
  opacity: 0;
}
.tooltip.show {
  opacity: var(--bs-tooltip-opacity);
}
.tooltip .tooltip-arrow {
  display: block;
  width: var(--bs-tooltip-arrow-width);
  height: var(--bs-tooltip-arrow-height);
}
.tooltip .tooltip-arrow::before {
  position: absolute;
  content: "";
  border-color: transparent;
  border-style: solid;
}

.bs-tooltip-top .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow {
  bottom: calc(-1 * var(--bs-tooltip-arrow-height));
}
.bs-tooltip-top .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before {
  top: -1px;
  border-width: var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * 0.5) 0;
  border-top-color: var(--bs-tooltip-bg);
}

/* rtl:begin:ignore */
.bs-tooltip-end .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow {
  left: calc(-1 * var(--bs-tooltip-arrow-height));
  width: var(--bs-tooltip-arrow-height);
  height: var(--bs-tooltip-arrow-width);
}
.bs-tooltip-end .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before {
  right: -1px;
  border-width: calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * 0.5) 0;
  border-right-color: var(--bs-tooltip-bg);
}

/* rtl:end:ignore */
.bs-tooltip-bottom .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow {
  top: calc(-1 * var(--bs-tooltip-arrow-height));
}
.bs-tooltip-bottom .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before {
  bottom: -1px;
  border-width: 0 calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height);
  border-bottom-color: var(--bs-tooltip-bg);
}

/* rtl:begin:ignore */
.bs-tooltip-start .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow {
  right: calc(-1 * var(--bs-tooltip-arrow-height));
  width: var(--bs-tooltip-arrow-height);
  height: var(--bs-tooltip-arrow-width);
}
.bs-tooltip-start .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before {
  left: -1px;
  border-width: calc(var(--bs-tooltip-arrow-width) * 0.5) 0 calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height);
  border-left-color: var(--bs-tooltip-bg);
}

/* rtl:end:ignore */
.tooltip-inner {
  max-width: var(--bs-tooltip-max-width);
  padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);
  color: var(--bs-tooltip-color);
  text-align: center;
  background-color: var(--bs-tooltip-bg);
  border-radius: var(--bs-tooltip-border-radius);
}

.popover {
  --bs-popover-zindex: 1070;
  --bs-popover-max-width: 276px;
  --bs-popover-font-size: 0.875rem;
  --bs-popover-bg: var(--bs-body-bg);
  --bs-popover-border-width: var(--bs-border-width);
  --bs-popover-border-color: var(--bs-border-color-translucent);
  --bs-popover-border-radius: var(--bs-border-radius-lg);
  --bs-popover-inner-border-radius: calc(var(--bs-border-radius-lg) - var(--bs-border-width));
  --bs-popover-box-shadow: var(--bs-box-shadow);
  --bs-popover-header-padding-x: 1rem;
  --bs-popover-header-padding-y: 0.5rem;
  --bs-popover-header-font-size: 1rem;
  --bs-popover-header-color: inherit;
  --bs-popover-header-bg: var(--bs-secondary-bg);
  --bs-popover-body-padding-x: 1rem;
  --bs-popover-body-padding-y: 1rem;
  --bs-popover-body-color: var(--bs-body-color);
  --bs-popover-arrow-width: 1rem;
  --bs-popover-arrow-height: 0.5rem;
  --bs-popover-arrow-border: var(--bs-popover-border-color);
  z-index: var(--bs-popover-zindex);
  display: block;
  max-width: var(--bs-popover-max-width);
  font-family: var(--bs-font-sans-serif);
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  white-space: normal;
  word-spacing: normal;
  line-break: auto;
  font-size: var(--bs-popover-font-size);
  word-wrap: break-word;
  background-color: var(--bs-popover-bg);
  background-clip: padding-box;
  border: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
  border-radius: var(--bs-popover-border-radius);
}
.popover .popover-arrow {
  display: block;
  width: var(--bs-popover-arrow-width);
  height: var(--bs-popover-arrow-height);
}
.popover .popover-arrow::before, .popover .popover-arrow::after {
  position: absolute;
  display: block;
  content: "";
  border-color: transparent;
  border-style: solid;
  border-width: 0;
}

.bs-popover-top > .popover-arrow, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow {
  bottom: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
}
.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before, .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after {
  border-width: var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * 0.5) 0;
}
.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before {
  bottom: 0;
  border-top-color: var(--bs-popover-arrow-border);
}
.bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after {
  bottom: var(--bs-popover-border-width);
  border-top-color: var(--bs-popover-bg);
}

/* rtl:begin:ignore */
.bs-popover-end > .popover-arrow, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow {
  left: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
  width: var(--bs-popover-arrow-height);
  height: var(--bs-popover-arrow-width);
}
.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before, .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after {
  border-width: calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * 0.5) 0;
}
.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before {
  left: 0;
  border-right-color: var(--bs-popover-arrow-border);
}
.bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after {
  left: var(--bs-popover-border-width);
  border-right-color: var(--bs-popover-bg);
}

/* rtl:end:ignore */
.bs-popover-bottom > .popover-arrow, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow {
  top: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
}
.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after {
  border-width: 0 calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height);
}
.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before {
  top: 0;
  border-bottom-color: var(--bs-popover-arrow-border);
}
.bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after {
  top: var(--bs-popover-border-width);
  border-bottom-color: var(--bs-popover-bg);
}
.bs-popover-bottom .popover-header::before, .bs-popover-auto[data-popper-placement^=bottom] .popover-header::before {
  position: absolute;
  top: 0;
  left: 50%;
  display: block;
  width: var(--bs-popover-arrow-width);
  margin-left: calc(-0.5 * var(--bs-popover-arrow-width));
  content: "";
  border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg);
}

/* rtl:begin:ignore */
.bs-popover-start > .popover-arrow, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow {
  right: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
  width: var(--bs-popover-arrow-height);
  height: var(--bs-popover-arrow-width);
}
.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before, .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after {
  border-width: calc(var(--bs-popover-arrow-width) * 0.5) 0 calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height);
}
.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before {
  right: 0;
  border-left-color: var(--bs-popover-arrow-border);
}
.bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after {
  right: var(--bs-popover-border-width);
  border-left-color: var(--bs-popover-bg);
}

/* rtl:end:ignore */
.popover-header {
  padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);
  margin-bottom: 0;
  font-size: var(--bs-popover-header-font-size);
  color: var(--bs-popover-header-color);
  background-color: var(--bs-popover-header-bg);
  border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
  border-top-left-radius: var(--bs-popover-inner-border-radius);
  border-top-right-radius: var(--bs-popover-inner-border-radius);
}
.popover-header:empty {
  display: none;
}

.popover-body {
  padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);
  color: var(--bs-popover-body-color);
}

.carousel {
  position: relative;
}

.carousel.pointer-event {
  touch-action: pan-y;
}

.carousel-inner {
  position: relative;
  width: 100%;
  overflow: hidden;
}
.carousel-inner::after {
  display: block;
  clear: both;
  content: "";
}

.carousel-item {
  position: relative;
  display: none;
  float: left;
  width: 100%;
  margin-right: -100%;
  backface-visibility: hidden;
  transition: transform 0.6s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-item {
    transition: none;
  }
}

.carousel-item.active,
.carousel-item-next,
.carousel-item-prev {
  display: block;
}

.carousel-item-next:not(.carousel-item-start),
.active.carousel-item-end {
  transform: translateX(100%);
}

.carousel-item-prev:not(.carousel-item-end),
.active.carousel-item-start {
  transform: translateX(-100%);
}

.carousel-fade .carousel-item {
  opacity: 0;
  transition-property: opacity;
  transform: none;
}
.carousel-fade .carousel-item.active,
.carousel-fade .carousel-item-next.carousel-item-start,
.carousel-fade .carousel-item-prev.carousel-item-end {
  z-index: 1;
  opacity: 1;
}
.carousel-fade .active.carousel-item-start,
.carousel-fade .active.carousel-item-end {
  z-index: 0;
  opacity: 0;
  transition: opacity 0s 0.6s;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-fade .active.carousel-item-start,
  .carousel-fade .active.carousel-item-end {
    transition: none;
  }
}

.carousel-control-prev,
.carousel-control-next {
  position: absolute;
  top: 0;
  bottom: 0;
  z-index: 1;
  display: flex;
  align-items: center;
  justify-content: center;
  width: 15%;
  padding: 0;
  color: #fff;
  text-align: center;
  background: none;
  border: 0;
  opacity: 0.5;
  transition: opacity 0.15s ease;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-control-prev,
  .carousel-control-next {
    transition: none;
  }
}
.carousel-control-prev:hover, .carousel-control-prev:focus,
.carousel-control-next:hover,
.carousel-control-next:focus {
  color: #fff;
  text-decoration: none;
  outline: 0;
  opacity: 0.9;
}

.carousel-control-prev {
  left: 0;
}

.carousel-control-next {
  right: 0;
}

.carousel-control-prev-icon,
.carousel-control-next-icon {
  display: inline-block;
  width: 2rem;
  height: 2rem;
  background-repeat: no-repeat;
  background-position: 50%;
  background-size: 100% 100%;
}

.carousel-control-prev-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%23fff%27%3e%3cpath d=%27M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z%27/%3e%3c/svg%3e") /*rtl:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")*/;
}

.carousel-control-next-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns=%27http://www.w3.org/2000/svg%27 viewBox=%270 0 16 16%27 fill=%27%23fff%27%3e%3cpath d=%27M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z%27/%3e%3c/svg%3e") /*rtl:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")*/;
}

.carousel-indicators {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 2;
  display: flex;
  justify-content: center;
  padding: 0;
  margin-right: 15%;
  margin-bottom: 1rem;
  margin-left: 15%;
}
.carousel-indicators [data-bs-target] {
  box-sizing: content-box;
  flex: 0 1 auto;
  width: 30px;
  height: 3px;
  padding: 0;
  margin-right: 3px;
  margin-left: 3px;
  text-indent: -999px;
  cursor: pointer;
  background-color: #fff;
  background-clip: padding-box;
  border: 0;
  border-top: 10px solid transparent;
  border-bottom: 10px solid transparent;
  opacity: 0.5;
  transition: opacity 0.6s ease;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-indicators [data-bs-target] {
    transition: none;
  }
}
.carousel-indicators .active {
  opacity: 1;
}

.carousel-caption {
  position: absolute;
  right: 15%;
  bottom: 1.25rem;
  left: 15%;
  padding-top: 1.25rem;
  padding-bottom: 1.25rem;
  color: #fff;
  text-align: center;
}

.carousel-dark .carousel-control-prev-icon,
.carousel-dark .carousel-control-next-icon {
  filter: invert(1) grayscale(100);
}
.carousel-dark .carousel-indicators [data-bs-target] {
  background-color: #000;
}
.carousel-dark .carousel-caption {
  color: #000;
}

[data-bs-theme=dark] .carousel .carousel-control-prev-icon,
[data-bs-theme=dark] .carousel .carousel-control-next-icon, [data-bs-theme=dark].carousel .carousel-control-prev-icon,
[data-bs-theme=dark].carousel .carousel-control-next-icon {
  filter: invert(1) grayscale(100);
}
[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target], [data-bs-theme=dark].carousel .carousel-indicators [data-bs-target] {
  background-color: #000;
}
[data-bs-theme=dark] .carousel .carousel-caption, [data-bs-theme=dark].carousel .carousel-caption {
  color: #000;
}

.spinner-grow,
.spinner-border {
  display: inline-block;
  width: var(--bs-spinner-width);
  height: var(--bs-spinner-height);
  vertical-align: var(--bs-spinner-vertical-align);
  border-radius: 50%;
  animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);
}

@keyframes spinner-border {
  to {
    transform: rotate(360deg) /* rtl:ignore */;
  }
}
.spinner-border {
  --bs-spinner-width: 2rem;
  --bs-spinner-height: 2rem;
  --bs-spinner-vertical-align: -0.125em;
  --bs-spinner-border-width: 0.25em;
  --bs-spinner-animation-speed: 0.75s;
  --bs-spinner-animation-name: spinner-border;
  border: var(--bs-spinner-border-width) solid currentcolor;
  border-right-color: transparent;
}

.spinner-border-sm {
  --bs-spinner-width: 1rem;
  --bs-spinner-height: 1rem;
  --bs-spinner-border-width: 0.2em;
}

@keyframes spinner-grow {
  0% {
    transform: scale(0);
  }
  50% {
    opacity: 1;
    transform: none;
  }
}
.spinner-grow {
  --bs-spinner-width: 2rem;
  --bs-spinner-height: 2rem;
  --bs-spinner-vertical-align: -0.125em;
  --bs-spinner-animation-speed: 0.75s;
  --bs-spinner-animation-name: spinner-grow;
  background-color: currentcolor;
  opacity: 0;
}

.spinner-grow-sm {
  --bs-spinner-width: 1rem;
  --bs-spinner-height: 1rem;
}

@media (prefers-reduced-motion: reduce) {
  .spinner-border,
  .spinner-grow {
    --bs-spinner-animation-speed: 1.5s;
  }
}
.offcanvas, .offcanvas-xxl, .offcanvas-xl, .offcanvas-lg, .offcanvas-md, .offcanvas-sm {
  --bs-offcanvas-zindex: 1045;
  --bs-offcanvas-width: 400px;
  --bs-offcanvas-height: 30vh;
  --bs-offcanvas-padding-x: 1rem;
  --bs-offcanvas-padding-y: 1rem;
  --bs-offcanvas-color: var(--bs-body-color);
  --bs-offcanvas-bg: var(--bs-body-bg);
  --bs-offcanvas-border-width: var(--bs-border-width);
  --bs-offcanvas-border-color: var(--bs-border-color-translucent);
  --bs-offcanvas-box-shadow: var(--bs-box-shadow-sm);
  --bs-offcanvas-transition: transform 0.3s ease-in-out;
  --bs-offcanvas-title-line-height: 1.5;
}

@media (max-width: 575.98px) {
  .offcanvas-sm {
    position: fixed;
    bottom: 0;
    z-index: var(--bs-offcanvas-zindex);
    display: flex;
    flex-direction: column;
    max-width: 100%;
    color: var(--bs-offcanvas-color);
    visibility: hidden;
    background-color: var(--bs-offcanvas-bg);
    background-clip: padding-box;
    outline: 0;
    transition: var(--bs-offcanvas-transition);
  }
}
@media (max-width: 575.98px) and (prefers-reduced-motion: reduce) {
  .offcanvas-sm {
    transition: none;
  }
}
@media (max-width: 575.98px) {
  .offcanvas-sm.offcanvas-start {
    top: 0;
    left: 0;
    width: var(--bs-offcanvas-width);
    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(-100%);
  }
  .offcanvas-sm.offcanvas-end {
    top: 0;
    right: 0;
    width: var(--bs-offcanvas-width);
    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(100%);
  }
  .offcanvas-sm.offcanvas-top {
    top: 0;
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(-100%);
  }
  .offcanvas-sm.offcanvas-bottom {
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(100%);
  }
  .offcanvas-sm.showing, .offcanvas-sm.show:not(.hiding) {
    transform: none;
  }
  .offcanvas-sm.showing, .offcanvas-sm.hiding, .offcanvas-sm.show {
    visibility: visible;
  }
}
@media (min-width: 576px) {
  .offcanvas-sm {
    --bs-offcanvas-height: auto;
    --bs-offcanvas-border-width: 0;
    background-color: transparent !important;
  }
  .offcanvas-sm .offcanvas-header {
    display: none;
  }
  .offcanvas-sm .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
    background-color: transparent !important;
  }
}

@media (max-width: 767.98px) {
  .offcanvas-md {
    position: fixed;
    bottom: 0;
    z-index: var(--bs-offcanvas-zindex);
    display: flex;
    flex-direction: column;
    max-width: 100%;
    color: var(--bs-offcanvas-color);
    visibility: hidden;
    background-color: var(--bs-offcanvas-bg);
    background-clip: padding-box;
    outline: 0;
    transition: var(--bs-offcanvas-transition);
  }
}
@media (max-width: 767.98px) and (prefers-reduced-motion: reduce) {
  .offcanvas-md {
    transition: none;
  }
}
@media (max-width: 767.98px) {
  .offcanvas-md.offcanvas-start {
    top: 0;
    left: 0;
    width: var(--bs-offcanvas-width);
    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(-100%);
  }
  .offcanvas-md.offcanvas-end {
    top: 0;
    right: 0;
    width: var(--bs-offcanvas-width);
    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(100%);
  }
  .offcanvas-md.offcanvas-top {
    top: 0;
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(-100%);
  }
  .offcanvas-md.offcanvas-bottom {
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(100%);
  }
  .offcanvas-md.showing, .offcanvas-md.show:not(.hiding) {
    transform: none;
  }
  .offcanvas-md.showing, .offcanvas-md.hiding, .offcanvas-md.show {
    visibility: visible;
  }
}
@media (min-width: 768px) {
  .offcanvas-md {
    --bs-offcanvas-height: auto;
    --bs-offcanvas-border-width: 0;
    background-color: transparent !important;
  }
  .offcanvas-md .offcanvas-header {
    display: none;
  }
  .offcanvas-md .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
    background-color: transparent !important;
  }
}

@media (max-width: 991.98px) {
  .offcanvas-lg {
    position: fixed;
    bottom: 0;
    z-index: var(--bs-offcanvas-zindex);
    display: flex;
    flex-direction: column;
    max-width: 100%;
    color: var(--bs-offcanvas-color);
    visibility: hidden;
    background-color: var(--bs-offcanvas-bg);
    background-clip: padding-box;
    outline: 0;
    transition: var(--bs-offcanvas-transition);
  }
}
@media (max-width: 991.98px) and (prefers-reduced-motion: reduce) {
  .offcanvas-lg {
    transition: none;
  }
}
@media (max-width: 991.98px) {
  .offcanvas-lg.offcanvas-start {
    top: 0;
    left: 0;
    width: var(--bs-offcanvas-width);
    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(-100%);
  }
  .offcanvas-lg.offcanvas-end {
    top: 0;
    right: 0;
    width: var(--bs-offcanvas-width);
    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(100%);
  }
  .offcanvas-lg.offcanvas-top {
    top: 0;
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(-100%);
  }
  .offcanvas-lg.offcanvas-bottom {
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(100%);
  }
  .offcanvas-lg.showing, .offcanvas-lg.show:not(.hiding) {
    transform: none;
  }
  .offcanvas-lg.showing, .offcanvas-lg.hiding, .offcanvas-lg.show {
    visibility: visible;
  }
}
@media (min-width: 992px) {
  .offcanvas-lg {
    --bs-offcanvas-height: auto;
    --bs-offcanvas-border-width: 0;
    background-color: transparent !important;
  }
  .offcanvas-lg .offcanvas-header {
    display: none;
  }
  .offcanvas-lg .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
    background-color: transparent !important;
  }
}

@media (max-width: 1199.98px) {
  .offcanvas-xl {
    position: fixed;
    bottom: 0;
    z-index: var(--bs-offcanvas-zindex);
    display: flex;
    flex-direction: column;
    max-width: 100%;
    color: var(--bs-offcanvas-color);
    visibility: hidden;
    background-color: var(--bs-offcanvas-bg);
    background-clip: padding-box;
    outline: 0;
    transition: var(--bs-offcanvas-transition);
  }
}
@media (max-width: 1199.98px) and (prefers-reduced-motion: reduce) {
  .offcanvas-xl {
    transition: none;
  }
}
@media (max-width: 1199.98px) {
  .offcanvas-xl.offcanvas-start {
    top: 0;
    left: 0;
    width: var(--bs-offcanvas-width);
    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(-100%);
  }
  .offcanvas-xl.offcanvas-end {
    top: 0;
    right: 0;
    width: var(--bs-offcanvas-width);
    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(100%);
  }
  .offcanvas-xl.offcanvas-top {
    top: 0;
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(-100%);
  }
  .offcanvas-xl.offcanvas-bottom {
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(100%);
  }
  .offcanvas-xl.showing, .offcanvas-xl.show:not(.hiding) {
    transform: none;
  }
  .offcanvas-xl.showing, .offcanvas-xl.hiding, .offcanvas-xl.show {
    visibility: visible;
  }
}
@media (min-width: 1200px) {
  .offcanvas-xl {
    --bs-offcanvas-height: auto;
    --bs-offcanvas-border-width: 0;
    background-color: transparent !important;
  }
  .offcanvas-xl .offcanvas-header {
    display: none;
  }
  .offcanvas-xl .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
    background-color: transparent !important;
  }
}

@media (max-width: 1399.98px) {
  .offcanvas-xxl {
    position: fixed;
    bottom: 0;
    z-index: var(--bs-offcanvas-zindex);
    display: flex;
    flex-direction: column;
    max-width: 100%;
    color: var(--bs-offcanvas-color);
    visibility: hidden;
    background-color: var(--bs-offcanvas-bg);
    background-clip: padding-box;
    outline: 0;
    transition: var(--bs-offcanvas-transition);
  }
}
@media (max-width: 1399.98px) and (prefers-reduced-motion: reduce) {
  .offcanvas-xxl {
    transition: none;
  }
}
@media (max-width: 1399.98px) {
  .offcanvas-xxl.offcanvas-start {
    top: 0;
    left: 0;
    width: var(--bs-offcanvas-width);
    border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(-100%);
  }
  .offcanvas-xxl.offcanvas-end {
    top: 0;
    right: 0;
    width: var(--bs-offcanvas-width);
    border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateX(100%);
  }
  .offcanvas-xxl.offcanvas-top {
    top: 0;
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(-100%);
  }
  .offcanvas-xxl.offcanvas-bottom {
    right: 0;
    left: 0;
    height: var(--bs-offcanvas-height);
    max-height: 100%;
    border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
    transform: translateY(100%);
  }
  .offcanvas-xxl.showing, .offcanvas-xxl.show:not(.hiding) {
    transform: none;
  }
  .offcanvas-xxl.showing, .offcanvas-xxl.hiding, .offcanvas-xxl.show {
    visibility: visible;
  }
}
@media (min-width: 1400px) {
  .offcanvas-xxl {
    --bs-offcanvas-height: auto;
    --bs-offcanvas-border-width: 0;
    background-color: transparent !important;
  }
  .offcanvas-xxl .offcanvas-header {
    display: none;
  }
  .offcanvas-xxl .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
    background-color: transparent !important;
  }
}

.offcanvas {
  position: fixed;
  bottom: 0;
  z-index: var(--bs-offcanvas-zindex);
  display: flex;
  flex-direction: column;
  max-width: 100%;
  color: var(--bs-offcanvas-color);
  visibility: hidden;
  background-color: var(--bs-offcanvas-bg);
  background-clip: padding-box;
  outline: 0;
  transition: var(--bs-offcanvas-transition);
}
@media (prefers-reduced-motion: reduce) {
  .offcanvas {
    transition: none;
  }
}
.offcanvas.offcanvas-start {
  top: 0;
  left: 0;
  width: var(--bs-offcanvas-width);
  border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateX(-100%);
}
.offcanvas.offcanvas-end {
  top: 0;
  right: 0;
  width: var(--bs-offcanvas-width);
  border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateX(100%);
}
.offcanvas.offcanvas-top {
  top: 0;
  right: 0;
  left: 0;
  height: var(--bs-offcanvas-height);
  max-height: 100%;
  border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateY(-100%);
}
.offcanvas.offcanvas-bottom {
  right: 0;
  left: 0;
  height: var(--bs-offcanvas-height);
  max-height: 100%;
  border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateY(100%);
}
.offcanvas.showing, .offcanvas.show:not(.hiding) {
  transform: none;
}
.offcanvas.showing, .offcanvas.hiding, .offcanvas.show {
  visibility: visible;
}

.offcanvas-backdrop {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1040;
  width: 100vw;
  height: 100vh;
  background-color: #000;
}
.offcanvas-backdrop.fade {
  opacity: 0;
}
.offcanvas-backdrop.show {
  opacity: 0.5;
}

.offcanvas-header {
  display: flex;
  align-items: center;
  padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
}
.offcanvas-header .btn-close {
  padding: calc(var(--bs-offcanvas-padding-y) * 0.5) calc(var(--bs-offcanvas-padding-x) * 0.5);
  margin: calc(-0.5 * var(--bs-offcanvas-padding-y)) calc(-0.5 * var(--bs-offcanvas-padding-x)) calc(-0.5 * var(--bs-offcanvas-padding-y)) auto;
}

.offcanvas-title {
  margin-bottom: 0;
  line-height: var(--bs-offcanvas-title-line-height);
}

.offcanvas-body {
  flex-grow: 1;
  padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
  overflow-y: auto;
}

.placeholder {
  display: inline-block;
  min-height: 1em;
  vertical-align: middle;
  cursor: wait;
  background-color: currentcolor;
  opacity: 0.5;
}
.placeholder.btn::before {
  display: inline-block;
  content: "";
}

.placeholder-xs {
  min-height: 0.6em;
}

.placeholder-sm {
  min-height: 0.8em;
}

.placeholder-lg {
  min-height: 1.2em;
}

.placeholder-glow .placeholder {
  animation: placeholder-glow 2s ease-in-out infinite;
}

@keyframes placeholder-glow {
  50% {
    opacity: 0.2;
  }
}
.placeholder-wave {
  mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);
  mask-size: 200% 100%;
  animation: placeholder-wave 2s linear infinite;
}

@keyframes placeholder-wave {
  100% {
    mask-position: -200% 0%;
  }
}
.clearfix::after {
  display: block;
  clear: both;
  content: "";
}

.text-bg-primary {
  color: #000 !important;
  background-color: RGBA(var(--bs-primary-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-100 {
  color: #000 !important;
  background-color: RGBA(var(--bs-gray-100-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-200 {
  color: #000 !important;
  background-color: RGBA(var(--bs-gray-200-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-300 {
  color: #000 !important;
  background-color: RGBA(var(--bs-gray-300-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-400 {
  color: #000 !important;
  background-color: RGBA(var(--bs-gray-400-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-500 {
  color: #000 !important;
  background-color: RGBA(var(--bs-gray-500-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-600 {
  color: #fff !important;
  background-color: RGBA(var(--bs-gray-600-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-700 {
  color: #fff !important;
  background-color: RGBA(var(--bs-gray-700-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-800 {
  color: #fff !important;
  background-color: RGBA(var(--bs-gray-800-rgb), var(--bs-bg-opacity, 1)) !important;
}

.text-bg-gray-900 {
  color: #fff !important;
  background-color: RGBA(var(--bs-gray-900-rgb), var(--bs-bg-opacity, 1)) !important;
}

.link-primary {
  color: RGBA(var(--bs-primary-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-primary:hover, .link-primary:focus {
  color: RGBA(73, 205, 172, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(73, 205, 172, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-100 {
  color: RGBA(var(--bs-gray-100-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-100-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-100:hover, .link-gray-100:focus {
  color: RGBA(249, 250, 251, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(249, 250, 251, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-200 {
  color: RGBA(var(--bs-gray-200-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-200-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-200:hover, .link-gray-200:focus {
  color: RGBA(237, 240, 242, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(237, 240, 242, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-300 {
  color: RGBA(var(--bs-gray-300-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-300-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-300:hover, .link-gray-300:focus {
  color: RGBA(229, 232, 235, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(229, 232, 235, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-400 {
  color: RGBA(var(--bs-gray-400-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-400-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-400:hover, .link-gray-400:focus {
  color: RGBA(216, 221, 225, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(216, 221, 225, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-500 {
  color: RGBA(var(--bs-gray-500-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-500-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-500:hover, .link-gray-500:focus {
  color: RGBA(189, 196, 202, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(189, 196, 202, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-600 {
  color: RGBA(var(--bs-gray-600-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-600-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-600:hover, .link-gray-600:focus {
  color: RGBA(86, 94, 100, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(86, 94, 100, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-700 {
  color: RGBA(var(--bs-gray-700-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-700-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-700:hover, .link-gray-700:focus {
  color: RGBA(58, 64, 70, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(58, 64, 70, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-800 {
  color: RGBA(var(--bs-gray-800-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-800-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-800:hover, .link-gray-800:focus {
  color: RGBA(42, 46, 51, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(42, 46, 51, var(--bs-link-underline-opacity, 1)) !important;
}

.link-gray-900 {
  color: RGBA(var(--bs-gray-900-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-gray-900-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-gray-900:hover, .link-gray-900:focus {
  color: RGBA(26, 30, 33, var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(26, 30, 33, var(--bs-link-underline-opacity, 1)) !important;
}

.link-body-emphasis {
  color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 1)) !important;
  text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
}
.link-body-emphasis:hover, .link-body-emphasis:focus {
  color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 0.75)) !important;
  text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 0.75)) !important;
}

.focus-ring:focus {
  outline: 0;
  box-shadow: var(--bs-focus-ring-x, 0) var(--bs-focus-ring-y, 0) var(--bs-focus-ring-blur, 0) var(--bs-focus-ring-width) var(--bs-focus-ring-color);
}

.icon-link {
  display: inline-flex;
  gap: 0.375rem;
  align-items: center;
  text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 0.5));
  text-underline-offset: 0.25em;
  backface-visibility: hidden;
}
.icon-link > .bi {
  flex-shrink: 0;
  width: 1em;
  height: 1em;
  fill: currentcolor;
  transition: 0.2s ease-in-out transform;
}
@media (prefers-reduced-motion: reduce) {
  .icon-link > .bi {
    transition: none;
  }
}

.icon-link-hover:hover > .bi, .icon-link-hover:focus-visible > .bi {
  transform: var(--bs-icon-link-transform, translate3d(0.25em, 0, 0));
}

.ratio {
  position: relative;
  width: 100%;
}
.ratio::before {
  display: block;
  padding-top: var(--bs-aspect-ratio);
  content: "";
}
.ratio > * {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}

.ratio-1x1 {
  --bs-aspect-ratio: 100%;
}

.ratio-4x3 {
  --bs-aspect-ratio: 75%;
}

.ratio-16x9 {
  --bs-aspect-ratio: 56.25%;
}

.ratio-21x9 {
  --bs-aspect-ratio: 42.8571428571%;
}

.fixed-top {
  position: fixed;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1030;
}

.fixed-bottom {
  position: fixed;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1030;
}

.sticky-top {
  position: sticky;
  top: 0;
  z-index: 1020;
}

.sticky-bottom {
  position: sticky;
  bottom: 0;
  z-index: 1020;
}

@media (min-width: 576px) {
  .sticky-sm-top {
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-sm-bottom {
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 768px) {
  .sticky-md-top {
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-md-bottom {
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 992px) {
  .sticky-lg-top {
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-lg-bottom {
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 1200px) {
  .sticky-xl-top {
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-xl-bottom {
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 1400px) {
  .sticky-xxl-top {
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-xxl-bottom {
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
.hstack {
  display: flex;
  flex-direction: row;
  align-items: center;
  align-self: stretch;
}

.vstack {
  display: flex;
  flex: 1 1 auto;
  flex-direction: column;
  align-self: stretch;
}

.visually-hidden,
.visually-hidden-focusable:not(:focus):not(:focus-within) {
  width: 1px !important;
  height: 1px !important;
  padding: 0 !important;
  margin: -1px !important;
  overflow: hidden !important;
  clip: rect(0, 0, 0, 0) !important;
  white-space: nowrap !important;
  border: 0 !important;
}
.visually-hidden:not(caption),
.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption) {
  position: absolute !important;
}

.stretched-link::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1;
  content: "";
}

.text-truncate {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.vr {
  display: inline-block;
  align-self: stretch;
  width: var(--bs-border-width);
  min-height: 1em;
  background-color: currentcolor;
  opacity: 0.25;
}

.align-baseline {
  vertical-align: baseline !important;
}

.align-top {
  vertical-align: top !important;
}

.align-middle {
  vertical-align: middle !important;
}

.align-bottom {
  vertical-align: bottom !important;
}

.align-text-bottom {
  vertical-align: text-bottom !important;
}

.align-text-top {
  vertical-align: text-top !important;
}

.float-start {
  float: left !important;
}

.float-end {
  float: right !important;
}

.float-none {
  float: none !important;
}

.object-fit-contain {
  object-fit: contain !important;
}

.object-fit-cover {
  object-fit: cover !important;
}

.object-fit-fill {
  object-fit: fill !important;
}

.object-fit-scale {
  object-fit: scale-down !important;
}

.object-fit-none {
  object-fit: none !important;
}

.opacity-0 {
  opacity: 0 !important;
}

.opacity-25 {
  opacity: 0.25 !important;
}

.opacity-50 {
  opacity: 0.5 !important;
}

.opacity-75 {
  opacity: 0.75 !important;
}

.opacity-100 {
  opacity: 1 !important;
}

.overflow-auto {
  overflow: auto !important;
}

.overflow-hidden {
  overflow: hidden !important;
}

.overflow-visible {
  overflow: visible !important;
}

.overflow-scroll {
  overflow: scroll !important;
}

.overflow-x-auto {
  overflow-x: auto !important;
}

.overflow-x-hidden {
  overflow-x: hidden !important;
}

.overflow-x-visible {
  overflow-x: visible !important;
}

.overflow-x-scroll {
  overflow-x: scroll !important;
}

.overflow-y-auto {
  overflow-y: auto !important;
}

.overflow-y-hidden {
  overflow-y: hidden !important;
}

.overflow-y-visible {
  overflow-y: visible !important;
}

.overflow-y-scroll {
  overflow-y: scroll !important;
}

.d-inline {
  display: inline !important;
}

.d-inline-block {
  display: inline-block !important;
}

.d-block, .header-line:after {
  display: block !important;
}

.d-grid {
  display: grid !important;
}

.d-inline-grid {
  display: inline-grid !important;
}

.d-table {
  display: table !important;
}

.d-table-row {
  display: table-row !important;
}

.d-table-cell {
  display: table-cell !important;
}

.d-flex {
  display: flex !important;
}

.d-inline-flex {
  display: inline-flex !important;
}

.d-none {
  display: none !important;
}

.shadow {
  box-shadow: var(--bs-box-shadow) !important;
}

.shadow-sm {
  box-shadow: var(--bs-box-shadow-sm) !important;
}

.shadow-lg {
  box-shadow: var(--bs-box-shadow-lg) !important;
}

.shadow-none {
  box-shadow: none !important;
}

.focus-ring-primary {
  --bs-focus-ring-color: rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-100 {
  --bs-focus-ring-color: rgba(var(--bs-gray-100-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-200 {
  --bs-focus-ring-color: rgba(var(--bs-gray-200-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-300 {
  --bs-focus-ring-color: rgba(var(--bs-gray-300-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-400 {
  --bs-focus-ring-color: rgba(var(--bs-gray-400-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-500 {
  --bs-focus-ring-color: rgba(var(--bs-gray-500-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-600 {
  --bs-focus-ring-color: rgba(var(--bs-gray-600-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-700 {
  --bs-focus-ring-color: rgba(var(--bs-gray-700-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-800 {
  --bs-focus-ring-color: rgba(var(--bs-gray-800-rgb), var(--bs-focus-ring-opacity));
}

.focus-ring-gray-900 {
  --bs-focus-ring-color: rgba(var(--bs-gray-900-rgb), var(--bs-focus-ring-opacity));
}

.position-static {
  position: static !important;
}

.position-relative, .header-line {
  position: relative !important;
}

.position-absolute, .header-line:before {
  position: absolute !important;
}

.position-fixed {
  position: fixed !important;
}

.position-sticky {
  position: sticky !important;
}

.top-0, .header-line:before {
  top: 0 !important;
}

.top-50 {
  top: 50% !important;
}

.top-100 {
  top: 100% !important;
}

.bottom-0, .header-line:before {
  bottom: 0 !important;
}

.bottom-50 {
  bottom: 50% !important;
}

.bottom-100 {
  bottom: 100% !important;
}

.start-0, .header-line.end:before, .header-line.start:before {
  left: 0 !important;
}

.start-50 {
  left: 50% !important;
}

.start-100 {
  left: 100% !important;
}

.end-0, .header-line.end:before, .header-line.start:before {
  right: 0 !important;
}

.end-50 {
  right: 50% !important;
}

.end-100 {
  right: 100% !important;
}

.translate-middle {
  transform: translate(-50%, -50%) !important;
}

.translate-middle-x {
  transform: translateX(-50%) !important;
}

.translate-middle-y {
  transform: translateY(-50%) !important;
}

.border {
  border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}

.border-0, .form-control {
  border: 0 !important;
}

.border-top {
  border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}

.border-top-0 {
  border-top: 0 !important;
}

.border-end {
  border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}

.border-end-0 {
  border-right: 0 !important;
}

.border-bottom {
  border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}

.border-bottom-0 {
  border-bottom: 0 !important;
}

.border-start {
  border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}

.border-start-0 {
  border-left: 0 !important;
}

.border-primary {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-100 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-100-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-200 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-200-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-300 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-300-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-400 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-400-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-500 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-500-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-600 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-600-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-700 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-700-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-800 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-800-rgb), var(--bs-border-opacity)) !important;
}

.border-gray-900 {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-gray-900-rgb), var(--bs-border-opacity)) !important;
}

.border-black {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-black-rgb), var(--bs-border-opacity)) !important;
}

.border-white {
  --bs-border-opacity: 1;
  border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important;
}

.border-primary-subtle {
  border-color: var(--bs-primary-border-subtle) !important;
}

.border-secondary-subtle {
  border-color: var(--bs-secondary-border-subtle) !important;
}

.border-success-subtle {
  border-color: var(--bs-success-border-subtle) !important;
}

.border-info-subtle {
  border-color: var(--bs-info-border-subtle) !important;
}

.border-warning-subtle {
  border-color: var(--bs-warning-border-subtle) !important;
}

.border-danger-subtle {
  border-color: var(--bs-danger-border-subtle) !important;
}

.border-light-subtle {
  border-color: var(--bs-light-border-subtle) !important;
}

.border-dark-subtle {
  border-color: var(--bs-dark-border-subtle) !important;
}

.border-1 {
  border-width: 1px !important;
}

.border-2 {
  border-width: 2px !important;
}

.border-3 {
  border-width: 3px !important;
}

.border-4 {
  border-width: 4px !important;
}

.border-5 {
  border-width: 5px !important;
}

.border-opacity-10 {
  --bs-border-opacity: 0.1;
}

.border-opacity-25 {
  --bs-border-opacity: 0.25;
}

.border-opacity-50 {
  --bs-border-opacity: 0.5;
}

.border-opacity-75 {
  --bs-border-opacity: 0.75;
}

.border-opacity-100 {
  --bs-border-opacity: 1;
}

.w-25 {
  width: 25% !important;
}

.w-50 {
  width: 50% !important;
}

.w-75 {
  width: 75% !important;
}

.w-100 {
  width: 100% !important;
}

.w-auto {
  width: auto !important;
}

.mw-100 {
  max-width: 100% !important;
}

.vw-100 {
  width: 100vw !important;
}

.min-vw-100 {
  min-width: 100vw !important;
}

.h-25 {
  height: 25% !important;
}

.h-50 {
  height: 50% !important;
}

.h-75 {
  height: 75% !important;
}

.h-100 {
  height: 100% !important;
}

.h-auto {
  height: auto !important;
}

.mh-100 {
  max-height: 100% !important;
}

.vh-100 {
  height: 100vh !important;
}

.min-vh-100 {
  min-height: 100vh !important;
}

.flex-fill {
  flex: 1 1 auto !important;
}

.flex-row {
  flex-direction: row !important;
}

.flex-column {
  flex-direction: column !important;
}

.flex-row-reverse {
  flex-direction: row-reverse !important;
}

.flex-column-reverse {
  flex-direction: column-reverse !important;
}

.flex-grow-0 {
  flex-grow: 0 !important;
}

.flex-grow-1 {
  flex-grow: 1 !important;
}

.flex-shrink-0 {
  flex-shrink: 0 !important;
}

.flex-shrink-1 {
  flex-shrink: 1 !important;
}

.flex-wrap {
  flex-wrap: wrap !important;
}

.flex-nowrap {
  flex-wrap: nowrap !important;
}

.flex-wrap-reverse {
  flex-wrap: wrap-reverse !important;
}

.justify-content-start {
  justify-content: flex-start !important;
}

.justify-content-end {
  justify-content: flex-end !important;
}

.justify-content-center {
  justify-content: center !important;
}

.justify-content-between {
  justify-content: space-between !important;
}

.justify-content-around {
  justify-content: space-around !important;
}

.justify-content-evenly {
  justify-content: space-evenly !important;
}

.align-items-start {
  align-items: flex-start !important;
}

.align-items-end {
  align-items: flex-end !important;
}

.align-items-center {
  align-items: center !important;
}

.align-items-baseline {
  align-items: baseline !important;
}

.align-items-stretch {
  align-items: stretch !important;
}

.align-content-start {
  align-content: flex-start !important;
}

.align-content-end {
  align-content: flex-end !important;
}

.align-content-center {
  align-content: center !important;
}

.align-content-between {
  align-content: space-between !important;
}

.align-content-around {
  align-content: space-around !important;
}

.align-content-stretch {
  align-content: stretch !important;
}

.align-self-auto {
  align-self: auto !important;
}

.align-self-start {
  align-self: flex-start !important;
}

.align-self-end {
  align-self: flex-end !important;
}

.align-self-center {
  align-self: center !important;
}

.align-self-baseline {
  align-self: baseline !important;
}

.align-self-stretch {
  align-self: stretch !important;
}

.order-first {
  order: -1 !important;
}

.order-0 {
  order: 0 !important;
}

.order-1 {
  order: 1 !important;
}

.order-2 {
  order: 2 !important;
}

.order-3 {
  order: 3 !important;
}

.order-4 {
  order: 4 !important;
}

.order-5 {
  order: 5 !important;
}

.order-last {
  order: 6 !important;
}

.m-0 {
  margin: 0 !important;
}

.m-1 {
  margin: 0.25rem !important;
}

.m-2 {
  margin: 0.5rem !important;
}

.m-3 {
  margin: 1rem !important;
}

.m-4 {
  margin: 1.5rem !important;
}

.m-5 {
  margin: 3rem !important;
}

.m-6 {
  margin: 5rem !important;
}

.m-7 {
  margin: 8rem !important;
}

.m-8 {
  margin: 10rem !important;
}

.m-9 {
  margin: 15rem !important;
}

.m-10 {
  margin: 20rem !important;
}

.m-auto {
  margin: auto !important;
}

.mx-0 {
  margin-right: 0 !important;
  margin-left: 0 !important;
}

.mx-1 {
  margin-right: 0.25rem !important;
  margin-left: 0.25rem !important;
}

.mx-2 {
  margin-right: 0.5rem !important;
  margin-left: 0.5rem !important;
}

.mx-3 {
  margin-right: 1rem !important;
  margin-left: 1rem !important;
}

.mx-4 {
  margin-right: 1.5rem !important;
  margin-left: 1.5rem !important;
}

.mx-5 {
  margin-right: 3rem !important;
  margin-left: 3rem !important;
}

.mx-6 {
  margin-right: 5rem !important;
  margin-left: 5rem !important;
}

.mx-7 {
  margin-right: 8rem !important;
  margin-left: 8rem !important;
}

.mx-8 {
  margin-right: 10rem !important;
  margin-left: 10rem !important;
}

.mx-9 {
  margin-right: 15rem !important;
  margin-left: 15rem !important;
}

.mx-10 {
  margin-right: 20rem !important;
  margin-left: 20rem !important;
}

.mx-auto, .header-line:after, .header-line.end:before, .header-line.start:before {
  margin-right: auto !important;
  margin-left: auto !important;
}

.my-0 {
  margin-top: 0 !important;
  margin-bottom: 0 !important;
}

.my-1 {
  margin-top: 0.25rem !important;
  margin-bottom: 0.25rem !important;
}

.my-2 {
  margin-top: 0.5rem !important;
  margin-bottom: 0.5rem !important;
}

.my-3 {
  margin-top: 1rem !important;
  margin-bottom: 1rem !important;
}

.my-4 {
  margin-top: 1.5rem !important;
  margin-bottom: 1.5rem !important;
}

.my-5 {
  margin-top: 3rem !important;
  margin-bottom: 3rem !important;
}

.my-6 {
  margin-top: 5rem !important;
  margin-bottom: 5rem !important;
}

.my-7 {
  margin-top: 8rem !important;
  margin-bottom: 8rem !important;
}

.my-8 {
  margin-top: 10rem !important;
  margin-bottom: 10rem !important;
}

.my-9 {
  margin-top: 15rem !important;
  margin-bottom: 15rem !important;
}

.my-10 {
  margin-top: 20rem !important;
  margin-bottom: 20rem !important;
}

.my-auto, .header-line:before {
  margin-top: auto !important;
  margin-bottom: auto !important;
}

.mt-0 {
  margin-top: 0 !important;
}

.mt-1 {
  margin-top: 0.25rem !important;
}

.mt-2 {
  margin-top: 0.5rem !important;
}

.mt-3 {
  margin-top: 1rem !important;
}

.mt-4 {
  margin-top: 1.5rem !important;
}

.mt-5 {
  margin-top: 3rem !important;
}

.mt-6 {
  margin-top: 5rem !important;
}

.mt-7 {
  margin-top: 8rem !important;
}

.mt-8 {
  margin-top: 10rem !important;
}

.mt-9 {
  margin-top: 15rem !important;
}

.mt-10 {
  margin-top: 20rem !important;
}

.mt-auto {
  margin-top: auto !important;
}

.me-0 {
  margin-right: 0 !important;
}

.me-1 {
  margin-right: 0.25rem !important;
}

.me-2 {
  margin-right: 0.5rem !important;
}

.me-3 {
  margin-right: 1rem !important;
}

.me-4 {
  margin-right: 1.5rem !important;
}

.me-5 {
  margin-right: 3rem !important;
}

.me-6 {
  margin-right: 5rem !important;
}

.me-7 {
  margin-right: 8rem !important;
}

.me-8 {
  margin-right: 10rem !important;
}

.me-9 {
  margin-right: 15rem !important;
}

.me-10 {
  margin-right: 20rem !important;
}

.me-auto {
  margin-right: auto !important;
}

.mb-0 {
  margin-bottom: 0 !important;
}

.mb-1 {
  margin-bottom: 0.25rem !important;
}

.mb-2 {
  margin-bottom: 0.5rem !important;
}

.mb-3 {
  margin-bottom: 1rem !important;
}

.mb-4 {
  margin-bottom: 1.5rem !important;
}

.mb-5 {
  margin-bottom: 3rem !important;
}

.mb-6 {
  margin-bottom: 5rem !important;
}

.mb-7 {
  margin-bottom: 8rem !important;
}

.mb-8 {
  margin-bottom: 10rem !important;
}

.mb-9 {
  margin-bottom: 15rem !important;
}

.mb-10 {
  margin-bottom: 20rem !important;
}

.mb-auto {
  margin-bottom: auto !important;
}

.ms-0 {
  margin-left: 0 !important;
}

.ms-1 {
  margin-left: 0.25rem !important;
}

.ms-2 {
  margin-left: 0.5rem !important;
}

.ms-3 {
  margin-left: 1rem !important;
}

.ms-4 {
  margin-left: 1.5rem !important;
}

.ms-5 {
  margin-left: 3rem !important;
}

.ms-6 {
  margin-left: 5rem !important;
}

.ms-7 {
  margin-left: 8rem !important;
}

.ms-8 {
  margin-left: 10rem !important;
}

.ms-9 {
  margin-left: 15rem !important;
}

.ms-10 {
  margin-left: 20rem !important;
}

.ms-auto {
  margin-left: auto !important;
}

.p-0 {
  padding: 0 !important;
}

.p-1 {
  padding: 0.25rem !important;
}

.p-2 {
  padding: 0.5rem !important;
}

.p-3 {
  padding: 1rem !important;
}

.p-4 {
  padding: 1.5rem !important;
}

.p-5 {
  padding: 3rem !important;
}

.p-6 {
  padding: 5rem !important;
}

.p-7 {
  padding: 8rem !important;
}

.p-8 {
  padding: 10rem !important;
}

.p-9 {
  padding: 15rem !important;
}

.p-10 {
  padding: 20rem !important;
}

.px-0 {
  padding-right: 0 !important;
  padding-left: 0 !important;
}

.px-1 {
  padding-right: 0.25rem !important;
  padding-left: 0.25rem !important;
}

.px-2 {
  padding-right: 0.5rem !important;
  padding-left: 0.5rem !important;
}

.px-3 {
  padding-right: 1rem !important;
  padding-left: 1rem !important;
}

.px-4 {
  padding-right: 1.5rem !important;
  padding-left: 1.5rem !important;
}

.px-5 {
  padding-right: 3rem !important;
  padding-left: 3rem !important;
}

.px-6 {
  padding-right: 5rem !important;
  padding-left: 5rem !important;
}

.px-7 {
  padding-right: 8rem !important;
  padding-left: 8rem !important;
}

.px-8 {
  padding-right: 10rem !important;
  padding-left: 10rem !important;
}

.px-9 {
  padding-right: 15rem !important;
  padding-left: 15rem !important;
}

.px-10 {
  padding-right: 20rem !important;
  padding-left: 20rem !important;
}

.py-0 {
  padding-top: 0 !important;
  padding-bottom: 0 !important;
}

.py-1 {
  padding-top: 0.25rem !important;
  padding-bottom: 0.25rem !important;
}

.py-2 {
  padding-top: 0.5rem !important;
  padding-bottom: 0.5rem !important;
}

.py-3 {
  padding-top: 1rem !important;
  padding-bottom: 1rem !important;
}

.py-4 {
  padding-top: 1.5rem !important;
  padding-bottom: 1.5rem !important;
}

.py-5 {
  padding-top: 3rem !important;
  padding-bottom: 3rem !important;
}

.py-6 {
  padding-top: 5rem !important;
  padding-bottom: 5rem !important;
}

.py-7 {
  padding-top: 8rem !important;
  padding-bottom: 8rem !important;
}

.py-8 {
  padding-top: 10rem !important;
  padding-bottom: 10rem !important;
}

.py-9 {
  padding-top: 15rem !important;
  padding-bottom: 15rem !important;
}

.py-10 {
  padding-top: 20rem !important;
  padding-bottom: 20rem !important;
}

.pt-0 {
  padding-top: 0 !important;
}

.pt-1 {
  padding-top: 0.25rem !important;
}

.pt-2 {
  padding-top: 0.5rem !important;
}

.pt-3 {
  padding-top: 1rem !important;
}

.pt-4 {
  padding-top: 1.5rem !important;
}

.pt-5 {
  padding-top: 3rem !important;
}

.pt-6 {
  padding-top: 5rem !important;
}

.pt-7 {
  padding-top: 8rem !important;
}

.pt-8 {
  padding-top: 10rem !important;
}

.pt-9 {
  padding-top: 15rem !important;
}

.pt-10 {
  padding-top: 20rem !important;
}

.pe-0 {
  padding-right: 0 !important;
}

.pe-1 {
  padding-right: 0.25rem !important;
}

.pe-2 {
  padding-right: 0.5rem !important;
}

.pe-3 {
  padding-right: 1rem !important;
}

.pe-4 {
  padding-right: 1.5rem !important;
}

.pe-5 {
  padding-right: 3rem !important;
}

.pe-6 {
  padding-right: 5rem !important;
}

.pe-7 {
  padding-right: 8rem !important;
}

.pe-8 {
  padding-right: 10rem !important;
}

.pe-9 {
  padding-right: 15rem !important;
}

.pe-10 {
  padding-right: 20rem !important;
}

.pb-0 {
  padding-bottom: 0 !important;
}

.pb-1 {
  padding-bottom: 0.25rem !important;
}

.pb-2 {
  padding-bottom: 0.5rem !important;
}

.pb-3 {
  padding-bottom: 1rem !important;
}

.pb-4 {
  padding-bottom: 1.5rem !important;
}

.pb-5 {
  padding-bottom: 3rem !important;
}

.pb-6 {
  padding-bottom: 5rem !important;
}

.pb-7 {
  padding-bottom: 8rem !important;
}

.pb-8 {
  padding-bottom: 10rem !important;
}

.pb-9 {
  padding-bottom: 15rem !important;
}

.pb-10 {
  padding-bottom: 20rem !important;
}

.ps-0 {
  padding-left: 0 !important;
}

.ps-1 {
  padding-left: 0.25rem !important;
}

.ps-2 {
  padding-left: 0.5rem !important;
}

.ps-3 {
  padding-left: 1rem !important;
}

.ps-4 {
  padding-left: 1.5rem !important;
}

.ps-5 {
  padding-left: 3rem !important;
}

.ps-6 {
  padding-left: 5rem !important;
}

.ps-7 {
  padding-left: 8rem !important;
}

.ps-8 {
  padding-left: 10rem !important;
}

.ps-9 {
  padding-left: 15rem !important;
}

.ps-10 {
  padding-left: 20rem !important;
}

.gap-0 {
  gap: 0 !important;
}

.gap-1 {
  gap: 0.25rem !important;
}

.gap-2 {
  gap: 0.5rem !important;
}

.gap-3 {
  gap: 1rem !important;
}

.gap-4 {
  gap: 1.5rem !important;
}

.gap-5 {
  gap: 3rem !important;
}

.gap-6 {
  gap: 5rem !important;
}

.gap-7 {
  gap: 8rem !important;
}

.gap-8 {
  gap: 10rem !important;
}

.gap-9 {
  gap: 15rem !important;
}

.gap-10 {
  gap: 20rem !important;
}

.row-gap-0 {
  row-gap: 0 !important;
}

.row-gap-1 {
  row-gap: 0.25rem !important;
}

.row-gap-2 {
  row-gap: 0.5rem !important;
}

.row-gap-3 {
  row-gap: 1rem !important;
}

.row-gap-4 {
  row-gap: 1.5rem !important;
}

.row-gap-5 {
  row-gap: 3rem !important;
}

.row-gap-6 {
  row-gap: 5rem !important;
}

.row-gap-7 {
  row-gap: 8rem !important;
}

.row-gap-8 {
  row-gap: 10rem !important;
}

.row-gap-9 {
  row-gap: 15rem !important;
}

.row-gap-10 {
  row-gap: 20rem !important;
}

.column-gap-0 {
  column-gap: 0 !important;
}

.column-gap-1 {
  column-gap: 0.25rem !important;
}

.column-gap-2 {
  column-gap: 0.5rem !important;
}

.column-gap-3 {
  column-gap: 1rem !important;
}

.column-gap-4 {
  column-gap: 1.5rem !important;
}

.column-gap-5 {
  column-gap: 3rem !important;
}

.column-gap-6 {
  column-gap: 5rem !important;
}

.column-gap-7 {
  column-gap: 8rem !important;
}

.column-gap-8 {
  column-gap: 10rem !important;
}

.column-gap-9 {
  column-gap: 15rem !important;
}

.column-gap-10 {
  column-gap: 20rem !important;
}

.font-monospace {
  font-family: var(--bs-font-monospace) !important;
}

.fs-1 {
  font-size: calc(1.375rem + 1.5vw) !important;
}

.fs-2 {
  font-size: calc(1.325rem + 0.9vw) !important;
}

.fs-3 {
  font-size: calc(1.3rem + 0.6vw) !important;
}

.fs-4 {
  font-size: calc(1.275rem + 0.3vw) !important;
}

.fs-5 {
  font-size: 1.25rem !important;
}

.fs-6 {
  font-size: 1rem !important;
}

.fst-italic {
  font-style: italic !important;
}

.fst-normal {
  font-style: normal !important;
}

.fw-lighter {
  font-weight: lighter !important;
}

.fw-light {
  font-weight: 300 !important;
}

.fw-normal {
  font-weight: 400 !important;
}

.fw-medium {
  font-weight: 500 !important;
}

.fw-semibold {
  font-weight: 600 !important;
}

.fw-bold {
  font-weight: 700 !important;
}

.fw-bolder {
  font-weight: bolder !important;
}

.lh-1 {
  line-height: 1 !important;
}

.lh-sm {
  line-height: 1.25 !important;
}

.lh-base {
  line-height: 1.5 !important;
}

.lh-lg {
  line-height: 2 !important;
}

.text-start {
  text-align: left !important;
}

.text-end {
  text-align: right !important;
}

.text-center {
  text-align: center !important;
}

.text-decoration-none, .footer-menu a {
  text-decoration: none !important;
}

.text-decoration-underline {
  text-decoration: underline !important;
}

.text-decoration-line-through {
  text-decoration: line-through !important;
}

.text-lowercase {
  text-transform: lowercase !important;
}

.text-uppercase, .footer-menu a {
  text-transform: uppercase !important;
}

.text-capitalize {
  text-transform: capitalize !important;
}

.text-wrap {
  white-space: normal !important;
}

.text-nowrap {
  white-space: nowrap !important;
}

/* rtl:begin:remove */
.text-break {
  word-wrap: break-word !important;
  word-break: break-word !important;
}

/* rtl:end:remove */
.text-primary, h1, .h1,
h2,
.h2,
h3,
.h3,
h4,
.h4,
h5,
.h5,
h6,
.h6, .current-menu-item a {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-100 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-100-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-200 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-200-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-300 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-300-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-400 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-400-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-500 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-500-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-600 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-600-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-700, p {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-700-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-800 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-800-rgb), var(--bs-text-opacity)) !important;
}

.text-gray-900 {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-gray-900-rgb), var(--bs-text-opacity)) !important;
}

.text-black {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important;
}

.text-white, .btn-primary, .footer-menu a {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important;
}

.text-body {
  --bs-text-opacity: 1;
  color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important;
}

.text-muted {
  --bs-text-opacity: 1;
  color: var(--bs-secondary-color) !important;
}

.text-black-50 {
  --bs-text-opacity: 1;
  color: rgba(0, 0, 0, 0.5) !important;
}

.text-white-50 {
  --bs-text-opacity: 1;
  color: rgba(255, 255, 255, 0.5) !important;
}

.text-body-secondary {
  --bs-text-opacity: 1;
  color: var(--bs-secondary-color) !important;
}

.text-body-tertiary {
  --bs-text-opacity: 1;
  color: var(--bs-tertiary-color) !important;
}

.text-body-emphasis {
  --bs-text-opacity: 1;
  color: var(--bs-emphasis-color) !important;
}

.text-reset {
  --bs-text-opacity: 1;
  color: inherit !important;
}

.text-opacity-25 {
  --bs-text-opacity: 0.25;
}

.text-opacity-50 {
  --bs-text-opacity: 0.5;
}

.text-opacity-75 {
  --bs-text-opacity: 0.75;
}

.text-opacity-100 {
  --bs-text-opacity: 1;
}

.text-primary-emphasis {
  color: var(--bs-primary-text-emphasis) !important;
}

.text-secondary-emphasis {
  color: var(--bs-secondary-text-emphasis) !important;
}

.text-success-emphasis {
  color: var(--bs-success-text-emphasis) !important;
}

.text-info-emphasis {
  color: var(--bs-info-text-emphasis) !important;
}

.text-warning-emphasis {
  color: var(--bs-warning-text-emphasis) !important;
}

.text-danger-emphasis {
  color: var(--bs-danger-text-emphasis) !important;
}

.text-light-emphasis {
  color: var(--bs-light-text-emphasis) !important;
}

.text-dark-emphasis {
  color: var(--bs-dark-text-emphasis) !important;
}

.link-opacity-10 {
  --bs-link-opacity: 0.1;
}

.link-opacity-10-hover:hover {
  --bs-link-opacity: 0.1;
}

.link-opacity-25 {
  --bs-link-opacity: 0.25;
}

.link-opacity-25-hover:hover {
  --bs-link-opacity: 0.25;
}

.link-opacity-50 {
  --bs-link-opacity: 0.5;
}

.link-opacity-50-hover:hover {
  --bs-link-opacity: 0.5;
}

.link-opacity-75 {
  --bs-link-opacity: 0.75;
}

.link-opacity-75-hover:hover {
  --bs-link-opacity: 0.75;
}

.link-opacity-100 {
  --bs-link-opacity: 1;
}

.link-opacity-100-hover:hover {
  --bs-link-opacity: 1;
}

.link-offset-1 {
  text-underline-offset: 0.125em !important;
}

.link-offset-1-hover:hover {
  text-underline-offset: 0.125em !important;
}

.link-offset-2 {
  text-underline-offset: 0.25em !important;
}

.link-offset-2-hover:hover {
  text-underline-offset: 0.25em !important;
}

.link-offset-3 {
  text-underline-offset: 0.375em !important;
}

.link-offset-3-hover:hover {
  text-underline-offset: 0.375em !important;
}

.link-underline-primary {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-100 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-100-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-200 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-200-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-300 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-300-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-400 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-400-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-500 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-500-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-600 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-600-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-700 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-700-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-800 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-800-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline-gray-900 {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-gray-900-rgb), var(--bs-link-underline-opacity)) !important;
}

.link-underline {
  --bs-link-underline-opacity: 1;
  text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
}

.link-underline-opacity-0 {
  --bs-link-underline-opacity: 0;
}

.link-underline-opacity-0-hover:hover {
  --bs-link-underline-opacity: 0;
}

.link-underline-opacity-10 {
  --bs-link-underline-opacity: 0.1;
}

.link-underline-opacity-10-hover:hover {
  --bs-link-underline-opacity: 0.1;
}

.link-underline-opacity-25 {
  --bs-link-underline-opacity: 0.25;
}

.link-underline-opacity-25-hover:hover {
  --bs-link-underline-opacity: 0.25;
}

.link-underline-opacity-50 {
  --bs-link-underline-opacity: 0.5;
}

.link-underline-opacity-50-hover:hover {
  --bs-link-underline-opacity: 0.5;
}

.link-underline-opacity-75 {
  --bs-link-underline-opacity: 0.75;
}

.link-underline-opacity-75-hover:hover {
  --bs-link-underline-opacity: 0.75;
}

.link-underline-opacity-100 {
  --bs-link-underline-opacity: 1;
}

.link-underline-opacity-100-hover:hover {
  --bs-link-underline-opacity: 1;
}

.bg-primary, .header-line:before, .header-line:after {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-100 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-100-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-200 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-200-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-300 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-300-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-400 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-400-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-500 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-500-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-600 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-600-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-700 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-700-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-800 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-800-rgb), var(--bs-bg-opacity)) !important;
}

.bg-gray-900 {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-gray-900-rgb), var(--bs-bg-opacity)) !important;
}

.bg-black {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important;
}

.bg-white {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important;
}

.bg-body {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important;
}

.bg-transparent {
  --bs-bg-opacity: 1;
  background-color: transparent !important;
}

.bg-body-secondary {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity)) !important;
}

.bg-body-tertiary {
  --bs-bg-opacity: 1;
  background-color: rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity)) !important;
}

.bg-opacity-10 {
  --bs-bg-opacity: 0.1;
}

.bg-opacity-25 {
  --bs-bg-opacity: 0.25;
}

.bg-opacity-50 {
  --bs-bg-opacity: 0.5;
}

.bg-opacity-75 {
  --bs-bg-opacity: 0.75;
}

.bg-opacity-100 {
  --bs-bg-opacity: 1;
}

.bg-primary-subtle {
  background-color: var(--bs-primary-bg-subtle) !important;
}

.bg-secondary-subtle {
  background-color: var(--bs-secondary-bg-subtle) !important;
}

.bg-success-subtle {
  background-color: var(--bs-success-bg-subtle) !important;
}

.bg-info-subtle {
  background-color: var(--bs-info-bg-subtle) !important;
}

.bg-warning-subtle {
  background-color: var(--bs-warning-bg-subtle) !important;
}

.bg-danger-subtle {
  background-color: var(--bs-danger-bg-subtle) !important;
}

.bg-light-subtle {
  background-color: var(--bs-light-bg-subtle) !important;
}

.bg-dark-subtle {
  background-color: var(--bs-dark-bg-subtle) !important;
}

.bg-gradient {
  background-image: var(--bs-gradient) !important;
}

.user-select-all {
  user-select: all !important;
}

.user-select-auto {
  user-select: auto !important;
}

.user-select-none {
  user-select: none !important;
}

.pe-none {
  pointer-events: none !important;
}

.pe-auto {
  pointer-events: auto !important;
}

.rounded {
  border-radius: var(--bs-border-radius) !important;
}

.rounded-0 {
  border-radius: 0 !important;
}

.rounded-1 {
  border-radius: var(--bs-border-radius-sm) !important;
}

.rounded-2 {
  border-radius: var(--bs-border-radius) !important;
}

.rounded-3 {
  border-radius: var(--bs-border-radius-lg) !important;
}

.rounded-4 {
  border-radius: var(--bs-border-radius-xl) !important;
}

.rounded-5 {
  border-radius: var(--bs-border-radius-xxl) !important;
}

.rounded-circle, .header-line:before {
  border-radius: 50% !important;
}

.rounded-pill {
  border-radius: var(--bs-border-radius-pill) !important;
}

.rounded-top {
  border-top-left-radius: var(--bs-border-radius) !important;
  border-top-right-radius: var(--bs-border-radius) !important;
}

.rounded-top-0 {
  border-top-left-radius: 0 !important;
  border-top-right-radius: 0 !important;
}

.rounded-top-1 {
  border-top-left-radius: var(--bs-border-radius-sm) !important;
  border-top-right-radius: var(--bs-border-radius-sm) !important;
}

.rounded-top-2 {
  border-top-left-radius: var(--bs-border-radius) !important;
  border-top-right-radius: var(--bs-border-radius) !important;
}

.rounded-top-3 {
  border-top-left-radius: var(--bs-border-radius-lg) !important;
  border-top-right-radius: var(--bs-border-radius-lg) !important;
}

.rounded-top-4 {
  border-top-left-radius: var(--bs-border-radius-xl) !important;
  border-top-right-radius: var(--bs-border-radius-xl) !important;
}

.rounded-top-5 {
  border-top-left-radius: var(--bs-border-radius-xxl) !important;
  border-top-right-radius: var(--bs-border-radius-xxl) !important;
}

.rounded-top-circle {
  border-top-left-radius: 50% !important;
  border-top-right-radius: 50% !important;
}

.rounded-top-pill {
  border-top-left-radius: var(--bs-border-radius-pill) !important;
  border-top-right-radius: var(--bs-border-radius-pill) !important;
}

.rounded-end {
  border-top-right-radius: var(--bs-border-radius) !important;
  border-bottom-right-radius: var(--bs-border-radius) !important;
}

.rounded-end-0 {
  border-top-right-radius: 0 !important;
  border-bottom-right-radius: 0 !important;
}

.rounded-end-1 {
  border-top-right-radius: var(--bs-border-radius-sm) !important;
  border-bottom-right-radius: var(--bs-border-radius-sm) !important;
}

.rounded-end-2 {
  border-top-right-radius: var(--bs-border-radius) !important;
  border-bottom-right-radius: var(--bs-border-radius) !important;
}

.rounded-end-3 {
  border-top-right-radius: var(--bs-border-radius-lg) !important;
  border-bottom-right-radius: var(--bs-border-radius-lg) !important;
}

.rounded-end-4 {
  border-top-right-radius: var(--bs-border-radius-xl) !important;
  border-bottom-right-radius: var(--bs-border-radius-xl) !important;
}

.rounded-end-5 {
  border-top-right-radius: var(--bs-border-radius-xxl) !important;
  border-bottom-right-radius: var(--bs-border-radius-xxl) !important;
}

.rounded-end-circle {
  border-top-right-radius: 50% !important;
  border-bottom-right-radius: 50% !important;
}

.rounded-end-pill {
  border-top-right-radius: var(--bs-border-radius-pill) !important;
  border-bottom-right-radius: var(--bs-border-radius-pill) !important;
}

.rounded-bottom {
  border-bottom-right-radius: var(--bs-border-radius) !important;
  border-bottom-left-radius: var(--bs-border-radius) !important;
}

.rounded-bottom-0 {
  border-bottom-right-radius: 0 !important;
  border-bottom-left-radius: 0 !important;
}

.rounded-bottom-1 {
  border-bottom-right-radius: var(--bs-border-radius-sm) !important;
  border-bottom-left-radius: var(--bs-border-radius-sm) !important;
}

.rounded-bottom-2 {
  border-bottom-right-radius: var(--bs-border-radius) !important;
  border-bottom-left-radius: var(--bs-border-radius) !important;
}

.rounded-bottom-3 {
  border-bottom-right-radius: var(--bs-border-radius-lg) !important;
  border-bottom-left-radius: var(--bs-border-radius-lg) !important;
}

.rounded-bottom-4 {
  border-bottom-right-radius: var(--bs-border-radius-xl) !important;
  border-bottom-left-radius: var(--bs-border-radius-xl) !important;
}

.rounded-bottom-5 {
  border-bottom-right-radius: var(--bs-border-radius-xxl) !important;
  border-bottom-left-radius: var(--bs-border-radius-xxl) !important;
}

.rounded-bottom-circle {
  border-bottom-right-radius: 50% !important;
  border-bottom-left-radius: 50% !important;
}

.rounded-bottom-pill {
  border-bottom-right-radius: var(--bs-border-radius-pill) !important;
  border-bottom-left-radius: var(--bs-border-radius-pill) !important;
}

.rounded-start {
  border-bottom-left-radius: var(--bs-border-radius) !important;
  border-top-left-radius: var(--bs-border-radius) !important;
}

.rounded-start-0 {
  border-bottom-left-radius: 0 !important;
  border-top-left-radius: 0 !important;
}

.rounded-start-1 {
  border-bottom-left-radius: var(--bs-border-radius-sm) !important;
  border-top-left-radius: var(--bs-border-radius-sm) !important;
}

.rounded-start-2 {
  border-bottom-left-radius: var(--bs-border-radius) !important;
  border-top-left-radius: var(--bs-border-radius) !important;
}

.rounded-start-3 {
  border-bottom-left-radius: var(--bs-border-radius-lg) !important;
  border-top-left-radius: var(--bs-border-radius-lg) !important;
}

.rounded-start-4 {
  border-bottom-left-radius: var(--bs-border-radius-xl) !important;
  border-top-left-radius: var(--bs-border-radius-xl) !important;
}

.rounded-start-5 {
  border-bottom-left-radius: var(--bs-border-radius-xxl) !important;
  border-top-left-radius: var(--bs-border-radius-xxl) !important;
}

.rounded-start-circle {
  border-bottom-left-radius: 50% !important;
  border-top-left-radius: 50% !important;
}

.rounded-start-pill {
  border-bottom-left-radius: var(--bs-border-radius-pill) !important;
  border-top-left-radius: var(--bs-border-radius-pill) !important;
}

.visible {
  visibility: visible !important;
}

.invisible {
  visibility: hidden !important;
}

.z-n1 {
  z-index: -1 !important;
}

.z-0 {
  z-index: 0 !important;
}

.z-1 {
  z-index: 1 !important;
}

.z-2 {
  z-index: 2 !important;
}

.z-3 {
  z-index: 3 !important;
}

.bg-primary-100, .form-control {
  background-color: #e6f9f3 !important;
}

.bg-primary-200 {
  background-color: #ccf2e7 !important;
}

.bg-primary-300 {
  background-color: #b3ecdb !important;
}

.bg-primary-400 {
  background-color: #99e5cf !important;
}

.bg-primary-500 {
  background-color: #80dec3 !important;
}

.bg-primary-600 {
  background-color: #66d7b7 !important;
}

.bg-primary-700 {
  background-color: #4dd1ab !important;
}

.bg-primary-800 {
  background-color: #33ca9f !important;
}

.bg-primary-900 {
  background-color: #1cc197 !important;
}

@media (min-width: 576px) {
  .float-sm-start {
    float: left !important;
  }
  .float-sm-end {
    float: right !important;
  }
  .float-sm-none {
    float: none !important;
  }
  .object-fit-sm-contain {
    object-fit: contain !important;
  }
  .object-fit-sm-cover {
    object-fit: cover !important;
  }
  .object-fit-sm-fill {
    object-fit: fill !important;
  }
  .object-fit-sm-scale {
    object-fit: scale-down !important;
  }
  .object-fit-sm-none {
    object-fit: none !important;
  }
  .d-sm-inline {
    display: inline !important;
  }
  .d-sm-inline-block {
    display: inline-block !important;
  }
  .d-sm-block {
    display: block !important;
  }
  .d-sm-grid {
    display: grid !important;
  }
  .d-sm-inline-grid {
    display: inline-grid !important;
  }
  .d-sm-table {
    display: table !important;
  }
  .d-sm-table-row {
    display: table-row !important;
  }
  .d-sm-table-cell {
    display: table-cell !important;
  }
  .d-sm-flex {
    display: flex !important;
  }
  .d-sm-inline-flex {
    display: inline-flex !important;
  }
  .d-sm-none {
    display: none !important;
  }
  .flex-sm-fill {
    flex: 1 1 auto !important;
  }
  .flex-sm-row {
    flex-direction: row !important;
  }
  .flex-sm-column {
    flex-direction: column !important;
  }
  .flex-sm-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-sm-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-sm-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-sm-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-sm-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-sm-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-sm-wrap {
    flex-wrap: wrap !important;
  }
  .flex-sm-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-sm-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-sm-start {
    justify-content: flex-start !important;
  }
  .justify-content-sm-end {
    justify-content: flex-end !important;
  }
  .justify-content-sm-center {
    justify-content: center !important;
  }
  .justify-content-sm-between {
    justify-content: space-between !important;
  }
  .justify-content-sm-around {
    justify-content: space-around !important;
  }
  .justify-content-sm-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-sm-start {
    align-items: flex-start !important;
  }
  .align-items-sm-end {
    align-items: flex-end !important;
  }
  .align-items-sm-center {
    align-items: center !important;
  }
  .align-items-sm-baseline {
    align-items: baseline !important;
  }
  .align-items-sm-stretch {
    align-items: stretch !important;
  }
  .align-content-sm-start {
    align-content: flex-start !important;
  }
  .align-content-sm-end {
    align-content: flex-end !important;
  }
  .align-content-sm-center {
    align-content: center !important;
  }
  .align-content-sm-between {
    align-content: space-between !important;
  }
  .align-content-sm-around {
    align-content: space-around !important;
  }
  .align-content-sm-stretch {
    align-content: stretch !important;
  }
  .align-self-sm-auto {
    align-self: auto !important;
  }
  .align-self-sm-start {
    align-self: flex-start !important;
  }
  .align-self-sm-end {
    align-self: flex-end !important;
  }
  .align-self-sm-center {
    align-self: center !important;
  }
  .align-self-sm-baseline {
    align-self: baseline !important;
  }
  .align-self-sm-stretch {
    align-self: stretch !important;
  }
  .order-sm-first {
    order: -1 !important;
  }
  .order-sm-0 {
    order: 0 !important;
  }
  .order-sm-1 {
    order: 1 !important;
  }
  .order-sm-2 {
    order: 2 !important;
  }
  .order-sm-3 {
    order: 3 !important;
  }
  .order-sm-4 {
    order: 4 !important;
  }
  .order-sm-5 {
    order: 5 !important;
  }
  .order-sm-last {
    order: 6 !important;
  }
  .m-sm-0 {
    margin: 0 !important;
  }
  .m-sm-1 {
    margin: 0.25rem !important;
  }
  .m-sm-2 {
    margin: 0.5rem !important;
  }
  .m-sm-3 {
    margin: 1rem !important;
  }
  .m-sm-4 {
    margin: 1.5rem !important;
  }
  .m-sm-5 {
    margin: 3rem !important;
  }
  .m-sm-6 {
    margin: 5rem !important;
  }
  .m-sm-7 {
    margin: 8rem !important;
  }
  .m-sm-8 {
    margin: 10rem !important;
  }
  .m-sm-9 {
    margin: 15rem !important;
  }
  .m-sm-10 {
    margin: 20rem !important;
  }
  .m-sm-auto {
    margin: auto !important;
  }
  .mx-sm-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-sm-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-sm-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-sm-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-sm-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-sm-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-sm-6 {
    margin-right: 5rem !important;
    margin-left: 5rem !important;
  }
  .mx-sm-7 {
    margin-right: 8rem !important;
    margin-left: 8rem !important;
  }
  .mx-sm-8 {
    margin-right: 10rem !important;
    margin-left: 10rem !important;
  }
  .mx-sm-9 {
    margin-right: 15rem !important;
    margin-left: 15rem !important;
  }
  .mx-sm-10 {
    margin-right: 20rem !important;
    margin-left: 20rem !important;
  }
  .mx-sm-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-sm-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-sm-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-sm-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-sm-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-sm-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-sm-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-sm-6 {
    margin-top: 5rem !important;
    margin-bottom: 5rem !important;
  }
  .my-sm-7 {
    margin-top: 8rem !important;
    margin-bottom: 8rem !important;
  }
  .my-sm-8 {
    margin-top: 10rem !important;
    margin-bottom: 10rem !important;
  }
  .my-sm-9 {
    margin-top: 15rem !important;
    margin-bottom: 15rem !important;
  }
  .my-sm-10 {
    margin-top: 20rem !important;
    margin-bottom: 20rem !important;
  }
  .my-sm-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-sm-0 {
    margin-top: 0 !important;
  }
  .mt-sm-1 {
    margin-top: 0.25rem !important;
  }
  .mt-sm-2 {
    margin-top: 0.5rem !important;
  }
  .mt-sm-3 {
    margin-top: 1rem !important;
  }
  .mt-sm-4 {
    margin-top: 1.5rem !important;
  }
  .mt-sm-5 {
    margin-top: 3rem !important;
  }
  .mt-sm-6 {
    margin-top: 5rem !important;
  }
  .mt-sm-7 {
    margin-top: 8rem !important;
  }
  .mt-sm-8 {
    margin-top: 10rem !important;
  }
  .mt-sm-9 {
    margin-top: 15rem !important;
  }
  .mt-sm-10 {
    margin-top: 20rem !important;
  }
  .mt-sm-auto {
    margin-top: auto !important;
  }
  .me-sm-0 {
    margin-right: 0 !important;
  }
  .me-sm-1 {
    margin-right: 0.25rem !important;
  }
  .me-sm-2 {
    margin-right: 0.5rem !important;
  }
  .me-sm-3 {
    margin-right: 1rem !important;
  }
  .me-sm-4 {
    margin-right: 1.5rem !important;
  }
  .me-sm-5 {
    margin-right: 3rem !important;
  }
  .me-sm-6 {
    margin-right: 5rem !important;
  }
  .me-sm-7 {
    margin-right: 8rem !important;
  }
  .me-sm-8 {
    margin-right: 10rem !important;
  }
  .me-sm-9 {
    margin-right: 15rem !important;
  }
  .me-sm-10 {
    margin-right: 20rem !important;
  }
  .me-sm-auto {
    margin-right: auto !important;
  }
  .mb-sm-0 {
    margin-bottom: 0 !important;
  }
  .mb-sm-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-sm-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-sm-3 {
    margin-bottom: 1rem !important;
  }
  .mb-sm-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-sm-5 {
    margin-bottom: 3rem !important;
  }
  .mb-sm-6 {
    margin-bottom: 5rem !important;
  }
  .mb-sm-7 {
    margin-bottom: 8rem !important;
  }
  .mb-sm-8 {
    margin-bottom: 10rem !important;
  }
  .mb-sm-9 {
    margin-bottom: 15rem !important;
  }
  .mb-sm-10 {
    margin-bottom: 20rem !important;
  }
  .mb-sm-auto {
    margin-bottom: auto !important;
  }
  .ms-sm-0 {
    margin-left: 0 !important;
  }
  .ms-sm-1 {
    margin-left: 0.25rem !important;
  }
  .ms-sm-2 {
    margin-left: 0.5rem !important;
  }
  .ms-sm-3 {
    margin-left: 1rem !important;
  }
  .ms-sm-4 {
    margin-left: 1.5rem !important;
  }
  .ms-sm-5 {
    margin-left: 3rem !important;
  }
  .ms-sm-6 {
    margin-left: 5rem !important;
  }
  .ms-sm-7 {
    margin-left: 8rem !important;
  }
  .ms-sm-8 {
    margin-left: 10rem !important;
  }
  .ms-sm-9 {
    margin-left: 15rem !important;
  }
  .ms-sm-10 {
    margin-left: 20rem !important;
  }
  .ms-sm-auto {
    margin-left: auto !important;
  }
  .p-sm-0 {
    padding: 0 !important;
  }
  .p-sm-1 {
    padding: 0.25rem !important;
  }
  .p-sm-2 {
    padding: 0.5rem !important;
  }
  .p-sm-3 {
    padding: 1rem !important;
  }
  .p-sm-4 {
    padding: 1.5rem !important;
  }
  .p-sm-5 {
    padding: 3rem !important;
  }
  .p-sm-6 {
    padding: 5rem !important;
  }
  .p-sm-7 {
    padding: 8rem !important;
  }
  .p-sm-8 {
    padding: 10rem !important;
  }
  .p-sm-9 {
    padding: 15rem !important;
  }
  .p-sm-10 {
    padding: 20rem !important;
  }
  .px-sm-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-sm-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-sm-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-sm-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-sm-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-sm-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .px-sm-6 {
    padding-right: 5rem !important;
    padding-left: 5rem !important;
  }
  .px-sm-7 {
    padding-right: 8rem !important;
    padding-left: 8rem !important;
  }
  .px-sm-8 {
    padding-right: 10rem !important;
    padding-left: 10rem !important;
  }
  .px-sm-9 {
    padding-right: 15rem !important;
    padding-left: 15rem !important;
  }
  .px-sm-10 {
    padding-right: 20rem !important;
    padding-left: 20rem !important;
  }
  .py-sm-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-sm-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-sm-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-sm-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-sm-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-sm-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .py-sm-6 {
    padding-top: 5rem !important;
    padding-bottom: 5rem !important;
  }
  .py-sm-7 {
    padding-top: 8rem !important;
    padding-bottom: 8rem !important;
  }
  .py-sm-8 {
    padding-top: 10rem !important;
    padding-bottom: 10rem !important;
  }
  .py-sm-9 {
    padding-top: 15rem !important;
    padding-bottom: 15rem !important;
  }
  .py-sm-10 {
    padding-top: 20rem !important;
    padding-bottom: 20rem !important;
  }
  .pt-sm-0 {
    padding-top: 0 !important;
  }
  .pt-sm-1 {
    padding-top: 0.25rem !important;
  }
  .pt-sm-2 {
    padding-top: 0.5rem !important;
  }
  .pt-sm-3 {
    padding-top: 1rem !important;
  }
  .pt-sm-4 {
    padding-top: 1.5rem !important;
  }
  .pt-sm-5 {
    padding-top: 3rem !important;
  }
  .pt-sm-6 {
    padding-top: 5rem !important;
  }
  .pt-sm-7 {
    padding-top: 8rem !important;
  }
  .pt-sm-8 {
    padding-top: 10rem !important;
  }
  .pt-sm-9 {
    padding-top: 15rem !important;
  }
  .pt-sm-10 {
    padding-top: 20rem !important;
  }
  .pe-sm-0 {
    padding-right: 0 !important;
  }
  .pe-sm-1 {
    padding-right: 0.25rem !important;
  }
  .pe-sm-2 {
    padding-right: 0.5rem !important;
  }
  .pe-sm-3 {
    padding-right: 1rem !important;
  }
  .pe-sm-4 {
    padding-right: 1.5rem !important;
  }
  .pe-sm-5 {
    padding-right: 3rem !important;
  }
  .pe-sm-6 {
    padding-right: 5rem !important;
  }
  .pe-sm-7 {
    padding-right: 8rem !important;
  }
  .pe-sm-8 {
    padding-right: 10rem !important;
  }
  .pe-sm-9 {
    padding-right: 15rem !important;
  }
  .pe-sm-10 {
    padding-right: 20rem !important;
  }
  .pb-sm-0 {
    padding-bottom: 0 !important;
  }
  .pb-sm-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-sm-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-sm-3 {
    padding-bottom: 1rem !important;
  }
  .pb-sm-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-sm-5 {
    padding-bottom: 3rem !important;
  }
  .pb-sm-6 {
    padding-bottom: 5rem !important;
  }
  .pb-sm-7 {
    padding-bottom: 8rem !important;
  }
  .pb-sm-8 {
    padding-bottom: 10rem !important;
  }
  .pb-sm-9 {
    padding-bottom: 15rem !important;
  }
  .pb-sm-10 {
    padding-bottom: 20rem !important;
  }
  .ps-sm-0 {
    padding-left: 0 !important;
  }
  .ps-sm-1 {
    padding-left: 0.25rem !important;
  }
  .ps-sm-2 {
    padding-left: 0.5rem !important;
  }
  .ps-sm-3 {
    padding-left: 1rem !important;
  }
  .ps-sm-4 {
    padding-left: 1.5rem !important;
  }
  .ps-sm-5 {
    padding-left: 3rem !important;
  }
  .ps-sm-6 {
    padding-left: 5rem !important;
  }
  .ps-sm-7 {
    padding-left: 8rem !important;
  }
  .ps-sm-8 {
    padding-left: 10rem !important;
  }
  .ps-sm-9 {
    padding-left: 15rem !important;
  }
  .ps-sm-10 {
    padding-left: 20rem !important;
  }
  .gap-sm-0 {
    gap: 0 !important;
  }
  .gap-sm-1 {
    gap: 0.25rem !important;
  }
  .gap-sm-2 {
    gap: 0.5rem !important;
  }
  .gap-sm-3 {
    gap: 1rem !important;
  }
  .gap-sm-4 {
    gap: 1.5rem !important;
  }
  .gap-sm-5 {
    gap: 3rem !important;
  }
  .gap-sm-6 {
    gap: 5rem !important;
  }
  .gap-sm-7 {
    gap: 8rem !important;
  }
  .gap-sm-8 {
    gap: 10rem !important;
  }
  .gap-sm-9 {
    gap: 15rem !important;
  }
  .gap-sm-10 {
    gap: 20rem !important;
  }
  .row-gap-sm-0 {
    row-gap: 0 !important;
  }
  .row-gap-sm-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-sm-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-sm-3 {
    row-gap: 1rem !important;
  }
  .row-gap-sm-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-sm-5 {
    row-gap: 3rem !important;
  }
  .row-gap-sm-6 {
    row-gap: 5rem !important;
  }
  .row-gap-sm-7 {
    row-gap: 8rem !important;
  }
  .row-gap-sm-8 {
    row-gap: 10rem !important;
  }
  .row-gap-sm-9 {
    row-gap: 15rem !important;
  }
  .row-gap-sm-10 {
    row-gap: 20rem !important;
  }
  .column-gap-sm-0 {
    column-gap: 0 !important;
  }
  .column-gap-sm-1 {
    column-gap: 0.25rem !important;
  }
  .column-gap-sm-2 {
    column-gap: 0.5rem !important;
  }
  .column-gap-sm-3 {
    column-gap: 1rem !important;
  }
  .column-gap-sm-4 {
    column-gap: 1.5rem !important;
  }
  .column-gap-sm-5 {
    column-gap: 3rem !important;
  }
  .column-gap-sm-6 {
    column-gap: 5rem !important;
  }
  .column-gap-sm-7 {
    column-gap: 8rem !important;
  }
  .column-gap-sm-8 {
    column-gap: 10rem !important;
  }
  .column-gap-sm-9 {
    column-gap: 15rem !important;
  }
  .column-gap-sm-10 {
    column-gap: 20rem !important;
  }
  .text-sm-start {
    text-align: left !important;
  }
  .text-sm-end {
    text-align: right !important;
  }
  .text-sm-center {
    text-align: center !important;
  }
}
@media (min-width: 768px) {
  .float-md-start {
    float: left !important;
  }
  .float-md-end {
    float: right !important;
  }
  .float-md-none {
    float: none !important;
  }
  .object-fit-md-contain {
    object-fit: contain !important;
  }
  .object-fit-md-cover {
    object-fit: cover !important;
  }
  .object-fit-md-fill {
    object-fit: fill !important;
  }
  .object-fit-md-scale {
    object-fit: scale-down !important;
  }
  .object-fit-md-none {
    object-fit: none !important;
  }
  .d-md-inline {
    display: inline !important;
  }
  .d-md-inline-block {
    display: inline-block !important;
  }
  .d-md-block {
    display: block !important;
  }
  .d-md-grid {
    display: grid !important;
  }
  .d-md-inline-grid {
    display: inline-grid !important;
  }
  .d-md-table {
    display: table !important;
  }
  .d-md-table-row {
    display: table-row !important;
  }
  .d-md-table-cell {
    display: table-cell !important;
  }
  .d-md-flex {
    display: flex !important;
  }
  .d-md-inline-flex {
    display: inline-flex !important;
  }
  .d-md-none {
    display: none !important;
  }
  .flex-md-fill {
    flex: 1 1 auto !important;
  }
  .flex-md-row {
    flex-direction: row !important;
  }
  .flex-md-column {
    flex-direction: column !important;
  }
  .flex-md-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-md-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-md-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-md-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-md-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-md-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-md-wrap {
    flex-wrap: wrap !important;
  }
  .flex-md-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-md-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-md-start {
    justify-content: flex-start !important;
  }
  .justify-content-md-end {
    justify-content: flex-end !important;
  }
  .justify-content-md-center {
    justify-content: center !important;
  }
  .justify-content-md-between {
    justify-content: space-between !important;
  }
  .justify-content-md-around {
    justify-content: space-around !important;
  }
  .justify-content-md-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-md-start {
    align-items: flex-start !important;
  }
  .align-items-md-end {
    align-items: flex-end !important;
  }
  .align-items-md-center {
    align-items: center !important;
  }
  .align-items-md-baseline {
    align-items: baseline !important;
  }
  .align-items-md-stretch {
    align-items: stretch !important;
  }
  .align-content-md-start {
    align-content: flex-start !important;
  }
  .align-content-md-end {
    align-content: flex-end !important;
  }
  .align-content-md-center {
    align-content: center !important;
  }
  .align-content-md-between {
    align-content: space-between !important;
  }
  .align-content-md-around {
    align-content: space-around !important;
  }
  .align-content-md-stretch {
    align-content: stretch !important;
  }
  .align-self-md-auto {
    align-self: auto !important;
  }
  .align-self-md-start {
    align-self: flex-start !important;
  }
  .align-self-md-end {
    align-self: flex-end !important;
  }
  .align-self-md-center {
    align-self: center !important;
  }
  .align-self-md-baseline {
    align-self: baseline !important;
  }
  .align-self-md-stretch {
    align-self: stretch !important;
  }
  .order-md-first {
    order: -1 !important;
  }
  .order-md-0 {
    order: 0 !important;
  }
  .order-md-1 {
    order: 1 !important;
  }
  .order-md-2 {
    order: 2 !important;
  }
  .order-md-3 {
    order: 3 !important;
  }
  .order-md-4 {
    order: 4 !important;
  }
  .order-md-5 {
    order: 5 !important;
  }
  .order-md-last {
    order: 6 !important;
  }
  .m-md-0 {
    margin: 0 !important;
  }
  .m-md-1 {
    margin: 0.25rem !important;
  }
  .m-md-2 {
    margin: 0.5rem !important;
  }
  .m-md-3 {
    margin: 1rem !important;
  }
  .m-md-4 {
    margin: 1.5rem !important;
  }
  .m-md-5 {
    margin: 3rem !important;
  }
  .m-md-6 {
    margin: 5rem !important;
  }
  .m-md-7 {
    margin: 8rem !important;
  }
  .m-md-8 {
    margin: 10rem !important;
  }
  .m-md-9 {
    margin: 15rem !important;
  }
  .m-md-10 {
    margin: 20rem !important;
  }
  .m-md-auto {
    margin: auto !important;
  }
  .mx-md-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-md-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-md-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-md-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-md-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-md-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-md-6 {
    margin-right: 5rem !important;
    margin-left: 5rem !important;
  }
  .mx-md-7 {
    margin-right: 8rem !important;
    margin-left: 8rem !important;
  }
  .mx-md-8 {
    margin-right: 10rem !important;
    margin-left: 10rem !important;
  }
  .mx-md-9 {
    margin-right: 15rem !important;
    margin-left: 15rem !important;
  }
  .mx-md-10 {
    margin-right: 20rem !important;
    margin-left: 20rem !important;
  }
  .mx-md-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-md-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-md-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-md-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-md-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-md-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-md-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-md-6 {
    margin-top: 5rem !important;
    margin-bottom: 5rem !important;
  }
  .my-md-7 {
    margin-top: 8rem !important;
    margin-bottom: 8rem !important;
  }
  .my-md-8 {
    margin-top: 10rem !important;
    margin-bottom: 10rem !important;
  }
  .my-md-9 {
    margin-top: 15rem !important;
    margin-bottom: 15rem !important;
  }
  .my-md-10 {
    margin-top: 20rem !important;
    margin-bottom: 20rem !important;
  }
  .my-md-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-md-0 {
    margin-top: 0 !important;
  }
  .mt-md-1 {
    margin-top: 0.25rem !important;
  }
  .mt-md-2 {
    margin-top: 0.5rem !important;
  }
  .mt-md-3 {
    margin-top: 1rem !important;
  }
  .mt-md-4 {
    margin-top: 1.5rem !important;
  }
  .mt-md-5 {
    margin-top: 3rem !important;
  }
  .mt-md-6 {
    margin-top: 5rem !important;
  }
  .mt-md-7 {
    margin-top: 8rem !important;
  }
  .mt-md-8 {
    margin-top: 10rem !important;
  }
  .mt-md-9 {
    margin-top: 15rem !important;
  }
  .mt-md-10 {
    margin-top: 20rem !important;
  }
  .mt-md-auto {
    margin-top: auto !important;
  }
  .me-md-0 {
    margin-right: 0 !important;
  }
  .me-md-1 {
    margin-right: 0.25rem !important;
  }
  .me-md-2 {
    margin-right: 0.5rem !important;
  }
  .me-md-3 {
    margin-right: 1rem !important;
  }
  .me-md-4 {
    margin-right: 1.5rem !important;
  }
  .me-md-5 {
    margin-right: 3rem !important;
  }
  .me-md-6 {
    margin-right: 5rem !important;
  }
  .me-md-7 {
    margin-right: 8rem !important;
  }
  .me-md-8 {
    margin-right: 10rem !important;
  }
  .me-md-9 {
    margin-right: 15rem !important;
  }
  .me-md-10 {
    margin-right: 20rem !important;
  }
  .me-md-auto {
    margin-right: auto !important;
  }
  .mb-md-0 {
    margin-bottom: 0 !important;
  }
  .mb-md-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-md-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-md-3 {
    margin-bottom: 1rem !important;
  }
  .mb-md-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-md-5 {
    margin-bottom: 3rem !important;
  }
  .mb-md-6 {
    margin-bottom: 5rem !important;
  }
  .mb-md-7 {
    margin-bottom: 8rem !important;
  }
  .mb-md-8 {
    margin-bottom: 10rem !important;
  }
  .mb-md-9 {
    margin-bottom: 15rem !important;
  }
  .mb-md-10 {
    margin-bottom: 20rem !important;
  }
  .mb-md-auto {
    margin-bottom: auto !important;
  }
  .ms-md-0 {
    margin-left: 0 !important;
  }
  .ms-md-1 {
    margin-left: 0.25rem !important;
  }
  .ms-md-2 {
    margin-left: 0.5rem !important;
  }
  .ms-md-3 {
    margin-left: 1rem !important;
  }
  .ms-md-4 {
    margin-left: 1.5rem !important;
  }
  .ms-md-5 {
    margin-left: 3rem !important;
  }
  .ms-md-6 {
    margin-left: 5rem !important;
  }
  .ms-md-7 {
    margin-left: 8rem !important;
  }
  .ms-md-8 {
    margin-left: 10rem !important;
  }
  .ms-md-9 {
    margin-left: 15rem !important;
  }
  .ms-md-10 {
    margin-left: 20rem !important;
  }
  .ms-md-auto {
    margin-left: auto !important;
  }
  .p-md-0 {
    padding: 0 !important;
  }
  .p-md-1 {
    padding: 0.25rem !important;
  }
  .p-md-2 {
    padding: 0.5rem !important;
  }
  .p-md-3 {
    padding: 1rem !important;
  }
  .p-md-4 {
    padding: 1.5rem !important;
  }
  .p-md-5 {
    padding: 3rem !important;
  }
  .p-md-6 {
    padding: 5rem !important;
  }
  .p-md-7 {
    padding: 8rem !important;
  }
  .p-md-8 {
    padding: 10rem !important;
  }
  .p-md-9 {
    padding: 15rem !important;
  }
  .p-md-10 {
    padding: 20rem !important;
  }
  .px-md-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-md-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-md-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-md-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-md-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-md-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .px-md-6 {
    padding-right: 5rem !important;
    padding-left: 5rem !important;
  }
  .px-md-7 {
    padding-right: 8rem !important;
    padding-left: 8rem !important;
  }
  .px-md-8 {
    padding-right: 10rem !important;
    padding-left: 10rem !important;
  }
  .px-md-9 {
    padding-right: 15rem !important;
    padding-left: 15rem !important;
  }
  .px-md-10 {
    padding-right: 20rem !important;
    padding-left: 20rem !important;
  }
  .py-md-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-md-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-md-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-md-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-md-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-md-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .py-md-6 {
    padding-top: 5rem !important;
    padding-bottom: 5rem !important;
  }
  .py-md-7 {
    padding-top: 8rem !important;
    padding-bottom: 8rem !important;
  }
  .py-md-8 {
    padding-top: 10rem !important;
    padding-bottom: 10rem !important;
  }
  .py-md-9 {
    padding-top: 15rem !important;
    padding-bottom: 15rem !important;
  }
  .py-md-10 {
    padding-top: 20rem !important;
    padding-bottom: 20rem !important;
  }
  .pt-md-0 {
    padding-top: 0 !important;
  }
  .pt-md-1 {
    padding-top: 0.25rem !important;
  }
  .pt-md-2 {
    padding-top: 0.5rem !important;
  }
  .pt-md-3 {
    padding-top: 1rem !important;
  }
  .pt-md-4 {
    padding-top: 1.5rem !important;
  }
  .pt-md-5 {
    padding-top: 3rem !important;
  }
  .pt-md-6 {
    padding-top: 5rem !important;
  }
  .pt-md-7 {
    padding-top: 8rem !important;
  }
  .pt-md-8 {
    padding-top: 10rem !important;
  }
  .pt-md-9 {
    padding-top: 15rem !important;
  }
  .pt-md-10 {
    padding-top: 20rem !important;
  }
  .pe-md-0 {
    padding-right: 0 !important;
  }
  .pe-md-1 {
    padding-right: 0.25rem !important;
  }
  .pe-md-2 {
    padding-right: 0.5rem !important;
  }
  .pe-md-3 {
    padding-right: 1rem !important;
  }
  .pe-md-4 {
    padding-right: 1.5rem !important;
  }
  .pe-md-5 {
    padding-right: 3rem !important;
  }
  .pe-md-6 {
    padding-right: 5rem !important;
  }
  .pe-md-7 {
    padding-right: 8rem !important;
  }
  .pe-md-8 {
    padding-right: 10rem !important;
  }
  .pe-md-9 {
    padding-right: 15rem !important;
  }
  .pe-md-10 {
    padding-right: 20rem !important;
  }
  .pb-md-0 {
    padding-bottom: 0 !important;
  }
  .pb-md-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-md-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-md-3 {
    padding-bottom: 1rem !important;
  }
  .pb-md-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-md-5 {
    padding-bottom: 3rem !important;
  }
  .pb-md-6 {
    padding-bottom: 5rem !important;
  }
  .pb-md-7 {
    padding-bottom: 8rem !important;
  }
  .pb-md-8 {
    padding-bottom: 10rem !important;
  }
  .pb-md-9 {
    padding-bottom: 15rem !important;
  }
  .pb-md-10 {
    padding-bottom: 20rem !important;
  }
  .ps-md-0 {
    padding-left: 0 !important;
  }
  .ps-md-1 {
    padding-left: 0.25rem !important;
  }
  .ps-md-2 {
    padding-left: 0.5rem !important;
  }
  .ps-md-3 {
    padding-left: 1rem !important;
  }
  .ps-md-4 {
    padding-left: 1.5rem !important;
  }
  .ps-md-5 {
    padding-left: 3rem !important;
  }
  .ps-md-6 {
    padding-left: 5rem !important;
  }
  .ps-md-7 {
    padding-left: 8rem !important;
  }
  .ps-md-8 {
    padding-left: 10rem !important;
  }
  .ps-md-9 {
    padding-left: 15rem !important;
  }
  .ps-md-10 {
    padding-left: 20rem !important;
  }
  .gap-md-0 {
    gap: 0 !important;
  }
  .gap-md-1 {
    gap: 0.25rem !important;
  }
  .gap-md-2 {
    gap: 0.5rem !important;
  }
  .gap-md-3 {
    gap: 1rem !important;
  }
  .gap-md-4 {
    gap: 1.5rem !important;
  }
  .gap-md-5 {
    gap: 3rem !important;
  }
  .gap-md-6 {
    gap: 5rem !important;
  }
  .gap-md-7 {
    gap: 8rem !important;
  }
  .gap-md-8 {
    gap: 10rem !important;
  }
  .gap-md-9 {
    gap: 15rem !important;
  }
  .gap-md-10 {
    gap: 20rem !important;
  }
  .row-gap-md-0 {
    row-gap: 0 !important;
  }
  .row-gap-md-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-md-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-md-3 {
    row-gap: 1rem !important;
  }
  .row-gap-md-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-md-5 {
    row-gap: 3rem !important;
  }
  .row-gap-md-6 {
    row-gap: 5rem !important;
  }
  .row-gap-md-7 {
    row-gap: 8rem !important;
  }
  .row-gap-md-8 {
    row-gap: 10rem !important;
  }
  .row-gap-md-9 {
    row-gap: 15rem !important;
  }
  .row-gap-md-10 {
    row-gap: 20rem !important;
  }
  .column-gap-md-0 {
    column-gap: 0 !important;
  }
  .column-gap-md-1 {
    column-gap: 0.25rem !important;
  }
  .column-gap-md-2 {
    column-gap: 0.5rem !important;
  }
  .column-gap-md-3 {
    column-gap: 1rem !important;
  }
  .column-gap-md-4 {
    column-gap: 1.5rem !important;
  }
  .column-gap-md-5 {
    column-gap: 3rem !important;
  }
  .column-gap-md-6 {
    column-gap: 5rem !important;
  }
  .column-gap-md-7 {
    column-gap: 8rem !important;
  }
  .column-gap-md-8 {
    column-gap: 10rem !important;
  }
  .column-gap-md-9 {
    column-gap: 15rem !important;
  }
  .column-gap-md-10 {
    column-gap: 20rem !important;
  }
  .text-md-start {
    text-align: left !important;
  }
  .text-md-end {
    text-align: right !important;
  }
  .text-md-center {
    text-align: center !important;
  }
}
@media (min-width: 992px) {
  .float-lg-start {
    float: left !important;
  }
  .float-lg-end {
    float: right !important;
  }
  .float-lg-none {
    float: none !important;
  }
  .object-fit-lg-contain {
    object-fit: contain !important;
  }
  .object-fit-lg-cover {
    object-fit: cover !important;
  }
  .object-fit-lg-fill {
    object-fit: fill !important;
  }
  .object-fit-lg-scale {
    object-fit: scale-down !important;
  }
  .object-fit-lg-none {
    object-fit: none !important;
  }
  .d-lg-inline {
    display: inline !important;
  }
  .d-lg-inline-block {
    display: inline-block !important;
  }
  .d-lg-block {
    display: block !important;
  }
  .d-lg-grid {
    display: grid !important;
  }
  .d-lg-inline-grid {
    display: inline-grid !important;
  }
  .d-lg-table {
    display: table !important;
  }
  .d-lg-table-row {
    display: table-row !important;
  }
  .d-lg-table-cell {
    display: table-cell !important;
  }
  .d-lg-flex {
    display: flex !important;
  }
  .d-lg-inline-flex {
    display: inline-flex !important;
  }
  .d-lg-none {
    display: none !important;
  }
  .flex-lg-fill {
    flex: 1 1 auto !important;
  }
  .flex-lg-row {
    flex-direction: row !important;
  }
  .flex-lg-column {
    flex-direction: column !important;
  }
  .flex-lg-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-lg-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-lg-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-lg-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-lg-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-lg-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-lg-wrap {
    flex-wrap: wrap !important;
  }
  .flex-lg-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-lg-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-lg-start {
    justify-content: flex-start !important;
  }
  .justify-content-lg-end {
    justify-content: flex-end !important;
  }
  .justify-content-lg-center {
    justify-content: center !important;
  }
  .justify-content-lg-between {
    justify-content: space-between !important;
  }
  .justify-content-lg-around {
    justify-content: space-around !important;
  }
  .justify-content-lg-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-lg-start {
    align-items: flex-start !important;
  }
  .align-items-lg-end {
    align-items: flex-end !important;
  }
  .align-items-lg-center {
    align-items: center !important;
  }
  .align-items-lg-baseline {
    align-items: baseline !important;
  }
  .align-items-lg-stretch {
    align-items: stretch !important;
  }
  .align-content-lg-start {
    align-content: flex-start !important;
  }
  .align-content-lg-end {
    align-content: flex-end !important;
  }
  .align-content-lg-center {
    align-content: center !important;
  }
  .align-content-lg-between {
    align-content: space-between !important;
  }
  .align-content-lg-around {
    align-content: space-around !important;
  }
  .align-content-lg-stretch {
    align-content: stretch !important;
  }
  .align-self-lg-auto {
    align-self: auto !important;
  }
  .align-self-lg-start {
    align-self: flex-start !important;
  }
  .align-self-lg-end {
    align-self: flex-end !important;
  }
  .align-self-lg-center {
    align-self: center !important;
  }
  .align-self-lg-baseline {
    align-self: baseline !important;
  }
  .align-self-lg-stretch {
    align-self: stretch !important;
  }
  .order-lg-first {
    order: -1 !important;
  }
  .order-lg-0 {
    order: 0 !important;
  }
  .order-lg-1 {
    order: 1 !important;
  }
  .order-lg-2 {
    order: 2 !important;
  }
  .order-lg-3 {
    order: 3 !important;
  }
  .order-lg-4 {
    order: 4 !important;
  }
  .order-lg-5 {
    order: 5 !important;
  }
  .order-lg-last {
    order: 6 !important;
  }
  .m-lg-0 {
    margin: 0 !important;
  }
  .m-lg-1 {
    margin: 0.25rem !important;
  }
  .m-lg-2 {
    margin: 0.5rem !important;
  }
  .m-lg-3 {
    margin: 1rem !important;
  }
  .m-lg-4 {
    margin: 1.5rem !important;
  }
  .m-lg-5 {
    margin: 3rem !important;
  }
  .m-lg-6 {
    margin: 5rem !important;
  }
  .m-lg-7 {
    margin: 8rem !important;
  }
  .m-lg-8 {
    margin: 10rem !important;
  }
  .m-lg-9 {
    margin: 15rem !important;
  }
  .m-lg-10 {
    margin: 20rem !important;
  }
  .m-lg-auto {
    margin: auto !important;
  }
  .mx-lg-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-lg-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-lg-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-lg-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-lg-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-lg-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-lg-6 {
    margin-right: 5rem !important;
    margin-left: 5rem !important;
  }
  .mx-lg-7 {
    margin-right: 8rem !important;
    margin-left: 8rem !important;
  }
  .mx-lg-8 {
    margin-right: 10rem !important;
    margin-left: 10rem !important;
  }
  .mx-lg-9 {
    margin-right: 15rem !important;
    margin-left: 15rem !important;
  }
  .mx-lg-10 {
    margin-right: 20rem !important;
    margin-left: 20rem !important;
  }
  .mx-lg-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-lg-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-lg-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-lg-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-lg-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-lg-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-lg-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-lg-6 {
    margin-top: 5rem !important;
    margin-bottom: 5rem !important;
  }
  .my-lg-7 {
    margin-top: 8rem !important;
    margin-bottom: 8rem !important;
  }
  .my-lg-8 {
    margin-top: 10rem !important;
    margin-bottom: 10rem !important;
  }
  .my-lg-9 {
    margin-top: 15rem !important;
    margin-bottom: 15rem !important;
  }
  .my-lg-10 {
    margin-top: 20rem !important;
    margin-bottom: 20rem !important;
  }
  .my-lg-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-lg-0 {
    margin-top: 0 !important;
  }
  .mt-lg-1 {
    margin-top: 0.25rem !important;
  }
  .mt-lg-2 {
    margin-top: 0.5rem !important;
  }
  .mt-lg-3 {
    margin-top: 1rem !important;
  }
  .mt-lg-4 {
    margin-top: 1.5rem !important;
  }
  .mt-lg-5 {
    margin-top: 3rem !important;
  }
  .mt-lg-6 {
    margin-top: 5rem !important;
  }
  .mt-lg-7 {
    margin-top: 8rem !important;
  }
  .mt-lg-8 {
    margin-top: 10rem !important;
  }
  .mt-lg-9 {
    margin-top: 15rem !important;
  }
  .mt-lg-10 {
    margin-top: 20rem !important;
  }
  .mt-lg-auto {
    margin-top: auto !important;
  }
  .me-lg-0 {
    margin-right: 0 !important;
  }
  .me-lg-1 {
    margin-right: 0.25rem !important;
  }
  .me-lg-2 {
    margin-right: 0.5rem !important;
  }
  .me-lg-3 {
    margin-right: 1rem !important;
  }
  .me-lg-4 {
    margin-right: 1.5rem !important;
  }
  .me-lg-5 {
    margin-right: 3rem !important;
  }
  .me-lg-6 {
    margin-right: 5rem !important;
  }
  .me-lg-7 {
    margin-right: 8rem !important;
  }
  .me-lg-8 {
    margin-right: 10rem !important;
  }
  .me-lg-9 {
    margin-right: 15rem !important;
  }
  .me-lg-10 {
    margin-right: 20rem !important;
  }
  .me-lg-auto {
    margin-right: auto !important;
  }
  .mb-lg-0 {
    margin-bottom: 0 !important;
  }
  .mb-lg-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-lg-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-lg-3 {
    margin-bottom: 1rem !important;
  }
  .mb-lg-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-lg-5 {
    margin-bottom: 3rem !important;
  }
  .mb-lg-6 {
    margin-bottom: 5rem !important;
  }
  .mb-lg-7 {
    margin-bottom: 8rem !important;
  }
  .mb-lg-8 {
    margin-bottom: 10rem !important;
  }
  .mb-lg-9 {
    margin-bottom: 15rem !important;
  }
  .mb-lg-10 {
    margin-bottom: 20rem !important;
  }
  .mb-lg-auto {
    margin-bottom: auto !important;
  }
  .ms-lg-0 {
    margin-left: 0 !important;
  }
  .ms-lg-1 {
    margin-left: 0.25rem !important;
  }
  .ms-lg-2 {
    margin-left: 0.5rem !important;
  }
  .ms-lg-3 {
    margin-left: 1rem !important;
  }
  .ms-lg-4 {
    margin-left: 1.5rem !important;
  }
  .ms-lg-5 {
    margin-left: 3rem !important;
  }
  .ms-lg-6 {
    margin-left: 5rem !important;
  }
  .ms-lg-7 {
    margin-left: 8rem !important;
  }
  .ms-lg-8 {
    margin-left: 10rem !important;
  }
  .ms-lg-9 {
    margin-left: 15rem !important;
  }
  .ms-lg-10 {
    margin-left: 20rem !important;
  }
  .ms-lg-auto {
    margin-left: auto !important;
  }
  .p-lg-0 {
    padding: 0 !important;
  }
  .p-lg-1 {
    padding: 0.25rem !important;
  }
  .p-lg-2 {
    padding: 0.5rem !important;
  }
  .p-lg-3 {
    padding: 1rem !important;
  }
  .p-lg-4 {
    padding: 1.5rem !important;
  }
  .p-lg-5 {
    padding: 3rem !important;
  }
  .p-lg-6 {
    padding: 5rem !important;
  }
  .p-lg-7 {
    padding: 8rem !important;
  }
  .p-lg-8 {
    padding: 10rem !important;
  }
  .p-lg-9 {
    padding: 15rem !important;
  }
  .p-lg-10 {
    padding: 20rem !important;
  }
  .px-lg-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-lg-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-lg-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-lg-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-lg-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-lg-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .px-lg-6 {
    padding-right: 5rem !important;
    padding-left: 5rem !important;
  }
  .px-lg-7 {
    padding-right: 8rem !important;
    padding-left: 8rem !important;
  }
  .px-lg-8 {
    padding-right: 10rem !important;
    padding-left: 10rem !important;
  }
  .px-lg-9 {
    padding-right: 15rem !important;
    padding-left: 15rem !important;
  }
  .px-lg-10 {
    padding-right: 20rem !important;
    padding-left: 20rem !important;
  }
  .py-lg-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-lg-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-lg-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-lg-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-lg-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-lg-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .py-lg-6 {
    padding-top: 5rem !important;
    padding-bottom: 5rem !important;
  }
  .py-lg-7 {
    padding-top: 8rem !important;
    padding-bottom: 8rem !important;
  }
  .py-lg-8 {
    padding-top: 10rem !important;
    padding-bottom: 10rem !important;
  }
  .py-lg-9 {
    padding-top: 15rem !important;
    padding-bottom: 15rem !important;
  }
  .py-lg-10 {
    padding-top: 20rem !important;
    padding-bottom: 20rem !important;
  }
  .pt-lg-0 {
    padding-top: 0 !important;
  }
  .pt-lg-1 {
    padding-top: 0.25rem !important;
  }
  .pt-lg-2 {
    padding-top: 0.5rem !important;
  }
  .pt-lg-3 {
    padding-top: 1rem !important;
  }
  .pt-lg-4 {
    padding-top: 1.5rem !important;
  }
  .pt-lg-5 {
    padding-top: 3rem !important;
  }
  .pt-lg-6 {
    padding-top: 5rem !important;
  }
  .pt-lg-7 {
    padding-top: 8rem !important;
  }
  .pt-lg-8 {
    padding-top: 10rem !important;
  }
  .pt-lg-9 {
    padding-top: 15rem !important;
  }
  .pt-lg-10 {
    padding-top: 20rem !important;
  }
  .pe-lg-0 {
    padding-right: 0 !important;
  }
  .pe-lg-1 {
    padding-right: 0.25rem !important;
  }
  .pe-lg-2 {
    padding-right: 0.5rem !important;
  }
  .pe-lg-3 {
    padding-right: 1rem !important;
  }
  .pe-lg-4 {
    padding-right: 1.5rem !important;
  }
  .pe-lg-5 {
    padding-right: 3rem !important;
  }
  .pe-lg-6 {
    padding-right: 5rem !important;
  }
  .pe-lg-7 {
    padding-right: 8rem !important;
  }
  .pe-lg-8 {
    padding-right: 10rem !important;
  }
  .pe-lg-9 {
    padding-right: 15rem !important;
  }
  .pe-lg-10 {
    padding-right: 20rem !important;
  }
  .pb-lg-0 {
    padding-bottom: 0 !important;
  }
  .pb-lg-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-lg-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-lg-3 {
    padding-bottom: 1rem !important;
  }
  .pb-lg-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-lg-5 {
    padding-bottom: 3rem !important;
  }
  .pb-lg-6 {
    padding-bottom: 5rem !important;
  }
  .pb-lg-7 {
    padding-bottom: 8rem !important;
  }
  .pb-lg-8 {
    padding-bottom: 10rem !important;
  }
  .pb-lg-9 {
    padding-bottom: 15rem !important;
  }
  .pb-lg-10 {
    padding-bottom: 20rem !important;
  }
  .ps-lg-0 {
    padding-left: 0 !important;
  }
  .ps-lg-1 {
    padding-left: 0.25rem !important;
  }
  .ps-lg-2 {
    padding-left: 0.5rem !important;
  }
  .ps-lg-3 {
    padding-left: 1rem !important;
  }
  .ps-lg-4 {
    padding-left: 1.5rem !important;
  }
  .ps-lg-5 {
    padding-left: 3rem !important;
  }
  .ps-lg-6 {
    padding-left: 5rem !important;
  }
  .ps-lg-7 {
    padding-left: 8rem !important;
  }
  .ps-lg-8 {
    padding-left: 10rem !important;
  }
  .ps-lg-9 {
    padding-left: 15rem !important;
  }
  .ps-lg-10 {
    padding-left: 20rem !important;
  }
  .gap-lg-0 {
    gap: 0 !important;
  }
  .gap-lg-1 {
    gap: 0.25rem !important;
  }
  .gap-lg-2 {
    gap: 0.5rem !important;
  }
  .gap-lg-3 {
    gap: 1rem !important;
  }
  .gap-lg-4 {
    gap: 1.5rem !important;
  }
  .gap-lg-5 {
    gap: 3rem !important;
  }
  .gap-lg-6 {
    gap: 5rem !important;
  }
  .gap-lg-7 {
    gap: 8rem !important;
  }
  .gap-lg-8 {
    gap: 10rem !important;
  }
  .gap-lg-9 {
    gap: 15rem !important;
  }
  .gap-lg-10 {
    gap: 20rem !important;
  }
  .row-gap-lg-0 {
    row-gap: 0 !important;
  }
  .row-gap-lg-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-lg-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-lg-3 {
    row-gap: 1rem !important;
  }
  .row-gap-lg-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-lg-5 {
    row-gap: 3rem !important;
  }
  .row-gap-lg-6 {
    row-gap: 5rem !important;
  }
  .row-gap-lg-7 {
    row-gap: 8rem !important;
  }
  .row-gap-lg-8 {
    row-gap: 10rem !important;
  }
  .row-gap-lg-9 {
    row-gap: 15rem !important;
  }
  .row-gap-lg-10 {
    row-gap: 20rem !important;
  }
  .column-gap-lg-0 {
    column-gap: 0 !important;
  }
  .column-gap-lg-1 {
    column-gap: 0.25rem !important;
  }
  .column-gap-lg-2 {
    column-gap: 0.5rem !important;
  }
  .column-gap-lg-3 {
    column-gap: 1rem !important;
  }
  .column-gap-lg-4 {
    column-gap: 1.5rem !important;
  }
  .column-gap-lg-5 {
    column-gap: 3rem !important;
  }
  .column-gap-lg-6 {
    column-gap: 5rem !important;
  }
  .column-gap-lg-7 {
    column-gap: 8rem !important;
  }
  .column-gap-lg-8 {
    column-gap: 10rem !important;
  }
  .column-gap-lg-9 {
    column-gap: 15rem !important;
  }
  .column-gap-lg-10 {
    column-gap: 20rem !important;
  }
  .text-lg-start {
    text-align: left !important;
  }
  .text-lg-end {
    text-align: right !important;
  }
  .text-lg-center {
    text-align: center !important;
  }
}
@media (min-width: 1200px) {
  .float-xl-start {
    float: left !important;
  }
  .float-xl-end {
    float: right !important;
  }
  .float-xl-none {
    float: none !important;
  }
  .object-fit-xl-contain {
    object-fit: contain !important;
  }
  .object-fit-xl-cover {
    object-fit: cover !important;
  }
  .object-fit-xl-fill {
    object-fit: fill !important;
  }
  .object-fit-xl-scale {
    object-fit: scale-down !important;
  }
  .object-fit-xl-none {
    object-fit: none !important;
  }
  .d-xl-inline {
    display: inline !important;
  }
  .d-xl-inline-block {
    display: inline-block !important;
  }
  .d-xl-block {
    display: block !important;
  }
  .d-xl-grid {
    display: grid !important;
  }
  .d-xl-inline-grid {
    display: inline-grid !important;
  }
  .d-xl-table {
    display: table !important;
  }
  .d-xl-table-row {
    display: table-row !important;
  }
  .d-xl-table-cell {
    display: table-cell !important;
  }
  .d-xl-flex {
    display: flex !important;
  }
  .d-xl-inline-flex {
    display: inline-flex !important;
  }
  .d-xl-none {
    display: none !important;
  }
  .flex-xl-fill {
    flex: 1 1 auto !important;
  }
  .flex-xl-row {
    flex-direction: row !important;
  }
  .flex-xl-column {
    flex-direction: column !important;
  }
  .flex-xl-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-xl-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-xl-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-xl-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-xl-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-xl-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-xl-wrap {
    flex-wrap: wrap !important;
  }
  .flex-xl-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-xl-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-xl-start {
    justify-content: flex-start !important;
  }
  .justify-content-xl-end {
    justify-content: flex-end !important;
  }
  .justify-content-xl-center {
    justify-content: center !important;
  }
  .justify-content-xl-between {
    justify-content: space-between !important;
  }
  .justify-content-xl-around {
    justify-content: space-around !important;
  }
  .justify-content-xl-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-xl-start {
    align-items: flex-start !important;
  }
  .align-items-xl-end {
    align-items: flex-end !important;
  }
  .align-items-xl-center {
    align-items: center !important;
  }
  .align-items-xl-baseline {
    align-items: baseline !important;
  }
  .align-items-xl-stretch {
    align-items: stretch !important;
  }
  .align-content-xl-start {
    align-content: flex-start !important;
  }
  .align-content-xl-end {
    align-content: flex-end !important;
  }
  .align-content-xl-center {
    align-content: center !important;
  }
  .align-content-xl-between {
    align-content: space-between !important;
  }
  .align-content-xl-around {
    align-content: space-around !important;
  }
  .align-content-xl-stretch {
    align-content: stretch !important;
  }
  .align-self-xl-auto {
    align-self: auto !important;
  }
  .align-self-xl-start {
    align-self: flex-start !important;
  }
  .align-self-xl-end {
    align-self: flex-end !important;
  }
  .align-self-xl-center {
    align-self: center !important;
  }
  .align-self-xl-baseline {
    align-self: baseline !important;
  }
  .align-self-xl-stretch {
    align-self: stretch !important;
  }
  .order-xl-first {
    order: -1 !important;
  }
  .order-xl-0 {
    order: 0 !important;
  }
  .order-xl-1 {
    order: 1 !important;
  }
  .order-xl-2 {
    order: 2 !important;
  }
  .order-xl-3 {
    order: 3 !important;
  }
  .order-xl-4 {
    order: 4 !important;
  }
  .order-xl-5 {
    order: 5 !important;
  }
  .order-xl-last {
    order: 6 !important;
  }
  .m-xl-0 {
    margin: 0 !important;
  }
  .m-xl-1 {
    margin: 0.25rem !important;
  }
  .m-xl-2 {
    margin: 0.5rem !important;
  }
  .m-xl-3 {
    margin: 1rem !important;
  }
  .m-xl-4 {
    margin: 1.5rem !important;
  }
  .m-xl-5 {
    margin: 3rem !important;
  }
  .m-xl-6 {
    margin: 5rem !important;
  }
  .m-xl-7 {
    margin: 8rem !important;
  }
  .m-xl-8 {
    margin: 10rem !important;
  }
  .m-xl-9 {
    margin: 15rem !important;
  }
  .m-xl-10 {
    margin: 20rem !important;
  }
  .m-xl-auto {
    margin: auto !important;
  }
  .mx-xl-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-xl-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-xl-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-xl-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-xl-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-xl-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-xl-6 {
    margin-right: 5rem !important;
    margin-left: 5rem !important;
  }
  .mx-xl-7 {
    margin-right: 8rem !important;
    margin-left: 8rem !important;
  }
  .mx-xl-8 {
    margin-right: 10rem !important;
    margin-left: 10rem !important;
  }
  .mx-xl-9 {
    margin-right: 15rem !important;
    margin-left: 15rem !important;
  }
  .mx-xl-10 {
    margin-right: 20rem !important;
    margin-left: 20rem !important;
  }
  .mx-xl-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-xl-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-xl-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-xl-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-xl-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-xl-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-xl-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-xl-6 {
    margin-top: 5rem !important;
    margin-bottom: 5rem !important;
  }
  .my-xl-7 {
    margin-top: 8rem !important;
    margin-bottom: 8rem !important;
  }
  .my-xl-8 {
    margin-top: 10rem !important;
    margin-bottom: 10rem !important;
  }
  .my-xl-9 {
    margin-top: 15rem !important;
    margin-bottom: 15rem !important;
  }
  .my-xl-10 {
    margin-top: 20rem !important;
    margin-bottom: 20rem !important;
  }
  .my-xl-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-xl-0 {
    margin-top: 0 !important;
  }
  .mt-xl-1 {
    margin-top: 0.25rem !important;
  }
  .mt-xl-2 {
    margin-top: 0.5rem !important;
  }
  .mt-xl-3 {
    margin-top: 1rem !important;
  }
  .mt-xl-4 {
    margin-top: 1.5rem !important;
  }
  .mt-xl-5 {
    margin-top: 3rem !important;
  }
  .mt-xl-6 {
    margin-top: 5rem !important;
  }
  .mt-xl-7 {
    margin-top: 8rem !important;
  }
  .mt-xl-8 {
    margin-top: 10rem !important;
  }
  .mt-xl-9 {
    margin-top: 15rem !important;
  }
  .mt-xl-10 {
    margin-top: 20rem !important;
  }
  .mt-xl-auto {
    margin-top: auto !important;
  }
  .me-xl-0 {
    margin-right: 0 !important;
  }
  .me-xl-1 {
    margin-right: 0.25rem !important;
  }
  .me-xl-2 {
    margin-right: 0.5rem !important;
  }
  .me-xl-3 {
    margin-right: 1rem !important;
  }
  .me-xl-4 {
    margin-right: 1.5rem !important;
  }
  .me-xl-5 {
    margin-right: 3rem !important;
  }
  .me-xl-6 {
    margin-right: 5rem !important;
  }
  .me-xl-7 {
    margin-right: 8rem !important;
  }
  .me-xl-8 {
    margin-right: 10rem !important;
  }
  .me-xl-9 {
    margin-right: 15rem !important;
  }
  .me-xl-10 {
    margin-right: 20rem !important;
  }
  .me-xl-auto {
    margin-right: auto !important;
  }
  .mb-xl-0 {
    margin-bottom: 0 !important;
  }
  .mb-xl-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-xl-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-xl-3 {
    margin-bottom: 1rem !important;
  }
  .mb-xl-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-xl-5 {
    margin-bottom: 3rem !important;
  }
  .mb-xl-6 {
    margin-bottom: 5rem !important;
  }
  .mb-xl-7 {
    margin-bottom: 8rem !important;
  }
  .mb-xl-8 {
    margin-bottom: 10rem !important;
  }
  .mb-xl-9 {
    margin-bottom: 15rem !important;
  }
  .mb-xl-10 {
    margin-bottom: 20rem !important;
  }
  .mb-xl-auto {
    margin-bottom: auto !important;
  }
  .ms-xl-0 {
    margin-left: 0 !important;
  }
  .ms-xl-1 {
    margin-left: 0.25rem !important;
  }
  .ms-xl-2 {
    margin-left: 0.5rem !important;
  }
  .ms-xl-3 {
    margin-left: 1rem !important;
  }
  .ms-xl-4 {
    margin-left: 1.5rem !important;
  }
  .ms-xl-5 {
    margin-left: 3rem !important;
  }
  .ms-xl-6 {
    margin-left: 5rem !important;
  }
  .ms-xl-7 {
    margin-left: 8rem !important;
  }
  .ms-xl-8 {
    margin-left: 10rem !important;
  }
  .ms-xl-9 {
    margin-left: 15rem !important;
  }
  .ms-xl-10 {
    margin-left: 20rem !important;
  }
  .ms-xl-auto {
    margin-left: auto !important;
  }
  .p-xl-0 {
    padding: 0 !important;
  }
  .p-xl-1 {
    padding: 0.25rem !important;
  }
  .p-xl-2 {
    padding: 0.5rem !important;
  }
  .p-xl-3 {
    padding: 1rem !important;
  }
  .p-xl-4 {
    padding: 1.5rem !important;
  }
  .p-xl-5 {
    padding: 3rem !important;
  }
  .p-xl-6 {
    padding: 5rem !important;
  }
  .p-xl-7 {
    padding: 8rem !important;
  }
  .p-xl-8 {
    padding: 10rem !important;
  }
  .p-xl-9 {
    padding: 15rem !important;
  }
  .p-xl-10 {
    padding: 20rem !important;
  }
  .px-xl-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-xl-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-xl-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-xl-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-xl-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-xl-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .px-xl-6 {
    padding-right: 5rem !important;
    padding-left: 5rem !important;
  }
  .px-xl-7 {
    padding-right: 8rem !important;
    padding-left: 8rem !important;
  }
  .px-xl-8 {
    padding-right: 10rem !important;
    padding-left: 10rem !important;
  }
  .px-xl-9 {
    padding-right: 15rem !important;
    padding-left: 15rem !important;
  }
  .px-xl-10 {
    padding-right: 20rem !important;
    padding-left: 20rem !important;
  }
  .py-xl-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-xl-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-xl-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-xl-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-xl-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-xl-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .py-xl-6 {
    padding-top: 5rem !important;
    padding-bottom: 5rem !important;
  }
  .py-xl-7 {
    padding-top: 8rem !important;
    padding-bottom: 8rem !important;
  }
  .py-xl-8 {
    padding-top: 10rem !important;
    padding-bottom: 10rem !important;
  }
  .py-xl-9 {
    padding-top: 15rem !important;
    padding-bottom: 15rem !important;
  }
  .py-xl-10 {
    padding-top: 20rem !important;
    padding-bottom: 20rem !important;
  }
  .pt-xl-0 {
    padding-top: 0 !important;
  }
  .pt-xl-1 {
    padding-top: 0.25rem !important;
  }
  .pt-xl-2 {
    padding-top: 0.5rem !important;
  }
  .pt-xl-3 {
    padding-top: 1rem !important;
  }
  .pt-xl-4 {
    padding-top: 1.5rem !important;
  }
  .pt-xl-5 {
    padding-top: 3rem !important;
  }
  .pt-xl-6 {
    padding-top: 5rem !important;
  }
  .pt-xl-7 {
    padding-top: 8rem !important;
  }
  .pt-xl-8 {
    padding-top: 10rem !important;
  }
  .pt-xl-9 {
    padding-top: 15rem !important;
  }
  .pt-xl-10 {
    padding-top: 20rem !important;
  }
  .pe-xl-0 {
    padding-right: 0 !important;
  }
  .pe-xl-1 {
    padding-right: 0.25rem !important;
  }
  .pe-xl-2 {
    padding-right: 0.5rem !important;
  }
  .pe-xl-3 {
    padding-right: 1rem !important;
  }
  .pe-xl-4 {
    padding-right: 1.5rem !important;
  }
  .pe-xl-5 {
    padding-right: 3rem !important;
  }
  .pe-xl-6 {
    padding-right: 5rem !important;
  }
  .pe-xl-7 {
    padding-right: 8rem !important;
  }
  .pe-xl-8 {
    padding-right: 10rem !important;
  }
  .pe-xl-9 {
    padding-right: 15rem !important;
  }
  .pe-xl-10 {
    padding-right: 20rem !important;
  }
  .pb-xl-0 {
    padding-bottom: 0 !important;
  }
  .pb-xl-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-xl-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-xl-3 {
    padding-bottom: 1rem !important;
  }
  .pb-xl-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-xl-5 {
    padding-bottom: 3rem !important;
  }
  .pb-xl-6 {
    padding-bottom: 5rem !important;
  }
  .pb-xl-7 {
    padding-bottom: 8rem !important;
  }
  .pb-xl-8 {
    padding-bottom: 10rem !important;
  }
  .pb-xl-9 {
    padding-bottom: 15rem !important;
  }
  .pb-xl-10 {
    padding-bottom: 20rem !important;
  }
  .ps-xl-0 {
    padding-left: 0 !important;
  }
  .ps-xl-1 {
    padding-left: 0.25rem !important;
  }
  .ps-xl-2 {
    padding-left: 0.5rem !important;
  }
  .ps-xl-3 {
    padding-left: 1rem !important;
  }
  .ps-xl-4 {
    padding-left: 1.5rem !important;
  }
  .ps-xl-5 {
    padding-left: 3rem !important;
  }
  .ps-xl-6 {
    padding-left: 5rem !important;
  }
  .ps-xl-7 {
    padding-left: 8rem !important;
  }
  .ps-xl-8 {
    padding-left: 10rem !important;
  }
  .ps-xl-9 {
    padding-left: 15rem !important;
  }
  .ps-xl-10 {
    padding-left: 20rem !important;
  }
  .gap-xl-0 {
    gap: 0 !important;
  }
  .gap-xl-1 {
    gap: 0.25rem !important;
  }
  .gap-xl-2 {
    gap: 0.5rem !important;
  }
  .gap-xl-3 {
    gap: 1rem !important;
  }
  .gap-xl-4 {
    gap: 1.5rem !important;
  }
  .gap-xl-5 {
    gap: 3rem !important;
  }
  .gap-xl-6 {
    gap: 5rem !important;
  }
  .gap-xl-7 {
    gap: 8rem !important;
  }
  .gap-xl-8 {
    gap: 10rem !important;
  }
  .gap-xl-9 {
    gap: 15rem !important;
  }
  .gap-xl-10 {
    gap: 20rem !important;
  }
  .row-gap-xl-0 {
    row-gap: 0 !important;
  }
  .row-gap-xl-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-xl-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-xl-3 {
    row-gap: 1rem !important;
  }
  .row-gap-xl-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-xl-5 {
    row-gap: 3rem !important;
  }
  .row-gap-xl-6 {
    row-gap: 5rem !important;
  }
  .row-gap-xl-7 {
    row-gap: 8rem !important;
  }
  .row-gap-xl-8 {
    row-gap: 10rem !important;
  }
  .row-gap-xl-9 {
    row-gap: 15rem !important;
  }
  .row-gap-xl-10 {
    row-gap: 20rem !important;
  }
  .column-gap-xl-0 {
    column-gap: 0 !important;
  }
  .column-gap-xl-1 {
    column-gap: 0.25rem !important;
  }
  .column-gap-xl-2 {
    column-gap: 0.5rem !important;
  }
  .column-gap-xl-3 {
    column-gap: 1rem !important;
  }
  .column-gap-xl-4 {
    column-gap: 1.5rem !important;
  }
  .column-gap-xl-5 {
    column-gap: 3rem !important;
  }
  .column-gap-xl-6 {
    column-gap: 5rem !important;
  }
  .column-gap-xl-7 {
    column-gap: 8rem !important;
  }
  .column-gap-xl-8 {
    column-gap: 10rem !important;
  }
  .column-gap-xl-9 {
    column-gap: 15rem !important;
  }
  .column-gap-xl-10 {
    column-gap: 20rem !important;
  }
  .text-xl-start {
    text-align: left !important;
  }
  .text-xl-end {
    text-align: right !important;
  }
  .text-xl-center {
    text-align: center !important;
  }
}
@media (min-width: 1400px) {
  .float-xxl-start {
    float: left !important;
  }
  .float-xxl-end {
    float: right !important;
  }
  .float-xxl-none {
    float: none !important;
  }
  .object-fit-xxl-contain {
    object-fit: contain !important;
  }
  .object-fit-xxl-cover {
    object-fit: cover !important;
  }
  .object-fit-xxl-fill {
    object-fit: fill !important;
  }
  .object-fit-xxl-scale {
    object-fit: scale-down !important;
  }
  .object-fit-xxl-none {
    object-fit: none !important;
  }
  .d-xxl-inline {
    display: inline !important;
  }
  .d-xxl-inline-block {
    display: inline-block !important;
  }
  .d-xxl-block {
    display: block !important;
  }
  .d-xxl-grid {
    display: grid !important;
  }
  .d-xxl-inline-grid {
    display: inline-grid !important;
  }
  .d-xxl-table {
    display: table !important;
  }
  .d-xxl-table-row {
    display: table-row !important;
  }
  .d-xxl-table-cell {
    display: table-cell !important;
  }
  .d-xxl-flex {
    display: flex !important;
  }
  .d-xxl-inline-flex {
    display: inline-flex !important;
  }
  .d-xxl-none {
    display: none !important;
  }
  .flex-xxl-fill {
    flex: 1 1 auto !important;
  }
  .flex-xxl-row {
    flex-direction: row !important;
  }
  .flex-xxl-column {
    flex-direction: column !important;
  }
  .flex-xxl-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-xxl-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-xxl-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-xxl-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-xxl-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-xxl-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-xxl-wrap {
    flex-wrap: wrap !important;
  }
  .flex-xxl-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-xxl-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-xxl-start {
    justify-content: flex-start !important;
  }
  .justify-content-xxl-end {
    justify-content: flex-end !important;
  }
  .justify-content-xxl-center {
    justify-content: center !important;
  }
  .justify-content-xxl-between {
    justify-content: space-between !important;
  }
  .justify-content-xxl-around {
    justify-content: space-around !important;
  }
  .justify-content-xxl-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-xxl-start {
    align-items: flex-start !important;
  }
  .align-items-xxl-end {
    align-items: flex-end !important;
  }
  .align-items-xxl-center {
    align-items: center !important;
  }
  .align-items-xxl-baseline {
    align-items: baseline !important;
  }
  .align-items-xxl-stretch {
    align-items: stretch !important;
  }
  .align-content-xxl-start {
    align-content: flex-start !important;
  }
  .align-content-xxl-end {
    align-content: flex-end !important;
  }
  .align-content-xxl-center {
    align-content: center !important;
  }
  .align-content-xxl-between {
    align-content: space-between !important;
  }
  .align-content-xxl-around {
    align-content: space-around !important;
  }
  .align-content-xxl-stretch {
    align-content: stretch !important;
  }
  .align-self-xxl-auto {
    align-self: auto !important;
  }
  .align-self-xxl-start {
    align-self: flex-start !important;
  }
  .align-self-xxl-end {
    align-self: flex-end !important;
  }
  .align-self-xxl-center {
    align-self: center !important;
  }
  .align-self-xxl-baseline {
    align-self: baseline !important;
  }
  .align-self-xxl-stretch {
    align-self: stretch !important;
  }
  .order-xxl-first {
    order: -1 !important;
  }
  .order-xxl-0 {
    order: 0 !important;
  }
  .order-xxl-1 {
    order: 1 !important;
  }
  .order-xxl-2 {
    order: 2 !important;
  }
  .order-xxl-3 {
    order: 3 !important;
  }
  .order-xxl-4 {
    order: 4 !important;
  }
  .order-xxl-5 {
    order: 5 !important;
  }
  .order-xxl-last {
    order: 6 !important;
  }
  .m-xxl-0 {
    margin: 0 !important;
  }
  .m-xxl-1 {
    margin: 0.25rem !important;
  }
  .m-xxl-2 {
    margin: 0.5rem !important;
  }
  .m-xxl-3 {
    margin: 1rem !important;
  }
  .m-xxl-4 {
    margin: 1.5rem !important;
  }
  .m-xxl-5 {
    margin: 3rem !important;
  }
  .m-xxl-6 {
    margin: 5rem !important;
  }
  .m-xxl-7 {
    margin: 8rem !important;
  }
  .m-xxl-8 {
    margin: 10rem !important;
  }
  .m-xxl-9 {
    margin: 15rem !important;
  }
  .m-xxl-10 {
    margin: 20rem !important;
  }
  .m-xxl-auto {
    margin: auto !important;
  }
  .mx-xxl-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-xxl-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-xxl-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-xxl-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-xxl-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-xxl-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-xxl-6 {
    margin-right: 5rem !important;
    margin-left: 5rem !important;
  }
  .mx-xxl-7 {
    margin-right: 8rem !important;
    margin-left: 8rem !important;
  }
  .mx-xxl-8 {
    margin-right: 10rem !important;
    margin-left: 10rem !important;
  }
  .mx-xxl-9 {
    margin-right: 15rem !important;
    margin-left: 15rem !important;
  }
  .mx-xxl-10 {
    margin-right: 20rem !important;
    margin-left: 20rem !important;
  }
  .mx-xxl-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-xxl-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-xxl-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-xxl-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-xxl-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-xxl-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-xxl-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-xxl-6 {
    margin-top: 5rem !important;
    margin-bottom: 5rem !important;
  }
  .my-xxl-7 {
    margin-top: 8rem !important;
    margin-bottom: 8rem !important;
  }
  .my-xxl-8 {
    margin-top: 10rem !important;
    margin-bottom: 10rem !important;
  }
  .my-xxl-9 {
    margin-top: 15rem !important;
    margin-bottom: 15rem !important;
  }
  .my-xxl-10 {
    margin-top: 20rem !important;
    margin-bottom: 20rem !important;
  }
  .my-xxl-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-xxl-0 {
    margin-top: 0 !important;
  }
  .mt-xxl-1 {
    margin-top: 0.25rem !important;
  }
  .mt-xxl-2 {
    margin-top: 0.5rem !important;
  }
  .mt-xxl-3 {
    margin-top: 1rem !important;
  }
  .mt-xxl-4 {
    margin-top: 1.5rem !important;
  }
  .mt-xxl-5 {
    margin-top: 3rem !important;
  }
  .mt-xxl-6 {
    margin-top: 5rem !important;
  }
  .mt-xxl-7 {
    margin-top: 8rem !important;
  }
  .mt-xxl-8 {
    margin-top: 10rem !important;
  }
  .mt-xxl-9 {
    margin-top: 15rem !important;
  }
  .mt-xxl-10 {
    margin-top: 20rem !important;
  }
  .mt-xxl-auto {
    margin-top: auto !important;
  }
  .me-xxl-0 {
    margin-right: 0 !important;
  }
  .me-xxl-1 {
    margin-right: 0.25rem !important;
  }
  .me-xxl-2 {
    margin-right: 0.5rem !important;
  }
  .me-xxl-3 {
    margin-right: 1rem !important;
  }
  .me-xxl-4 {
    margin-right: 1.5rem !important;
  }
  .me-xxl-5 {
    margin-right: 3rem !important;
  }
  .me-xxl-6 {
    margin-right: 5rem !important;
  }
  .me-xxl-7 {
    margin-right: 8rem !important;
  }
  .me-xxl-8 {
    margin-right: 10rem !important;
  }
  .me-xxl-9 {
    margin-right: 15rem !important;
  }
  .me-xxl-10 {
    margin-right: 20rem !important;
  }
  .me-xxl-auto {
    margin-right: auto !important;
  }
  .mb-xxl-0 {
    margin-bottom: 0 !important;
  }
  .mb-xxl-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-xxl-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-xxl-3 {
    margin-bottom: 1rem !important;
  }
  .mb-xxl-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-xxl-5 {
    margin-bottom: 3rem !important;
  }
  .mb-xxl-6 {
    margin-bottom: 5rem !important;
  }
  .mb-xxl-7 {
    margin-bottom: 8rem !important;
  }
  .mb-xxl-8 {
    margin-bottom: 10rem !important;
  }
  .mb-xxl-9 {
    margin-bottom: 15rem !important;
  }
  .mb-xxl-10 {
    margin-bottom: 20rem !important;
  }
  .mb-xxl-auto {
    margin-bottom: auto !important;
  }
  .ms-xxl-0 {
    margin-left: 0 !important;
  }
  .ms-xxl-1 {
    margin-left: 0.25rem !important;
  }
  .ms-xxl-2 {
    margin-left: 0.5rem !important;
  }
  .ms-xxl-3 {
    margin-left: 1rem !important;
  }
  .ms-xxl-4 {
    margin-left: 1.5rem !important;
  }
  .ms-xxl-5 {
    margin-left: 3rem !important;
  }
  .ms-xxl-6 {
    margin-left: 5rem !important;
  }
  .ms-xxl-7 {
    margin-left: 8rem !important;
  }
  .ms-xxl-8 {
    margin-left: 10rem !important;
  }
  .ms-xxl-9 {
    margin-left: 15rem !important;
  }
  .ms-xxl-10 {
    margin-left: 20rem !important;
  }
  .ms-xxl-auto {
    margin-left: auto !important;
  }
  .p-xxl-0 {
    padding: 0 !important;
  }
  .p-xxl-1 {
    padding: 0.25rem !important;
  }
  .p-xxl-2 {
    padding: 0.5rem !important;
  }
  .p-xxl-3 {
    padding: 1rem !important;
  }
  .p-xxl-4 {
    padding: 1.5rem !important;
  }
  .p-xxl-5 {
    padding: 3rem !important;
  }
  .p-xxl-6 {
    padding: 5rem !important;
  }
  .p-xxl-7 {
    padding: 8rem !important;
  }
  .p-xxl-8 {
    padding: 10rem !important;
  }
  .p-xxl-9 {
    padding: 15rem !important;
  }
  .p-xxl-10 {
    padding: 20rem !important;
  }
  .px-xxl-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-xxl-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-xxl-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-xxl-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-xxl-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-xxl-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .px-xxl-6 {
    padding-right: 5rem !important;
    padding-left: 5rem !important;
  }
  .px-xxl-7 {
    padding-right: 8rem !important;
    padding-left: 8rem !important;
  }
  .px-xxl-8 {
    padding-right: 10rem !important;
    padding-left: 10rem !important;
  }
  .px-xxl-9 {
    padding-right: 15rem !important;
    padding-left: 15rem !important;
  }
  .px-xxl-10 {
    padding-right: 20rem !important;
    padding-left: 20rem !important;
  }
  .py-xxl-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-xxl-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-xxl-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-xxl-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-xxl-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-xxl-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .py-xxl-6 {
    padding-top: 5rem !important;
    padding-bottom: 5rem !important;
  }
  .py-xxl-7 {
    padding-top: 8rem !important;
    padding-bottom: 8rem !important;
  }
  .py-xxl-8 {
    padding-top: 10rem !important;
    padding-bottom: 10rem !important;
  }
  .py-xxl-9 {
    padding-top: 15rem !important;
    padding-bottom: 15rem !important;
  }
  .py-xxl-10 {
    padding-top: 20rem !important;
    padding-bottom: 20rem !important;
  }
  .pt-xxl-0 {
    padding-top: 0 !important;
  }
  .pt-xxl-1 {
    padding-top: 0.25rem !important;
  }
  .pt-xxl-2 {
    padding-top: 0.5rem !important;
  }
  .pt-xxl-3 {
    padding-top: 1rem !important;
  }
  .pt-xxl-4 {
    padding-top: 1.5rem !important;
  }
  .pt-xxl-5 {
    padding-top: 3rem !important;
  }
  .pt-xxl-6 {
    padding-top: 5rem !important;
  }
  .pt-xxl-7 {
    padding-top: 8rem !important;
  }
  .pt-xxl-8 {
    padding-top: 10rem !important;
  }
  .pt-xxl-9 {
    padding-top: 15rem !important;
  }
  .pt-xxl-10 {
    padding-top: 20rem !important;
  }
  .pe-xxl-0 {
    padding-right: 0 !important;
  }
  .pe-xxl-1 {
    padding-right: 0.25rem !important;
  }
  .pe-xxl-2 {
    padding-right: 0.5rem !important;
  }
  .pe-xxl-3 {
    padding-right: 1rem !important;
  }
  .pe-xxl-4 {
    padding-right: 1.5rem !important;
  }
  .pe-xxl-5 {
    padding-right: 3rem !important;
  }
  .pe-xxl-6 {
    padding-right: 5rem !important;
  }
  .pe-xxl-7 {
    padding-right: 8rem !important;
  }
  .pe-xxl-8 {
    padding-right: 10rem !important;
  }
  .pe-xxl-9 {
    padding-right: 15rem !important;
  }
  .pe-xxl-10 {
    padding-right: 20rem !important;
  }
  .pb-xxl-0 {
    padding-bottom: 0 !important;
  }
  .pb-xxl-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-xxl-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-xxl-3 {
    padding-bottom: 1rem !important;
  }
  .pb-xxl-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-xxl-5 {
    padding-bottom: 3rem !important;
  }
  .pb-xxl-6 {
    padding-bottom: 5rem !important;
  }
  .pb-xxl-7 {
    padding-bottom: 8rem !important;
  }
  .pb-xxl-8 {
    padding-bottom: 10rem !important;
  }
  .pb-xxl-9 {
    padding-bottom: 15rem !important;
  }
  .pb-xxl-10 {
    padding-bottom: 20rem !important;
  }
  .ps-xxl-0 {
    padding-left: 0 !important;
  }
  .ps-xxl-1 {
    padding-left: 0.25rem !important;
  }
  .ps-xxl-2 {
    padding-left: 0.5rem !important;
  }
  .ps-xxl-3 {
    padding-left: 1rem !important;
  }
  .ps-xxl-4 {
    padding-left: 1.5rem !important;
  }
  .ps-xxl-5 {
    padding-left: 3rem !important;
  }
  .ps-xxl-6 {
    padding-left: 5rem !important;
  }
  .ps-xxl-7 {
    padding-left: 8rem !important;
  }
  .ps-xxl-8 {
    padding-left: 10rem !important;
  }
  .ps-xxl-9 {
    padding-left: 15rem !important;
  }
  .ps-xxl-10 {
    padding-left: 20rem !important;
  }
  .gap-xxl-0 {
    gap: 0 !important;
  }
  .gap-xxl-1 {
    gap: 0.25rem !important;
  }
  .gap-xxl-2 {
    gap: 0.5rem !important;
  }
  .gap-xxl-3 {
    gap: 1rem !important;
  }
  .gap-xxl-4 {
    gap: 1.5rem !important;
  }
  .gap-xxl-5 {
    gap: 3rem !important;
  }
  .gap-xxl-6 {
    gap: 5rem !important;
  }
  .gap-xxl-7 {
    gap: 8rem !important;
  }
  .gap-xxl-8 {
    gap: 10rem !important;
  }
  .gap-xxl-9 {
    gap: 15rem !important;
  }
  .gap-xxl-10 {
    gap: 20rem !important;
  }
  .row-gap-xxl-0 {
    row-gap: 0 !important;
  }
  .row-gap-xxl-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-xxl-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-xxl-3 {
    row-gap: 1rem !important;
  }
  .row-gap-xxl-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-xxl-5 {
    row-gap: 3rem !important;
  }
  .row-gap-xxl-6 {
    row-gap: 5rem !important;
  }
  .row-gap-xxl-7 {
    row-gap: 8rem !important;
  }
  .row-gap-xxl-8 {
    row-gap: 10rem !important;
  }
  .row-gap-xxl-9 {
    row-gap: 15rem !important;
  }
  .row-gap-xxl-10 {
    row-gap: 20rem !important;
  }
  .column-gap-xxl-0 {
    column-gap: 0 !important;
  }
  .column-gap-xxl-1 {
    column-gap: 0.25rem !important;
  }
  .column-gap-xxl-2 {
    column-gap: 0.5rem !important;
  }
  .column-gap-xxl-3 {
    column-gap: 1rem !important;
  }
  .column-gap-xxl-4 {
    column-gap: 1.5rem !important;
  }
  .column-gap-xxl-5 {
    column-gap: 3rem !important;
  }
  .column-gap-xxl-6 {
    column-gap: 5rem !important;
  }
  .column-gap-xxl-7 {
    column-gap: 8rem !important;
  }
  .column-gap-xxl-8 {
    column-gap: 10rem !important;
  }
  .column-gap-xxl-9 {
    column-gap: 15rem !important;
  }
  .column-gap-xxl-10 {
    column-gap: 20rem !important;
  }
  .text-xxl-start {
    text-align: left !important;
  }
  .text-xxl-end {
    text-align: right !important;
  }
  .text-xxl-center {
    text-align: center !important;
  }
}
@media (min-width: 1200px) {
  .fs-1 {
    font-size: 2.5rem !important;
  }
  .fs-2 {
    font-size: 2rem !important;
  }
  .fs-3 {
    font-size: 1.75rem !important;
  }
  .fs-4 {
    font-size: 1.5rem !important;
  }
}
@media print {
  .d-print-inline {
    display: inline !important;
  }
  .d-print-inline-block {
    display: inline-block !important;
  }
  .d-print-block {
    display: block !important;
  }
  .d-print-grid {
    display: grid !important;
  }
  .d-print-inline-grid {
    display: inline-grid !important;
  }
  .d-print-table {
    display: table !important;
  }
  .d-print-table-row {
    display: table-row !important;
  }
  .d-print-table-cell {
    display: table-cell !important;
  }
  .d-print-flex {
    display: flex !important;
  }
  .d-print-inline-flex {
    display: inline-flex !important;
  }
  .d-print-none {
    display: none !important;
  }
}
@font-face {
  font-family: "Open Sans";
  src: url(../.././css/build/font/opensans-regular-webfont.eot);
  src: url(../.././css/build/font/opensans-regular-webfont.eot) format("embedded-opentype"), url(../.././css/build/font/opensans-regular-webfont.woff2) format("woff2"), url(../.././css/build/font/opensans-regular-webfont.woff) format("woff"), url(../.././css/build/font/opensans-regular-webfont.ttf) format("truetype");
  font-weight: normal;
  font-style: normal;
}
html {
  font-family: "Open Sans", serif;
  font-weight: 400;
}

.shadow-none {
  box-shadow: none;
}

.shadow-1 {
  box-shadow: rgba(0, 0, 0, 0.1) 1px 1px 6px;
}

.bg-cover {
  background-size: cover;
}

.bg-contain {
  background-size: contain;
}

.bg-center {
  background-position: center;
}

.bg-right-bottom {
  background-position: right bottom;
}

.bg-left-bottom {
  background-position: left bottom;
}

.bg-top-center {
  background-position: top center;
}

.maxw-1px {
  max-width: 1px;
}

.maxw-2px {
  max-width: 2px;
}

.maxw-3px {
  max-width: 3px;
}

.maxw-4px {
  max-width: 4px;
}

.maxw-5px {
  max-width: 5px;
}

.maxw-6px {
  max-width: 6px;
}

.maxw-7px {
  max-width: 7px;
}

.maxw-8px {
  max-width: 8px;
}

.maxw-9px {
  max-width: 9px;
}

.maxw-10px {
  max-width: 10px;
}

.maxw-11px {
  max-width: 11px;
}

.maxw-12px {
  max-width: 12px;
}

.maxw-13px {
  max-width: 13px;
}

.maxw-14px {
  max-width: 14px;
}

.maxw-15px {
  max-width: 15px;
}

.maxw-16px {
  max-width: 16px;
}

.maxw-17px {
  max-width: 17px;
}

.maxw-18px {
  max-width: 18px;
}

.maxw-19px {
  max-width: 19px;
}

.maxw-20px {
  max-width: 20px;
}

.maxw-21px {
  max-width: 21px;
}

.maxw-22px {
  max-width: 22px;
}

.maxw-23px {
  max-width: 23px;
}

.maxw-24px {
  max-width: 24px;
}

.maxw-25px {
  max-width: 25px;
}

.maxw-26px {
  max-width: 26px;
}

.maxw-27px {
  max-width: 27px;
}

.maxw-28px {
  max-width: 28px;
}

.maxw-29px {
  max-width: 29px;
}

.maxw-30px {
  max-width: 30px;
}

.maxw-31px {
  max-width: 31px;
}

.maxw-32px {
  max-width: 32px;
}

.maxw-33px {
  max-width: 33px;
}

.maxw-34px {
  max-width: 34px;
}

.maxw-35px {
  max-width: 35px;
}

.maxw-36px {
  max-width: 36px;
}

.maxw-37px {
  max-width: 37px;
}

.maxw-38px {
  max-width: 38px;
}

.maxw-39px {
  max-width: 39px;
}

.maxw-40px {
  max-width: 40px;
}

.maxw-41px {
  max-width: 41px;
}

.maxw-42px {
  max-width: 42px;
}

.maxw-43px {
  max-width: 43px;
}

.maxw-44px {
  max-width: 44px;
}

.maxw-45px {
  max-width: 45px;
}

.maxw-46px {
  max-width: 46px;
}

.maxw-47px {
  max-width: 47px;
}

.maxw-48px {
  max-width: 48px;
}

.maxw-49px {
  max-width: 49px;
}

.maxw-50px {
  max-width: 50px;
}

.maxw-51px {
  max-width: 51px;
}

.maxw-52px {
  max-width: 52px;
}

.maxw-53px {
  max-width: 53px;
}

.maxw-54px {
  max-width: 54px;
}

.maxw-55px {
  max-width: 55px;
}

.maxw-56px {
  max-width: 56px;
}

.maxw-57px {
  max-width: 57px;
}

.maxw-58px {
  max-width: 58px;
}

.maxw-59px {
  max-width: 59px;
}

.maxw-60px {
  max-width: 60px;
}

.maxw-61px {
  max-width: 61px;
}

.maxw-62px {
  max-width: 62px;
}

.maxw-63px {
  max-width: 63px;
}

.maxw-64px {
  max-width: 64px;
}

.maxw-65px {
  max-width: 65px;
}

.maxw-66px {
  max-width: 66px;
}

.maxw-67px {
  max-width: 67px;
}

.maxw-68px {
  max-width: 68px;
}

.maxw-69px {
  max-width: 69px;
}

.maxw-70px {
  max-width: 70px;
}

.maxw-71px {
  max-width: 71px;
}

.maxw-72px {
  max-width: 72px;
}

.maxw-73px {
  max-width: 73px;
}

.maxw-74px {
  max-width: 74px;
}

.maxw-75px {
  max-width: 75px;
}

.maxw-76px {
  max-width: 76px;
}

.maxw-77px {
  max-width: 77px;
}

.maxw-78px {
  max-width: 78px;
}

.maxw-79px {
  max-width: 79px;
}

.maxw-80px {
  max-width: 80px;
}

.maxw-81px {
  max-width: 81px;
}

.maxw-82px {
  max-width: 82px;
}

.maxw-83px {
  max-width: 83px;
}

.maxw-84px {
  max-width: 84px;
}

.maxw-85px {
  max-width: 85px;
}

.maxw-86px {
  max-width: 86px;
}

.maxw-87px {
  max-width: 87px;
}

.maxw-88px {
  max-width: 88px;
}

.maxw-89px {
  max-width: 89px;
}

.maxw-90px {
  max-width: 90px;
}

.maxw-91px {
  max-width: 91px;
}

.maxw-92px {
  max-width: 92px;
}

.maxw-93px {
  max-width: 93px;
}

.maxw-94px {
  max-width: 94px;
}

.maxw-95px {
  max-width: 95px;
}

.maxw-96px {
  max-width: 96px;
}

.maxw-97px {
  max-width: 97px;
}

.maxw-98px {
  max-width: 98px;
}

.maxw-99px {
  max-width: 99px;
}

.maxw-100px {
  max-width: 100px;
}

.maxw-101px {
  max-width: 101px;
}

.maxw-102px {
  max-width: 102px;
}

.maxw-103px {
  max-width: 103px;
}

.maxw-104px {
  max-width: 104px;
}

.maxw-105px {
  max-width: 105px;
}

.maxw-106px {
  max-width: 106px;
}

.maxw-107px {
  max-width: 107px;
}

.maxw-108px {
  max-width: 108px;
}

.maxw-109px {
  max-width: 109px;
}

.maxw-110px {
  max-width: 110px;
}

.maxw-111px {
  max-width: 111px;
}

.maxw-112px {
  max-width: 112px;
}

.maxw-113px {
  max-width: 113px;
}

.maxw-114px {
  max-width: 114px;
}

.maxw-115px {
  max-width: 115px;
}

.maxw-116px {
  max-width: 116px;
}

.maxw-117px {
  max-width: 117px;
}

.maxw-118px {
  max-width: 118px;
}

.maxw-119px {
  max-width: 119px;
}

.maxw-120px {
  max-width: 120px;
}

.maxw-121px {
  max-width: 121px;
}

.maxw-122px {
  max-width: 122px;
}

.maxw-123px {
  max-width: 123px;
}

.maxw-124px {
  max-width: 124px;
}

.maxw-125px {
  max-width: 125px;
}

.maxw-126px {
  max-width: 126px;
}

.maxw-127px {
  max-width: 127px;
}

.maxw-128px {
  max-width: 128px;
}

.maxw-129px {
  max-width: 129px;
}

.maxw-130px {
  max-width: 130px;
}

.maxw-131px {
  max-width: 131px;
}

.maxw-132px {
  max-width: 132px;
}

.maxw-133px {
  max-width: 133px;
}

.maxw-134px {
  max-width: 134px;
}

.maxw-135px {
  max-width: 135px;
}

.maxw-136px {
  max-width: 136px;
}

.maxw-137px {
  max-width: 137px;
}

.maxw-138px {
  max-width: 138px;
}

.maxw-139px {
  max-width: 139px;
}

.maxw-140px {
  max-width: 140px;
}

.maxw-141px {
  max-width: 141px;
}

.maxw-142px {
  max-width: 142px;
}

.maxw-143px {
  max-width: 143px;
}

.maxw-144px {
  max-width: 144px;
}

.maxw-145px {
  max-width: 145px;
}

.maxw-146px {
  max-width: 146px;
}

.maxw-147px {
  max-width: 147px;
}

.maxw-148px {
  max-width: 148px;
}

.maxw-149px {
  max-width: 149px;
}

.maxw-150px {
  max-width: 150px;
}

.maxw-151px {
  max-width: 151px;
}

.maxw-152px {
  max-width: 152px;
}

.maxw-153px {
  max-width: 153px;
}

.maxw-154px {
  max-width: 154px;
}

.maxw-155px {
  max-width: 155px;
}

.maxw-156px {
  max-width: 156px;
}

.maxw-157px {
  max-width: 157px;
}

.maxw-158px {
  max-width: 158px;
}

.maxw-159px {
  max-width: 159px;
}

.maxw-160px {
  max-width: 160px;
}

.maxw-161px {
  max-width: 161px;
}

.maxw-162px {
  max-width: 162px;
}

.maxw-163px {
  max-width: 163px;
}

.maxw-164px {
  max-width: 164px;
}

.maxw-165px {
  max-width: 165px;
}

.maxw-166px {
  max-width: 166px;
}

.maxw-167px {
  max-width: 167px;
}

.maxw-168px {
  max-width: 168px;
}

.maxw-169px {
  max-width: 169px;
}

.maxw-170px {
  max-width: 170px;
}

.maxw-171px {
  max-width: 171px;
}

.maxw-172px {
  max-width: 172px;
}

.maxw-173px {
  max-width: 173px;
}

.maxw-174px {
  max-width: 174px;
}

.maxw-175px {
  max-width: 175px;
}

.maxw-176px {
  max-width: 176px;
}

.maxw-177px {
  max-width: 177px;
}

.maxw-178px {
  max-width: 178px;
}

.maxw-179px {
  max-width: 179px;
}

.maxw-180px {
  max-width: 180px;
}

.maxw-181px {
  max-width: 181px;
}

.maxw-182px {
  max-width: 182px;
}

.maxw-183px {
  max-width: 183px;
}

.maxw-184px {
  max-width: 184px;
}

.maxw-185px {
  max-width: 185px;
}

.maxw-186px {
  max-width: 186px;
}

.maxw-187px {
  max-width: 187px;
}

.maxw-188px {
  max-width: 188px;
}

.maxw-189px {
  max-width: 189px;
}

.maxw-190px {
  max-width: 190px;
}

.maxw-191px {
  max-width: 191px;
}

.maxw-192px {
  max-width: 192px;
}

.maxw-193px {
  max-width: 193px;
}

.maxw-194px {
  max-width: 194px;
}

.maxw-195px {
  max-width: 195px;
}

.maxw-196px {
  max-width: 196px;
}

.maxw-197px {
  max-width: 197px;
}

.maxw-198px {
  max-width: 198px;
}

.maxw-199px {
  max-width: 199px;
}

.maxw-200px {
  max-width: 200px;
}

.maxw-201px {
  max-width: 201px;
}

.maxw-202px {
  max-width: 202px;
}

.maxw-203px {
  max-width: 203px;
}

.maxw-204px {
  max-width: 204px;
}

.maxw-205px {
  max-width: 205px;
}

.maxw-206px {
  max-width: 206px;
}

.maxw-207px {
  max-width: 207px;
}

.maxw-208px {
  max-width: 208px;
}

.maxw-209px {
  max-width: 209px;
}

.maxw-210px {
  max-width: 210px;
}

.maxw-211px {
  max-width: 211px;
}

.maxw-212px {
  max-width: 212px;
}

.maxw-213px {
  max-width: 213px;
}

.maxw-214px {
  max-width: 214px;
}

.maxw-215px {
  max-width: 215px;
}

.maxw-216px {
  max-width: 216px;
}

.maxw-217px {
  max-width: 217px;
}

.maxw-218px {
  max-width: 218px;
}

.maxw-219px {
  max-width: 219px;
}

.maxw-220px {
  max-width: 220px;
}

.maxw-221px {
  max-width: 221px;
}

.maxw-222px {
  max-width: 222px;
}

.maxw-223px {
  max-width: 223px;
}

.maxw-224px {
  max-width: 224px;
}

.maxw-225px {
  max-width: 225px;
}

.maxw-226px {
  max-width: 226px;
}

.maxw-227px {
  max-width: 227px;
}

.maxw-228px {
  max-width: 228px;
}

.maxw-229px {
  max-width: 229px;
}

.maxw-230px {
  max-width: 230px;
}

.maxw-231px {
  max-width: 231px;
}

.maxw-232px {
  max-width: 232px;
}

.maxw-233px {
  max-width: 233px;
}

.maxw-234px {
  max-width: 234px;
}

.maxw-235px {
  max-width: 235px;
}

.maxw-236px {
  max-width: 236px;
}

.maxw-237px {
  max-width: 237px;
}

.maxw-238px {
  max-width: 238px;
}

.maxw-239px {
  max-width: 239px;
}

.maxw-240px {
  max-width: 240px;
}

.maxw-241px {
  max-width: 241px;
}

.maxw-242px {
  max-width: 242px;
}

.maxw-243px {
  max-width: 243px;
}

.maxw-244px {
  max-width: 244px;
}

.maxw-245px {
  max-width: 245px;
}

.maxw-246px {
  max-width: 246px;
}

.maxw-247px {
  max-width: 247px;
}

.maxw-248px {
  max-width: 248px;
}

.maxw-249px {
  max-width: 249px;
}

.maxw-250px {
  max-width: 250px;
}

.maxw-251px {
  max-width: 251px;
}

.maxw-252px {
  max-width: 252px;
}

.maxw-253px {
  max-width: 253px;
}

.maxw-254px {
  max-width: 254px;
}

.maxw-255px {
  max-width: 255px;
}

.maxw-256px {
  max-width: 256px;
}

.maxw-257px {
  max-width: 257px;
}

.maxw-258px {
  max-width: 258px;
}

.maxw-259px {
  max-width: 259px;
}

.maxw-260px {
  max-width: 260px;
}

.maxw-261px {
  max-width: 261px;
}

.maxw-262px {
  max-width: 262px;
}

.maxw-263px {
  max-width: 263px;
}

.maxw-264px {
  max-width: 264px;
}

.maxw-265px {
  max-width: 265px;
}

.maxw-266px {
  max-width: 266px;
}

.maxw-267px {
  max-width: 267px;
}

.maxw-268px {
  max-width: 268px;
}

.maxw-269px {
  max-width: 269px;
}

.maxw-270px {
  max-width: 270px;
}

.maxw-271px {
  max-width: 271px;
}

.maxw-272px {
  max-width: 272px;
}

.maxw-273px {
  max-width: 273px;
}

.maxw-274px {
  max-width: 274px;
}

.maxw-275px {
  max-width: 275px;
}

.maxw-276px {
  max-width: 276px;
}

.maxw-277px {
  max-width: 277px;
}

.maxw-278px {
  max-width: 278px;
}

.maxw-279px {
  max-width: 279px;
}

.maxw-280px {
  max-width: 280px;
}

.maxw-281px {
  max-width: 281px;
}

.maxw-282px {
  max-width: 282px;
}

.maxw-283px {
  max-width: 283px;
}

.maxw-284px {
  max-width: 284px;
}

.maxw-285px {
  max-width: 285px;
}

.maxw-286px {
  max-width: 286px;
}

.maxw-287px {
  max-width: 287px;
}

.maxw-288px {
  max-width: 288px;
}

.maxw-289px {
  max-width: 289px;
}

.maxw-290px {
  max-width: 290px;
}

.maxw-291px {
  max-width: 291px;
}

.maxw-292px {
  max-width: 292px;
}

.maxw-293px {
  max-width: 293px;
}

.maxw-294px {
  max-width: 294px;
}

.maxw-295px {
  max-width: 295px;
}

.maxw-296px {
  max-width: 296px;
}

.maxw-297px {
  max-width: 297px;
}

.maxw-298px {
  max-width: 298px;
}

.maxw-299px {
  max-width: 299px;
}

.maxw-300px {
  max-width: 300px;
}

.maxw-301px {
  max-width: 301px;
}

.maxw-302px {
  max-width: 302px;
}

.maxw-303px {
  max-width: 303px;
}

.maxw-304px {
  max-width: 304px;
}

.maxw-305px {
  max-width: 305px;
}

.maxw-306px {
  max-width: 306px;
}

.maxw-307px {
  max-width: 307px;
}

.maxw-308px {
  max-width: 308px;
}

.maxw-309px {
  max-width: 309px;
}

.maxw-310px {
  max-width: 310px;
}

.maxw-311px {
  max-width: 311px;
}

.maxw-312px {
  max-width: 312px;
}

.maxw-313px {
  max-width: 313px;
}

.maxw-314px {
  max-width: 314px;
}

.maxw-315px {
  max-width: 315px;
}

.maxw-316px {
  max-width: 316px;
}

.maxw-317px {
  max-width: 317px;
}

.maxw-318px {
  max-width: 318px;
}

.maxw-319px {
  max-width: 319px;
}

.maxw-320px {
  max-width: 320px;
}

.maxw-321px {
  max-width: 321px;
}

.maxw-322px {
  max-width: 322px;
}

.maxw-323px {
  max-width: 323px;
}

.maxw-324px {
  max-width: 324px;
}

.maxw-325px {
  max-width: 325px;
}

.maxw-326px {
  max-width: 326px;
}

.maxw-327px {
  max-width: 327px;
}

.maxw-328px {
  max-width: 328px;
}

.maxw-329px {
  max-width: 329px;
}

.maxw-330px {
  max-width: 330px;
}

.maxw-331px {
  max-width: 331px;
}

.maxw-332px {
  max-width: 332px;
}

.maxw-333px {
  max-width: 333px;
}

.maxw-334px {
  max-width: 334px;
}

.maxw-335px {
  max-width: 335px;
}

.maxw-336px {
  max-width: 336px;
}

.maxw-337px {
  max-width: 337px;
}

.maxw-338px {
  max-width: 338px;
}

.maxw-339px {
  max-width: 339px;
}

.maxw-340px {
  max-width: 340px;
}

.maxw-341px {
  max-width: 341px;
}

.maxw-342px {
  max-width: 342px;
}

.maxw-343px {
  max-width: 343px;
}

.maxw-344px {
  max-width: 344px;
}

.maxw-345px {
  max-width: 345px;
}

.maxw-346px {
  max-width: 346px;
}

.maxw-347px {
  max-width: 347px;
}

.maxw-348px {
  max-width: 348px;
}

.maxw-349px {
  max-width: 349px;
}

.maxw-350px {
  max-width: 350px;
}

.maxw-351px {
  max-width: 351px;
}

.maxw-352px {
  max-width: 352px;
}

.maxw-353px {
  max-width: 353px;
}

.maxw-354px {
  max-width: 354px;
}

.maxw-355px {
  max-width: 355px;
}

.maxw-356px {
  max-width: 356px;
}

.maxw-357px {
  max-width: 357px;
}

.maxw-358px {
  max-width: 358px;
}

.maxw-359px {
  max-width: 359px;
}

.maxw-360px {
  max-width: 360px;
}

.maxw-361px {
  max-width: 361px;
}

.maxw-362px {
  max-width: 362px;
}

.maxw-363px {
  max-width: 363px;
}

.maxw-364px {
  max-width: 364px;
}

.maxw-365px {
  max-width: 365px;
}

.maxw-366px {
  max-width: 366px;
}

.maxw-367px {
  max-width: 367px;
}

.maxw-368px {
  max-width: 368px;
}

.maxw-369px {
  max-width: 369px;
}

.maxw-370px {
  max-width: 370px;
}

.maxw-371px {
  max-width: 371px;
}

.maxw-372px {
  max-width: 372px;
}

.maxw-373px {
  max-width: 373px;
}

.maxw-374px {
  max-width: 374px;
}

.maxw-375px {
  max-width: 375px;
}

.maxw-376px {
  max-width: 376px;
}

.maxw-377px {
  max-width: 377px;
}

.maxw-378px {
  max-width: 378px;
}

.maxw-379px {
  max-width: 379px;
}

.maxw-380px {
  max-width: 380px;
}

.maxw-381px {
  max-width: 381px;
}

.maxw-382px {
  max-width: 382px;
}

.maxw-383px {
  max-width: 383px;
}

.maxw-384px {
  max-width: 384px;
}

.maxw-385px {
  max-width: 385px;
}

.maxw-386px {
  max-width: 386px;
}

.maxw-387px {
  max-width: 387px;
}

.maxw-388px {
  max-width: 388px;
}

.maxw-389px {
  max-width: 389px;
}

.maxw-390px {
  max-width: 390px;
}

.maxw-391px {
  max-width: 391px;
}

.maxw-392px {
  max-width: 392px;
}

.maxw-393px {
  max-width: 393px;
}

.maxw-394px {
  max-width: 394px;
}

.maxw-395px {
  max-width: 395px;
}

.maxw-396px {
  max-width: 396px;
}

.maxw-397px {
  max-width: 397px;
}

.maxw-398px {
  max-width: 398px;
}

.maxw-399px {
  max-width: 399px;
}

.maxw-400px {
  max-width: 400px;
}

.maxw-401px {
  max-width: 401px;
}

.maxw-402px {
  max-width: 402px;
}

.maxw-403px {
  max-width: 403px;
}

.maxw-404px {
  max-width: 404px;
}

.maxw-405px {
  max-width: 405px;
}

.maxw-406px {
  max-width: 406px;
}

.maxw-407px {
  max-width: 407px;
}

.maxw-408px {
  max-width: 408px;
}

.maxw-409px {
  max-width: 409px;
}

.maxw-410px {
  max-width: 410px;
}

.maxw-411px {
  max-width: 411px;
}

.maxw-412px {
  max-width: 412px;
}

.maxw-413px {
  max-width: 413px;
}

.maxw-414px {
  max-width: 414px;
}

.maxw-415px {
  max-width: 415px;
}

.maxw-416px {
  max-width: 416px;
}

.maxw-417px {
  max-width: 417px;
}

.maxw-418px {
  max-width: 418px;
}

.maxw-419px {
  max-width: 419px;
}

.maxw-420px {
  max-width: 420px;
}

.maxw-421px {
  max-width: 421px;
}

.maxw-422px {
  max-width: 422px;
}

.maxw-423px {
  max-width: 423px;
}

.maxw-424px {
  max-width: 424px;
}

.maxw-425px {
  max-width: 425px;
}

.maxw-426px {
  max-width: 426px;
}

.maxw-427px {
  max-width: 427px;
}

.maxw-428px {
  max-width: 428px;
}

.maxw-429px {
  max-width: 429px;
}

.maxw-430px {
  max-width: 430px;
}

.maxw-431px {
  max-width: 431px;
}

.maxw-432px {
  max-width: 432px;
}

.maxw-433px {
  max-width: 433px;
}

.maxw-434px {
  max-width: 434px;
}

.maxw-435px {
  max-width: 435px;
}

.maxw-436px {
  max-width: 436px;
}

.maxw-437px {
  max-width: 437px;
}

.maxw-438px {
  max-width: 438px;
}

.maxw-439px {
  max-width: 439px;
}

.maxw-440px {
  max-width: 440px;
}

.maxw-441px {
  max-width: 441px;
}

.maxw-442px {
  max-width: 442px;
}

.maxw-443px {
  max-width: 443px;
}

.maxw-444px {
  max-width: 444px;
}

.maxw-445px {
  max-width: 445px;
}

.maxw-446px {
  max-width: 446px;
}

.maxw-447px {
  max-width: 447px;
}

.maxw-448px {
  max-width: 448px;
}

.maxw-449px {
  max-width: 449px;
}

.maxw-450px {
  max-width: 450px;
}

.maxw-451px {
  max-width: 451px;
}

.maxw-452px {
  max-width: 452px;
}

.maxw-453px {
  max-width: 453px;
}

.maxw-454px {
  max-width: 454px;
}

.maxw-455px {
  max-width: 455px;
}

.maxw-456px {
  max-width: 456px;
}

.maxw-457px {
  max-width: 457px;
}

.maxw-458px {
  max-width: 458px;
}

.maxw-459px {
  max-width: 459px;
}

.maxw-460px {
  max-width: 460px;
}

.maxw-461px {
  max-width: 461px;
}

.maxw-462px {
  max-width: 462px;
}

.maxw-463px {
  max-width: 463px;
}

.maxw-464px {
  max-width: 464px;
}

.maxw-465px {
  max-width: 465px;
}

.maxw-466px {
  max-width: 466px;
}

.maxw-467px {
  max-width: 467px;
}

.maxw-468px {
  max-width: 468px;
}

.maxw-469px {
  max-width: 469px;
}

.maxw-470px {
  max-width: 470px;
}

.maxw-471px {
  max-width: 471px;
}

.maxw-472px {
  max-width: 472px;
}

.maxw-473px {
  max-width: 473px;
}

.maxw-474px {
  max-width: 474px;
}

.maxw-475px {
  max-width: 475px;
}

.maxw-476px {
  max-width: 476px;
}

.maxw-477px {
  max-width: 477px;
}

.maxw-478px {
  max-width: 478px;
}

.maxw-479px {
  max-width: 479px;
}

.maxw-480px {
  max-width: 480px;
}

.maxw-481px {
  max-width: 481px;
}

.maxw-482px {
  max-width: 482px;
}

.maxw-483px {
  max-width: 483px;
}

.maxw-484px {
  max-width: 484px;
}

.maxw-485px {
  max-width: 485px;
}

.maxw-486px {
  max-width: 486px;
}

.maxw-487px {
  max-width: 487px;
}

.maxw-488px {
  max-width: 488px;
}

.maxw-489px {
  max-width: 489px;
}

.maxw-490px {
  max-width: 490px;
}

.maxw-491px {
  max-width: 491px;
}

.maxw-492px {
  max-width: 492px;
}

.maxw-493px {
  max-width: 493px;
}

.maxw-494px {
  max-width: 494px;
}

.maxw-495px {
  max-width: 495px;
}

.maxw-496px {
  max-width: 496px;
}

.maxw-497px {
  max-width: 497px;
}

.maxw-498px {
  max-width: 498px;
}

.maxw-499px {
  max-width: 499px;
}

.maxw-500px {
  max-width: 500px;
}

.maxw-501px {
  max-width: 501px;
}

.maxw-502px {
  max-width: 502px;
}

.maxw-503px {
  max-width: 503px;
}

.maxw-504px {
  max-width: 504px;
}

.maxw-505px {
  max-width: 505px;
}

.maxw-506px {
  max-width: 506px;
}

.maxw-507px {
  max-width: 507px;
}

.maxw-508px {
  max-width: 508px;
}

.maxw-509px {
  max-width: 509px;
}

.maxw-510px {
  max-width: 510px;
}

.maxw-511px {
  max-width: 511px;
}

.maxw-512px {
  max-width: 512px;
}

.maxw-513px {
  max-width: 513px;
}

.maxw-514px {
  max-width: 514px;
}

.maxw-515px {
  max-width: 515px;
}

.maxw-516px {
  max-width: 516px;
}

.maxw-517px {
  max-width: 517px;
}

.maxw-518px {
  max-width: 518px;
}

.maxw-519px {
  max-width: 519px;
}

.maxw-520px {
  max-width: 520px;
}

.maxw-521px {
  max-width: 521px;
}

.maxw-522px {
  max-width: 522px;
}

.maxw-523px {
  max-width: 523px;
}

.maxw-524px {
  max-width: 524px;
}

.maxw-525px {
  max-width: 525px;
}

.maxw-526px {
  max-width: 526px;
}

.maxw-527px {
  max-width: 527px;
}

.maxw-528px {
  max-width: 528px;
}

.maxw-529px {
  max-width: 529px;
}

.maxw-530px {
  max-width: 530px;
}

.maxw-531px {
  max-width: 531px;
}

.maxw-532px {
  max-width: 532px;
}

.maxw-533px {
  max-width: 533px;
}

.maxw-534px {
  max-width: 534px;
}

.maxw-535px {
  max-width: 535px;
}

.maxw-536px {
  max-width: 536px;
}

.maxw-537px {
  max-width: 537px;
}

.maxw-538px {
  max-width: 538px;
}

.maxw-539px {
  max-width: 539px;
}

.maxw-540px {
  max-width: 540px;
}

.maxw-541px {
  max-width: 541px;
}

.maxw-542px {
  max-width: 542px;
}

.maxw-543px {
  max-width: 543px;
}

.maxw-544px {
  max-width: 544px;
}

.maxw-545px {
  max-width: 545px;
}

.maxw-546px {
  max-width: 546px;
}

.maxw-547px {
  max-width: 547px;
}

.maxw-548px {
  max-width: 548px;
}

.maxw-549px {
  max-width: 549px;
}

.maxw-550px {
  max-width: 550px;
}

.maxw-551px {
  max-width: 551px;
}

.maxw-552px {
  max-width: 552px;
}

.maxw-553px {
  max-width: 553px;
}

.maxw-554px {
  max-width: 554px;
}

.maxw-555px {
  max-width: 555px;
}

.maxw-556px {
  max-width: 556px;
}

.maxw-557px {
  max-width: 557px;
}

.maxw-558px {
  max-width: 558px;
}

.maxw-559px {
  max-width: 559px;
}

.maxw-560px {
  max-width: 560px;
}

.maxw-561px {
  max-width: 561px;
}

.maxw-562px {
  max-width: 562px;
}

.maxw-563px {
  max-width: 563px;
}

.maxw-564px {
  max-width: 564px;
}

.maxw-565px {
  max-width: 565px;
}

.maxw-566px {
  max-width: 566px;
}

.maxw-567px {
  max-width: 567px;
}

.maxw-568px {
  max-width: 568px;
}

.maxw-569px {
  max-width: 569px;
}

.maxw-570px {
  max-width: 570px;
}

.maxw-571px {
  max-width: 571px;
}

.maxw-572px {
  max-width: 572px;
}

.maxw-573px {
  max-width: 573px;
}

.maxw-574px {
  max-width: 574px;
}

.maxw-575px {
  max-width: 575px;
}

.maxw-576px {
  max-width: 576px;
}

.maxw-577px {
  max-width: 577px;
}

.maxw-578px {
  max-width: 578px;
}

.maxw-579px {
  max-width: 579px;
}

.maxw-580px {
  max-width: 580px;
}

.maxw-581px {
  max-width: 581px;
}

.maxw-582px {
  max-width: 582px;
}

.maxw-583px {
  max-width: 583px;
}

.maxw-584px {
  max-width: 584px;
}

.maxw-585px {
  max-width: 585px;
}

.maxw-586px {
  max-width: 586px;
}

.maxw-587px {
  max-width: 587px;
}

.maxw-588px {
  max-width: 588px;
}

.maxw-589px {
  max-width: 589px;
}

.maxw-590px {
  max-width: 590px;
}

.maxw-591px {
  max-width: 591px;
}

.maxw-592px {
  max-width: 592px;
}

.maxw-593px {
  max-width: 593px;
}

.maxw-594px {
  max-width: 594px;
}

.maxw-595px {
  max-width: 595px;
}

.maxw-596px {
  max-width: 596px;
}

.maxw-597px {
  max-width: 597px;
}

.maxw-598px {
  max-width: 598px;
}

.maxw-599px {
  max-width: 599px;
}

.maxw-600px {
  max-width: 600px;
}

.maxw-601px {
  max-width: 601px;
}

.maxw-602px {
  max-width: 602px;
}

.maxw-603px {
  max-width: 603px;
}

.maxw-604px {
  max-width: 604px;
}

.maxw-605px {
  max-width: 605px;
}

.maxw-606px {
  max-width: 606px;
}

.maxw-607px {
  max-width: 607px;
}

.maxw-608px {
  max-width: 608px;
}

.maxw-609px {
  max-width: 609px;
}

.maxw-610px {
  max-width: 610px;
}

.maxw-611px {
  max-width: 611px;
}

.maxw-612px {
  max-width: 612px;
}

.maxw-613px {
  max-width: 613px;
}

.maxw-614px {
  max-width: 614px;
}

.maxw-615px {
  max-width: 615px;
}

.maxw-616px {
  max-width: 616px;
}

.maxw-617px {
  max-width: 617px;
}

.maxw-618px {
  max-width: 618px;
}

.maxw-619px {
  max-width: 619px;
}

.maxw-620px {
  max-width: 620px;
}

.maxw-621px {
  max-width: 621px;
}

.maxw-622px {
  max-width: 622px;
}

.maxw-623px {
  max-width: 623px;
}

.maxw-624px {
  max-width: 624px;
}

.maxw-625px {
  max-width: 625px;
}

.maxw-626px {
  max-width: 626px;
}

.maxw-627px {
  max-width: 627px;
}

.maxw-628px {
  max-width: 628px;
}

.maxw-629px {
  max-width: 629px;
}

.maxw-630px {
  max-width: 630px;
}

.maxw-631px {
  max-width: 631px;
}

.maxw-632px {
  max-width: 632px;
}

.maxw-633px {
  max-width: 633px;
}

.maxw-634px {
  max-width: 634px;
}

.maxw-635px {
  max-width: 635px;
}

.maxw-636px {
  max-width: 636px;
}

.maxw-637px {
  max-width: 637px;
}

.maxw-638px {
  max-width: 638px;
}

.maxw-639px {
  max-width: 639px;
}

.maxw-640px {
  max-width: 640px;
}

.maxw-641px {
  max-width: 641px;
}

.maxw-642px {
  max-width: 642px;
}

.maxw-643px {
  max-width: 643px;
}

.maxw-644px {
  max-width: 644px;
}

.maxw-645px {
  max-width: 645px;
}

.maxw-646px {
  max-width: 646px;
}

.maxw-647px {
  max-width: 647px;
}

.maxw-648px {
  max-width: 648px;
}

.maxw-649px {
  max-width: 649px;
}

.maxw-650px {
  max-width: 650px;
}

.maxw-651px {
  max-width: 651px;
}

.maxw-652px {
  max-width: 652px;
}

.maxw-653px {
  max-width: 653px;
}

.maxw-654px {
  max-width: 654px;
}

.maxw-655px {
  max-width: 655px;
}

.maxw-656px {
  max-width: 656px;
}

.maxw-657px {
  max-width: 657px;
}

.maxw-658px {
  max-width: 658px;
}

.maxw-659px {
  max-width: 659px;
}

.maxw-660px {
  max-width: 660px;
}

.maxw-661px {
  max-width: 661px;
}

.maxw-662px {
  max-width: 662px;
}

.maxw-663px {
  max-width: 663px;
}

.maxw-664px {
  max-width: 664px;
}

.maxw-665px {
  max-width: 665px;
}

.maxw-666px {
  max-width: 666px;
}

.maxw-667px {
  max-width: 667px;
}

.maxw-668px {
  max-width: 668px;
}

.maxw-669px {
  max-width: 669px;
}

.maxw-670px {
  max-width: 670px;
}

.maxw-671px {
  max-width: 671px;
}

.maxw-672px {
  max-width: 672px;
}

.maxw-673px {
  max-width: 673px;
}

.maxw-674px {
  max-width: 674px;
}

.maxw-675px {
  max-width: 675px;
}

.maxw-676px {
  max-width: 676px;
}

.maxw-677px {
  max-width: 677px;
}

.maxw-678px {
  max-width: 678px;
}

.maxw-679px {
  max-width: 679px;
}

.maxw-680px {
  max-width: 680px;
}

.maxw-681px {
  max-width: 681px;
}

.maxw-682px {
  max-width: 682px;
}

.maxw-683px {
  max-width: 683px;
}

.maxw-684px {
  max-width: 684px;
}

.maxw-685px {
  max-width: 685px;
}

.maxw-686px {
  max-width: 686px;
}

.maxw-687px {
  max-width: 687px;
}

.maxw-688px {
  max-width: 688px;
}

.maxw-689px {
  max-width: 689px;
}

.maxw-690px {
  max-width: 690px;
}

.maxw-691px {
  max-width: 691px;
}

.maxw-692px {
  max-width: 692px;
}

.maxw-693px {
  max-width: 693px;
}

.maxw-694px {
  max-width: 694px;
}

.maxw-695px {
  max-width: 695px;
}

.maxw-696px {
  max-width: 696px;
}

.maxw-697px {
  max-width: 697px;
}

.maxw-698px {
  max-width: 698px;
}

.maxw-699px {
  max-width: 699px;
}

.maxw-700px {
  max-width: 700px;
}

.maxw-701px {
  max-width: 701px;
}

.maxw-702px {
  max-width: 702px;
}

.maxw-703px {
  max-width: 703px;
}

.maxw-704px {
  max-width: 704px;
}

.maxw-705px {
  max-width: 705px;
}

.maxw-706px {
  max-width: 706px;
}

.maxw-707px {
  max-width: 707px;
}

.maxw-708px {
  max-width: 708px;
}

.maxw-709px {
  max-width: 709px;
}

.maxw-710px {
  max-width: 710px;
}

.maxw-711px {
  max-width: 711px;
}

.maxw-712px {
  max-width: 712px;
}

.maxw-713px {
  max-width: 713px;
}

.maxw-714px {
  max-width: 714px;
}

.maxw-715px {
  max-width: 715px;
}

.maxw-716px {
  max-width: 716px;
}

.maxw-717px {
  max-width: 717px;
}

.maxw-718px {
  max-width: 718px;
}

.maxw-719px {
  max-width: 719px;
}

.maxw-720px {
  max-width: 720px;
}

.maxw-721px {
  max-width: 721px;
}

.maxw-722px {
  max-width: 722px;
}

.maxw-723px {
  max-width: 723px;
}

.maxw-724px {
  max-width: 724px;
}

.maxw-725px {
  max-width: 725px;
}

.maxw-726px {
  max-width: 726px;
}

.maxw-727px {
  max-width: 727px;
}

.maxw-728px {
  max-width: 728px;
}

.maxw-729px {
  max-width: 729px;
}

.maxw-730px {
  max-width: 730px;
}

.maxw-731px {
  max-width: 731px;
}

.maxw-732px {
  max-width: 732px;
}

.maxw-733px {
  max-width: 733px;
}

.maxw-734px {
  max-width: 734px;
}

.maxw-735px {
  max-width: 735px;
}

.maxw-736px {
  max-width: 736px;
}

.maxw-737px {
  max-width: 737px;
}

.maxw-738px {
  max-width: 738px;
}

.maxw-739px {
  max-width: 739px;
}

.maxw-740px {
  max-width: 740px;
}

.maxw-741px {
  max-width: 741px;
}

.maxw-742px {
  max-width: 742px;
}

.maxw-743px {
  max-width: 743px;
}

.maxw-744px {
  max-width: 744px;
}

.maxw-745px {
  max-width: 745px;
}

.maxw-746px {
  max-width: 746px;
}

.maxw-747px {
  max-width: 747px;
}

.maxw-748px {
  max-width: 748px;
}

.maxw-749px {
  max-width: 749px;
}

.maxw-750px {
  max-width: 750px;
}

.maxw-751px {
  max-width: 751px;
}

.maxw-752px {
  max-width: 752px;
}

.maxw-753px {
  max-width: 753px;
}

.maxw-754px {
  max-width: 754px;
}

.maxw-755px {
  max-width: 755px;
}

.maxw-756px {
  max-width: 756px;
}

.maxw-757px {
  max-width: 757px;
}

.maxw-758px {
  max-width: 758px;
}

.maxw-759px {
  max-width: 759px;
}

.maxw-760px {
  max-width: 760px;
}

.maxw-761px {
  max-width: 761px;
}

.maxw-762px {
  max-width: 762px;
}

.maxw-763px {
  max-width: 763px;
}

.maxw-764px {
  max-width: 764px;
}

.maxw-765px {
  max-width: 765px;
}

.maxw-766px {
  max-width: 766px;
}

.maxw-767px {
  max-width: 767px;
}

.maxw-768px {
  max-width: 768px;
}

.maxw-769px {
  max-width: 769px;
}

.maxw-770px {
  max-width: 770px;
}

.maxw-771px {
  max-width: 771px;
}

.maxw-772px {
  max-width: 772px;
}

.maxw-773px {
  max-width: 773px;
}

.maxw-774px {
  max-width: 774px;
}

.maxw-775px {
  max-width: 775px;
}

.maxw-776px {
  max-width: 776px;
}

.maxw-777px {
  max-width: 777px;
}

.maxw-778px {
  max-width: 778px;
}

.maxw-779px {
  max-width: 779px;
}

.maxw-780px {
  max-width: 780px;
}

.maxw-781px {
  max-width: 781px;
}

.maxw-782px {
  max-width: 782px;
}

.maxw-783px {
  max-width: 783px;
}

.maxw-784px {
  max-width: 784px;
}

.maxw-785px {
  max-width: 785px;
}

.maxw-786px {
  max-width: 786px;
}

.maxw-787px {
  max-width: 787px;
}

.maxw-788px {
  max-width: 788px;
}

.maxw-789px {
  max-width: 789px;
}

.maxw-790px {
  max-width: 790px;
}

.maxw-791px {
  max-width: 791px;
}

.maxw-792px {
  max-width: 792px;
}

.maxw-793px {
  max-width: 793px;
}

.maxw-794px {
  max-width: 794px;
}

.maxw-795px {
  max-width: 795px;
}

.maxw-796px {
  max-width: 796px;
}

.maxw-797px {
  max-width: 797px;
}

.maxw-798px {
  max-width: 798px;
}

.maxw-799px {
  max-width: 799px;
}

.maxw-800px {
  max-width: 800px;
}

.maxw-801px {
  max-width: 801px;
}

.maxw-802px {
  max-width: 802px;
}

.maxw-803px {
  max-width: 803px;
}

.maxw-804px {
  max-width: 804px;
}

.maxw-805px {
  max-width: 805px;
}

.maxw-806px {
  max-width: 806px;
}

.maxw-807px {
  max-width: 807px;
}

.maxw-808px {
  max-width: 808px;
}

.maxw-809px {
  max-width: 809px;
}

.maxw-810px {
  max-width: 810px;
}

.maxw-811px {
  max-width: 811px;
}

.maxw-812px {
  max-width: 812px;
}

.maxw-813px {
  max-width: 813px;
}

.maxw-814px {
  max-width: 814px;
}

.maxw-815px {
  max-width: 815px;
}

.maxw-816px {
  max-width: 816px;
}

.maxw-817px {
  max-width: 817px;
}

.maxw-818px {
  max-width: 818px;
}

.maxw-819px {
  max-width: 819px;
}

.maxw-820px {
  max-width: 820px;
}

.maxw-821px {
  max-width: 821px;
}

.maxw-822px {
  max-width: 822px;
}

.maxw-823px {
  max-width: 823px;
}

.maxw-824px {
  max-width: 824px;
}

.maxw-825px {
  max-width: 825px;
}

.maxw-826px {
  max-width: 826px;
}

.maxw-827px {
  max-width: 827px;
}

.maxw-828px {
  max-width: 828px;
}

.maxw-829px {
  max-width: 829px;
}

.maxw-830px {
  max-width: 830px;
}

.maxw-831px {
  max-width: 831px;
}

.maxw-832px {
  max-width: 832px;
}

.maxw-833px {
  max-width: 833px;
}

.maxw-834px {
  max-width: 834px;
}

.maxw-835px {
  max-width: 835px;
}

.maxw-836px {
  max-width: 836px;
}

.maxw-837px {
  max-width: 837px;
}

.maxw-838px {
  max-width: 838px;
}

.maxw-839px {
  max-width: 839px;
}

.maxw-840px {
  max-width: 840px;
}

.maxw-841px {
  max-width: 841px;
}

.maxw-842px {
  max-width: 842px;
}

.maxw-843px {
  max-width: 843px;
}

.maxw-844px {
  max-width: 844px;
}

.maxw-845px {
  max-width: 845px;
}

.maxw-846px {
  max-width: 846px;
}

.maxw-847px {
  max-width: 847px;
}

.maxw-848px {
  max-width: 848px;
}

.maxw-849px {
  max-width: 849px;
}

.maxw-850px {
  max-width: 850px;
}

.maxw-851px {
  max-width: 851px;
}

.maxw-852px {
  max-width: 852px;
}

.maxw-853px {
  max-width: 853px;
}

.maxw-854px {
  max-width: 854px;
}

.maxw-855px {
  max-width: 855px;
}

.maxw-856px {
  max-width: 856px;
}

.maxw-857px {
  max-width: 857px;
}

.maxw-858px {
  max-width: 858px;
}

.maxw-859px {
  max-width: 859px;
}

.maxw-860px {
  max-width: 860px;
}

.maxw-861px {
  max-width: 861px;
}

.maxw-862px {
  max-width: 862px;
}

.maxw-863px {
  max-width: 863px;
}

.maxw-864px {
  max-width: 864px;
}

.maxw-865px {
  max-width: 865px;
}

.maxw-866px {
  max-width: 866px;
}

.maxw-867px {
  max-width: 867px;
}

.maxw-868px {
  max-width: 868px;
}

.maxw-869px {
  max-width: 869px;
}

.maxw-870px {
  max-width: 870px;
}

.maxw-871px {
  max-width: 871px;
}

.maxw-872px {
  max-width: 872px;
}

.maxw-873px {
  max-width: 873px;
}

.maxw-874px {
  max-width: 874px;
}

.maxw-875px {
  max-width: 875px;
}

.maxw-876px {
  max-width: 876px;
}

.maxw-877px {
  max-width: 877px;
}

.maxw-878px {
  max-width: 878px;
}

.maxw-879px {
  max-width: 879px;
}

.maxw-880px {
  max-width: 880px;
}

.maxw-881px {
  max-width: 881px;
}

.maxw-882px {
  max-width: 882px;
}

.maxw-883px {
  max-width: 883px;
}

.maxw-884px {
  max-width: 884px;
}

.maxw-885px {
  max-width: 885px;
}

.maxw-886px {
  max-width: 886px;
}

.maxw-887px {
  max-width: 887px;
}

.maxw-888px {
  max-width: 888px;
}

.maxw-889px {
  max-width: 889px;
}

.maxw-890px {
  max-width: 890px;
}

.maxw-891px {
  max-width: 891px;
}

.maxw-892px {
  max-width: 892px;
}

.maxw-893px {
  max-width: 893px;
}

.maxw-894px {
  max-width: 894px;
}

.maxw-895px {
  max-width: 895px;
}

.maxw-896px {
  max-width: 896px;
}

.maxw-897px {
  max-width: 897px;
}

.maxw-898px {
  max-width: 898px;
}

.maxw-899px {
  max-width: 899px;
}

.maxw-900px {
  max-width: 900px;
}

.maxw-901px {
  max-width: 901px;
}

.maxw-902px {
  max-width: 902px;
}

.maxw-903px {
  max-width: 903px;
}

.maxw-904px {
  max-width: 904px;
}

.maxw-905px {
  max-width: 905px;
}

.maxw-906px {
  max-width: 906px;
}

.maxw-907px {
  max-width: 907px;
}

.maxw-908px {
  max-width: 908px;
}

.maxw-909px {
  max-width: 909px;
}

.maxw-910px {
  max-width: 910px;
}

.maxw-911px {
  max-width: 911px;
}

.maxw-912px {
  max-width: 912px;
}

.maxw-913px {
  max-width: 913px;
}

.maxw-914px {
  max-width: 914px;
}

.maxw-915px {
  max-width: 915px;
}

.maxw-916px {
  max-width: 916px;
}

.maxw-917px {
  max-width: 917px;
}

.maxw-918px {
  max-width: 918px;
}

.maxw-919px {
  max-width: 919px;
}

.maxw-920px {
  max-width: 920px;
}

.maxw-921px {
  max-width: 921px;
}

.maxw-922px {
  max-width: 922px;
}

.maxw-923px {
  max-width: 923px;
}

.maxw-924px {
  max-width: 924px;
}

.maxw-925px {
  max-width: 925px;
}

.maxw-926px {
  max-width: 926px;
}

.maxw-927px {
  max-width: 927px;
}

.maxw-928px {
  max-width: 928px;
}

.maxw-929px {
  max-width: 929px;
}

.maxw-930px {
  max-width: 930px;
}

.maxw-931px {
  max-width: 931px;
}

.maxw-932px {
  max-width: 932px;
}

.maxw-933px {
  max-width: 933px;
}

.maxw-934px {
  max-width: 934px;
}

.maxw-935px {
  max-width: 935px;
}

.maxw-936px {
  max-width: 936px;
}

.maxw-937px {
  max-width: 937px;
}

.maxw-938px {
  max-width: 938px;
}

.maxw-939px {
  max-width: 939px;
}

.maxw-940px {
  max-width: 940px;
}

.maxw-941px {
  max-width: 941px;
}

.maxw-942px {
  max-width: 942px;
}

.maxw-943px {
  max-width: 943px;
}

.maxw-944px {
  max-width: 944px;
}

.maxw-945px {
  max-width: 945px;
}

.maxw-946px {
  max-width: 946px;
}

.maxw-947px {
  max-width: 947px;
}

.maxw-948px {
  max-width: 948px;
}

.maxw-949px {
  max-width: 949px;
}

.maxw-950px {
  max-width: 950px;
}

.maxw-951px {
  max-width: 951px;
}

.maxw-952px {
  max-width: 952px;
}

.maxw-953px {
  max-width: 953px;
}

.maxw-954px {
  max-width: 954px;
}

.maxw-955px {
  max-width: 955px;
}

.maxw-956px {
  max-width: 956px;
}

.maxw-957px {
  max-width: 957px;
}

.maxw-958px {
  max-width: 958px;
}

.maxw-959px {
  max-width: 959px;
}

.maxw-960px {
  max-width: 960px;
}

.maxw-961px {
  max-width: 961px;
}

.maxw-962px {
  max-width: 962px;
}

.maxw-963px {
  max-width: 963px;
}

.maxw-964px {
  max-width: 964px;
}

.maxw-965px {
  max-width: 965px;
}

.maxw-966px {
  max-width: 966px;
}

.maxw-967px {
  max-width: 967px;
}

.maxw-968px {
  max-width: 968px;
}

.maxw-969px {
  max-width: 969px;
}

.maxw-970px {
  max-width: 970px;
}

.maxw-971px {
  max-width: 971px;
}

.maxw-972px {
  max-width: 972px;
}

.maxw-973px {
  max-width: 973px;
}

.maxw-974px {
  max-width: 974px;
}

.maxw-975px {
  max-width: 975px;
}

.maxw-976px {
  max-width: 976px;
}

.maxw-977px {
  max-width: 977px;
}

.maxw-978px {
  max-width: 978px;
}

.maxw-979px {
  max-width: 979px;
}

.maxw-980px {
  max-width: 980px;
}

.maxw-981px {
  max-width: 981px;
}

.maxw-982px {
  max-width: 982px;
}

.maxw-983px {
  max-width: 983px;
}

.maxw-984px {
  max-width: 984px;
}

.maxw-985px {
  max-width: 985px;
}

.maxw-986px {
  max-width: 986px;
}

.maxw-987px {
  max-width: 987px;
}

.maxw-988px {
  max-width: 988px;
}

.maxw-989px {
  max-width: 989px;
}

.maxw-990px {
  max-width: 990px;
}

.maxw-991px {
  max-width: 991px;
}

.maxw-992px {
  max-width: 992px;
}

.maxw-993px {
  max-width: 993px;
}

.maxw-994px {
  max-width: 994px;
}

.maxw-995px {
  max-width: 995px;
}

.maxw-996px {
  max-width: 996px;
}

.maxw-997px {
  max-width: 997px;
}

.maxw-998px {
  max-width: 998px;
}

.maxw-999px {
  max-width: 999px;
}

.maxw-1000px {
  max-width: 1000px;
}

.h-1px, .header-line:after {
  height: 1px;
}

@media (min-width: 992px) {
  .h-lg-1px {
    height: 1px;
  }
}
.h-2px {
  height: 2px;
}

@media (min-width: 992px) {
  .h-lg-2px {
    height: 2px;
  }
}
.h-3px {
  height: 3px;
}

@media (min-width: 992px) {
  .h-lg-3px {
    height: 3px;
  }
}
.h-4px {
  height: 4px;
}

@media (min-width: 992px) {
  .h-lg-4px {
    height: 4px;
  }
}
.h-5px {
  height: 5px;
}

@media (min-width: 992px) {
  .h-lg-5px {
    height: 5px;
  }
}
.h-6px {
  height: 6px;
}

@media (min-width: 992px) {
  .h-lg-6px {
    height: 6px;
  }
}
.h-7px {
  height: 7px;
}

@media (min-width: 992px) {
  .h-lg-7px {
    height: 7px;
  }
}
.h-8px {
  height: 8px;
}

@media (min-width: 992px) {
  .h-lg-8px {
    height: 8px;
  }
}
.h-9px {
  height: 9px;
}

@media (min-width: 992px) {
  .h-lg-9px {
    height: 9px;
  }
}
.h-10px {
  height: 10px;
}

@media (min-width: 992px) {
  .h-lg-10px {
    height: 10px;
  }
}
.h-11px {
  height: 11px;
}

@media (min-width: 992px) {
  .h-lg-11px {
    height: 11px;
  }
}
.h-12px {
  height: 12px;
}

@media (min-width: 992px) {
  .h-lg-12px {
    height: 12px;
  }
}
.h-13px {
  height: 13px;
}

@media (min-width: 992px) {
  .h-lg-13px {
    height: 13px;
  }
}
.h-14px {
  height: 14px;
}

@media (min-width: 992px) {
  .h-lg-14px {
    height: 14px;
  }
}
.h-15px, .header-line:before {
  height: 15px;
}

@media (min-width: 992px) {
  .h-lg-15px {
    height: 15px;
  }
}
.h-16px {
  height: 16px;
}

@media (min-width: 992px) {
  .h-lg-16px {
    height: 16px;
  }
}
.h-17px {
  height: 17px;
}

@media (min-width: 992px) {
  .h-lg-17px {
    height: 17px;
  }
}
.h-18px {
  height: 18px;
}

@media (min-width: 992px) {
  .h-lg-18px {
    height: 18px;
  }
}
.h-19px {
  height: 19px;
}

@media (min-width: 992px) {
  .h-lg-19px {
    height: 19px;
  }
}
.h-20px {
  height: 20px;
}

@media (min-width: 992px) {
  .h-lg-20px {
    height: 20px;
  }
}
.h-21px {
  height: 21px;
}

@media (min-width: 992px) {
  .h-lg-21px {
    height: 21px;
  }
}
.h-22px {
  height: 22px;
}

@media (min-width: 992px) {
  .h-lg-22px {
    height: 22px;
  }
}
.h-23px {
  height: 23px;
}

@media (min-width: 992px) {
  .h-lg-23px {
    height: 23px;
  }
}
.h-24px {
  height: 24px;
}

@media (min-width: 992px) {
  .h-lg-24px {
    height: 24px;
  }
}
.h-25px {
  height: 25px;
}

@media (min-width: 992px) {
  .h-lg-25px {
    height: 25px;
  }
}
.h-26px {
  height: 26px;
}

@media (min-width: 992px) {
  .h-lg-26px {
    height: 26px;
  }
}
.h-27px {
  height: 27px;
}

@media (min-width: 992px) {
  .h-lg-27px {
    height: 27px;
  }
}
.h-28px {
  height: 28px;
}

@media (min-width: 992px) {
  .h-lg-28px {
    height: 28px;
  }
}
.h-29px {
  height: 29px;
}

@media (min-width: 992px) {
  .h-lg-29px {
    height: 29px;
  }
}
.h-30px {
  height: 30px;
}

@media (min-width: 992px) {
  .h-lg-30px {
    height: 30px;
  }
}
.h-31px {
  height: 31px;
}

@media (min-width: 992px) {
  .h-lg-31px {
    height: 31px;
  }
}
.h-32px {
  height: 32px;
}

@media (min-width: 992px) {
  .h-lg-32px {
    height: 32px;
  }
}
.h-33px {
  height: 33px;
}

@media (min-width: 992px) {
  .h-lg-33px {
    height: 33px;
  }
}
.h-34px {
  height: 34px;
}

@media (min-width: 992px) {
  .h-lg-34px {
    height: 34px;
  }
}
.h-35px {
  height: 35px;
}

@media (min-width: 992px) {
  .h-lg-35px {
    height: 35px;
  }
}
.h-36px {
  height: 36px;
}

@media (min-width: 992px) {
  .h-lg-36px {
    height: 36px;
  }
}
.h-37px {
  height: 37px;
}

@media (min-width: 992px) {
  .h-lg-37px {
    height: 37px;
  }
}
.h-38px {
  height: 38px;
}

@media (min-width: 992px) {
  .h-lg-38px {
    height: 38px;
  }
}
.h-39px {
  height: 39px;
}

@media (min-width: 992px) {
  .h-lg-39px {
    height: 39px;
  }
}
.h-40px {
  height: 40px;
}

@media (min-width: 992px) {
  .h-lg-40px {
    height: 40px;
  }
}
.h-41px {
  height: 41px;
}

@media (min-width: 992px) {
  .h-lg-41px {
    height: 41px;
  }
}
.h-42px {
  height: 42px;
}

@media (min-width: 992px) {
  .h-lg-42px {
    height: 42px;
  }
}
.h-43px {
  height: 43px;
}

@media (min-width: 992px) {
  .h-lg-43px {
    height: 43px;
  }
}
.h-44px {
  height: 44px;
}

@media (min-width: 992px) {
  .h-lg-44px {
    height: 44px;
  }
}
.h-45px {
  height: 45px;
}

@media (min-width: 992px) {
  .h-lg-45px {
    height: 45px;
  }
}
.h-46px {
  height: 46px;
}

@media (min-width: 992px) {
  .h-lg-46px {
    height: 46px;
  }
}
.h-47px {
  height: 47px;
}

@media (min-width: 992px) {
  .h-lg-47px {
    height: 47px;
  }
}
.h-48px {
  height: 48px;
}

@media (min-width: 992px) {
  .h-lg-48px {
    height: 48px;
  }
}
.h-49px {
  height: 49px;
}

@media (min-width: 992px) {
  .h-lg-49px {
    height: 49px;
  }
}
.h-50px {
  height: 50px;
}

@media (min-width: 992px) {
  .h-lg-50px {
    height: 50px;
  }
}
.h-51px {
  height: 51px;
}

@media (min-width: 992px) {
  .h-lg-51px {
    height: 51px;
  }
}
.h-52px {
  height: 52px;
}

@media (min-width: 992px) {
  .h-lg-52px {
    height: 52px;
  }
}
.h-53px {
  height: 53px;
}

@media (min-width: 992px) {
  .h-lg-53px {
    height: 53px;
  }
}
.h-54px {
  height: 54px;
}

@media (min-width: 992px) {
  .h-lg-54px {
    height: 54px;
  }
}
.h-55px {
  height: 55px;
}

@media (min-width: 992px) {
  .h-lg-55px {
    height: 55px;
  }
}
.h-56px {
  height: 56px;
}

@media (min-width: 992px) {
  .h-lg-56px {
    height: 56px;
  }
}
.h-57px {
  height: 57px;
}

@media (min-width: 992px) {
  .h-lg-57px {
    height: 57px;
  }
}
.h-58px {
  height: 58px;
}

@media (min-width: 992px) {
  .h-lg-58px {
    height: 58px;
  }
}
.h-59px {
  height: 59px;
}

@media (min-width: 992px) {
  .h-lg-59px {
    height: 59px;
  }
}
.h-60px {
  height: 60px;
}

@media (min-width: 992px) {
  .h-lg-60px {
    height: 60px;
  }
}
.h-61px {
  height: 61px;
}

@media (min-width: 992px) {
  .h-lg-61px {
    height: 61px;
  }
}
.h-62px {
  height: 62px;
}

@media (min-width: 992px) {
  .h-lg-62px {
    height: 62px;
  }
}
.h-63px {
  height: 63px;
}

@media (min-width: 992px) {
  .h-lg-63px {
    height: 63px;
  }
}
.h-64px {
  height: 64px;
}

@media (min-width: 992px) {
  .h-lg-64px {
    height: 64px;
  }
}
.h-65px {
  height: 65px;
}

@media (min-width: 992px) {
  .h-lg-65px {
    height: 65px;
  }
}
.h-66px {
  height: 66px;
}

@media (min-width: 992px) {
  .h-lg-66px {
    height: 66px;
  }
}
.h-67px {
  height: 67px;
}

@media (min-width: 992px) {
  .h-lg-67px {
    height: 67px;
  }
}
.h-68px {
  height: 68px;
}

@media (min-width: 992px) {
  .h-lg-68px {
    height: 68px;
  }
}
.h-69px {
  height: 69px;
}

@media (min-width: 992px) {
  .h-lg-69px {
    height: 69px;
  }
}
.h-70px {
  height: 70px;
}

@media (min-width: 992px) {
  .h-lg-70px {
    height: 70px;
  }
}
.h-71px {
  height: 71px;
}

@media (min-width: 992px) {
  .h-lg-71px {
    height: 71px;
  }
}
.h-72px {
  height: 72px;
}

@media (min-width: 992px) {
  .h-lg-72px {
    height: 72px;
  }
}
.h-73px {
  height: 73px;
}

@media (min-width: 992px) {
  .h-lg-73px {
    height: 73px;
  }
}
.h-74px {
  height: 74px;
}

@media (min-width: 992px) {
  .h-lg-74px {
    height: 74px;
  }
}
.h-75px {
  height: 75px;
}

@media (min-width: 992px) {
  .h-lg-75px {
    height: 75px;
  }
}
.h-76px {
  height: 76px;
}

@media (min-width: 992px) {
  .h-lg-76px {
    height: 76px;
  }
}
.h-77px {
  height: 77px;
}

@media (min-width: 992px) {
  .h-lg-77px {
    height: 77px;
  }
}
.h-78px {
  height: 78px;
}

@media (min-width: 992px) {
  .h-lg-78px {
    height: 78px;
  }
}
.h-79px {
  height: 79px;
}

@media (min-width: 992px) {
  .h-lg-79px {
    height: 79px;
  }
}
.h-80px {
  height: 80px;
}

@media (min-width: 992px) {
  .h-lg-80px {
    height: 80px;
  }
}
.h-81px {
  height: 81px;
}

@media (min-width: 992px) {
  .h-lg-81px {
    height: 81px;
  }
}
.h-82px {
  height: 82px;
}

@media (min-width: 992px) {
  .h-lg-82px {
    height: 82px;
  }
}
.h-83px {
  height: 83px;
}

@media (min-width: 992px) {
  .h-lg-83px {
    height: 83px;
  }
}
.h-84px {
  height: 84px;
}

@media (min-width: 992px) {
  .h-lg-84px {
    height: 84px;
  }
}
.h-85px {
  height: 85px;
}

@media (min-width: 992px) {
  .h-lg-85px {
    height: 85px;
  }
}
.h-86px {
  height: 86px;
}

@media (min-width: 992px) {
  .h-lg-86px {
    height: 86px;
  }
}
.h-87px {
  height: 87px;
}

@media (min-width: 992px) {
  .h-lg-87px {
    height: 87px;
  }
}
.h-88px {
  height: 88px;
}

@media (min-width: 992px) {
  .h-lg-88px {
    height: 88px;
  }
}
.h-89px {
  height: 89px;
}

@media (min-width: 992px) {
  .h-lg-89px {
    height: 89px;
  }
}
.h-90px {
  height: 90px;
}

@media (min-width: 992px) {
  .h-lg-90px {
    height: 90px;
  }
}
.h-91px {
  height: 91px;
}

@media (min-width: 992px) {
  .h-lg-91px {
    height: 91px;
  }
}
.h-92px {
  height: 92px;
}

@media (min-width: 992px) {
  .h-lg-92px {
    height: 92px;
  }
}
.h-93px {
  height: 93px;
}

@media (min-width: 992px) {
  .h-lg-93px {
    height: 93px;
  }
}
.h-94px {
  height: 94px;
}

@media (min-width: 992px) {
  .h-lg-94px {
    height: 94px;
  }
}
.h-95px {
  height: 95px;
}

@media (min-width: 992px) {
  .h-lg-95px {
    height: 95px;
  }
}
.h-96px {
  height: 96px;
}

@media (min-width: 992px) {
  .h-lg-96px {
    height: 96px;
  }
}
.h-97px {
  height: 97px;
}

@media (min-width: 992px) {
  .h-lg-97px {
    height: 97px;
  }
}
.h-98px {
  height: 98px;
}

@media (min-width: 992px) {
  .h-lg-98px {
    height: 98px;
  }
}
.h-99px {
  height: 99px;
}

@media (min-width: 992px) {
  .h-lg-99px {
    height: 99px;
  }
}
.h-100px {
  height: 100px;
}

@media (min-width: 992px) {
  .h-lg-100px {
    height: 100px;
  }
}
.h-101px {
  height: 101px;
}

@media (min-width: 992px) {
  .h-lg-101px {
    height: 101px;
  }
}
.h-102px {
  height: 102px;
}

@media (min-width: 992px) {
  .h-lg-102px {
    height: 102px;
  }
}
.h-103px {
  height: 103px;
}

@media (min-width: 992px) {
  .h-lg-103px {
    height: 103px;
  }
}
.h-104px {
  height: 104px;
}

@media (min-width: 992px) {
  .h-lg-104px {
    height: 104px;
  }
}
.h-105px {
  height: 105px;
}

@media (min-width: 992px) {
  .h-lg-105px {
    height: 105px;
  }
}
.h-106px {
  height: 106px;
}

@media (min-width: 992px) {
  .h-lg-106px {
    height: 106px;
  }
}
.h-107px {
  height: 107px;
}

@media (min-width: 992px) {
  .h-lg-107px {
    height: 107px;
  }
}
.h-108px {
  height: 108px;
}

@media (min-width: 992px) {
  .h-lg-108px {
    height: 108px;
  }
}
.h-109px {
  height: 109px;
}

@media (min-width: 992px) {
  .h-lg-109px {
    height: 109px;
  }
}
.h-110px {
  height: 110px;
}

@media (min-width: 992px) {
  .h-lg-110px {
    height: 110px;
  }
}
.h-111px {
  height: 111px;
}

@media (min-width: 992px) {
  .h-lg-111px {
    height: 111px;
  }
}
.h-112px {
  height: 112px;
}

@media (min-width: 992px) {
  .h-lg-112px {
    height: 112px;
  }
}
.h-113px {
  height: 113px;
}

@media (min-width: 992px) {
  .h-lg-113px {
    height: 113px;
  }
}
.h-114px {
  height: 114px;
}

@media (min-width: 992px) {
  .h-lg-114px {
    height: 114px;
  }
}
.h-115px {
  height: 115px;
}

@media (min-width: 992px) {
  .h-lg-115px {
    height: 115px;
  }
}
.h-116px {
  height: 116px;
}

@media (min-width: 992px) {
  .h-lg-116px {
    height: 116px;
  }
}
.h-117px {
  height: 117px;
}

@media (min-width: 992px) {
  .h-lg-117px {
    height: 117px;
  }
}
.h-118px {
  height: 118px;
}

@media (min-width: 992px) {
  .h-lg-118px {
    height: 118px;
  }
}
.h-119px {
  height: 119px;
}

@media (min-width: 992px) {
  .h-lg-119px {
    height: 119px;
  }
}
.h-120px {
  height: 120px;
}

@media (min-width: 992px) {
  .h-lg-120px {
    height: 120px;
  }
}
.h-121px {
  height: 121px;
}

@media (min-width: 992px) {
  .h-lg-121px {
    height: 121px;
  }
}
.h-122px {
  height: 122px;
}

@media (min-width: 992px) {
  .h-lg-122px {
    height: 122px;
  }
}
.h-123px {
  height: 123px;
}

@media (min-width: 992px) {
  .h-lg-123px {
    height: 123px;
  }
}
.h-124px {
  height: 124px;
}

@media (min-width: 992px) {
  .h-lg-124px {
    height: 124px;
  }
}
.h-125px {
  height: 125px;
}

@media (min-width: 992px) {
  .h-lg-125px {
    height: 125px;
  }
}
.h-126px {
  height: 126px;
}

@media (min-width: 992px) {
  .h-lg-126px {
    height: 126px;
  }
}
.h-127px {
  height: 127px;
}

@media (min-width: 992px) {
  .h-lg-127px {
    height: 127px;
  }
}
.h-128px {
  height: 128px;
}

@media (min-width: 992px) {
  .h-lg-128px {
    height: 128px;
  }
}
.h-129px {
  height: 129px;
}

@media (min-width: 992px) {
  .h-lg-129px {
    height: 129px;
  }
}
.h-130px {
  height: 130px;
}

@media (min-width: 992px) {
  .h-lg-130px {
    height: 130px;
  }
}
.h-131px {
  height: 131px;
}

@media (min-width: 992px) {
  .h-lg-131px {
    height: 131px;
  }
}
.h-132px {
  height: 132px;
}

@media (min-width: 992px) {
  .h-lg-132px {
    height: 132px;
  }
}
.h-133px {
  height: 133px;
}

@media (min-width: 992px) {
  .h-lg-133px {
    height: 133px;
  }
}
.h-134px {
  height: 134px;
}

@media (min-width: 992px) {
  .h-lg-134px {
    height: 134px;
  }
}
.h-135px {
  height: 135px;
}

@media (min-width: 992px) {
  .h-lg-135px {
    height: 135px;
  }
}
.h-136px {
  height: 136px;
}

@media (min-width: 992px) {
  .h-lg-136px {
    height: 136px;
  }
}
.h-137px {
  height: 137px;
}

@media (min-width: 992px) {
  .h-lg-137px {
    height: 137px;
  }
}
.h-138px {
  height: 138px;
}

@media (min-width: 992px) {
  .h-lg-138px {
    height: 138px;
  }
}
.h-139px {
  height: 139px;
}

@media (min-width: 992px) {
  .h-lg-139px {
    height: 139px;
  }
}
.h-140px {
  height: 140px;
}

@media (min-width: 992px) {
  .h-lg-140px {
    height: 140px;
  }
}
.h-141px {
  height: 141px;
}

@media (min-width: 992px) {
  .h-lg-141px {
    height: 141px;
  }
}
.h-142px {
  height: 142px;
}

@media (min-width: 992px) {
  .h-lg-142px {
    height: 142px;
  }
}
.h-143px {
  height: 143px;
}

@media (min-width: 992px) {
  .h-lg-143px {
    height: 143px;
  }
}
.h-144px {
  height: 144px;
}

@media (min-width: 992px) {
  .h-lg-144px {
    height: 144px;
  }
}
.h-145px {
  height: 145px;
}

@media (min-width: 992px) {
  .h-lg-145px {
    height: 145px;
  }
}
.h-146px {
  height: 146px;
}

@media (min-width: 992px) {
  .h-lg-146px {
    height: 146px;
  }
}
.h-147px {
  height: 147px;
}

@media (min-width: 992px) {
  .h-lg-147px {
    height: 147px;
  }
}
.h-148px {
  height: 148px;
}

@media (min-width: 992px) {
  .h-lg-148px {
    height: 148px;
  }
}
.h-149px {
  height: 149px;
}

@media (min-width: 992px) {
  .h-lg-149px {
    height: 149px;
  }
}
.h-150px {
  height: 150px;
}

@media (min-width: 992px) {
  .h-lg-150px {
    height: 150px;
  }
}
.h-151px {
  height: 151px;
}

@media (min-width: 992px) {
  .h-lg-151px {
    height: 151px;
  }
}
.h-152px {
  height: 152px;
}

@media (min-width: 992px) {
  .h-lg-152px {
    height: 152px;
  }
}
.h-153px {
  height: 153px;
}

@media (min-width: 992px) {
  .h-lg-153px {
    height: 153px;
  }
}
.h-154px {
  height: 154px;
}

@media (min-width: 992px) {
  .h-lg-154px {
    height: 154px;
  }
}
.h-155px {
  height: 155px;
}

@media (min-width: 992px) {
  .h-lg-155px {
    height: 155px;
  }
}
.h-156px {
  height: 156px;
}

@media (min-width: 992px) {
  .h-lg-156px {
    height: 156px;
  }
}
.h-157px {
  height: 157px;
}

@media (min-width: 992px) {
  .h-lg-157px {
    height: 157px;
  }
}
.h-158px {
  height: 158px;
}

@media (min-width: 992px) {
  .h-lg-158px {
    height: 158px;
  }
}
.h-159px {
  height: 159px;
}

@media (min-width: 992px) {
  .h-lg-159px {
    height: 159px;
  }
}
.h-160px {
  height: 160px;
}

@media (min-width: 992px) {
  .h-lg-160px {
    height: 160px;
  }
}
.h-161px {
  height: 161px;
}

@media (min-width: 992px) {
  .h-lg-161px {
    height: 161px;
  }
}
.h-162px {
  height: 162px;
}

@media (min-width: 992px) {
  .h-lg-162px {
    height: 162px;
  }
}
.h-163px {
  height: 163px;
}

@media (min-width: 992px) {
  .h-lg-163px {
    height: 163px;
  }
}
.h-164px {
  height: 164px;
}

@media (min-width: 992px) {
  .h-lg-164px {
    height: 164px;
  }
}
.h-165px {
  height: 165px;
}

@media (min-width: 992px) {
  .h-lg-165px {
    height: 165px;
  }
}
.h-166px {
  height: 166px;
}

@media (min-width: 992px) {
  .h-lg-166px {
    height: 166px;
  }
}
.h-167px {
  height: 167px;
}

@media (min-width: 992px) {
  .h-lg-167px {
    height: 167px;
  }
}
.h-168px {
  height: 168px;
}

@media (min-width: 992px) {
  .h-lg-168px {
    height: 168px;
  }
}
.h-169px {
  height: 169px;
}

@media (min-width: 992px) {
  .h-lg-169px {
    height: 169px;
  }
}
.h-170px {
  height: 170px;
}

@media (min-width: 992px) {
  .h-lg-170px {
    height: 170px;
  }
}
.h-171px {
  height: 171px;
}

@media (min-width: 992px) {
  .h-lg-171px {
    height: 171px;
  }
}
.h-172px {
  height: 172px;
}

@media (min-width: 992px) {
  .h-lg-172px {
    height: 172px;
  }
}
.h-173px {
  height: 173px;
}

@media (min-width: 992px) {
  .h-lg-173px {
    height: 173px;
  }
}
.h-174px {
  height: 174px;
}

@media (min-width: 992px) {
  .h-lg-174px {
    height: 174px;
  }
}
.h-175px {
  height: 175px;
}

@media (min-width: 992px) {
  .h-lg-175px {
    height: 175px;
  }
}
.h-176px {
  height: 176px;
}

@media (min-width: 992px) {
  .h-lg-176px {
    height: 176px;
  }
}
.h-177px {
  height: 177px;
}

@media (min-width: 992px) {
  .h-lg-177px {
    height: 177px;
  }
}
.h-178px {
  height: 178px;
}

@media (min-width: 992px) {
  .h-lg-178px {
    height: 178px;
  }
}
.h-179px {
  height: 179px;
}

@media (min-width: 992px) {
  .h-lg-179px {
    height: 179px;
  }
}
.h-180px {
  height: 180px;
}

@media (min-width: 992px) {
  .h-lg-180px {
    height: 180px;
  }
}
.h-181px {
  height: 181px;
}

@media (min-width: 992px) {
  .h-lg-181px {
    height: 181px;
  }
}
.h-182px {
  height: 182px;
}

@media (min-width: 992px) {
  .h-lg-182px {
    height: 182px;
  }
}
.h-183px {
  height: 183px;
}

@media (min-width: 992px) {
  .h-lg-183px {
    height: 183px;
  }
}
.h-184px {
  height: 184px;
}

@media (min-width: 992px) {
  .h-lg-184px {
    height: 184px;
  }
}
.h-185px {
  height: 185px;
}

@media (min-width: 992px) {
  .h-lg-185px {
    height: 185px;
  }
}
.h-186px {
  height: 186px;
}

@media (min-width: 992px) {
  .h-lg-186px {
    height: 186px;
  }
}
.h-187px {
  height: 187px;
}

@media (min-width: 992px) {
  .h-lg-187px {
    height: 187px;
  }
}
.h-188px {
  height: 188px;
}

@media (min-width: 992px) {
  .h-lg-188px {
    height: 188px;
  }
}
.h-189px {
  height: 189px;
}

@media (min-width: 992px) {
  .h-lg-189px {
    height: 189px;
  }
}
.h-190px {
  height: 190px;
}

@media (min-width: 992px) {
  .h-lg-190px {
    height: 190px;
  }
}
.h-191px {
  height: 191px;
}

@media (min-width: 992px) {
  .h-lg-191px {
    height: 191px;
  }
}
.h-192px {
  height: 192px;
}

@media (min-width: 992px) {
  .h-lg-192px {
    height: 192px;
  }
}
.h-193px {
  height: 193px;
}

@media (min-width: 992px) {
  .h-lg-193px {
    height: 193px;
  }
}
.h-194px {
  height: 194px;
}

@media (min-width: 992px) {
  .h-lg-194px {
    height: 194px;
  }
}
.h-195px {
  height: 195px;
}

@media (min-width: 992px) {
  .h-lg-195px {
    height: 195px;
  }
}
.h-196px {
  height: 196px;
}

@media (min-width: 992px) {
  .h-lg-196px {
    height: 196px;
  }
}
.h-197px {
  height: 197px;
}

@media (min-width: 992px) {
  .h-lg-197px {
    height: 197px;
  }
}
.h-198px {
  height: 198px;
}

@media (min-width: 992px) {
  .h-lg-198px {
    height: 198px;
  }
}
.h-199px {
  height: 199px;
}

@media (min-width: 992px) {
  .h-lg-199px {
    height: 199px;
  }
}
.h-200px {
  height: 200px;
}

@media (min-width: 992px) {
  .h-lg-200px {
    height: 200px;
  }
}
.h-201px {
  height: 201px;
}

@media (min-width: 992px) {
  .h-lg-201px {
    height: 201px;
  }
}
.h-202px {
  height: 202px;
}

@media (min-width: 992px) {
  .h-lg-202px {
    height: 202px;
  }
}
.h-203px {
  height: 203px;
}

@media (min-width: 992px) {
  .h-lg-203px {
    height: 203px;
  }
}
.h-204px {
  height: 204px;
}

@media (min-width: 992px) {
  .h-lg-204px {
    height: 204px;
  }
}
.h-205px {
  height: 205px;
}

@media (min-width: 992px) {
  .h-lg-205px {
    height: 205px;
  }
}
.h-206px {
  height: 206px;
}

@media (min-width: 992px) {
  .h-lg-206px {
    height: 206px;
  }
}
.h-207px {
  height: 207px;
}

@media (min-width: 992px) {
  .h-lg-207px {
    height: 207px;
  }
}
.h-208px {
  height: 208px;
}

@media (min-width: 992px) {
  .h-lg-208px {
    height: 208px;
  }
}
.h-209px {
  height: 209px;
}

@media (min-width: 992px) {
  .h-lg-209px {
    height: 209px;
  }
}
.h-210px {
  height: 210px;
}

@media (min-width: 992px) {
  .h-lg-210px {
    height: 210px;
  }
}
.h-211px {
  height: 211px;
}

@media (min-width: 992px) {
  .h-lg-211px {
    height: 211px;
  }
}
.h-212px {
  height: 212px;
}

@media (min-width: 992px) {
  .h-lg-212px {
    height: 212px;
  }
}
.h-213px {
  height: 213px;
}

@media (min-width: 992px) {
  .h-lg-213px {
    height: 213px;
  }
}
.h-214px {
  height: 214px;
}

@media (min-width: 992px) {
  .h-lg-214px {
    height: 214px;
  }
}
.h-215px {
  height: 215px;
}

@media (min-width: 992px) {
  .h-lg-215px {
    height: 215px;
  }
}
.h-216px {
  height: 216px;
}

@media (min-width: 992px) {
  .h-lg-216px {
    height: 216px;
  }
}
.h-217px {
  height: 217px;
}

@media (min-width: 992px) {
  .h-lg-217px {
    height: 217px;
  }
}
.h-218px {
  height: 218px;
}

@media (min-width: 992px) {
  .h-lg-218px {
    height: 218px;
  }
}
.h-219px {
  height: 219px;
}

@media (min-width: 992px) {
  .h-lg-219px {
    height: 219px;
  }
}
.h-220px {
  height: 220px;
}

@media (min-width: 992px) {
  .h-lg-220px {
    height: 220px;
  }
}
.h-221px {
  height: 221px;
}

@media (min-width: 992px) {
  .h-lg-221px {
    height: 221px;
  }
}
.h-222px {
  height: 222px;
}

@media (min-width: 992px) {
  .h-lg-222px {
    height: 222px;
  }
}
.h-223px {
  height: 223px;
}

@media (min-width: 992px) {
  .h-lg-223px {
    height: 223px;
  }
}
.h-224px {
  height: 224px;
}

@media (min-width: 992px) {
  .h-lg-224px {
    height: 224px;
  }
}
.h-225px {
  height: 225px;
}

@media (min-width: 992px) {
  .h-lg-225px {
    height: 225px;
  }
}
.h-226px {
  height: 226px;
}

@media (min-width: 992px) {
  .h-lg-226px {
    height: 226px;
  }
}
.h-227px {
  height: 227px;
}

@media (min-width: 992px) {
  .h-lg-227px {
    height: 227px;
  }
}
.h-228px {
  height: 228px;
}

@media (min-width: 992px) {
  .h-lg-228px {
    height: 228px;
  }
}
.h-229px {
  height: 229px;
}

@media (min-width: 992px) {
  .h-lg-229px {
    height: 229px;
  }
}
.h-230px {
  height: 230px;
}

@media (min-width: 992px) {
  .h-lg-230px {
    height: 230px;
  }
}
.h-231px {
  height: 231px;
}

@media (min-width: 992px) {
  .h-lg-231px {
    height: 231px;
  }
}
.h-232px {
  height: 232px;
}

@media (min-width: 992px) {
  .h-lg-232px {
    height: 232px;
  }
}
.h-233px {
  height: 233px;
}

@media (min-width: 992px) {
  .h-lg-233px {
    height: 233px;
  }
}
.h-234px {
  height: 234px;
}

@media (min-width: 992px) {
  .h-lg-234px {
    height: 234px;
  }
}
.h-235px {
  height: 235px;
}

@media (min-width: 992px) {
  .h-lg-235px {
    height: 235px;
  }
}
.h-236px {
  height: 236px;
}

@media (min-width: 992px) {
  .h-lg-236px {
    height: 236px;
  }
}
.h-237px {
  height: 237px;
}

@media (min-width: 992px) {
  .h-lg-237px {
    height: 237px;
  }
}
.h-238px {
  height: 238px;
}

@media (min-width: 992px) {
  .h-lg-238px {
    height: 238px;
  }
}
.h-239px {
  height: 239px;
}

@media (min-width: 992px) {
  .h-lg-239px {
    height: 239px;
  }
}
.h-240px {
  height: 240px;
}

@media (min-width: 992px) {
  .h-lg-240px {
    height: 240px;
  }
}
.h-241px {
  height: 241px;
}

@media (min-width: 992px) {
  .h-lg-241px {
    height: 241px;
  }
}
.h-242px {
  height: 242px;
}

@media (min-width: 992px) {
  .h-lg-242px {
    height: 242px;
  }
}
.h-243px {
  height: 243px;
}

@media (min-width: 992px) {
  .h-lg-243px {
    height: 243px;
  }
}
.h-244px {
  height: 244px;
}

@media (min-width: 992px) {
  .h-lg-244px {
    height: 244px;
  }
}
.h-245px {
  height: 245px;
}

@media (min-width: 992px) {
  .h-lg-245px {
    height: 245px;
  }
}
.h-246px {
  height: 246px;
}

@media (min-width: 992px) {
  .h-lg-246px {
    height: 246px;
  }
}
.h-247px {
  height: 247px;
}

@media (min-width: 992px) {
  .h-lg-247px {
    height: 247px;
  }
}
.h-248px {
  height: 248px;
}

@media (min-width: 992px) {
  .h-lg-248px {
    height: 248px;
  }
}
.h-249px {
  height: 249px;
}

@media (min-width: 992px) {
  .h-lg-249px {
    height: 249px;
  }
}
.h-250px {
  height: 250px;
}

@media (min-width: 992px) {
  .h-lg-250px {
    height: 250px;
  }
}
.h-251px {
  height: 251px;
}

@media (min-width: 992px) {
  .h-lg-251px {
    height: 251px;
  }
}
.h-252px {
  height: 252px;
}

@media (min-width: 992px) {
  .h-lg-252px {
    height: 252px;
  }
}
.h-253px {
  height: 253px;
}

@media (min-width: 992px) {
  .h-lg-253px {
    height: 253px;
  }
}
.h-254px {
  height: 254px;
}

@media (min-width: 992px) {
  .h-lg-254px {
    height: 254px;
  }
}
.h-255px {
  height: 255px;
}

@media (min-width: 992px) {
  .h-lg-255px {
    height: 255px;
  }
}
.h-256px {
  height: 256px;
}

@media (min-width: 992px) {
  .h-lg-256px {
    height: 256px;
  }
}
.h-257px {
  height: 257px;
}

@media (min-width: 992px) {
  .h-lg-257px {
    height: 257px;
  }
}
.h-258px {
  height: 258px;
}

@media (min-width: 992px) {
  .h-lg-258px {
    height: 258px;
  }
}
.h-259px {
  height: 259px;
}

@media (min-width: 992px) {
  .h-lg-259px {
    height: 259px;
  }
}
.h-260px {
  height: 260px;
}

@media (min-width: 992px) {
  .h-lg-260px {
    height: 260px;
  }
}
.h-261px {
  height: 261px;
}

@media (min-width: 992px) {
  .h-lg-261px {
    height: 261px;
  }
}
.h-262px {
  height: 262px;
}

@media (min-width: 992px) {
  .h-lg-262px {
    height: 262px;
  }
}
.h-263px {
  height: 263px;
}

@media (min-width: 992px) {
  .h-lg-263px {
    height: 263px;
  }
}
.h-264px {
  height: 264px;
}

@media (min-width: 992px) {
  .h-lg-264px {
    height: 264px;
  }
}
.h-265px {
  height: 265px;
}

@media (min-width: 992px) {
  .h-lg-265px {
    height: 265px;
  }
}
.h-266px {
  height: 266px;
}

@media (min-width: 992px) {
  .h-lg-266px {
    height: 266px;
  }
}
.h-267px {
  height: 267px;
}

@media (min-width: 992px) {
  .h-lg-267px {
    height: 267px;
  }
}
.h-268px {
  height: 268px;
}

@media (min-width: 992px) {
  .h-lg-268px {
    height: 268px;
  }
}
.h-269px {
  height: 269px;
}

@media (min-width: 992px) {
  .h-lg-269px {
    height: 269px;
  }
}
.h-270px {
  height: 270px;
}

@media (min-width: 992px) {
  .h-lg-270px {
    height: 270px;
  }
}
.h-271px {
  height: 271px;
}

@media (min-width: 992px) {
  .h-lg-271px {
    height: 271px;
  }
}
.h-272px {
  height: 272px;
}

@media (min-width: 992px) {
  .h-lg-272px {
    height: 272px;
  }
}
.h-273px {
  height: 273px;
}

@media (min-width: 992px) {
  .h-lg-273px {
    height: 273px;
  }
}
.h-274px {
  height: 274px;
}

@media (min-width: 992px) {
  .h-lg-274px {
    height: 274px;
  }
}
.h-275px {
  height: 275px;
}

@media (min-width: 992px) {
  .h-lg-275px {
    height: 275px;
  }
}
.h-276px {
  height: 276px;
}

@media (min-width: 992px) {
  .h-lg-276px {
    height: 276px;
  }
}
.h-277px {
  height: 277px;
}

@media (min-width: 992px) {
  .h-lg-277px {
    height: 277px;
  }
}
.h-278px {
  height: 278px;
}

@media (min-width: 992px) {
  .h-lg-278px {
    height: 278px;
  }
}
.h-279px {
  height: 279px;
}

@media (min-width: 992px) {
  .h-lg-279px {
    height: 279px;
  }
}
.h-280px {
  height: 280px;
}

@media (min-width: 992px) {
  .h-lg-280px {
    height: 280px;
  }
}
.h-281px {
  height: 281px;
}

@media (min-width: 992px) {
  .h-lg-281px {
    height: 281px;
  }
}
.h-282px {
  height: 282px;
}

@media (min-width: 992px) {
  .h-lg-282px {
    height: 282px;
  }
}
.h-283px {
  height: 283px;
}

@media (min-width: 992px) {
  .h-lg-283px {
    height: 283px;
  }
}
.h-284px {
  height: 284px;
}

@media (min-width: 992px) {
  .h-lg-284px {
    height: 284px;
  }
}
.h-285px {
  height: 285px;
}

@media (min-width: 992px) {
  .h-lg-285px {
    height: 285px;
  }
}
.h-286px {
  height: 286px;
}

@media (min-width: 992px) {
  .h-lg-286px {
    height: 286px;
  }
}
.h-287px {
  height: 287px;
}

@media (min-width: 992px) {
  .h-lg-287px {
    height: 287px;
  }
}
.h-288px {
  height: 288px;
}

@media (min-width: 992px) {
  .h-lg-288px {
    height: 288px;
  }
}
.h-289px {
  height: 289px;
}

@media (min-width: 992px) {
  .h-lg-289px {
    height: 289px;
  }
}
.h-290px {
  height: 290px;
}

@media (min-width: 992px) {
  .h-lg-290px {
    height: 290px;
  }
}
.h-291px {
  height: 291px;
}

@media (min-width: 992px) {
  .h-lg-291px {
    height: 291px;
  }
}
.h-292px {
  height: 292px;
}

@media (min-width: 992px) {
  .h-lg-292px {
    height: 292px;
  }
}
.h-293px {
  height: 293px;
}

@media (min-width: 992px) {
  .h-lg-293px {
    height: 293px;
  }
}
.h-294px {
  height: 294px;
}

@media (min-width: 992px) {
  .h-lg-294px {
    height: 294px;
  }
}
.h-295px {
  height: 295px;
}

@media (min-width: 992px) {
  .h-lg-295px {
    height: 295px;
  }
}
.h-296px {
  height: 296px;
}

@media (min-width: 992px) {
  .h-lg-296px {
    height: 296px;
  }
}
.h-297px {
  height: 297px;
}

@media (min-width: 992px) {
  .h-lg-297px {
    height: 297px;
  }
}
.h-298px {
  height: 298px;
}

@media (min-width: 992px) {
  .h-lg-298px {
    height: 298px;
  }
}
.h-299px {
  height: 299px;
}

@media (min-width: 992px) {
  .h-lg-299px {
    height: 299px;
  }
}
.h-300px {
  height: 300px;
}

@media (min-width: 992px) {
  .h-lg-300px {
    height: 300px;
  }
}
.h-301px {
  height: 301px;
}

@media (min-width: 992px) {
  .h-lg-301px {
    height: 301px;
  }
}
.h-302px {
  height: 302px;
}

@media (min-width: 992px) {
  .h-lg-302px {
    height: 302px;
  }
}
.h-303px {
  height: 303px;
}

@media (min-width: 992px) {
  .h-lg-303px {
    height: 303px;
  }
}
.h-304px {
  height: 304px;
}

@media (min-width: 992px) {
  .h-lg-304px {
    height: 304px;
  }
}
.h-305px {
  height: 305px;
}

@media (min-width: 992px) {
  .h-lg-305px {
    height: 305px;
  }
}
.h-306px {
  height: 306px;
}

@media (min-width: 992px) {
  .h-lg-306px {
    height: 306px;
  }
}
.h-307px {
  height: 307px;
}

@media (min-width: 992px) {
  .h-lg-307px {
    height: 307px;
  }
}
.h-308px {
  height: 308px;
}

@media (min-width: 992px) {
  .h-lg-308px {
    height: 308px;
  }
}
.h-309px {
  height: 309px;
}

@media (min-width: 992px) {
  .h-lg-309px {
    height: 309px;
  }
}
.h-310px {
  height: 310px;
}

@media (min-width: 992px) {
  .h-lg-310px {
    height: 310px;
  }
}
.h-311px {
  height: 311px;
}

@media (min-width: 992px) {
  .h-lg-311px {
    height: 311px;
  }
}
.h-312px {
  height: 312px;
}

@media (min-width: 992px) {
  .h-lg-312px {
    height: 312px;
  }
}
.h-313px {
  height: 313px;
}

@media (min-width: 992px) {
  .h-lg-313px {
    height: 313px;
  }
}
.h-314px {
  height: 314px;
}

@media (min-width: 992px) {
  .h-lg-314px {
    height: 314px;
  }
}
.h-315px {
  height: 315px;
}

@media (min-width: 992px) {
  .h-lg-315px {
    height: 315px;
  }
}
.h-316px {
  height: 316px;
}

@media (min-width: 992px) {
  .h-lg-316px {
    height: 316px;
  }
}
.h-317px {
  height: 317px;
}

@media (min-width: 992px) {
  .h-lg-317px {
    height: 317px;
  }
}
.h-318px {
  height: 318px;
}

@media (min-width: 992px) {
  .h-lg-318px {
    height: 318px;
  }
}
.h-319px {
  height: 319px;
}

@media (min-width: 992px) {
  .h-lg-319px {
    height: 319px;
  }
}
.h-320px {
  height: 320px;
}

@media (min-width: 992px) {
  .h-lg-320px {
    height: 320px;
  }
}
.h-321px {
  height: 321px;
}

@media (min-width: 992px) {
  .h-lg-321px {
    height: 321px;
  }
}
.h-322px {
  height: 322px;
}

@media (min-width: 992px) {
  .h-lg-322px {
    height: 322px;
  }
}
.h-323px {
  height: 323px;
}

@media (min-width: 992px) {
  .h-lg-323px {
    height: 323px;
  }
}
.h-324px {
  height: 324px;
}

@media (min-width: 992px) {
  .h-lg-324px {
    height: 324px;
  }
}
.h-325px {
  height: 325px;
}

@media (min-width: 992px) {
  .h-lg-325px {
    height: 325px;
  }
}
.h-326px {
  height: 326px;
}

@media (min-width: 992px) {
  .h-lg-326px {
    height: 326px;
  }
}
.h-327px {
  height: 327px;
}

@media (min-width: 992px) {
  .h-lg-327px {
    height: 327px;
  }
}
.h-328px {
  height: 328px;
}

@media (min-width: 992px) {
  .h-lg-328px {
    height: 328px;
  }
}
.h-329px {
  height: 329px;
}

@media (min-width: 992px) {
  .h-lg-329px {
    height: 329px;
  }
}
.h-330px {
  height: 330px;
}

@media (min-width: 992px) {
  .h-lg-330px {
    height: 330px;
  }
}
.h-331px {
  height: 331px;
}

@media (min-width: 992px) {
  .h-lg-331px {
    height: 331px;
  }
}
.h-332px {
  height: 332px;
}

@media (min-width: 992px) {
  .h-lg-332px {
    height: 332px;
  }
}
.h-333px {
  height: 333px;
}

@media (min-width: 992px) {
  .h-lg-333px {
    height: 333px;
  }
}
.h-334px {
  height: 334px;
}

@media (min-width: 992px) {
  .h-lg-334px {
    height: 334px;
  }
}
.h-335px {
  height: 335px;
}

@media (min-width: 992px) {
  .h-lg-335px {
    height: 335px;
  }
}
.h-336px {
  height: 336px;
}

@media (min-width: 992px) {
  .h-lg-336px {
    height: 336px;
  }
}
.h-337px {
  height: 337px;
}

@media (min-width: 992px) {
  .h-lg-337px {
    height: 337px;
  }
}
.h-338px {
  height: 338px;
}

@media (min-width: 992px) {
  .h-lg-338px {
    height: 338px;
  }
}
.h-339px {
  height: 339px;
}

@media (min-width: 992px) {
  .h-lg-339px {
    height: 339px;
  }
}
.h-340px {
  height: 340px;
}

@media (min-width: 992px) {
  .h-lg-340px {
    height: 340px;
  }
}
.h-341px {
  height: 341px;
}

@media (min-width: 992px) {
  .h-lg-341px {
    height: 341px;
  }
}
.h-342px {
  height: 342px;
}

@media (min-width: 992px) {
  .h-lg-342px {
    height: 342px;
  }
}
.h-343px {
  height: 343px;
}

@media (min-width: 992px) {
  .h-lg-343px {
    height: 343px;
  }
}
.h-344px {
  height: 344px;
}

@media (min-width: 992px) {
  .h-lg-344px {
    height: 344px;
  }
}
.h-345px {
  height: 345px;
}

@media (min-width: 992px) {
  .h-lg-345px {
    height: 345px;
  }
}
.h-346px {
  height: 346px;
}

@media (min-width: 992px) {
  .h-lg-346px {
    height: 346px;
  }
}
.h-347px {
  height: 347px;
}

@media (min-width: 992px) {
  .h-lg-347px {
    height: 347px;
  }
}
.h-348px {
  height: 348px;
}

@media (min-width: 992px) {
  .h-lg-348px {
    height: 348px;
  }
}
.h-349px {
  height: 349px;
}

@media (min-width: 992px) {
  .h-lg-349px {
    height: 349px;
  }
}
.h-350px {
  height: 350px;
}

@media (min-width: 992px) {
  .h-lg-350px {
    height: 350px;
  }
}
.h-351px {
  height: 351px;
}

@media (min-width: 992px) {
  .h-lg-351px {
    height: 351px;
  }
}
.h-352px {
  height: 352px;
}

@media (min-width: 992px) {
  .h-lg-352px {
    height: 352px;
  }
}
.h-353px {
  height: 353px;
}

@media (min-width: 992px) {
  .h-lg-353px {
    height: 353px;
  }
}
.h-354px {
  height: 354px;
}

@media (min-width: 992px) {
  .h-lg-354px {
    height: 354px;
  }
}
.h-355px {
  height: 355px;
}

@media (min-width: 992px) {
  .h-lg-355px {
    height: 355px;
  }
}
.h-356px {
  height: 356px;
}

@media (min-width: 992px) {
  .h-lg-356px {
    height: 356px;
  }
}
.h-357px {
  height: 357px;
}

@media (min-width: 992px) {
  .h-lg-357px {
    height: 357px;
  }
}
.h-358px {
  height: 358px;
}

@media (min-width: 992px) {
  .h-lg-358px {
    height: 358px;
  }
}
.h-359px {
  height: 359px;
}

@media (min-width: 992px) {
  .h-lg-359px {
    height: 359px;
  }
}
.h-360px {
  height: 360px;
}

@media (min-width: 992px) {
  .h-lg-360px {
    height: 360px;
  }
}
.h-361px {
  height: 361px;
}

@media (min-width: 992px) {
  .h-lg-361px {
    height: 361px;
  }
}
.h-362px {
  height: 362px;
}

@media (min-width: 992px) {
  .h-lg-362px {
    height: 362px;
  }
}
.h-363px {
  height: 363px;
}

@media (min-width: 992px) {
  .h-lg-363px {
    height: 363px;
  }
}
.h-364px {
  height: 364px;
}

@media (min-width: 992px) {
  .h-lg-364px {
    height: 364px;
  }
}
.h-365px {
  height: 365px;
}

@media (min-width: 992px) {
  .h-lg-365px {
    height: 365px;
  }
}
.h-366px {
  height: 366px;
}

@media (min-width: 992px) {
  .h-lg-366px {
    height: 366px;
  }
}
.h-367px {
  height: 367px;
}

@media (min-width: 992px) {
  .h-lg-367px {
    height: 367px;
  }
}
.h-368px {
  height: 368px;
}

@media (min-width: 992px) {
  .h-lg-368px {
    height: 368px;
  }
}
.h-369px {
  height: 369px;
}

@media (min-width: 992px) {
  .h-lg-369px {
    height: 369px;
  }
}
.h-370px {
  height: 370px;
}

@media (min-width: 992px) {
  .h-lg-370px {
    height: 370px;
  }
}
.h-371px {
  height: 371px;
}

@media (min-width: 992px) {
  .h-lg-371px {
    height: 371px;
  }
}
.h-372px {
  height: 372px;
}

@media (min-width: 992px) {
  .h-lg-372px {
    height: 372px;
  }
}
.h-373px {
  height: 373px;
}

@media (min-width: 992px) {
  .h-lg-373px {
    height: 373px;
  }
}
.h-374px {
  height: 374px;
}

@media (min-width: 992px) {
  .h-lg-374px {
    height: 374px;
  }
}
.h-375px {
  height: 375px;
}

@media (min-width: 992px) {
  .h-lg-375px {
    height: 375px;
  }
}
.h-376px {
  height: 376px;
}

@media (min-width: 992px) {
  .h-lg-376px {
    height: 376px;
  }
}
.h-377px {
  height: 377px;
}

@media (min-width: 992px) {
  .h-lg-377px {
    height: 377px;
  }
}
.h-378px {
  height: 378px;
}

@media (min-width: 992px) {
  .h-lg-378px {
    height: 378px;
  }
}
.h-379px {
  height: 379px;
}

@media (min-width: 992px) {
  .h-lg-379px {
    height: 379px;
  }
}
.h-380px {
  height: 380px;
}

@media (min-width: 992px) {
  .h-lg-380px {
    height: 380px;
  }
}
.h-381px {
  height: 381px;
}

@media (min-width: 992px) {
  .h-lg-381px {
    height: 381px;
  }
}
.h-382px {
  height: 382px;
}

@media (min-width: 992px) {
  .h-lg-382px {
    height: 382px;
  }
}
.h-383px {
  height: 383px;
}

@media (min-width: 992px) {
  .h-lg-383px {
    height: 383px;
  }
}
.h-384px {
  height: 384px;
}

@media (min-width: 992px) {
  .h-lg-384px {
    height: 384px;
  }
}
.h-385px {
  height: 385px;
}

@media (min-width: 992px) {
  .h-lg-385px {
    height: 385px;
  }
}
.h-386px {
  height: 386px;
}

@media (min-width: 992px) {
  .h-lg-386px {
    height: 386px;
  }
}
.h-387px {
  height: 387px;
}

@media (min-width: 992px) {
  .h-lg-387px {
    height: 387px;
  }
}
.h-388px {
  height: 388px;
}

@media (min-width: 992px) {
  .h-lg-388px {
    height: 388px;
  }
}
.h-389px {
  height: 389px;
}

@media (min-width: 992px) {
  .h-lg-389px {
    height: 389px;
  }
}
.h-390px {
  height: 390px;
}

@media (min-width: 992px) {
  .h-lg-390px {
    height: 390px;
  }
}
.h-391px {
  height: 391px;
}

@media (min-width: 992px) {
  .h-lg-391px {
    height: 391px;
  }
}
.h-392px {
  height: 392px;
}

@media (min-width: 992px) {
  .h-lg-392px {
    height: 392px;
  }
}
.h-393px {
  height: 393px;
}

@media (min-width: 992px) {
  .h-lg-393px {
    height: 393px;
  }
}
.h-394px {
  height: 394px;
}

@media (min-width: 992px) {
  .h-lg-394px {
    height: 394px;
  }
}
.h-395px {
  height: 395px;
}

@media (min-width: 992px) {
  .h-lg-395px {
    height: 395px;
  }
}
.h-396px {
  height: 396px;
}

@media (min-width: 992px) {
  .h-lg-396px {
    height: 396px;
  }
}
.h-397px {
  height: 397px;
}

@media (min-width: 992px) {
  .h-lg-397px {
    height: 397px;
  }
}
.h-398px {
  height: 398px;
}

@media (min-width: 992px) {
  .h-lg-398px {
    height: 398px;
  }
}
.h-399px {
  height: 399px;
}

@media (min-width: 992px) {
  .h-lg-399px {
    height: 399px;
  }
}
.h-400px {
  height: 400px;
}

@media (min-width: 992px) {
  .h-lg-400px {
    height: 400px;
  }
}
.h-401px {
  height: 401px;
}

@media (min-width: 992px) {
  .h-lg-401px {
    height: 401px;
  }
}
.h-402px {
  height: 402px;
}

@media (min-width: 992px) {
  .h-lg-402px {
    height: 402px;
  }
}
.h-403px {
  height: 403px;
}

@media (min-width: 992px) {
  .h-lg-403px {
    height: 403px;
  }
}
.h-404px {
  height: 404px;
}

@media (min-width: 992px) {
  .h-lg-404px {
    height: 404px;
  }
}
.h-405px {
  height: 405px;
}

@media (min-width: 992px) {
  .h-lg-405px {
    height: 405px;
  }
}
.h-406px {
  height: 406px;
}

@media (min-width: 992px) {
  .h-lg-406px {
    height: 406px;
  }
}
.h-407px {
  height: 407px;
}

@media (min-width: 992px) {
  .h-lg-407px {
    height: 407px;
  }
}
.h-408px {
  height: 408px;
}

@media (min-width: 992px) {
  .h-lg-408px {
    height: 408px;
  }
}
.h-409px {
  height: 409px;
}

@media (min-width: 992px) {
  .h-lg-409px {
    height: 409px;
  }
}
.h-410px {
  height: 410px;
}

@media (min-width: 992px) {
  .h-lg-410px {
    height: 410px;
  }
}
.h-411px {
  height: 411px;
}

@media (min-width: 992px) {
  .h-lg-411px {
    height: 411px;
  }
}
.h-412px {
  height: 412px;
}

@media (min-width: 992px) {
  .h-lg-412px {
    height: 412px;
  }
}
.h-413px {
  height: 413px;
}

@media (min-width: 992px) {
  .h-lg-413px {
    height: 413px;
  }
}
.h-414px {
  height: 414px;
}

@media (min-width: 992px) {
  .h-lg-414px {
    height: 414px;
  }
}
.h-415px {
  height: 415px;
}

@media (min-width: 992px) {
  .h-lg-415px {
    height: 415px;
  }
}
.h-416px {
  height: 416px;
}

@media (min-width: 992px) {
  .h-lg-416px {
    height: 416px;
  }
}
.h-417px {
  height: 417px;
}

@media (min-width: 992px) {
  .h-lg-417px {
    height: 417px;
  }
}
.h-418px {
  height: 418px;
}

@media (min-width: 992px) {
  .h-lg-418px {
    height: 418px;
  }
}
.h-419px {
  height: 419px;
}

@media (min-width: 992px) {
  .h-lg-419px {
    height: 419px;
  }
}
.h-420px {
  height: 420px;
}

@media (min-width: 992px) {
  .h-lg-420px {
    height: 420px;
  }
}
.h-421px {
  height: 421px;
}

@media (min-width: 992px) {
  .h-lg-421px {
    height: 421px;
  }
}
.h-422px {
  height: 422px;
}

@media (min-width: 992px) {
  .h-lg-422px {
    height: 422px;
  }
}
.h-423px {
  height: 423px;
}

@media (min-width: 992px) {
  .h-lg-423px {
    height: 423px;
  }
}
.h-424px {
  height: 424px;
}

@media (min-width: 992px) {
  .h-lg-424px {
    height: 424px;
  }
}
.h-425px {
  height: 425px;
}

@media (min-width: 992px) {
  .h-lg-425px {
    height: 425px;
  }
}
.h-426px {
  height: 426px;
}

@media (min-width: 992px) {
  .h-lg-426px {
    height: 426px;
  }
}
.h-427px {
  height: 427px;
}

@media (min-width: 992px) {
  .h-lg-427px {
    height: 427px;
  }
}
.h-428px {
  height: 428px;
}

@media (min-width: 992px) {
  .h-lg-428px {
    height: 428px;
  }
}
.h-429px {
  height: 429px;
}

@media (min-width: 992px) {
  .h-lg-429px {
    height: 429px;
  }
}
.h-430px {
  height: 430px;
}

@media (min-width: 992px) {
  .h-lg-430px {
    height: 430px;
  }
}
.h-431px {
  height: 431px;
}

@media (min-width: 992px) {
  .h-lg-431px {
    height: 431px;
  }
}
.h-432px {
  height: 432px;
}

@media (min-width: 992px) {
  .h-lg-432px {
    height: 432px;
  }
}
.h-433px {
  height: 433px;
}

@media (min-width: 992px) {
  .h-lg-433px {
    height: 433px;
  }
}
.h-434px {
  height: 434px;
}

@media (min-width: 992px) {
  .h-lg-434px {
    height: 434px;
  }
}
.h-435px {
  height: 435px;
}

@media (min-width: 992px) {
  .h-lg-435px {
    height: 435px;
  }
}
.h-436px {
  height: 436px;
}

@media (min-width: 992px) {
  .h-lg-436px {
    height: 436px;
  }
}
.h-437px {
  height: 437px;
}

@media (min-width: 992px) {
  .h-lg-437px {
    height: 437px;
  }
}
.h-438px {
  height: 438px;
}

@media (min-width: 992px) {
  .h-lg-438px {
    height: 438px;
  }
}
.h-439px {
  height: 439px;
}

@media (min-width: 992px) {
  .h-lg-439px {
    height: 439px;
  }
}
.h-440px {
  height: 440px;
}

@media (min-width: 992px) {
  .h-lg-440px {
    height: 440px;
  }
}
.h-441px {
  height: 441px;
}

@media (min-width: 992px) {
  .h-lg-441px {
    height: 441px;
  }
}
.h-442px {
  height: 442px;
}

@media (min-width: 992px) {
  .h-lg-442px {
    height: 442px;
  }
}
.h-443px {
  height: 443px;
}

@media (min-width: 992px) {
  .h-lg-443px {
    height: 443px;
  }
}
.h-444px {
  height: 444px;
}

@media (min-width: 992px) {
  .h-lg-444px {
    height: 444px;
  }
}
.h-445px {
  height: 445px;
}

@media (min-width: 992px) {
  .h-lg-445px {
    height: 445px;
  }
}
.h-446px {
  height: 446px;
}

@media (min-width: 992px) {
  .h-lg-446px {
    height: 446px;
  }
}
.h-447px {
  height: 447px;
}

@media (min-width: 992px) {
  .h-lg-447px {
    height: 447px;
  }
}
.h-448px {
  height: 448px;
}

@media (min-width: 992px) {
  .h-lg-448px {
    height: 448px;
  }
}
.h-449px {
  height: 449px;
}

@media (min-width: 992px) {
  .h-lg-449px {
    height: 449px;
  }
}
.h-450px {
  height: 450px;
}

@media (min-width: 992px) {
  .h-lg-450px {
    height: 450px;
  }
}
.h-451px {
  height: 451px;
}

@media (min-width: 992px) {
  .h-lg-451px {
    height: 451px;
  }
}
.h-452px {
  height: 452px;
}

@media (min-width: 992px) {
  .h-lg-452px {
    height: 452px;
  }
}
.h-453px {
  height: 453px;
}

@media (min-width: 992px) {
  .h-lg-453px {
    height: 453px;
  }
}
.h-454px {
  height: 454px;
}

@media (min-width: 992px) {
  .h-lg-454px {
    height: 454px;
  }
}
.h-455px {
  height: 455px;
}

@media (min-width: 992px) {
  .h-lg-455px {
    height: 455px;
  }
}
.h-456px {
  height: 456px;
}

@media (min-width: 992px) {
  .h-lg-456px {
    height: 456px;
  }
}
.h-457px {
  height: 457px;
}

@media (min-width: 992px) {
  .h-lg-457px {
    height: 457px;
  }
}
.h-458px {
  height: 458px;
}

@media (min-width: 992px) {
  .h-lg-458px {
    height: 458px;
  }
}
.h-459px {
  height: 459px;
}

@media (min-width: 992px) {
  .h-lg-459px {
    height: 459px;
  }
}
.h-460px {
  height: 460px;
}

@media (min-width: 992px) {
  .h-lg-460px {
    height: 460px;
  }
}
.h-461px {
  height: 461px;
}

@media (min-width: 992px) {
  .h-lg-461px {
    height: 461px;
  }
}
.h-462px {
  height: 462px;
}

@media (min-width: 992px) {
  .h-lg-462px {
    height: 462px;
  }
}
.h-463px {
  height: 463px;
}

@media (min-width: 992px) {
  .h-lg-463px {
    height: 463px;
  }
}
.h-464px {
  height: 464px;
}

@media (min-width: 992px) {
  .h-lg-464px {
    height: 464px;
  }
}
.h-465px {
  height: 465px;
}

@media (min-width: 992px) {
  .h-lg-465px {
    height: 465px;
  }
}
.h-466px {
  height: 466px;
}

@media (min-width: 992px) {
  .h-lg-466px {
    height: 466px;
  }
}
.h-467px {
  height: 467px;
}

@media (min-width: 992px) {
  .h-lg-467px {
    height: 467px;
  }
}
.h-468px {
  height: 468px;
}

@media (min-width: 992px) {
  .h-lg-468px {
    height: 468px;
  }
}
.h-469px {
  height: 469px;
}

@media (min-width: 992px) {
  .h-lg-469px {
    height: 469px;
  }
}
.h-470px {
  height: 470px;
}

@media (min-width: 992px) {
  .h-lg-470px {
    height: 470px;
  }
}
.h-471px {
  height: 471px;
}

@media (min-width: 992px) {
  .h-lg-471px {
    height: 471px;
  }
}
.h-472px {
  height: 472px;
}

@media (min-width: 992px) {
  .h-lg-472px {
    height: 472px;
  }
}
.h-473px {
  height: 473px;
}

@media (min-width: 992px) {
  .h-lg-473px {
    height: 473px;
  }
}
.h-474px {
  height: 474px;
}

@media (min-width: 992px) {
  .h-lg-474px {
    height: 474px;
  }
}
.h-475px {
  height: 475px;
}

@media (min-width: 992px) {
  .h-lg-475px {
    height: 475px;
  }
}
.h-476px {
  height: 476px;
}

@media (min-width: 992px) {
  .h-lg-476px {
    height: 476px;
  }
}
.h-477px {
  height: 477px;
}

@media (min-width: 992px) {
  .h-lg-477px {
    height: 477px;
  }
}
.h-478px {
  height: 478px;
}

@media (min-width: 992px) {
  .h-lg-478px {
    height: 478px;
  }
}
.h-479px {
  height: 479px;
}

@media (min-width: 992px) {
  .h-lg-479px {
    height: 479px;
  }
}
.h-480px {
  height: 480px;
}

@media (min-width: 992px) {
  .h-lg-480px {
    height: 480px;
  }
}
.h-481px {
  height: 481px;
}

@media (min-width: 992px) {
  .h-lg-481px {
    height: 481px;
  }
}
.h-482px {
  height: 482px;
}

@media (min-width: 992px) {
  .h-lg-482px {
    height: 482px;
  }
}
.h-483px {
  height: 483px;
}

@media (min-width: 992px) {
  .h-lg-483px {
    height: 483px;
  }
}
.h-484px {
  height: 484px;
}

@media (min-width: 992px) {
  .h-lg-484px {
    height: 484px;
  }
}
.h-485px {
  height: 485px;
}

@media (min-width: 992px) {
  .h-lg-485px {
    height: 485px;
  }
}
.h-486px {
  height: 486px;
}

@media (min-width: 992px) {
  .h-lg-486px {
    height: 486px;
  }
}
.h-487px {
  height: 487px;
}

@media (min-width: 992px) {
  .h-lg-487px {
    height: 487px;
  }
}
.h-488px {
  height: 488px;
}

@media (min-width: 992px) {
  .h-lg-488px {
    height: 488px;
  }
}
.h-489px {
  height: 489px;
}

@media (min-width: 992px) {
  .h-lg-489px {
    height: 489px;
  }
}
.h-490px {
  height: 490px;
}

@media (min-width: 992px) {
  .h-lg-490px {
    height: 490px;
  }
}
.h-491px {
  height: 491px;
}

@media (min-width: 992px) {
  .h-lg-491px {
    height: 491px;
  }
}
.h-492px {
  height: 492px;
}

@media (min-width: 992px) {
  .h-lg-492px {
    height: 492px;
  }
}
.h-493px {
  height: 493px;
}

@media (min-width: 992px) {
  .h-lg-493px {
    height: 493px;
  }
}
.h-494px {
  height: 494px;
}

@media (min-width: 992px) {
  .h-lg-494px {
    height: 494px;
  }
}
.h-495px {
  height: 495px;
}

@media (min-width: 992px) {
  .h-lg-495px {
    height: 495px;
  }
}
.h-496px {
  height: 496px;
}

@media (min-width: 992px) {
  .h-lg-496px {
    height: 496px;
  }
}
.h-497px {
  height: 497px;
}

@media (min-width: 992px) {
  .h-lg-497px {
    height: 497px;
  }
}
.h-498px {
  height: 498px;
}

@media (min-width: 992px) {
  .h-lg-498px {
    height: 498px;
  }
}
.h-499px {
  height: 499px;
}

@media (min-width: 992px) {
  .h-lg-499px {
    height: 499px;
  }
}
.h-500px {
  height: 500px;
}

@media (min-width: 992px) {
  .h-lg-500px {
    height: 500px;
  }
}
.h-501px {
  height: 501px;
}

@media (min-width: 992px) {
  .h-lg-501px {
    height: 501px;
  }
}
.h-502px {
  height: 502px;
}

@media (min-width: 992px) {
  .h-lg-502px {
    height: 502px;
  }
}
.h-503px {
  height: 503px;
}

@media (min-width: 992px) {
  .h-lg-503px {
    height: 503px;
  }
}
.h-504px {
  height: 504px;
}

@media (min-width: 992px) {
  .h-lg-504px {
    height: 504px;
  }
}
.h-505px {
  height: 505px;
}

@media (min-width: 992px) {
  .h-lg-505px {
    height: 505px;
  }
}
.h-506px {
  height: 506px;
}

@media (min-width: 992px) {
  .h-lg-506px {
    height: 506px;
  }
}
.h-507px {
  height: 507px;
}

@media (min-width: 992px) {
  .h-lg-507px {
    height: 507px;
  }
}
.h-508px {
  height: 508px;
}

@media (min-width: 992px) {
  .h-lg-508px {
    height: 508px;
  }
}
.h-509px {
  height: 509px;
}

@media (min-width: 992px) {
  .h-lg-509px {
    height: 509px;
  }
}
.h-510px {
  height: 510px;
}

@media (min-width: 992px) {
  .h-lg-510px {
    height: 510px;
  }
}
.h-511px {
  height: 511px;
}

@media (min-width: 992px) {
  .h-lg-511px {
    height: 511px;
  }
}
.h-512px {
  height: 512px;
}

@media (min-width: 992px) {
  .h-lg-512px {
    height: 512px;
  }
}
.h-513px {
  height: 513px;
}

@media (min-width: 992px) {
  .h-lg-513px {
    height: 513px;
  }
}
.h-514px {
  height: 514px;
}

@media (min-width: 992px) {
  .h-lg-514px {
    height: 514px;
  }
}
.h-515px {
  height: 515px;
}

@media (min-width: 992px) {
  .h-lg-515px {
    height: 515px;
  }
}
.h-516px {
  height: 516px;
}

@media (min-width: 992px) {
  .h-lg-516px {
    height: 516px;
  }
}
.h-517px {
  height: 517px;
}

@media (min-width: 992px) {
  .h-lg-517px {
    height: 517px;
  }
}
.h-518px {
  height: 518px;
}

@media (min-width: 992px) {
  .h-lg-518px {
    height: 518px;
  }
}
.h-519px {
  height: 519px;
}

@media (min-width: 992px) {
  .h-lg-519px {
    height: 519px;
  }
}
.h-520px {
  height: 520px;
}

@media (min-width: 992px) {
  .h-lg-520px {
    height: 520px;
  }
}
.h-521px {
  height: 521px;
}

@media (min-width: 992px) {
  .h-lg-521px {
    height: 521px;
  }
}
.h-522px {
  height: 522px;
}

@media (min-width: 992px) {
  .h-lg-522px {
    height: 522px;
  }
}
.h-523px {
  height: 523px;
}

@media (min-width: 992px) {
  .h-lg-523px {
    height: 523px;
  }
}
.h-524px {
  height: 524px;
}

@media (min-width: 992px) {
  .h-lg-524px {
    height: 524px;
  }
}
.h-525px {
  height: 525px;
}

@media (min-width: 992px) {
  .h-lg-525px {
    height: 525px;
  }
}
.h-526px {
  height: 526px;
}

@media (min-width: 992px) {
  .h-lg-526px {
    height: 526px;
  }
}
.h-527px {
  height: 527px;
}

@media (min-width: 992px) {
  .h-lg-527px {
    height: 527px;
  }
}
.h-528px {
  height: 528px;
}

@media (min-width: 992px) {
  .h-lg-528px {
    height: 528px;
  }
}
.h-529px {
  height: 529px;
}

@media (min-width: 992px) {
  .h-lg-529px {
    height: 529px;
  }
}
.h-530px {
  height: 530px;
}

@media (min-width: 992px) {
  .h-lg-530px {
    height: 530px;
  }
}
.h-531px {
  height: 531px;
}

@media (min-width: 992px) {
  .h-lg-531px {
    height: 531px;
  }
}
.h-532px {
  height: 532px;
}

@media (min-width: 992px) {
  .h-lg-532px {
    height: 532px;
  }
}
.h-533px {
  height: 533px;
}

@media (min-width: 992px) {
  .h-lg-533px {
    height: 533px;
  }
}
.h-534px {
  height: 534px;
}

@media (min-width: 992px) {
  .h-lg-534px {
    height: 534px;
  }
}
.h-535px {
  height: 535px;
}

@media (min-width: 992px) {
  .h-lg-535px {
    height: 535px;
  }
}
.h-536px {
  height: 536px;
}

@media (min-width: 992px) {
  .h-lg-536px {
    height: 536px;
  }
}
.h-537px {
  height: 537px;
}

@media (min-width: 992px) {
  .h-lg-537px {
    height: 537px;
  }
}
.h-538px {
  height: 538px;
}

@media (min-width: 992px) {
  .h-lg-538px {
    height: 538px;
  }
}
.h-539px {
  height: 539px;
}

@media (min-width: 992px) {
  .h-lg-539px {
    height: 539px;
  }
}
.h-540px {
  height: 540px;
}

@media (min-width: 992px) {
  .h-lg-540px {
    height: 540px;
  }
}
.h-541px {
  height: 541px;
}

@media (min-width: 992px) {
  .h-lg-541px {
    height: 541px;
  }
}
.h-542px {
  height: 542px;
}

@media (min-width: 992px) {
  .h-lg-542px {
    height: 542px;
  }
}
.h-543px {
  height: 543px;
}

@media (min-width: 992px) {
  .h-lg-543px {
    height: 543px;
  }
}
.h-544px {
  height: 544px;
}

@media (min-width: 992px) {
  .h-lg-544px {
    height: 544px;
  }
}
.h-545px {
  height: 545px;
}

@media (min-width: 992px) {
  .h-lg-545px {
    height: 545px;
  }
}
.h-546px {
  height: 546px;
}

@media (min-width: 992px) {
  .h-lg-546px {
    height: 546px;
  }
}
.h-547px {
  height: 547px;
}

@media (min-width: 992px) {
  .h-lg-547px {
    height: 547px;
  }
}
.h-548px {
  height: 548px;
}

@media (min-width: 992px) {
  .h-lg-548px {
    height: 548px;
  }
}
.h-549px {
  height: 549px;
}

@media (min-width: 992px) {
  .h-lg-549px {
    height: 549px;
  }
}
.h-550px {
  height: 550px;
}

@media (min-width: 992px) {
  .h-lg-550px {
    height: 550px;
  }
}
.h-551px {
  height: 551px;
}

@media (min-width: 992px) {
  .h-lg-551px {
    height: 551px;
  }
}
.h-552px {
  height: 552px;
}

@media (min-width: 992px) {
  .h-lg-552px {
    height: 552px;
  }
}
.h-553px {
  height: 553px;
}

@media (min-width: 992px) {
  .h-lg-553px {
    height: 553px;
  }
}
.h-554px {
  height: 554px;
}

@media (min-width: 992px) {
  .h-lg-554px {
    height: 554px;
  }
}
.h-555px {
  height: 555px;
}

@media (min-width: 992px) {
  .h-lg-555px {
    height: 555px;
  }
}
.h-556px {
  height: 556px;
}

@media (min-width: 992px) {
  .h-lg-556px {
    height: 556px;
  }
}
.h-557px {
  height: 557px;
}

@media (min-width: 992px) {
  .h-lg-557px {
    height: 557px;
  }
}
.h-558px {
  height: 558px;
}

@media (min-width: 992px) {
  .h-lg-558px {
    height: 558px;
  }
}
.h-559px {
  height: 559px;
}

@media (min-width: 992px) {
  .h-lg-559px {
    height: 559px;
  }
}
.h-560px {
  height: 560px;
}

@media (min-width: 992px) {
  .h-lg-560px {
    height: 560px;
  }
}
.h-561px {
  height: 561px;
}

@media (min-width: 992px) {
  .h-lg-561px {
    height: 561px;
  }
}
.h-562px {
  height: 562px;
}

@media (min-width: 992px) {
  .h-lg-562px {
    height: 562px;
  }
}
.h-563px {
  height: 563px;
}

@media (min-width: 992px) {
  .h-lg-563px {
    height: 563px;
  }
}
.h-564px {
  height: 564px;
}

@media (min-width: 992px) {
  .h-lg-564px {
    height: 564px;
  }
}
.h-565px {
  height: 565px;
}

@media (min-width: 992px) {
  .h-lg-565px {
    height: 565px;
  }
}
.h-566px {
  height: 566px;
}

@media (min-width: 992px) {
  .h-lg-566px {
    height: 566px;
  }
}
.h-567px {
  height: 567px;
}

@media (min-width: 992px) {
  .h-lg-567px {
    height: 567px;
  }
}
.h-568px {
  height: 568px;
}

@media (min-width: 992px) {
  .h-lg-568px {
    height: 568px;
  }
}
.h-569px {
  height: 569px;
}

@media (min-width: 992px) {
  .h-lg-569px {
    height: 569px;
  }
}
.h-570px {
  height: 570px;
}

@media (min-width: 992px) {
  .h-lg-570px {
    height: 570px;
  }
}
.h-571px {
  height: 571px;
}

@media (min-width: 992px) {
  .h-lg-571px {
    height: 571px;
  }
}
.h-572px {
  height: 572px;
}

@media (min-width: 992px) {
  .h-lg-572px {
    height: 572px;
  }
}
.h-573px {
  height: 573px;
}

@media (min-width: 992px) {
  .h-lg-573px {
    height: 573px;
  }
}
.h-574px {
  height: 574px;
}

@media (min-width: 992px) {
  .h-lg-574px {
    height: 574px;
  }
}
.h-575px {
  height: 575px;
}

@media (min-width: 992px) {
  .h-lg-575px {
    height: 575px;
  }
}
.h-576px {
  height: 576px;
}

@media (min-width: 992px) {
  .h-lg-576px {
    height: 576px;
  }
}
.h-577px {
  height: 577px;
}

@media (min-width: 992px) {
  .h-lg-577px {
    height: 577px;
  }
}
.h-578px {
  height: 578px;
}

@media (min-width: 992px) {
  .h-lg-578px {
    height: 578px;
  }
}
.h-579px {
  height: 579px;
}

@media (min-width: 992px) {
  .h-lg-579px {
    height: 579px;
  }
}
.h-580px {
  height: 580px;
}

@media (min-width: 992px) {
  .h-lg-580px {
    height: 580px;
  }
}
.h-581px {
  height: 581px;
}

@media (min-width: 992px) {
  .h-lg-581px {
    height: 581px;
  }
}
.h-582px {
  height: 582px;
}

@media (min-width: 992px) {
  .h-lg-582px {
    height: 582px;
  }
}
.h-583px {
  height: 583px;
}

@media (min-width: 992px) {
  .h-lg-583px {
    height: 583px;
  }
}
.h-584px {
  height: 584px;
}

@media (min-width: 992px) {
  .h-lg-584px {
    height: 584px;
  }
}
.h-585px {
  height: 585px;
}

@media (min-width: 992px) {
  .h-lg-585px {
    height: 585px;
  }
}
.h-586px {
  height: 586px;
}

@media (min-width: 992px) {
  .h-lg-586px {
    height: 586px;
  }
}
.h-587px {
  height: 587px;
}

@media (min-width: 992px) {
  .h-lg-587px {
    height: 587px;
  }
}
.h-588px {
  height: 588px;
}

@media (min-width: 992px) {
  .h-lg-588px {
    height: 588px;
  }
}
.h-589px {
  height: 589px;
}

@media (min-width: 992px) {
  .h-lg-589px {
    height: 589px;
  }
}
.h-590px {
  height: 590px;
}

@media (min-width: 992px) {
  .h-lg-590px {
    height: 590px;
  }
}
.h-591px {
  height: 591px;
}

@media (min-width: 992px) {
  .h-lg-591px {
    height: 591px;
  }
}
.h-592px {
  height: 592px;
}

@media (min-width: 992px) {
  .h-lg-592px {
    height: 592px;
  }
}
.h-593px {
  height: 593px;
}

@media (min-width: 992px) {
  .h-lg-593px {
    height: 593px;
  }
}
.h-594px {
  height: 594px;
}

@media (min-width: 992px) {
  .h-lg-594px {
    height: 594px;
  }
}
.h-595px {
  height: 595px;
}

@media (min-width: 992px) {
  .h-lg-595px {
    height: 595px;
  }
}
.h-596px {
  height: 596px;
}

@media (min-width: 992px) {
  .h-lg-596px {
    height: 596px;
  }
}
.h-597px {
  height: 597px;
}

@media (min-width: 992px) {
  .h-lg-597px {
    height: 597px;
  }
}
.h-598px {
  height: 598px;
}

@media (min-width: 992px) {
  .h-lg-598px {
    height: 598px;
  }
}
.h-599px {
  height: 599px;
}

@media (min-width: 992px) {
  .h-lg-599px {
    height: 599px;
  }
}
.h-600px {
  height: 600px;
}

@media (min-width: 992px) {
  .h-lg-600px {
    height: 600px;
  }
}
.h-601px {
  height: 601px;
}

@media (min-width: 992px) {
  .h-lg-601px {
    height: 601px;
  }
}
.h-602px {
  height: 602px;
}

@media (min-width: 992px) {
  .h-lg-602px {
    height: 602px;
  }
}
.h-603px {
  height: 603px;
}

@media (min-width: 992px) {
  .h-lg-603px {
    height: 603px;
  }
}
.h-604px {
  height: 604px;
}

@media (min-width: 992px) {
  .h-lg-604px {
    height: 604px;
  }
}
.h-605px {
  height: 605px;
}

@media (min-width: 992px) {
  .h-lg-605px {
    height: 605px;
  }
}
.h-606px {
  height: 606px;
}

@media (min-width: 992px) {
  .h-lg-606px {
    height: 606px;
  }
}
.h-607px {
  height: 607px;
}

@media (min-width: 992px) {
  .h-lg-607px {
    height: 607px;
  }
}
.h-608px {
  height: 608px;
}

@media (min-width: 992px) {
  .h-lg-608px {
    height: 608px;
  }
}
.h-609px {
  height: 609px;
}

@media (min-width: 992px) {
  .h-lg-609px {
    height: 609px;
  }
}
.h-610px {
  height: 610px;
}

@media (min-width: 992px) {
  .h-lg-610px {
    height: 610px;
  }
}
.h-611px {
  height: 611px;
}

@media (min-width: 992px) {
  .h-lg-611px {
    height: 611px;
  }
}
.h-612px {
  height: 612px;
}

@media (min-width: 992px) {
  .h-lg-612px {
    height: 612px;
  }
}
.h-613px {
  height: 613px;
}

@media (min-width: 992px) {
  .h-lg-613px {
    height: 613px;
  }
}
.h-614px {
  height: 614px;
}

@media (min-width: 992px) {
  .h-lg-614px {
    height: 614px;
  }
}
.h-615px {
  height: 615px;
}

@media (min-width: 992px) {
  .h-lg-615px {
    height: 615px;
  }
}
.h-616px {
  height: 616px;
}

@media (min-width: 992px) {
  .h-lg-616px {
    height: 616px;
  }
}
.h-617px {
  height: 617px;
}

@media (min-width: 992px) {
  .h-lg-617px {
    height: 617px;
  }
}
.h-618px {
  height: 618px;
}

@media (min-width: 992px) {
  .h-lg-618px {
    height: 618px;
  }
}
.h-619px {
  height: 619px;
}

@media (min-width: 992px) {
  .h-lg-619px {
    height: 619px;
  }
}
.h-620px {
  height: 620px;
}

@media (min-width: 992px) {
  .h-lg-620px {
    height: 620px;
  }
}
.h-621px {
  height: 621px;
}

@media (min-width: 992px) {
  .h-lg-621px {
    height: 621px;
  }
}
.h-622px {
  height: 622px;
}

@media (min-width: 992px) {
  .h-lg-622px {
    height: 622px;
  }
}
.h-623px {
  height: 623px;
}

@media (min-width: 992px) {
  .h-lg-623px {
    height: 623px;
  }
}
.h-624px {
  height: 624px;
}

@media (min-width: 992px) {
  .h-lg-624px {
    height: 624px;
  }
}
.h-625px {
  height: 625px;
}

@media (min-width: 992px) {
  .h-lg-625px {
    height: 625px;
  }
}
.h-626px {
  height: 626px;
}

@media (min-width: 992px) {
  .h-lg-626px {
    height: 626px;
  }
}
.h-627px {
  height: 627px;
}

@media (min-width: 992px) {
  .h-lg-627px {
    height: 627px;
  }
}
.h-628px {
  height: 628px;
}

@media (min-width: 992px) {
  .h-lg-628px {
    height: 628px;
  }
}
.h-629px {
  height: 629px;
}

@media (min-width: 992px) {
  .h-lg-629px {
    height: 629px;
  }
}
.h-630px {
  height: 630px;
}

@media (min-width: 992px) {
  .h-lg-630px {
    height: 630px;
  }
}
.h-631px {
  height: 631px;
}

@media (min-width: 992px) {
  .h-lg-631px {
    height: 631px;
  }
}
.h-632px {
  height: 632px;
}

@media (min-width: 992px) {
  .h-lg-632px {
    height: 632px;
  }
}
.h-633px {
  height: 633px;
}

@media (min-width: 992px) {
  .h-lg-633px {
    height: 633px;
  }
}
.h-634px {
  height: 634px;
}

@media (min-width: 992px) {
  .h-lg-634px {
    height: 634px;
  }
}
.h-635px {
  height: 635px;
}

@media (min-width: 992px) {
  .h-lg-635px {
    height: 635px;
  }
}
.h-636px {
  height: 636px;
}

@media (min-width: 992px) {
  .h-lg-636px {
    height: 636px;
  }
}
.h-637px {
  height: 637px;
}

@media (min-width: 992px) {
  .h-lg-637px {
    height: 637px;
  }
}
.h-638px {
  height: 638px;
}

@media (min-width: 992px) {
  .h-lg-638px {
    height: 638px;
  }
}
.h-639px {
  height: 639px;
}

@media (min-width: 992px) {
  .h-lg-639px {
    height: 639px;
  }
}
.h-640px {
  height: 640px;
}

@media (min-width: 992px) {
  .h-lg-640px {
    height: 640px;
  }
}
.h-641px {
  height: 641px;
}

@media (min-width: 992px) {
  .h-lg-641px {
    height: 641px;
  }
}
.h-642px {
  height: 642px;
}

@media (min-width: 992px) {
  .h-lg-642px {
    height: 642px;
  }
}
.h-643px {
  height: 643px;
}

@media (min-width: 992px) {
  .h-lg-643px {
    height: 643px;
  }
}
.h-644px {
  height: 644px;
}

@media (min-width: 992px) {
  .h-lg-644px {
    height: 644px;
  }
}
.h-645px {
  height: 645px;
}

@media (min-width: 992px) {
  .h-lg-645px {
    height: 645px;
  }
}
.h-646px {
  height: 646px;
}

@media (min-width: 992px) {
  .h-lg-646px {
    height: 646px;
  }
}
.h-647px {
  height: 647px;
}

@media (min-width: 992px) {
  .h-lg-647px {
    height: 647px;
  }
}
.h-648px {
  height: 648px;
}

@media (min-width: 992px) {
  .h-lg-648px {
    height: 648px;
  }
}
.h-649px {
  height: 649px;
}

@media (min-width: 992px) {
  .h-lg-649px {
    height: 649px;
  }
}
.h-650px {
  height: 650px;
}

@media (min-width: 992px) {
  .h-lg-650px {
    height: 650px;
  }
}
.h-651px {
  height: 651px;
}

@media (min-width: 992px) {
  .h-lg-651px {
    height: 651px;
  }
}
.h-652px {
  height: 652px;
}

@media (min-width: 992px) {
  .h-lg-652px {
    height: 652px;
  }
}
.h-653px {
  height: 653px;
}

@media (min-width: 992px) {
  .h-lg-653px {
    height: 653px;
  }
}
.h-654px {
  height: 654px;
}

@media (min-width: 992px) {
  .h-lg-654px {
    height: 654px;
  }
}
.h-655px {
  height: 655px;
}

@media (min-width: 992px) {
  .h-lg-655px {
    height: 655px;
  }
}
.h-656px {
  height: 656px;
}

@media (min-width: 992px) {
  .h-lg-656px {
    height: 656px;
  }
}
.h-657px {
  height: 657px;
}

@media (min-width: 992px) {
  .h-lg-657px {
    height: 657px;
  }
}
.h-658px {
  height: 658px;
}

@media (min-width: 992px) {
  .h-lg-658px {
    height: 658px;
  }
}
.h-659px {
  height: 659px;
}

@media (min-width: 992px) {
  .h-lg-659px {
    height: 659px;
  }
}
.h-660px {
  height: 660px;
}

@media (min-width: 992px) {
  .h-lg-660px {
    height: 660px;
  }
}
.h-661px {
  height: 661px;
}

@media (min-width: 992px) {
  .h-lg-661px {
    height: 661px;
  }
}
.h-662px {
  height: 662px;
}

@media (min-width: 992px) {
  .h-lg-662px {
    height: 662px;
  }
}
.h-663px {
  height: 663px;
}

@media (min-width: 992px) {
  .h-lg-663px {
    height: 663px;
  }
}
.h-664px {
  height: 664px;
}

@media (min-width: 992px) {
  .h-lg-664px {
    height: 664px;
  }
}
.h-665px {
  height: 665px;
}

@media (min-width: 992px) {
  .h-lg-665px {
    height: 665px;
  }
}
.h-666px {
  height: 666px;
}

@media (min-width: 992px) {
  .h-lg-666px {
    height: 666px;
  }
}
.h-667px {
  height: 667px;
}

@media (min-width: 992px) {
  .h-lg-667px {
    height: 667px;
  }
}
.h-668px {
  height: 668px;
}

@media (min-width: 992px) {
  .h-lg-668px {
    height: 668px;
  }
}
.h-669px {
  height: 669px;
}

@media (min-width: 992px) {
  .h-lg-669px {
    height: 669px;
  }
}
.h-670px {
  height: 670px;
}

@media (min-width: 992px) {
  .h-lg-670px {
    height: 670px;
  }
}
.h-671px {
  height: 671px;
}

@media (min-width: 992px) {
  .h-lg-671px {
    height: 671px;
  }
}
.h-672px {
  height: 672px;
}

@media (min-width: 992px) {
  .h-lg-672px {
    height: 672px;
  }
}
.h-673px {
  height: 673px;
}

@media (min-width: 992px) {
  .h-lg-673px {
    height: 673px;
  }
}
.h-674px {
  height: 674px;
}

@media (min-width: 992px) {
  .h-lg-674px {
    height: 674px;
  }
}
.h-675px {
  height: 675px;
}

@media (min-width: 992px) {
  .h-lg-675px {
    height: 675px;
  }
}
.h-676px {
  height: 676px;
}

@media (min-width: 992px) {
  .h-lg-676px {
    height: 676px;
  }
}
.h-677px {
  height: 677px;
}

@media (min-width: 992px) {
  .h-lg-677px {
    height: 677px;
  }
}
.h-678px {
  height: 678px;
}

@media (min-width: 992px) {
  .h-lg-678px {
    height: 678px;
  }
}
.h-679px {
  height: 679px;
}

@media (min-width: 992px) {
  .h-lg-679px {
    height: 679px;
  }
}
.h-680px {
  height: 680px;
}

@media (min-width: 992px) {
  .h-lg-680px {
    height: 680px;
  }
}
.h-681px {
  height: 681px;
}

@media (min-width: 992px) {
  .h-lg-681px {
    height: 681px;
  }
}
.h-682px {
  height: 682px;
}

@media (min-width: 992px) {
  .h-lg-682px {
    height: 682px;
  }
}
.h-683px {
  height: 683px;
}

@media (min-width: 992px) {
  .h-lg-683px {
    height: 683px;
  }
}
.h-684px {
  height: 684px;
}

@media (min-width: 992px) {
  .h-lg-684px {
    height: 684px;
  }
}
.h-685px {
  height: 685px;
}

@media (min-width: 992px) {
  .h-lg-685px {
    height: 685px;
  }
}
.h-686px {
  height: 686px;
}

@media (min-width: 992px) {
  .h-lg-686px {
    height: 686px;
  }
}
.h-687px {
  height: 687px;
}

@media (min-width: 992px) {
  .h-lg-687px {
    height: 687px;
  }
}
.h-688px {
  height: 688px;
}

@media (min-width: 992px) {
  .h-lg-688px {
    height: 688px;
  }
}
.h-689px {
  height: 689px;
}

@media (min-width: 992px) {
  .h-lg-689px {
    height: 689px;
  }
}
.h-690px {
  height: 690px;
}

@media (min-width: 992px) {
  .h-lg-690px {
    height: 690px;
  }
}
.h-691px {
  height: 691px;
}

@media (min-width: 992px) {
  .h-lg-691px {
    height: 691px;
  }
}
.h-692px {
  height: 692px;
}

@media (min-width: 992px) {
  .h-lg-692px {
    height: 692px;
  }
}
.h-693px {
  height: 693px;
}

@media (min-width: 992px) {
  .h-lg-693px {
    height: 693px;
  }
}
.h-694px {
  height: 694px;
}

@media (min-width: 992px) {
  .h-lg-694px {
    height: 694px;
  }
}
.h-695px {
  height: 695px;
}

@media (min-width: 992px) {
  .h-lg-695px {
    height: 695px;
  }
}
.h-696px {
  height: 696px;
}

@media (min-width: 992px) {
  .h-lg-696px {
    height: 696px;
  }
}
.h-697px {
  height: 697px;
}

@media (min-width: 992px) {
  .h-lg-697px {
    height: 697px;
  }
}
.h-698px {
  height: 698px;
}

@media (min-width: 992px) {
  .h-lg-698px {
    height: 698px;
  }
}
.h-699px {
  height: 699px;
}

@media (min-width: 992px) {
  .h-lg-699px {
    height: 699px;
  }
}
.h-700px {
  height: 700px;
}

@media (min-width: 992px) {
  .h-lg-700px {
    height: 700px;
  }
}
.h-701px {
  height: 701px;
}

@media (min-width: 992px) {
  .h-lg-701px {
    height: 701px;
  }
}
.h-702px {
  height: 702px;
}

@media (min-width: 992px) {
  .h-lg-702px {
    height: 702px;
  }
}
.h-703px {
  height: 703px;
}

@media (min-width: 992px) {
  .h-lg-703px {
    height: 703px;
  }
}
.h-704px {
  height: 704px;
}

@media (min-width: 992px) {
  .h-lg-704px {
    height: 704px;
  }
}
.h-705px {
  height: 705px;
}

@media (min-width: 992px) {
  .h-lg-705px {
    height: 705px;
  }
}
.h-706px {
  height: 706px;
}

@media (min-width: 992px) {
  .h-lg-706px {
    height: 706px;
  }
}
.h-707px {
  height: 707px;
}

@media (min-width: 992px) {
  .h-lg-707px {
    height: 707px;
  }
}
.h-708px {
  height: 708px;
}

@media (min-width: 992px) {
  .h-lg-708px {
    height: 708px;
  }
}
.h-709px {
  height: 709px;
}

@media (min-width: 992px) {
  .h-lg-709px {
    height: 709px;
  }
}
.h-710px {
  height: 710px;
}

@media (min-width: 992px) {
  .h-lg-710px {
    height: 710px;
  }
}
.h-711px {
  height: 711px;
}

@media (min-width: 992px) {
  .h-lg-711px {
    height: 711px;
  }
}
.h-712px {
  height: 712px;
}

@media (min-width: 992px) {
  .h-lg-712px {
    height: 712px;
  }
}
.h-713px {
  height: 713px;
}

@media (min-width: 992px) {
  .h-lg-713px {
    height: 713px;
  }
}
.h-714px {
  height: 714px;
}

@media (min-width: 992px) {
  .h-lg-714px {
    height: 714px;
  }
}
.h-715px {
  height: 715px;
}

@media (min-width: 992px) {
  .h-lg-715px {
    height: 715px;
  }
}
.h-716px {
  height: 716px;
}

@media (min-width: 992px) {
  .h-lg-716px {
    height: 716px;
  }
}
.h-717px {
  height: 717px;
}

@media (min-width: 992px) {
  .h-lg-717px {
    height: 717px;
  }
}
.h-718px {
  height: 718px;
}

@media (min-width: 992px) {
  .h-lg-718px {
    height: 718px;
  }
}
.h-719px {
  height: 719px;
}

@media (min-width: 992px) {
  .h-lg-719px {
    height: 719px;
  }
}
.h-720px {
  height: 720px;
}

@media (min-width: 992px) {
  .h-lg-720px {
    height: 720px;
  }
}
.h-721px {
  height: 721px;
}

@media (min-width: 992px) {
  .h-lg-721px {
    height: 721px;
  }
}
.h-722px {
  height: 722px;
}

@media (min-width: 992px) {
  .h-lg-722px {
    height: 722px;
  }
}
.h-723px {
  height: 723px;
}

@media (min-width: 992px) {
  .h-lg-723px {
    height: 723px;
  }
}
.h-724px {
  height: 724px;
}

@media (min-width: 992px) {
  .h-lg-724px {
    height: 724px;
  }
}
.h-725px {
  height: 725px;
}

@media (min-width: 992px) {
  .h-lg-725px {
    height: 725px;
  }
}
.h-726px {
  height: 726px;
}

@media (min-width: 992px) {
  .h-lg-726px {
    height: 726px;
  }
}
.h-727px {
  height: 727px;
}

@media (min-width: 992px) {
  .h-lg-727px {
    height: 727px;
  }
}
.h-728px {
  height: 728px;
}

@media (min-width: 992px) {
  .h-lg-728px {
    height: 728px;
  }
}
.h-729px {
  height: 729px;
}

@media (min-width: 992px) {
  .h-lg-729px {
    height: 729px;
  }
}
.h-730px {
  height: 730px;
}

@media (min-width: 992px) {
  .h-lg-730px {
    height: 730px;
  }
}
.h-731px {
  height: 731px;
}

@media (min-width: 992px) {
  .h-lg-731px {
    height: 731px;
  }
}
.h-732px {
  height: 732px;
}

@media (min-width: 992px) {
  .h-lg-732px {
    height: 732px;
  }
}
.h-733px {
  height: 733px;
}

@media (min-width: 992px) {
  .h-lg-733px {
    height: 733px;
  }
}
.h-734px {
  height: 734px;
}

@media (min-width: 992px) {
  .h-lg-734px {
    height: 734px;
  }
}
.h-735px {
  height: 735px;
}

@media (min-width: 992px) {
  .h-lg-735px {
    height: 735px;
  }
}
.h-736px {
  height: 736px;
}

@media (min-width: 992px) {
  .h-lg-736px {
    height: 736px;
  }
}
.h-737px {
  height: 737px;
}

@media (min-width: 992px) {
  .h-lg-737px {
    height: 737px;
  }
}
.h-738px {
  height: 738px;
}

@media (min-width: 992px) {
  .h-lg-738px {
    height: 738px;
  }
}
.h-739px {
  height: 739px;
}

@media (min-width: 992px) {
  .h-lg-739px {
    height: 739px;
  }
}
.h-740px {
  height: 740px;
}

@media (min-width: 992px) {
  .h-lg-740px {
    height: 740px;
  }
}
.h-741px {
  height: 741px;
}

@media (min-width: 992px) {
  .h-lg-741px {
    height: 741px;
  }
}
.h-742px {
  height: 742px;
}

@media (min-width: 992px) {
  .h-lg-742px {
    height: 742px;
  }
}
.h-743px {
  height: 743px;
}

@media (min-width: 992px) {
  .h-lg-743px {
    height: 743px;
  }
}
.h-744px {
  height: 744px;
}

@media (min-width: 992px) {
  .h-lg-744px {
    height: 744px;
  }
}
.h-745px {
  height: 745px;
}

@media (min-width: 992px) {
  .h-lg-745px {
    height: 745px;
  }
}
.h-746px {
  height: 746px;
}

@media (min-width: 992px) {
  .h-lg-746px {
    height: 746px;
  }
}
.h-747px {
  height: 747px;
}

@media (min-width: 992px) {
  .h-lg-747px {
    height: 747px;
  }
}
.h-748px {
  height: 748px;
}

@media (min-width: 992px) {
  .h-lg-748px {
    height: 748px;
  }
}
.h-749px {
  height: 749px;
}

@media (min-width: 992px) {
  .h-lg-749px {
    height: 749px;
  }
}
.h-750px {
  height: 750px;
}

@media (min-width: 992px) {
  .h-lg-750px {
    height: 750px;
  }
}
.h-751px {
  height: 751px;
}

@media (min-width: 992px) {
  .h-lg-751px {
    height: 751px;
  }
}
.h-752px {
  height: 752px;
}

@media (min-width: 992px) {
  .h-lg-752px {
    height: 752px;
  }
}
.h-753px {
  height: 753px;
}

@media (min-width: 992px) {
  .h-lg-753px {
    height: 753px;
  }
}
.h-754px {
  height: 754px;
}

@media (min-width: 992px) {
  .h-lg-754px {
    height: 754px;
  }
}
.h-755px {
  height: 755px;
}

@media (min-width: 992px) {
  .h-lg-755px {
    height: 755px;
  }
}
.h-756px {
  height: 756px;
}

@media (min-width: 992px) {
  .h-lg-756px {
    height: 756px;
  }
}
.h-757px {
  height: 757px;
}

@media (min-width: 992px) {
  .h-lg-757px {
    height: 757px;
  }
}
.h-758px {
  height: 758px;
}

@media (min-width: 992px) {
  .h-lg-758px {
    height: 758px;
  }
}
.h-759px {
  height: 759px;
}

@media (min-width: 992px) {
  .h-lg-759px {
    height: 759px;
  }
}
.h-760px {
  height: 760px;
}

@media (min-width: 992px) {
  .h-lg-760px {
    height: 760px;
  }
}
.h-761px {
  height: 761px;
}

@media (min-width: 992px) {
  .h-lg-761px {
    height: 761px;
  }
}
.h-762px {
  height: 762px;
}

@media (min-width: 992px) {
  .h-lg-762px {
    height: 762px;
  }
}
.h-763px {
  height: 763px;
}

@media (min-width: 992px) {
  .h-lg-763px {
    height: 763px;
  }
}
.h-764px {
  height: 764px;
}

@media (min-width: 992px) {
  .h-lg-764px {
    height: 764px;
  }
}
.h-765px {
  height: 765px;
}

@media (min-width: 992px) {
  .h-lg-765px {
    height: 765px;
  }
}
.h-766px {
  height: 766px;
}

@media (min-width: 992px) {
  .h-lg-766px {
    height: 766px;
  }
}
.h-767px {
  height: 767px;
}

@media (min-width: 992px) {
  .h-lg-767px {
    height: 767px;
  }
}
.h-768px {
  height: 768px;
}

@media (min-width: 992px) {
  .h-lg-768px {
    height: 768px;
  }
}
.h-769px {
  height: 769px;
}

@media (min-width: 992px) {
  .h-lg-769px {
    height: 769px;
  }
}
.h-770px {
  height: 770px;
}

@media (min-width: 992px) {
  .h-lg-770px {
    height: 770px;
  }
}
.h-771px {
  height: 771px;
}

@media (min-width: 992px) {
  .h-lg-771px {
    height: 771px;
  }
}
.h-772px {
  height: 772px;
}

@media (min-width: 992px) {
  .h-lg-772px {
    height: 772px;
  }
}
.h-773px {
  height: 773px;
}

@media (min-width: 992px) {
  .h-lg-773px {
    height: 773px;
  }
}
.h-774px {
  height: 774px;
}

@media (min-width: 992px) {
  .h-lg-774px {
    height: 774px;
  }
}
.h-775px {
  height: 775px;
}

@media (min-width: 992px) {
  .h-lg-775px {
    height: 775px;
  }
}
.h-776px {
  height: 776px;
}

@media (min-width: 992px) {
  .h-lg-776px {
    height: 776px;
  }
}
.h-777px {
  height: 777px;
}

@media (min-width: 992px) {
  .h-lg-777px {
    height: 777px;
  }
}
.h-778px {
  height: 778px;
}

@media (min-width: 992px) {
  .h-lg-778px {
    height: 778px;
  }
}
.h-779px {
  height: 779px;
}

@media (min-width: 992px) {
  .h-lg-779px {
    height: 779px;
  }
}
.h-780px {
  height: 780px;
}

@media (min-width: 992px) {
  .h-lg-780px {
    height: 780px;
  }
}
.h-781px {
  height: 781px;
}

@media (min-width: 992px) {
  .h-lg-781px {
    height: 781px;
  }
}
.h-782px {
  height: 782px;
}

@media (min-width: 992px) {
  .h-lg-782px {
    height: 782px;
  }
}
.h-783px {
  height: 783px;
}

@media (min-width: 992px) {
  .h-lg-783px {
    height: 783px;
  }
}
.h-784px {
  height: 784px;
}

@media (min-width: 992px) {
  .h-lg-784px {
    height: 784px;
  }
}
.h-785px {
  height: 785px;
}

@media (min-width: 992px) {
  .h-lg-785px {
    height: 785px;
  }
}
.h-786px {
  height: 786px;
}

@media (min-width: 992px) {
  .h-lg-786px {
    height: 786px;
  }
}
.h-787px {
  height: 787px;
}

@media (min-width: 992px) {
  .h-lg-787px {
    height: 787px;
  }
}
.h-788px {
  height: 788px;
}

@media (min-width: 992px) {
  .h-lg-788px {
    height: 788px;
  }
}
.h-789px {
  height: 789px;
}

@media (min-width: 992px) {
  .h-lg-789px {
    height: 789px;
  }
}
.h-790px {
  height: 790px;
}

@media (min-width: 992px) {
  .h-lg-790px {
    height: 790px;
  }
}
.h-791px {
  height: 791px;
}

@media (min-width: 992px) {
  .h-lg-791px {
    height: 791px;
  }
}
.h-792px {
  height: 792px;
}

@media (min-width: 992px) {
  .h-lg-792px {
    height: 792px;
  }
}
.h-793px {
  height: 793px;
}

@media (min-width: 992px) {
  .h-lg-793px {
    height: 793px;
  }
}
.h-794px {
  height: 794px;
}

@media (min-width: 992px) {
  .h-lg-794px {
    height: 794px;
  }
}
.h-795px {
  height: 795px;
}

@media (min-width: 992px) {
  .h-lg-795px {
    height: 795px;
  }
}
.h-796px {
  height: 796px;
}

@media (min-width: 992px) {
  .h-lg-796px {
    height: 796px;
  }
}
.h-797px {
  height: 797px;
}

@media (min-width: 992px) {
  .h-lg-797px {
    height: 797px;
  }
}
.h-798px {
  height: 798px;
}

@media (min-width: 992px) {
  .h-lg-798px {
    height: 798px;
  }
}
.h-799px {
  height: 799px;
}

@media (min-width: 992px) {
  .h-lg-799px {
    height: 799px;
  }
}
.h-800px {
  height: 800px;
}

@media (min-width: 992px) {
  .h-lg-800px {
    height: 800px;
  }
}
.h-801px {
  height: 801px;
}

@media (min-width: 992px) {
  .h-lg-801px {
    height: 801px;
  }
}
.h-802px {
  height: 802px;
}

@media (min-width: 992px) {
  .h-lg-802px {
    height: 802px;
  }
}
.h-803px {
  height: 803px;
}

@media (min-width: 992px) {
  .h-lg-803px {
    height: 803px;
  }
}
.h-804px {
  height: 804px;
}

@media (min-width: 992px) {
  .h-lg-804px {
    height: 804px;
  }
}
.h-805px {
  height: 805px;
}

@media (min-width: 992px) {
  .h-lg-805px {
    height: 805px;
  }
}
.h-806px {
  height: 806px;
}

@media (min-width: 992px) {
  .h-lg-806px {
    height: 806px;
  }
}
.h-807px {
  height: 807px;
}

@media (min-width: 992px) {
  .h-lg-807px {
    height: 807px;
  }
}
.h-808px {
  height: 808px;
}

@media (min-width: 992px) {
  .h-lg-808px {
    height: 808px;
  }
}
.h-809px {
  height: 809px;
}

@media (min-width: 992px) {
  .h-lg-809px {
    height: 809px;
  }
}
.h-810px {
  height: 810px;
}

@media (min-width: 992px) {
  .h-lg-810px {
    height: 810px;
  }
}
.h-811px {
  height: 811px;
}

@media (min-width: 992px) {
  .h-lg-811px {
    height: 811px;
  }
}
.h-812px {
  height: 812px;
}

@media (min-width: 992px) {
  .h-lg-812px {
    height: 812px;
  }
}
.h-813px {
  height: 813px;
}

@media (min-width: 992px) {
  .h-lg-813px {
    height: 813px;
  }
}
.h-814px {
  height: 814px;
}

@media (min-width: 992px) {
  .h-lg-814px {
    height: 814px;
  }
}
.h-815px {
  height: 815px;
}

@media (min-width: 992px) {
  .h-lg-815px {
    height: 815px;
  }
}
.h-816px {
  height: 816px;
}

@media (min-width: 992px) {
  .h-lg-816px {
    height: 816px;
  }
}
.h-817px {
  height: 817px;
}

@media (min-width: 992px) {
  .h-lg-817px {
    height: 817px;
  }
}
.h-818px {
  height: 818px;
}

@media (min-width: 992px) {
  .h-lg-818px {
    height: 818px;
  }
}
.h-819px {
  height: 819px;
}

@media (min-width: 992px) {
  .h-lg-819px {
    height: 819px;
  }
}
.h-820px {
  height: 820px;
}

@media (min-width: 992px) {
  .h-lg-820px {
    height: 820px;
  }
}
.h-821px {
  height: 821px;
}

@media (min-width: 992px) {
  .h-lg-821px {
    height: 821px;
  }
}
.h-822px {
  height: 822px;
}

@media (min-width: 992px) {
  .h-lg-822px {
    height: 822px;
  }
}
.h-823px {
  height: 823px;
}

@media (min-width: 992px) {
  .h-lg-823px {
    height: 823px;
  }
}
.h-824px {
  height: 824px;
}

@media (min-width: 992px) {
  .h-lg-824px {
    height: 824px;
  }
}
.h-825px {
  height: 825px;
}

@media (min-width: 992px) {
  .h-lg-825px {
    height: 825px;
  }
}
.h-826px {
  height: 826px;
}

@media (min-width: 992px) {
  .h-lg-826px {
    height: 826px;
  }
}
.h-827px {
  height: 827px;
}

@media (min-width: 992px) {
  .h-lg-827px {
    height: 827px;
  }
}
.h-828px {
  height: 828px;
}

@media (min-width: 992px) {
  .h-lg-828px {
    height: 828px;
  }
}
.h-829px {
  height: 829px;
}

@media (min-width: 992px) {
  .h-lg-829px {
    height: 829px;
  }
}
.h-830px {
  height: 830px;
}

@media (min-width: 992px) {
  .h-lg-830px {
    height: 830px;
  }
}
.h-831px {
  height: 831px;
}

@media (min-width: 992px) {
  .h-lg-831px {
    height: 831px;
  }
}
.h-832px {
  height: 832px;
}

@media (min-width: 992px) {
  .h-lg-832px {
    height: 832px;
  }
}
.h-833px {
  height: 833px;
}

@media (min-width: 992px) {
  .h-lg-833px {
    height: 833px;
  }
}
.h-834px {
  height: 834px;
}

@media (min-width: 992px) {
  .h-lg-834px {
    height: 834px;
  }
}
.h-835px {
  height: 835px;
}

@media (min-width: 992px) {
  .h-lg-835px {
    height: 835px;
  }
}
.h-836px {
  height: 836px;
}

@media (min-width: 992px) {
  .h-lg-836px {
    height: 836px;
  }
}
.h-837px {
  height: 837px;
}

@media (min-width: 992px) {
  .h-lg-837px {
    height: 837px;
  }
}
.h-838px {
  height: 838px;
}

@media (min-width: 992px) {
  .h-lg-838px {
    height: 838px;
  }
}
.h-839px {
  height: 839px;
}

@media (min-width: 992px) {
  .h-lg-839px {
    height: 839px;
  }
}
.h-840px {
  height: 840px;
}

@media (min-width: 992px) {
  .h-lg-840px {
    height: 840px;
  }
}
.h-841px {
  height: 841px;
}

@media (min-width: 992px) {
  .h-lg-841px {
    height: 841px;
  }
}
.h-842px {
  height: 842px;
}

@media (min-width: 992px) {
  .h-lg-842px {
    height: 842px;
  }
}
.h-843px {
  height: 843px;
}

@media (min-width: 992px) {
  .h-lg-843px {
    height: 843px;
  }
}
.h-844px {
  height: 844px;
}

@media (min-width: 992px) {
  .h-lg-844px {
    height: 844px;
  }
}
.h-845px {
  height: 845px;
}

@media (min-width: 992px) {
  .h-lg-845px {
    height: 845px;
  }
}
.h-846px {
  height: 846px;
}

@media (min-width: 992px) {
  .h-lg-846px {
    height: 846px;
  }
}
.h-847px {
  height: 847px;
}

@media (min-width: 992px) {
  .h-lg-847px {
    height: 847px;
  }
}
.h-848px {
  height: 848px;
}

@media (min-width: 992px) {
  .h-lg-848px {
    height: 848px;
  }
}
.h-849px {
  height: 849px;
}

@media (min-width: 992px) {
  .h-lg-849px {
    height: 849px;
  }
}
.h-850px {
  height: 850px;
}

@media (min-width: 992px) {
  .h-lg-850px {
    height: 850px;
  }
}
.h-851px {
  height: 851px;
}

@media (min-width: 992px) {
  .h-lg-851px {
    height: 851px;
  }
}
.h-852px {
  height: 852px;
}

@media (min-width: 992px) {
  .h-lg-852px {
    height: 852px;
  }
}
.h-853px {
  height: 853px;
}

@media (min-width: 992px) {
  .h-lg-853px {
    height: 853px;
  }
}
.h-854px {
  height: 854px;
}

@media (min-width: 992px) {
  .h-lg-854px {
    height: 854px;
  }
}
.h-855px {
  height: 855px;
}

@media (min-width: 992px) {
  .h-lg-855px {
    height: 855px;
  }
}
.h-856px {
  height: 856px;
}

@media (min-width: 992px) {
  .h-lg-856px {
    height: 856px;
  }
}
.h-857px {
  height: 857px;
}

@media (min-width: 992px) {
  .h-lg-857px {
    height: 857px;
  }
}
.h-858px {
  height: 858px;
}

@media (min-width: 992px) {
  .h-lg-858px {
    height: 858px;
  }
}
.h-859px {
  height: 859px;
}

@media (min-width: 992px) {
  .h-lg-859px {
    height: 859px;
  }
}
.h-860px {
  height: 860px;
}

@media (min-width: 992px) {
  .h-lg-860px {
    height: 860px;
  }
}
.h-861px {
  height: 861px;
}

@media (min-width: 992px) {
  .h-lg-861px {
    height: 861px;
  }
}
.h-862px {
  height: 862px;
}

@media (min-width: 992px) {
  .h-lg-862px {
    height: 862px;
  }
}
.h-863px {
  height: 863px;
}

@media (min-width: 992px) {
  .h-lg-863px {
    height: 863px;
  }
}
.h-864px {
  height: 864px;
}

@media (min-width: 992px) {
  .h-lg-864px {
    height: 864px;
  }
}
.h-865px {
  height: 865px;
}

@media (min-width: 992px) {
  .h-lg-865px {
    height: 865px;
  }
}
.h-866px {
  height: 866px;
}

@media (min-width: 992px) {
  .h-lg-866px {
    height: 866px;
  }
}
.h-867px {
  height: 867px;
}

@media (min-width: 992px) {
  .h-lg-867px {
    height: 867px;
  }
}
.h-868px {
  height: 868px;
}

@media (min-width: 992px) {
  .h-lg-868px {
    height: 868px;
  }
}
.h-869px {
  height: 869px;
}

@media (min-width: 992px) {
  .h-lg-869px {
    height: 869px;
  }
}
.h-870px {
  height: 870px;
}

@media (min-width: 992px) {
  .h-lg-870px {
    height: 870px;
  }
}
.h-871px {
  height: 871px;
}

@media (min-width: 992px) {
  .h-lg-871px {
    height: 871px;
  }
}
.h-872px {
  height: 872px;
}

@media (min-width: 992px) {
  .h-lg-872px {
    height: 872px;
  }
}
.h-873px {
  height: 873px;
}

@media (min-width: 992px) {
  .h-lg-873px {
    height: 873px;
  }
}
.h-874px {
  height: 874px;
}

@media (min-width: 992px) {
  .h-lg-874px {
    height: 874px;
  }
}
.h-875px {
  height: 875px;
}

@media (min-width: 992px) {
  .h-lg-875px {
    height: 875px;
  }
}
.h-876px {
  height: 876px;
}

@media (min-width: 992px) {
  .h-lg-876px {
    height: 876px;
  }
}
.h-877px {
  height: 877px;
}

@media (min-width: 992px) {
  .h-lg-877px {
    height: 877px;
  }
}
.h-878px {
  height: 878px;
}

@media (min-width: 992px) {
  .h-lg-878px {
    height: 878px;
  }
}
.h-879px {
  height: 879px;
}

@media (min-width: 992px) {
  .h-lg-879px {
    height: 879px;
  }
}
.h-880px {
  height: 880px;
}

@media (min-width: 992px) {
  .h-lg-880px {
    height: 880px;
  }
}
.h-881px {
  height: 881px;
}

@media (min-width: 992px) {
  .h-lg-881px {
    height: 881px;
  }
}
.h-882px {
  height: 882px;
}

@media (min-width: 992px) {
  .h-lg-882px {
    height: 882px;
  }
}
.h-883px {
  height: 883px;
}

@media (min-width: 992px) {
  .h-lg-883px {
    height: 883px;
  }
}
.h-884px {
  height: 884px;
}

@media (min-width: 992px) {
  .h-lg-884px {
    height: 884px;
  }
}
.h-885px {
  height: 885px;
}

@media (min-width: 992px) {
  .h-lg-885px {
    height: 885px;
  }
}
.h-886px {
  height: 886px;
}

@media (min-width: 992px) {
  .h-lg-886px {
    height: 886px;
  }
}
.h-887px {
  height: 887px;
}

@media (min-width: 992px) {
  .h-lg-887px {
    height: 887px;
  }
}
.h-888px {
  height: 888px;
}

@media (min-width: 992px) {
  .h-lg-888px {
    height: 888px;
  }
}
.h-889px {
  height: 889px;
}

@media (min-width: 992px) {
  .h-lg-889px {
    height: 889px;
  }
}
.h-890px {
  height: 890px;
}

@media (min-width: 992px) {
  .h-lg-890px {
    height: 890px;
  }
}
.h-891px {
  height: 891px;
}

@media (min-width: 992px) {
  .h-lg-891px {
    height: 891px;
  }
}
.h-892px {
  height: 892px;
}

@media (min-width: 992px) {
  .h-lg-892px {
    height: 892px;
  }
}
.h-893px {
  height: 893px;
}

@media (min-width: 992px) {
  .h-lg-893px {
    height: 893px;
  }
}
.h-894px {
  height: 894px;
}

@media (min-width: 992px) {
  .h-lg-894px {
    height: 894px;
  }
}
.h-895px {
  height: 895px;
}

@media (min-width: 992px) {
  .h-lg-895px {
    height: 895px;
  }
}
.h-896px {
  height: 896px;
}

@media (min-width: 992px) {
  .h-lg-896px {
    height: 896px;
  }
}
.h-897px {
  height: 897px;
}

@media (min-width: 992px) {
  .h-lg-897px {
    height: 897px;
  }
}
.h-898px {
  height: 898px;
}

@media (min-width: 992px) {
  .h-lg-898px {
    height: 898px;
  }
}
.h-899px {
  height: 899px;
}

@media (min-width: 992px) {
  .h-lg-899px {
    height: 899px;
  }
}
.h-900px {
  height: 900px;
}

@media (min-width: 992px) {
  .h-lg-900px {
    height: 900px;
  }
}
.h-901px {
  height: 901px;
}

@media (min-width: 992px) {
  .h-lg-901px {
    height: 901px;
  }
}
.h-902px {
  height: 902px;
}

@media (min-width: 992px) {
  .h-lg-902px {
    height: 902px;
  }
}
.h-903px {
  height: 903px;
}

@media (min-width: 992px) {
  .h-lg-903px {
    height: 903px;
  }
}
.h-904px {
  height: 904px;
}

@media (min-width: 992px) {
  .h-lg-904px {
    height: 904px;
  }
}
.h-905px {
  height: 905px;
}

@media (min-width: 992px) {
  .h-lg-905px {
    height: 905px;
  }
}
.h-906px {
  height: 906px;
}

@media (min-width: 992px) {
  .h-lg-906px {
    height: 906px;
  }
}
.h-907px {
  height: 907px;
}

@media (min-width: 992px) {
  .h-lg-907px {
    height: 907px;
  }
}
.h-908px {
  height: 908px;
}

@media (min-width: 992px) {
  .h-lg-908px {
    height: 908px;
  }
}
.h-909px {
  height: 909px;
}

@media (min-width: 992px) {
  .h-lg-909px {
    height: 909px;
  }
}
.h-910px {
  height: 910px;
}

@media (min-width: 992px) {
  .h-lg-910px {
    height: 910px;
  }
}
.h-911px {
  height: 911px;
}

@media (min-width: 992px) {
  .h-lg-911px {
    height: 911px;
  }
}
.h-912px {
  height: 912px;
}

@media (min-width: 992px) {
  .h-lg-912px {
    height: 912px;
  }
}
.h-913px {
  height: 913px;
}

@media (min-width: 992px) {
  .h-lg-913px {
    height: 913px;
  }
}
.h-914px {
  height: 914px;
}

@media (min-width: 992px) {
  .h-lg-914px {
    height: 914px;
  }
}
.h-915px {
  height: 915px;
}

@media (min-width: 992px) {
  .h-lg-915px {
    height: 915px;
  }
}
.h-916px {
  height: 916px;
}

@media (min-width: 992px) {
  .h-lg-916px {
    height: 916px;
  }
}
.h-917px {
  height: 917px;
}

@media (min-width: 992px) {
  .h-lg-917px {
    height: 917px;
  }
}
.h-918px {
  height: 918px;
}

@media (min-width: 992px) {
  .h-lg-918px {
    height: 918px;
  }
}
.h-919px {
  height: 919px;
}

@media (min-width: 992px) {
  .h-lg-919px {
    height: 919px;
  }
}
.h-920px {
  height: 920px;
}

@media (min-width: 992px) {
  .h-lg-920px {
    height: 920px;
  }
}
.h-921px {
  height: 921px;
}

@media (min-width: 992px) {
  .h-lg-921px {
    height: 921px;
  }
}
.h-922px {
  height: 922px;
}

@media (min-width: 992px) {
  .h-lg-922px {
    height: 922px;
  }
}
.h-923px {
  height: 923px;
}

@media (min-width: 992px) {
  .h-lg-923px {
    height: 923px;
  }
}
.h-924px {
  height: 924px;
}

@media (min-width: 992px) {
  .h-lg-924px {
    height: 924px;
  }
}
.h-925px {
  height: 925px;
}

@media (min-width: 992px) {
  .h-lg-925px {
    height: 925px;
  }
}
.h-926px {
  height: 926px;
}

@media (min-width: 992px) {
  .h-lg-926px {
    height: 926px;
  }
}
.h-927px {
  height: 927px;
}

@media (min-width: 992px) {
  .h-lg-927px {
    height: 927px;
  }
}
.h-928px {
  height: 928px;
}

@media (min-width: 992px) {
  .h-lg-928px {
    height: 928px;
  }
}
.h-929px {
  height: 929px;
}

@media (min-width: 992px) {
  .h-lg-929px {
    height: 929px;
  }
}
.h-930px {
  height: 930px;
}

@media (min-width: 992px) {
  .h-lg-930px {
    height: 930px;
  }
}
.h-931px {
  height: 931px;
}

@media (min-width: 992px) {
  .h-lg-931px {
    height: 931px;
  }
}
.h-932px {
  height: 932px;
}

@media (min-width: 992px) {
  .h-lg-932px {
    height: 932px;
  }
}
.h-933px {
  height: 933px;
}

@media (min-width: 992px) {
  .h-lg-933px {
    height: 933px;
  }
}
.h-934px {
  height: 934px;
}

@media (min-width: 992px) {
  .h-lg-934px {
    height: 934px;
  }
}
.h-935px {
  height: 935px;
}

@media (min-width: 992px) {
  .h-lg-935px {
    height: 935px;
  }
}
.h-936px {
  height: 936px;
}

@media (min-width: 992px) {
  .h-lg-936px {
    height: 936px;
  }
}
.h-937px {
  height: 937px;
}

@media (min-width: 992px) {
  .h-lg-937px {
    height: 937px;
  }
}
.h-938px {
  height: 938px;
}

@media (min-width: 992px) {
  .h-lg-938px {
    height: 938px;
  }
}
.h-939px {
  height: 939px;
}

@media (min-width: 992px) {
  .h-lg-939px {
    height: 939px;
  }
}
.h-940px {
  height: 940px;
}

@media (min-width: 992px) {
  .h-lg-940px {
    height: 940px;
  }
}
.h-941px {
  height: 941px;
}

@media (min-width: 992px) {
  .h-lg-941px {
    height: 941px;
  }
}
.h-942px {
  height: 942px;
}

@media (min-width: 992px) {
  .h-lg-942px {
    height: 942px;
  }
}
.h-943px {
  height: 943px;
}

@media (min-width: 992px) {
  .h-lg-943px {
    height: 943px;
  }
}
.h-944px {
  height: 944px;
}

@media (min-width: 992px) {
  .h-lg-944px {
    height: 944px;
  }
}
.h-945px {
  height: 945px;
}

@media (min-width: 992px) {
  .h-lg-945px {
    height: 945px;
  }
}
.h-946px {
  height: 946px;
}

@media (min-width: 992px) {
  .h-lg-946px {
    height: 946px;
  }
}
.h-947px {
  height: 947px;
}

@media (min-width: 992px) {
  .h-lg-947px {
    height: 947px;
  }
}
.h-948px {
  height: 948px;
}

@media (min-width: 992px) {
  .h-lg-948px {
    height: 948px;
  }
}
.h-949px {
  height: 949px;
}

@media (min-width: 992px) {
  .h-lg-949px {
    height: 949px;
  }
}
.h-950px {
  height: 950px;
}

@media (min-width: 992px) {
  .h-lg-950px {
    height: 950px;
  }
}
.h-951px {
  height: 951px;
}

@media (min-width: 992px) {
  .h-lg-951px {
    height: 951px;
  }
}
.h-952px {
  height: 952px;
}

@media (min-width: 992px) {
  .h-lg-952px {
    height: 952px;
  }
}
.h-953px {
  height: 953px;
}

@media (min-width: 992px) {
  .h-lg-953px {
    height: 953px;
  }
}
.h-954px {
  height: 954px;
}

@media (min-width: 992px) {
  .h-lg-954px {
    height: 954px;
  }
}
.h-955px {
  height: 955px;
}

@media (min-width: 992px) {
  .h-lg-955px {
    height: 955px;
  }
}
.h-956px {
  height: 956px;
}

@media (min-width: 992px) {
  .h-lg-956px {
    height: 956px;
  }
}
.h-957px {
  height: 957px;
}

@media (min-width: 992px) {
  .h-lg-957px {
    height: 957px;
  }
}
.h-958px {
  height: 958px;
}

@media (min-width: 992px) {
  .h-lg-958px {
    height: 958px;
  }
}
.h-959px {
  height: 959px;
}

@media (min-width: 992px) {
  .h-lg-959px {
    height: 959px;
  }
}
.h-960px {
  height: 960px;
}

@media (min-width: 992px) {
  .h-lg-960px {
    height: 960px;
  }
}
.h-961px {
  height: 961px;
}

@media (min-width: 992px) {
  .h-lg-961px {
    height: 961px;
  }
}
.h-962px {
  height: 962px;
}

@media (min-width: 992px) {
  .h-lg-962px {
    height: 962px;
  }
}
.h-963px {
  height: 963px;
}

@media (min-width: 992px) {
  .h-lg-963px {
    height: 963px;
  }
}
.h-964px {
  height: 964px;
}

@media (min-width: 992px) {
  .h-lg-964px {
    height: 964px;
  }
}
.h-965px {
  height: 965px;
}

@media (min-width: 992px) {
  .h-lg-965px {
    height: 965px;
  }
}
.h-966px {
  height: 966px;
}

@media (min-width: 992px) {
  .h-lg-966px {
    height: 966px;
  }
}
.h-967px {
  height: 967px;
}

@media (min-width: 992px) {
  .h-lg-967px {
    height: 967px;
  }
}
.h-968px {
  height: 968px;
}

@media (min-width: 992px) {
  .h-lg-968px {
    height: 968px;
  }
}
.h-969px {
  height: 969px;
}

@media (min-width: 992px) {
  .h-lg-969px {
    height: 969px;
  }
}
.h-970px {
  height: 970px;
}

@media (min-width: 992px) {
  .h-lg-970px {
    height: 970px;
  }
}
.h-971px {
  height: 971px;
}

@media (min-width: 992px) {
  .h-lg-971px {
    height: 971px;
  }
}
.h-972px {
  height: 972px;
}

@media (min-width: 992px) {
  .h-lg-972px {
    height: 972px;
  }
}
.h-973px {
  height: 973px;
}

@media (min-width: 992px) {
  .h-lg-973px {
    height: 973px;
  }
}
.h-974px {
  height: 974px;
}

@media (min-width: 992px) {
  .h-lg-974px {
    height: 974px;
  }
}
.h-975px {
  height: 975px;
}

@media (min-width: 992px) {
  .h-lg-975px {
    height: 975px;
  }
}
.h-976px {
  height: 976px;
}

@media (min-width: 992px) {
  .h-lg-976px {
    height: 976px;
  }
}
.h-977px {
  height: 977px;
}

@media (min-width: 992px) {
  .h-lg-977px {
    height: 977px;
  }
}
.h-978px {
  height: 978px;
}

@media (min-width: 992px) {
  .h-lg-978px {
    height: 978px;
  }
}
.h-979px {
  height: 979px;
}

@media (min-width: 992px) {
  .h-lg-979px {
    height: 979px;
  }
}
.h-980px {
  height: 980px;
}

@media (min-width: 992px) {
  .h-lg-980px {
    height: 980px;
  }
}
.h-981px {
  height: 981px;
}

@media (min-width: 992px) {
  .h-lg-981px {
    height: 981px;
  }
}
.h-982px {
  height: 982px;
}

@media (min-width: 992px) {
  .h-lg-982px {
    height: 982px;
  }
}
.h-983px {
  height: 983px;
}

@media (min-width: 992px) {
  .h-lg-983px {
    height: 983px;
  }
}
.h-984px {
  height: 984px;
}

@media (min-width: 992px) {
  .h-lg-984px {
    height: 984px;
  }
}
.h-985px {
  height: 985px;
}

@media (min-width: 992px) {
  .h-lg-985px {
    height: 985px;
  }
}
.h-986px {
  height: 986px;
}

@media (min-width: 992px) {
  .h-lg-986px {
    height: 986px;
  }
}
.h-987px {
  height: 987px;
}

@media (min-width: 992px) {
  .h-lg-987px {
    height: 987px;
  }
}
.h-988px {
  height: 988px;
}

@media (min-width: 992px) {
  .h-lg-988px {
    height: 988px;
  }
}
.h-989px {
  height: 989px;
}

@media (min-width: 992px) {
  .h-lg-989px {
    height: 989px;
  }
}
.h-990px {
  height: 990px;
}

@media (min-width: 992px) {
  .h-lg-990px {
    height: 990px;
  }
}
.h-991px {
  height: 991px;
}

@media (min-width: 992px) {
  .h-lg-991px {
    height: 991px;
  }
}
.h-992px {
  height: 992px;
}

@media (min-width: 992px) {
  .h-lg-992px {
    height: 992px;
  }
}
.h-993px {
  height: 993px;
}

@media (min-width: 992px) {
  .h-lg-993px {
    height: 993px;
  }
}
.h-994px {
  height: 994px;
}

@media (min-width: 992px) {
  .h-lg-994px {
    height: 994px;
  }
}
.h-995px {
  height: 995px;
}

@media (min-width: 992px) {
  .h-lg-995px {
    height: 995px;
  }
}
.h-996px {
  height: 996px;
}

@media (min-width: 992px) {
  .h-lg-996px {
    height: 996px;
  }
}
.h-997px {
  height: 997px;
}

@media (min-width: 992px) {
  .h-lg-997px {
    height: 997px;
  }
}
.h-998px {
  height: 998px;
}

@media (min-width: 992px) {
  .h-lg-998px {
    height: 998px;
  }
}
.h-999px {
  height: 999px;
}

@media (min-width: 992px) {
  .h-lg-999px {
    height: 999px;
  }
}
.h-1000px {
  height: 1000px;
}

@media (min-width: 992px) {
  .h-lg-1000px {
    height: 1000px;
  }
}
.w-1px {
  width: 1px;
}

@media (min-width: 768px) {
  .w-md-1px {
    width: 1px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-2px {
  width: 2px;
}

@media (min-width: 768px) {
  .w-md-2px {
    width: 2px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-3px {
  width: 3px;
}

@media (min-width: 768px) {
  .w-md-3px {
    width: 3px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-4px {
  width: 4px;
}

@media (min-width: 768px) {
  .w-md-4px {
    width: 4px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-5px {
  width: 5px;
}

@media (min-width: 768px) {
  .w-md-5px {
    width: 5px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-6px {
  width: 6px;
}

@media (min-width: 768px) {
  .w-md-6px {
    width: 6px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-7px {
  width: 7px;
}

@media (min-width: 768px) {
  .w-md-7px {
    width: 7px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-8px {
  width: 8px;
}

@media (min-width: 768px) {
  .w-md-8px {
    width: 8px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-9px {
  width: 9px;
}

@media (min-width: 768px) {
  .w-md-9px {
    width: 9px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-10px {
  width: 10px;
}

@media (min-width: 768px) {
  .w-md-10px {
    width: 10px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-11px {
  width: 11px;
}

@media (min-width: 768px) {
  .w-md-11px {
    width: 11px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-12px {
  width: 12px;
}

@media (min-width: 768px) {
  .w-md-12px {
    width: 12px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-13px {
  width: 13px;
}

@media (min-width: 768px) {
  .w-md-13px {
    width: 13px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-14px {
  width: 14px;
}

@media (min-width: 768px) {
  .w-md-14px {
    width: 14px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-15px, .header-line:before {
  width: 15px;
}

@media (min-width: 768px) {
  .w-md-15px {
    width: 15px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-16px {
  width: 16px;
}

@media (min-width: 768px) {
  .w-md-16px {
    width: 16px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-17px {
  width: 17px;
}

@media (min-width: 768px) {
  .w-md-17px {
    width: 17px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-18px {
  width: 18px;
}

@media (min-width: 768px) {
  .w-md-18px {
    width: 18px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-19px {
  width: 19px;
}

@media (min-width: 768px) {
  .w-md-19px {
    width: 19px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-20px {
  width: 20px;
}

@media (min-width: 768px) {
  .w-md-20px {
    width: 20px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-21px {
  width: 21px;
}

@media (min-width: 768px) {
  .w-md-21px {
    width: 21px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-22px {
  width: 22px;
}

@media (min-width: 768px) {
  .w-md-22px {
    width: 22px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-23px {
  width: 23px;
}

@media (min-width: 768px) {
  .w-md-23px {
    width: 23px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-24px {
  width: 24px;
}

@media (min-width: 768px) {
  .w-md-24px {
    width: 24px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-25px {
  width: 25px;
}

@media (min-width: 768px) {
  .w-md-25px {
    width: 25px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-26px {
  width: 26px;
}

@media (min-width: 768px) {
  .w-md-26px {
    width: 26px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-27px {
  width: 27px;
}

@media (min-width: 768px) {
  .w-md-27px {
    width: 27px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-28px {
  width: 28px;
}

@media (min-width: 768px) {
  .w-md-28px {
    width: 28px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-29px {
  width: 29px;
}

@media (min-width: 768px) {
  .w-md-29px {
    width: 29px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-30px {
  width: 30px;
}

@media (min-width: 768px) {
  .w-md-30px {
    width: 30px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-31px {
  width: 31px;
}

@media (min-width: 768px) {
  .w-md-31px {
    width: 31px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-32px {
  width: 32px;
}

@media (min-width: 768px) {
  .w-md-32px {
    width: 32px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-33px {
  width: 33px;
}

@media (min-width: 768px) {
  .w-md-33px {
    width: 33px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-34px {
  width: 34px;
}

@media (min-width: 768px) {
  .w-md-34px {
    width: 34px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-35px {
  width: 35px;
}

@media (min-width: 768px) {
  .w-md-35px {
    width: 35px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-36px {
  width: 36px;
}

@media (min-width: 768px) {
  .w-md-36px {
    width: 36px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-37px {
  width: 37px;
}

@media (min-width: 768px) {
  .w-md-37px {
    width: 37px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-38px {
  width: 38px;
}

@media (min-width: 768px) {
  .w-md-38px {
    width: 38px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-39px {
  width: 39px;
}

@media (min-width: 768px) {
  .w-md-39px {
    width: 39px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-40px {
  width: 40px;
}

@media (min-width: 768px) {
  .w-md-40px {
    width: 40px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-41px {
  width: 41px;
}

@media (min-width: 768px) {
  .w-md-41px {
    width: 41px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-42px {
  width: 42px;
}

@media (min-width: 768px) {
  .w-md-42px {
    width: 42px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-43px {
  width: 43px;
}

@media (min-width: 768px) {
  .w-md-43px {
    width: 43px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-44px {
  width: 44px;
}

@media (min-width: 768px) {
  .w-md-44px {
    width: 44px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-45px {
  width: 45px;
}

@media (min-width: 768px) {
  .w-md-45px {
    width: 45px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-46px {
  width: 46px;
}

@media (min-width: 768px) {
  .w-md-46px {
    width: 46px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-47px {
  width: 47px;
}

@media (min-width: 768px) {
  .w-md-47px {
    width: 47px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-48px {
  width: 48px;
}

@media (min-width: 768px) {
  .w-md-48px {
    width: 48px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-49px {
  width: 49px;
}

@media (min-width: 768px) {
  .w-md-49px {
    width: 49px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-50px {
  width: 50px;
}

@media (min-width: 768px) {
  .w-md-50px {
    width: 50px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-51px {
  width: 51px;
}

@media (min-width: 768px) {
  .w-md-51px {
    width: 51px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-52px {
  width: 52px;
}

@media (min-width: 768px) {
  .w-md-52px {
    width: 52px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-53px {
  width: 53px;
}

@media (min-width: 768px) {
  .w-md-53px {
    width: 53px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-54px {
  width: 54px;
}

@media (min-width: 768px) {
  .w-md-54px {
    width: 54px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-55px {
  width: 55px;
}

@media (min-width: 768px) {
  .w-md-55px {
    width: 55px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-56px {
  width: 56px;
}

@media (min-width: 768px) {
  .w-md-56px {
    width: 56px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-57px {
  width: 57px;
}

@media (min-width: 768px) {
  .w-md-57px {
    width: 57px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-58px {
  width: 58px;
}

@media (min-width: 768px) {
  .w-md-58px {
    width: 58px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-59px {
  width: 59px;
}

@media (min-width: 768px) {
  .w-md-59px {
    width: 59px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-60px {
  width: 60px;
}

@media (min-width: 768px) {
  .w-md-60px {
    width: 60px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-61px {
  width: 61px;
}

@media (min-width: 768px) {
  .w-md-61px {
    width: 61px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-62px {
  width: 62px;
}

@media (min-width: 768px) {
  .w-md-62px {
    width: 62px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-63px {
  width: 63px;
}

@media (min-width: 768px) {
  .w-md-63px {
    width: 63px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-64px {
  width: 64px;
}

@media (min-width: 768px) {
  .w-md-64px {
    width: 64px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-65px {
  width: 65px;
}

@media (min-width: 768px) {
  .w-md-65px {
    width: 65px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-66px {
  width: 66px;
}

@media (min-width: 768px) {
  .w-md-66px {
    width: 66px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-67px {
  width: 67px;
}

@media (min-width: 768px) {
  .w-md-67px {
    width: 67px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-68px {
  width: 68px;
}

@media (min-width: 768px) {
  .w-md-68px {
    width: 68px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-69px {
  width: 69px;
}

@media (min-width: 768px) {
  .w-md-69px {
    width: 69px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-70px {
  width: 70px;
}

@media (min-width: 768px) {
  .w-md-70px {
    width: 70px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-71px {
  width: 71px;
}

@media (min-width: 768px) {
  .w-md-71px {
    width: 71px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-72px {
  width: 72px;
}

@media (min-width: 768px) {
  .w-md-72px {
    width: 72px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-73px {
  width: 73px;
}

@media (min-width: 768px) {
  .w-md-73px {
    width: 73px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-74px {
  width: 74px;
}

@media (min-width: 768px) {
  .w-md-74px {
    width: 74px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-75px {
  width: 75px;
}

@media (min-width: 768px) {
  .w-md-75px {
    width: 75px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-76px {
  width: 76px;
}

@media (min-width: 768px) {
  .w-md-76px {
    width: 76px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-77px {
  width: 77px;
}

@media (min-width: 768px) {
  .w-md-77px {
    width: 77px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-78px {
  width: 78px;
}

@media (min-width: 768px) {
  .w-md-78px {
    width: 78px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-79px {
  width: 79px;
}

@media (min-width: 768px) {
  .w-md-79px {
    width: 79px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-80px {
  width: 80px;
}

@media (min-width: 768px) {
  .w-md-80px {
    width: 80px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-81px {
  width: 81px;
}

@media (min-width: 768px) {
  .w-md-81px {
    width: 81px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-82px {
  width: 82px;
}

@media (min-width: 768px) {
  .w-md-82px {
    width: 82px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-83px {
  width: 83px;
}

@media (min-width: 768px) {
  .w-md-83px {
    width: 83px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-84px {
  width: 84px;
}

@media (min-width: 768px) {
  .w-md-84px {
    width: 84px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-85px {
  width: 85px;
}

@media (min-width: 768px) {
  .w-md-85px {
    width: 85px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-86px {
  width: 86px;
}

@media (min-width: 768px) {
  .w-md-86px {
    width: 86px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-87px {
  width: 87px;
}

@media (min-width: 768px) {
  .w-md-87px {
    width: 87px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-88px {
  width: 88px;
}

@media (min-width: 768px) {
  .w-md-88px {
    width: 88px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-89px {
  width: 89px;
}

@media (min-width: 768px) {
  .w-md-89px {
    width: 89px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-90px {
  width: 90px;
}

@media (min-width: 768px) {
  .w-md-90px {
    width: 90px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-91px {
  width: 91px;
}

@media (min-width: 768px) {
  .w-md-91px {
    width: 91px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-92px {
  width: 92px;
}

@media (min-width: 768px) {
  .w-md-92px {
    width: 92px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-93px {
  width: 93px;
}

@media (min-width: 768px) {
  .w-md-93px {
    width: 93px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-94px {
  width: 94px;
}

@media (min-width: 768px) {
  .w-md-94px {
    width: 94px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-95px {
  width: 95px;
}

@media (min-width: 768px) {
  .w-md-95px {
    width: 95px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-96px {
  width: 96px;
}

@media (min-width: 768px) {
  .w-md-96px {
    width: 96px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-97px {
  width: 97px;
}

@media (min-width: 768px) {
  .w-md-97px {
    width: 97px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-98px {
  width: 98px;
}

@media (min-width: 768px) {
  .w-md-98px {
    width: 98px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-99px {
  width: 99px;
}

@media (min-width: 768px) {
  .w-md-99px {
    width: 99px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-100px {
  width: 100px;
}

@media (min-width: 768px) {
  .w-md-100px {
    width: 100px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-101px {
  width: 101px;
}

@media (min-width: 768px) {
  .w-md-101px {
    width: 101px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-102px {
  width: 102px;
}

@media (min-width: 768px) {
  .w-md-102px {
    width: 102px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-103px {
  width: 103px;
}

@media (min-width: 768px) {
  .w-md-103px {
    width: 103px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-104px {
  width: 104px;
}

@media (min-width: 768px) {
  .w-md-104px {
    width: 104px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-105px {
  width: 105px;
}

@media (min-width: 768px) {
  .w-md-105px {
    width: 105px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-106px {
  width: 106px;
}

@media (min-width: 768px) {
  .w-md-106px {
    width: 106px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-107px {
  width: 107px;
}

@media (min-width: 768px) {
  .w-md-107px {
    width: 107px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-108px {
  width: 108px;
}

@media (min-width: 768px) {
  .w-md-108px {
    width: 108px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-109px {
  width: 109px;
}

@media (min-width: 768px) {
  .w-md-109px {
    width: 109px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-110px {
  width: 110px;
}

@media (min-width: 768px) {
  .w-md-110px {
    width: 110px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-111px {
  width: 111px;
}

@media (min-width: 768px) {
  .w-md-111px {
    width: 111px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-112px {
  width: 112px;
}

@media (min-width: 768px) {
  .w-md-112px {
    width: 112px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-113px {
  width: 113px;
}

@media (min-width: 768px) {
  .w-md-113px {
    width: 113px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-114px {
  width: 114px;
}

@media (min-width: 768px) {
  .w-md-114px {
    width: 114px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-115px {
  width: 115px;
}

@media (min-width: 768px) {
  .w-md-115px {
    width: 115px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-116px {
  width: 116px;
}

@media (min-width: 768px) {
  .w-md-116px {
    width: 116px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-117px {
  width: 117px;
}

@media (min-width: 768px) {
  .w-md-117px {
    width: 117px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-118px {
  width: 118px;
}

@media (min-width: 768px) {
  .w-md-118px {
    width: 118px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-119px {
  width: 119px;
}

@media (min-width: 768px) {
  .w-md-119px {
    width: 119px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-120px {
  width: 120px;
}

@media (min-width: 768px) {
  .w-md-120px {
    width: 120px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-121px {
  width: 121px;
}

@media (min-width: 768px) {
  .w-md-121px {
    width: 121px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-122px {
  width: 122px;
}

@media (min-width: 768px) {
  .w-md-122px {
    width: 122px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-123px {
  width: 123px;
}

@media (min-width: 768px) {
  .w-md-123px {
    width: 123px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-124px {
  width: 124px;
}

@media (min-width: 768px) {
  .w-md-124px {
    width: 124px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-125px {
  width: 125px;
}

@media (min-width: 768px) {
  .w-md-125px {
    width: 125px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-126px {
  width: 126px;
}

@media (min-width: 768px) {
  .w-md-126px {
    width: 126px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-127px {
  width: 127px;
}

@media (min-width: 768px) {
  .w-md-127px {
    width: 127px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-128px {
  width: 128px;
}

@media (min-width: 768px) {
  .w-md-128px {
    width: 128px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-129px {
  width: 129px;
}

@media (min-width: 768px) {
  .w-md-129px {
    width: 129px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-130px {
  width: 130px;
}

@media (min-width: 768px) {
  .w-md-130px {
    width: 130px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-131px {
  width: 131px;
}

@media (min-width: 768px) {
  .w-md-131px {
    width: 131px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-132px {
  width: 132px;
}

@media (min-width: 768px) {
  .w-md-132px {
    width: 132px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-133px {
  width: 133px;
}

@media (min-width: 768px) {
  .w-md-133px {
    width: 133px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-134px {
  width: 134px;
}

@media (min-width: 768px) {
  .w-md-134px {
    width: 134px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-135px {
  width: 135px;
}

@media (min-width: 768px) {
  .w-md-135px {
    width: 135px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-136px {
  width: 136px;
}

@media (min-width: 768px) {
  .w-md-136px {
    width: 136px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-137px {
  width: 137px;
}

@media (min-width: 768px) {
  .w-md-137px {
    width: 137px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-138px {
  width: 138px;
}

@media (min-width: 768px) {
  .w-md-138px {
    width: 138px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-139px {
  width: 139px;
}

@media (min-width: 768px) {
  .w-md-139px {
    width: 139px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-140px {
  width: 140px;
}

@media (min-width: 768px) {
  .w-md-140px {
    width: 140px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-141px {
  width: 141px;
}

@media (min-width: 768px) {
  .w-md-141px {
    width: 141px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-142px {
  width: 142px;
}

@media (min-width: 768px) {
  .w-md-142px {
    width: 142px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-143px {
  width: 143px;
}

@media (min-width: 768px) {
  .w-md-143px {
    width: 143px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-144px {
  width: 144px;
}

@media (min-width: 768px) {
  .w-md-144px {
    width: 144px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-145px {
  width: 145px;
}

@media (min-width: 768px) {
  .w-md-145px {
    width: 145px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-146px {
  width: 146px;
}

@media (min-width: 768px) {
  .w-md-146px {
    width: 146px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-147px {
  width: 147px;
}

@media (min-width: 768px) {
  .w-md-147px {
    width: 147px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-148px {
  width: 148px;
}

@media (min-width: 768px) {
  .w-md-148px {
    width: 148px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-149px {
  width: 149px;
}

@media (min-width: 768px) {
  .w-md-149px {
    width: 149px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-150px {
  width: 150px;
}

@media (min-width: 768px) {
  .w-md-150px {
    width: 150px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-151px {
  width: 151px;
}

@media (min-width: 768px) {
  .w-md-151px {
    width: 151px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-152px {
  width: 152px;
}

@media (min-width: 768px) {
  .w-md-152px {
    width: 152px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-153px {
  width: 153px;
}

@media (min-width: 768px) {
  .w-md-153px {
    width: 153px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-154px {
  width: 154px;
}

@media (min-width: 768px) {
  .w-md-154px {
    width: 154px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-155px {
  width: 155px;
}

@media (min-width: 768px) {
  .w-md-155px {
    width: 155px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-156px {
  width: 156px;
}

@media (min-width: 768px) {
  .w-md-156px {
    width: 156px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-157px {
  width: 157px;
}

@media (min-width: 768px) {
  .w-md-157px {
    width: 157px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-158px {
  width: 158px;
}

@media (min-width: 768px) {
  .w-md-158px {
    width: 158px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-159px {
  width: 159px;
}

@media (min-width: 768px) {
  .w-md-159px {
    width: 159px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-160px {
  width: 160px;
}

@media (min-width: 768px) {
  .w-md-160px {
    width: 160px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-161px {
  width: 161px;
}

@media (min-width: 768px) {
  .w-md-161px {
    width: 161px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-162px {
  width: 162px;
}

@media (min-width: 768px) {
  .w-md-162px {
    width: 162px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-163px {
  width: 163px;
}

@media (min-width: 768px) {
  .w-md-163px {
    width: 163px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-164px {
  width: 164px;
}

@media (min-width: 768px) {
  .w-md-164px {
    width: 164px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-165px {
  width: 165px;
}

@media (min-width: 768px) {
  .w-md-165px {
    width: 165px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-166px {
  width: 166px;
}

@media (min-width: 768px) {
  .w-md-166px {
    width: 166px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-167px {
  width: 167px;
}

@media (min-width: 768px) {
  .w-md-167px {
    width: 167px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-168px {
  width: 168px;
}

@media (min-width: 768px) {
  .w-md-168px {
    width: 168px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-169px {
  width: 169px;
}

@media (min-width: 768px) {
  .w-md-169px {
    width: 169px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-170px {
  width: 170px;
}

@media (min-width: 768px) {
  .w-md-170px {
    width: 170px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-171px {
  width: 171px;
}

@media (min-width: 768px) {
  .w-md-171px {
    width: 171px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-172px {
  width: 172px;
}

@media (min-width: 768px) {
  .w-md-172px {
    width: 172px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-173px {
  width: 173px;
}

@media (min-width: 768px) {
  .w-md-173px {
    width: 173px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-174px {
  width: 174px;
}

@media (min-width: 768px) {
  .w-md-174px {
    width: 174px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-175px {
  width: 175px;
}

@media (min-width: 768px) {
  .w-md-175px {
    width: 175px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-176px {
  width: 176px;
}

@media (min-width: 768px) {
  .w-md-176px {
    width: 176px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-177px {
  width: 177px;
}

@media (min-width: 768px) {
  .w-md-177px {
    width: 177px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-178px {
  width: 178px;
}

@media (min-width: 768px) {
  .w-md-178px {
    width: 178px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-179px {
  width: 179px;
}

@media (min-width: 768px) {
  .w-md-179px {
    width: 179px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-180px {
  width: 180px;
}

@media (min-width: 768px) {
  .w-md-180px {
    width: 180px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-181px {
  width: 181px;
}

@media (min-width: 768px) {
  .w-md-181px {
    width: 181px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-182px {
  width: 182px;
}

@media (min-width: 768px) {
  .w-md-182px {
    width: 182px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-183px {
  width: 183px;
}

@media (min-width: 768px) {
  .w-md-183px {
    width: 183px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-184px {
  width: 184px;
}

@media (min-width: 768px) {
  .w-md-184px {
    width: 184px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-185px {
  width: 185px;
}

@media (min-width: 768px) {
  .w-md-185px {
    width: 185px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-186px {
  width: 186px;
}

@media (min-width: 768px) {
  .w-md-186px {
    width: 186px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-187px {
  width: 187px;
}

@media (min-width: 768px) {
  .w-md-187px {
    width: 187px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-188px {
  width: 188px;
}

@media (min-width: 768px) {
  .w-md-188px {
    width: 188px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-189px {
  width: 189px;
}

@media (min-width: 768px) {
  .w-md-189px {
    width: 189px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-190px {
  width: 190px;
}

@media (min-width: 768px) {
  .w-md-190px {
    width: 190px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-191px {
  width: 191px;
}

@media (min-width: 768px) {
  .w-md-191px {
    width: 191px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-192px {
  width: 192px;
}

@media (min-width: 768px) {
  .w-md-192px {
    width: 192px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-193px {
  width: 193px;
}

@media (min-width: 768px) {
  .w-md-193px {
    width: 193px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-194px {
  width: 194px;
}

@media (min-width: 768px) {
  .w-md-194px {
    width: 194px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-195px {
  width: 195px;
}

@media (min-width: 768px) {
  .w-md-195px {
    width: 195px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-196px {
  width: 196px;
}

@media (min-width: 768px) {
  .w-md-196px {
    width: 196px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-197px {
  width: 197px;
}

@media (min-width: 768px) {
  .w-md-197px {
    width: 197px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-198px {
  width: 198px;
}

@media (min-width: 768px) {
  .w-md-198px {
    width: 198px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-199px {
  width: 199px;
}

@media (min-width: 768px) {
  .w-md-199px {
    width: 199px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-200px, .header-line:after {
  width: 200px;
}

@media (min-width: 768px) {
  .w-md-200px {
    width: 200px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-201px {
  width: 201px;
}

@media (min-width: 768px) {
  .w-md-201px {
    width: 201px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-202px {
  width: 202px;
}

@media (min-width: 768px) {
  .w-md-202px {
    width: 202px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-203px {
  width: 203px;
}

@media (min-width: 768px) {
  .w-md-203px {
    width: 203px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-204px {
  width: 204px;
}

@media (min-width: 768px) {
  .w-md-204px {
    width: 204px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-205px {
  width: 205px;
}

@media (min-width: 768px) {
  .w-md-205px {
    width: 205px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-206px {
  width: 206px;
}

@media (min-width: 768px) {
  .w-md-206px {
    width: 206px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-207px {
  width: 207px;
}

@media (min-width: 768px) {
  .w-md-207px {
    width: 207px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-208px {
  width: 208px;
}

@media (min-width: 768px) {
  .w-md-208px {
    width: 208px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-209px {
  width: 209px;
}

@media (min-width: 768px) {
  .w-md-209px {
    width: 209px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-210px {
  width: 210px;
}

@media (min-width: 768px) {
  .w-md-210px {
    width: 210px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-211px {
  width: 211px;
}

@media (min-width: 768px) {
  .w-md-211px {
    width: 211px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-212px {
  width: 212px;
}

@media (min-width: 768px) {
  .w-md-212px {
    width: 212px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-213px {
  width: 213px;
}

@media (min-width: 768px) {
  .w-md-213px {
    width: 213px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-214px {
  width: 214px;
}

@media (min-width: 768px) {
  .w-md-214px {
    width: 214px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-215px {
  width: 215px;
}

@media (min-width: 768px) {
  .w-md-215px {
    width: 215px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-216px {
  width: 216px;
}

@media (min-width: 768px) {
  .w-md-216px {
    width: 216px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-217px {
  width: 217px;
}

@media (min-width: 768px) {
  .w-md-217px {
    width: 217px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-218px {
  width: 218px;
}

@media (min-width: 768px) {
  .w-md-218px {
    width: 218px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-219px {
  width: 219px;
}

@media (min-width: 768px) {
  .w-md-219px {
    width: 219px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-220px {
  width: 220px;
}

@media (min-width: 768px) {
  .w-md-220px {
    width: 220px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-221px {
  width: 221px;
}

@media (min-width: 768px) {
  .w-md-221px {
    width: 221px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-222px {
  width: 222px;
}

@media (min-width: 768px) {
  .w-md-222px {
    width: 222px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-223px {
  width: 223px;
}

@media (min-width: 768px) {
  .w-md-223px {
    width: 223px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-224px {
  width: 224px;
}

@media (min-width: 768px) {
  .w-md-224px {
    width: 224px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-225px {
  width: 225px;
}

@media (min-width: 768px) {
  .w-md-225px {
    width: 225px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-226px {
  width: 226px;
}

@media (min-width: 768px) {
  .w-md-226px {
    width: 226px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-227px {
  width: 227px;
}

@media (min-width: 768px) {
  .w-md-227px {
    width: 227px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-228px {
  width: 228px;
}

@media (min-width: 768px) {
  .w-md-228px {
    width: 228px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-229px {
  width: 229px;
}

@media (min-width: 768px) {
  .w-md-229px {
    width: 229px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-230px {
  width: 230px;
}

@media (min-width: 768px) {
  .w-md-230px {
    width: 230px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-231px {
  width: 231px;
}

@media (min-width: 768px) {
  .w-md-231px {
    width: 231px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-232px {
  width: 232px;
}

@media (min-width: 768px) {
  .w-md-232px {
    width: 232px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-233px {
  width: 233px;
}

@media (min-width: 768px) {
  .w-md-233px {
    width: 233px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-234px {
  width: 234px;
}

@media (min-width: 768px) {
  .w-md-234px {
    width: 234px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-235px {
  width: 235px;
}

@media (min-width: 768px) {
  .w-md-235px {
    width: 235px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-236px {
  width: 236px;
}

@media (min-width: 768px) {
  .w-md-236px {
    width: 236px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-237px {
  width: 237px;
}

@media (min-width: 768px) {
  .w-md-237px {
    width: 237px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-238px {
  width: 238px;
}

@media (min-width: 768px) {
  .w-md-238px {
    width: 238px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-239px {
  width: 239px;
}

@media (min-width: 768px) {
  .w-md-239px {
    width: 239px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-240px {
  width: 240px;
}

@media (min-width: 768px) {
  .w-md-240px {
    width: 240px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-241px {
  width: 241px;
}

@media (min-width: 768px) {
  .w-md-241px {
    width: 241px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-242px {
  width: 242px;
}

@media (min-width: 768px) {
  .w-md-242px {
    width: 242px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-243px {
  width: 243px;
}

@media (min-width: 768px) {
  .w-md-243px {
    width: 243px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-244px {
  width: 244px;
}

@media (min-width: 768px) {
  .w-md-244px {
    width: 244px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-245px {
  width: 245px;
}

@media (min-width: 768px) {
  .w-md-245px {
    width: 245px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-246px {
  width: 246px;
}

@media (min-width: 768px) {
  .w-md-246px {
    width: 246px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-247px {
  width: 247px;
}

@media (min-width: 768px) {
  .w-md-247px {
    width: 247px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-248px {
  width: 248px;
}

@media (min-width: 768px) {
  .w-md-248px {
    width: 248px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-249px {
  width: 249px;
}

@media (min-width: 768px) {
  .w-md-249px {
    width: 249px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-250px {
  width: 250px;
}

@media (min-width: 768px) {
  .w-md-250px {
    width: 250px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-251px {
  width: 251px;
}

@media (min-width: 768px) {
  .w-md-251px {
    width: 251px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-252px {
  width: 252px;
}

@media (min-width: 768px) {
  .w-md-252px {
    width: 252px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-253px {
  width: 253px;
}

@media (min-width: 768px) {
  .w-md-253px {
    width: 253px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-254px {
  width: 254px;
}

@media (min-width: 768px) {
  .w-md-254px {
    width: 254px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-255px {
  width: 255px;
}

@media (min-width: 768px) {
  .w-md-255px {
    width: 255px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-256px {
  width: 256px;
}

@media (min-width: 768px) {
  .w-md-256px {
    width: 256px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-257px {
  width: 257px;
}

@media (min-width: 768px) {
  .w-md-257px {
    width: 257px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-258px {
  width: 258px;
}

@media (min-width: 768px) {
  .w-md-258px {
    width: 258px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-259px {
  width: 259px;
}

@media (min-width: 768px) {
  .w-md-259px {
    width: 259px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-260px {
  width: 260px;
}

@media (min-width: 768px) {
  .w-md-260px {
    width: 260px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-261px {
  width: 261px;
}

@media (min-width: 768px) {
  .w-md-261px {
    width: 261px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-262px {
  width: 262px;
}

@media (min-width: 768px) {
  .w-md-262px {
    width: 262px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-263px {
  width: 263px;
}

@media (min-width: 768px) {
  .w-md-263px {
    width: 263px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-264px {
  width: 264px;
}

@media (min-width: 768px) {
  .w-md-264px {
    width: 264px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-265px {
  width: 265px;
}

@media (min-width: 768px) {
  .w-md-265px {
    width: 265px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-266px {
  width: 266px;
}

@media (min-width: 768px) {
  .w-md-266px {
    width: 266px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-267px {
  width: 267px;
}

@media (min-width: 768px) {
  .w-md-267px {
    width: 267px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-268px {
  width: 268px;
}

@media (min-width: 768px) {
  .w-md-268px {
    width: 268px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-269px {
  width: 269px;
}

@media (min-width: 768px) {
  .w-md-269px {
    width: 269px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-270px {
  width: 270px;
}

@media (min-width: 768px) {
  .w-md-270px {
    width: 270px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-271px {
  width: 271px;
}

@media (min-width: 768px) {
  .w-md-271px {
    width: 271px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-272px {
  width: 272px;
}

@media (min-width: 768px) {
  .w-md-272px {
    width: 272px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-273px {
  width: 273px;
}

@media (min-width: 768px) {
  .w-md-273px {
    width: 273px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-274px {
  width: 274px;
}

@media (min-width: 768px) {
  .w-md-274px {
    width: 274px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-275px {
  width: 275px;
}

@media (min-width: 768px) {
  .w-md-275px {
    width: 275px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-276px {
  width: 276px;
}

@media (min-width: 768px) {
  .w-md-276px {
    width: 276px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-277px {
  width: 277px;
}

@media (min-width: 768px) {
  .w-md-277px {
    width: 277px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-278px {
  width: 278px;
}

@media (min-width: 768px) {
  .w-md-278px {
    width: 278px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-279px {
  width: 279px;
}

@media (min-width: 768px) {
  .w-md-279px {
    width: 279px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-280px {
  width: 280px;
}

@media (min-width: 768px) {
  .w-md-280px {
    width: 280px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-281px {
  width: 281px;
}

@media (min-width: 768px) {
  .w-md-281px {
    width: 281px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-282px {
  width: 282px;
}

@media (min-width: 768px) {
  .w-md-282px {
    width: 282px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-283px {
  width: 283px;
}

@media (min-width: 768px) {
  .w-md-283px {
    width: 283px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-284px {
  width: 284px;
}

@media (min-width: 768px) {
  .w-md-284px {
    width: 284px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-285px {
  width: 285px;
}

@media (min-width: 768px) {
  .w-md-285px {
    width: 285px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-286px {
  width: 286px;
}

@media (min-width: 768px) {
  .w-md-286px {
    width: 286px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-287px {
  width: 287px;
}

@media (min-width: 768px) {
  .w-md-287px {
    width: 287px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-288px {
  width: 288px;
}

@media (min-width: 768px) {
  .w-md-288px {
    width: 288px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-289px {
  width: 289px;
}

@media (min-width: 768px) {
  .w-md-289px {
    width: 289px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-290px {
  width: 290px;
}

@media (min-width: 768px) {
  .w-md-290px {
    width: 290px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-291px {
  width: 291px;
}

@media (min-width: 768px) {
  .w-md-291px {
    width: 291px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-292px {
  width: 292px;
}

@media (min-width: 768px) {
  .w-md-292px {
    width: 292px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-293px {
  width: 293px;
}

@media (min-width: 768px) {
  .w-md-293px {
    width: 293px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-294px {
  width: 294px;
}

@media (min-width: 768px) {
  .w-md-294px {
    width: 294px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-295px {
  width: 295px;
}

@media (min-width: 768px) {
  .w-md-295px {
    width: 295px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-296px {
  width: 296px;
}

@media (min-width: 768px) {
  .w-md-296px {
    width: 296px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-297px {
  width: 297px;
}

@media (min-width: 768px) {
  .w-md-297px {
    width: 297px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-298px {
  width: 298px;
}

@media (min-width: 768px) {
  .w-md-298px {
    width: 298px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-299px {
  width: 299px;
}

@media (min-width: 768px) {
  .w-md-299px {
    width: 299px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-300px {
  width: 300px;
}

@media (min-width: 768px) {
  .w-md-300px {
    width: 300px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-301px {
  width: 301px;
}

@media (min-width: 768px) {
  .w-md-301px {
    width: 301px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-302px {
  width: 302px;
}

@media (min-width: 768px) {
  .w-md-302px {
    width: 302px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-303px {
  width: 303px;
}

@media (min-width: 768px) {
  .w-md-303px {
    width: 303px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-304px {
  width: 304px;
}

@media (min-width: 768px) {
  .w-md-304px {
    width: 304px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-305px {
  width: 305px;
}

@media (min-width: 768px) {
  .w-md-305px {
    width: 305px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-306px {
  width: 306px;
}

@media (min-width: 768px) {
  .w-md-306px {
    width: 306px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-307px {
  width: 307px;
}

@media (min-width: 768px) {
  .w-md-307px {
    width: 307px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-308px {
  width: 308px;
}

@media (min-width: 768px) {
  .w-md-308px {
    width: 308px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-309px {
  width: 309px;
}

@media (min-width: 768px) {
  .w-md-309px {
    width: 309px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-310px {
  width: 310px;
}

@media (min-width: 768px) {
  .w-md-310px {
    width: 310px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-311px {
  width: 311px;
}

@media (min-width: 768px) {
  .w-md-311px {
    width: 311px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-312px {
  width: 312px;
}

@media (min-width: 768px) {
  .w-md-312px {
    width: 312px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-313px {
  width: 313px;
}

@media (min-width: 768px) {
  .w-md-313px {
    width: 313px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-314px {
  width: 314px;
}

@media (min-width: 768px) {
  .w-md-314px {
    width: 314px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-315px {
  width: 315px;
}

@media (min-width: 768px) {
  .w-md-315px {
    width: 315px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-316px {
  width: 316px;
}

@media (min-width: 768px) {
  .w-md-316px {
    width: 316px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-317px {
  width: 317px;
}

@media (min-width: 768px) {
  .w-md-317px {
    width: 317px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-318px {
  width: 318px;
}

@media (min-width: 768px) {
  .w-md-318px {
    width: 318px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-319px {
  width: 319px;
}

@media (min-width: 768px) {
  .w-md-319px {
    width: 319px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-320px {
  width: 320px;
}

@media (min-width: 768px) {
  .w-md-320px {
    width: 320px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-321px {
  width: 321px;
}

@media (min-width: 768px) {
  .w-md-321px {
    width: 321px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-322px {
  width: 322px;
}

@media (min-width: 768px) {
  .w-md-322px {
    width: 322px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-323px {
  width: 323px;
}

@media (min-width: 768px) {
  .w-md-323px {
    width: 323px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-324px {
  width: 324px;
}

@media (min-width: 768px) {
  .w-md-324px {
    width: 324px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-325px {
  width: 325px;
}

@media (min-width: 768px) {
  .w-md-325px {
    width: 325px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-326px {
  width: 326px;
}

@media (min-width: 768px) {
  .w-md-326px {
    width: 326px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-327px {
  width: 327px;
}

@media (min-width: 768px) {
  .w-md-327px {
    width: 327px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-328px {
  width: 328px;
}

@media (min-width: 768px) {
  .w-md-328px {
    width: 328px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-329px {
  width: 329px;
}

@media (min-width: 768px) {
  .w-md-329px {
    width: 329px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-330px {
  width: 330px;
}

@media (min-width: 768px) {
  .w-md-330px {
    width: 330px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-331px {
  width: 331px;
}

@media (min-width: 768px) {
  .w-md-331px {
    width: 331px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-332px {
  width: 332px;
}

@media (min-width: 768px) {
  .w-md-332px {
    width: 332px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-333px {
  width: 333px;
}

@media (min-width: 768px) {
  .w-md-333px {
    width: 333px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-334px {
  width: 334px;
}

@media (min-width: 768px) {
  .w-md-334px {
    width: 334px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-335px {
  width: 335px;
}

@media (min-width: 768px) {
  .w-md-335px {
    width: 335px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-336px {
  width: 336px;
}

@media (min-width: 768px) {
  .w-md-336px {
    width: 336px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-337px {
  width: 337px;
}

@media (min-width: 768px) {
  .w-md-337px {
    width: 337px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-338px {
  width: 338px;
}

@media (min-width: 768px) {
  .w-md-338px {
    width: 338px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-339px {
  width: 339px;
}

@media (min-width: 768px) {
  .w-md-339px {
    width: 339px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-340px {
  width: 340px;
}

@media (min-width: 768px) {
  .w-md-340px {
    width: 340px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-341px {
  width: 341px;
}

@media (min-width: 768px) {
  .w-md-341px {
    width: 341px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-342px {
  width: 342px;
}

@media (min-width: 768px) {
  .w-md-342px {
    width: 342px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-343px {
  width: 343px;
}

@media (min-width: 768px) {
  .w-md-343px {
    width: 343px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-344px {
  width: 344px;
}

@media (min-width: 768px) {
  .w-md-344px {
    width: 344px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-345px {
  width: 345px;
}

@media (min-width: 768px) {
  .w-md-345px {
    width: 345px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-346px {
  width: 346px;
}

@media (min-width: 768px) {
  .w-md-346px {
    width: 346px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-347px {
  width: 347px;
}

@media (min-width: 768px) {
  .w-md-347px {
    width: 347px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-348px {
  width: 348px;
}

@media (min-width: 768px) {
  .w-md-348px {
    width: 348px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-349px {
  width: 349px;
}

@media (min-width: 768px) {
  .w-md-349px {
    width: 349px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-350px {
  width: 350px;
}

@media (min-width: 768px) {
  .w-md-350px {
    width: 350px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-351px {
  width: 351px;
}

@media (min-width: 768px) {
  .w-md-351px {
    width: 351px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-352px {
  width: 352px;
}

@media (min-width: 768px) {
  .w-md-352px {
    width: 352px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-353px {
  width: 353px;
}

@media (min-width: 768px) {
  .w-md-353px {
    width: 353px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-354px {
  width: 354px;
}

@media (min-width: 768px) {
  .w-md-354px {
    width: 354px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-355px {
  width: 355px;
}

@media (min-width: 768px) {
  .w-md-355px {
    width: 355px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-356px {
  width: 356px;
}

@media (min-width: 768px) {
  .w-md-356px {
    width: 356px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-357px {
  width: 357px;
}

@media (min-width: 768px) {
  .w-md-357px {
    width: 357px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-358px {
  width: 358px;
}

@media (min-width: 768px) {
  .w-md-358px {
    width: 358px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-359px {
  width: 359px;
}

@media (min-width: 768px) {
  .w-md-359px {
    width: 359px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-360px {
  width: 360px;
}

@media (min-width: 768px) {
  .w-md-360px {
    width: 360px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-361px {
  width: 361px;
}

@media (min-width: 768px) {
  .w-md-361px {
    width: 361px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-362px {
  width: 362px;
}

@media (min-width: 768px) {
  .w-md-362px {
    width: 362px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-363px {
  width: 363px;
}

@media (min-width: 768px) {
  .w-md-363px {
    width: 363px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-364px {
  width: 364px;
}

@media (min-width: 768px) {
  .w-md-364px {
    width: 364px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-365px {
  width: 365px;
}

@media (min-width: 768px) {
  .w-md-365px {
    width: 365px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-366px {
  width: 366px;
}

@media (min-width: 768px) {
  .w-md-366px {
    width: 366px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-367px {
  width: 367px;
}

@media (min-width: 768px) {
  .w-md-367px {
    width: 367px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-368px {
  width: 368px;
}

@media (min-width: 768px) {
  .w-md-368px {
    width: 368px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-369px {
  width: 369px;
}

@media (min-width: 768px) {
  .w-md-369px {
    width: 369px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-370px {
  width: 370px;
}

@media (min-width: 768px) {
  .w-md-370px {
    width: 370px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-371px {
  width: 371px;
}

@media (min-width: 768px) {
  .w-md-371px {
    width: 371px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-372px {
  width: 372px;
}

@media (min-width: 768px) {
  .w-md-372px {
    width: 372px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-373px {
  width: 373px;
}

@media (min-width: 768px) {
  .w-md-373px {
    width: 373px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-374px {
  width: 374px;
}

@media (min-width: 768px) {
  .w-md-374px {
    width: 374px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-375px {
  width: 375px;
}

@media (min-width: 768px) {
  .w-md-375px {
    width: 375px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-376px {
  width: 376px;
}

@media (min-width: 768px) {
  .w-md-376px {
    width: 376px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-377px {
  width: 377px;
}

@media (min-width: 768px) {
  .w-md-377px {
    width: 377px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-378px {
  width: 378px;
}

@media (min-width: 768px) {
  .w-md-378px {
    width: 378px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-379px {
  width: 379px;
}

@media (min-width: 768px) {
  .w-md-379px {
    width: 379px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-380px {
  width: 380px;
}

@media (min-width: 768px) {
  .w-md-380px {
    width: 380px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-381px {
  width: 381px;
}

@media (min-width: 768px) {
  .w-md-381px {
    width: 381px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-382px {
  width: 382px;
}

@media (min-width: 768px) {
  .w-md-382px {
    width: 382px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-383px {
  width: 383px;
}

@media (min-width: 768px) {
  .w-md-383px {
    width: 383px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-384px {
  width: 384px;
}

@media (min-width: 768px) {
  .w-md-384px {
    width: 384px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-385px {
  width: 385px;
}

@media (min-width: 768px) {
  .w-md-385px {
    width: 385px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-386px {
  width: 386px;
}

@media (min-width: 768px) {
  .w-md-386px {
    width: 386px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-387px {
  width: 387px;
}

@media (min-width: 768px) {
  .w-md-387px {
    width: 387px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-388px {
  width: 388px;
}

@media (min-width: 768px) {
  .w-md-388px {
    width: 388px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-389px {
  width: 389px;
}

@media (min-width: 768px) {
  .w-md-389px {
    width: 389px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-390px {
  width: 390px;
}

@media (min-width: 768px) {
  .w-md-390px {
    width: 390px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-391px {
  width: 391px;
}

@media (min-width: 768px) {
  .w-md-391px {
    width: 391px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-392px {
  width: 392px;
}

@media (min-width: 768px) {
  .w-md-392px {
    width: 392px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-393px {
  width: 393px;
}

@media (min-width: 768px) {
  .w-md-393px {
    width: 393px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-394px {
  width: 394px;
}

@media (min-width: 768px) {
  .w-md-394px {
    width: 394px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-395px {
  width: 395px;
}

@media (min-width: 768px) {
  .w-md-395px {
    width: 395px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-396px {
  width: 396px;
}

@media (min-width: 768px) {
  .w-md-396px {
    width: 396px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-397px {
  width: 397px;
}

@media (min-width: 768px) {
  .w-md-397px {
    width: 397px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-398px {
  width: 398px;
}

@media (min-width: 768px) {
  .w-md-398px {
    width: 398px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-399px {
  width: 399px;
}

@media (min-width: 768px) {
  .w-md-399px {
    width: 399px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-400px {
  width: 400px;
}

@media (min-width: 768px) {
  .w-md-400px {
    width: 400px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-401px {
  width: 401px;
}

@media (min-width: 768px) {
  .w-md-401px {
    width: 401px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-402px {
  width: 402px;
}

@media (min-width: 768px) {
  .w-md-402px {
    width: 402px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-403px {
  width: 403px;
}

@media (min-width: 768px) {
  .w-md-403px {
    width: 403px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-404px {
  width: 404px;
}

@media (min-width: 768px) {
  .w-md-404px {
    width: 404px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-405px {
  width: 405px;
}

@media (min-width: 768px) {
  .w-md-405px {
    width: 405px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-406px {
  width: 406px;
}

@media (min-width: 768px) {
  .w-md-406px {
    width: 406px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-407px {
  width: 407px;
}

@media (min-width: 768px) {
  .w-md-407px {
    width: 407px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-408px {
  width: 408px;
}

@media (min-width: 768px) {
  .w-md-408px {
    width: 408px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-409px {
  width: 409px;
}

@media (min-width: 768px) {
  .w-md-409px {
    width: 409px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-410px {
  width: 410px;
}

@media (min-width: 768px) {
  .w-md-410px {
    width: 410px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-411px {
  width: 411px;
}

@media (min-width: 768px) {
  .w-md-411px {
    width: 411px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-412px {
  width: 412px;
}

@media (min-width: 768px) {
  .w-md-412px {
    width: 412px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-413px {
  width: 413px;
}

@media (min-width: 768px) {
  .w-md-413px {
    width: 413px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-414px {
  width: 414px;
}

@media (min-width: 768px) {
  .w-md-414px {
    width: 414px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-415px {
  width: 415px;
}

@media (min-width: 768px) {
  .w-md-415px {
    width: 415px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-416px {
  width: 416px;
}

@media (min-width: 768px) {
  .w-md-416px {
    width: 416px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-417px {
  width: 417px;
}

@media (min-width: 768px) {
  .w-md-417px {
    width: 417px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-418px {
  width: 418px;
}

@media (min-width: 768px) {
  .w-md-418px {
    width: 418px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-419px {
  width: 419px;
}

@media (min-width: 768px) {
  .w-md-419px {
    width: 419px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-420px {
  width: 420px;
}

@media (min-width: 768px) {
  .w-md-420px {
    width: 420px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-421px {
  width: 421px;
}

@media (min-width: 768px) {
  .w-md-421px {
    width: 421px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-422px {
  width: 422px;
}

@media (min-width: 768px) {
  .w-md-422px {
    width: 422px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-423px {
  width: 423px;
}

@media (min-width: 768px) {
  .w-md-423px {
    width: 423px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-424px {
  width: 424px;
}

@media (min-width: 768px) {
  .w-md-424px {
    width: 424px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-425px {
  width: 425px;
}

@media (min-width: 768px) {
  .w-md-425px {
    width: 425px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-426px {
  width: 426px;
}

@media (min-width: 768px) {
  .w-md-426px {
    width: 426px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-427px {
  width: 427px;
}

@media (min-width: 768px) {
  .w-md-427px {
    width: 427px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-428px {
  width: 428px;
}

@media (min-width: 768px) {
  .w-md-428px {
    width: 428px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-429px {
  width: 429px;
}

@media (min-width: 768px) {
  .w-md-429px {
    width: 429px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-430px {
  width: 430px;
}

@media (min-width: 768px) {
  .w-md-430px {
    width: 430px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-431px {
  width: 431px;
}

@media (min-width: 768px) {
  .w-md-431px {
    width: 431px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-432px {
  width: 432px;
}

@media (min-width: 768px) {
  .w-md-432px {
    width: 432px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-433px {
  width: 433px;
}

@media (min-width: 768px) {
  .w-md-433px {
    width: 433px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-434px {
  width: 434px;
}

@media (min-width: 768px) {
  .w-md-434px {
    width: 434px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-435px {
  width: 435px;
}

@media (min-width: 768px) {
  .w-md-435px {
    width: 435px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-436px {
  width: 436px;
}

@media (min-width: 768px) {
  .w-md-436px {
    width: 436px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-437px {
  width: 437px;
}

@media (min-width: 768px) {
  .w-md-437px {
    width: 437px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-438px {
  width: 438px;
}

@media (min-width: 768px) {
  .w-md-438px {
    width: 438px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-439px {
  width: 439px;
}

@media (min-width: 768px) {
  .w-md-439px {
    width: 439px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-440px {
  width: 440px;
}

@media (min-width: 768px) {
  .w-md-440px {
    width: 440px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-441px {
  width: 441px;
}

@media (min-width: 768px) {
  .w-md-441px {
    width: 441px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-442px {
  width: 442px;
}

@media (min-width: 768px) {
  .w-md-442px {
    width: 442px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-443px {
  width: 443px;
}

@media (min-width: 768px) {
  .w-md-443px {
    width: 443px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-444px {
  width: 444px;
}

@media (min-width: 768px) {
  .w-md-444px {
    width: 444px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-445px {
  width: 445px;
}

@media (min-width: 768px) {
  .w-md-445px {
    width: 445px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-446px {
  width: 446px;
}

@media (min-width: 768px) {
  .w-md-446px {
    width: 446px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-447px {
  width: 447px;
}

@media (min-width: 768px) {
  .w-md-447px {
    width: 447px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-448px {
  width: 448px;
}

@media (min-width: 768px) {
  .w-md-448px {
    width: 448px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-449px {
  width: 449px;
}

@media (min-width: 768px) {
  .w-md-449px {
    width: 449px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-450px {
  width: 450px;
}

@media (min-width: 768px) {
  .w-md-450px {
    width: 450px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-451px {
  width: 451px;
}

@media (min-width: 768px) {
  .w-md-451px {
    width: 451px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-452px {
  width: 452px;
}

@media (min-width: 768px) {
  .w-md-452px {
    width: 452px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-453px {
  width: 453px;
}

@media (min-width: 768px) {
  .w-md-453px {
    width: 453px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-454px {
  width: 454px;
}

@media (min-width: 768px) {
  .w-md-454px {
    width: 454px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-455px {
  width: 455px;
}

@media (min-width: 768px) {
  .w-md-455px {
    width: 455px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-456px {
  width: 456px;
}

@media (min-width: 768px) {
  .w-md-456px {
    width: 456px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-457px {
  width: 457px;
}

@media (min-width: 768px) {
  .w-md-457px {
    width: 457px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-458px {
  width: 458px;
}

@media (min-width: 768px) {
  .w-md-458px {
    width: 458px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-459px {
  width: 459px;
}

@media (min-width: 768px) {
  .w-md-459px {
    width: 459px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-460px {
  width: 460px;
}

@media (min-width: 768px) {
  .w-md-460px {
    width: 460px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-461px {
  width: 461px;
}

@media (min-width: 768px) {
  .w-md-461px {
    width: 461px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-462px {
  width: 462px;
}

@media (min-width: 768px) {
  .w-md-462px {
    width: 462px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-463px {
  width: 463px;
}

@media (min-width: 768px) {
  .w-md-463px {
    width: 463px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-464px {
  width: 464px;
}

@media (min-width: 768px) {
  .w-md-464px {
    width: 464px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-465px {
  width: 465px;
}

@media (min-width: 768px) {
  .w-md-465px {
    width: 465px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-466px {
  width: 466px;
}

@media (min-width: 768px) {
  .w-md-466px {
    width: 466px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-467px {
  width: 467px;
}

@media (min-width: 768px) {
  .w-md-467px {
    width: 467px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-468px {
  width: 468px;
}

@media (min-width: 768px) {
  .w-md-468px {
    width: 468px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-469px {
  width: 469px;
}

@media (min-width: 768px) {
  .w-md-469px {
    width: 469px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-470px {
  width: 470px;
}

@media (min-width: 768px) {
  .w-md-470px {
    width: 470px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-471px {
  width: 471px;
}

@media (min-width: 768px) {
  .w-md-471px {
    width: 471px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-472px {
  width: 472px;
}

@media (min-width: 768px) {
  .w-md-472px {
    width: 472px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-473px {
  width: 473px;
}

@media (min-width: 768px) {
  .w-md-473px {
    width: 473px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-474px {
  width: 474px;
}

@media (min-width: 768px) {
  .w-md-474px {
    width: 474px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-475px {
  width: 475px;
}

@media (min-width: 768px) {
  .w-md-475px {
    width: 475px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-476px {
  width: 476px;
}

@media (min-width: 768px) {
  .w-md-476px {
    width: 476px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-477px {
  width: 477px;
}

@media (min-width: 768px) {
  .w-md-477px {
    width: 477px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-478px {
  width: 478px;
}

@media (min-width: 768px) {
  .w-md-478px {
    width: 478px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-479px {
  width: 479px;
}

@media (min-width: 768px) {
  .w-md-479px {
    width: 479px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-480px {
  width: 480px;
}

@media (min-width: 768px) {
  .w-md-480px {
    width: 480px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-481px {
  width: 481px;
}

@media (min-width: 768px) {
  .w-md-481px {
    width: 481px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-482px {
  width: 482px;
}

@media (min-width: 768px) {
  .w-md-482px {
    width: 482px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-483px {
  width: 483px;
}

@media (min-width: 768px) {
  .w-md-483px {
    width: 483px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-484px {
  width: 484px;
}

@media (min-width: 768px) {
  .w-md-484px {
    width: 484px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-485px {
  width: 485px;
}

@media (min-width: 768px) {
  .w-md-485px {
    width: 485px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-486px {
  width: 486px;
}

@media (min-width: 768px) {
  .w-md-486px {
    width: 486px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-487px {
  width: 487px;
}

@media (min-width: 768px) {
  .w-md-487px {
    width: 487px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-488px {
  width: 488px;
}

@media (min-width: 768px) {
  .w-md-488px {
    width: 488px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-489px {
  width: 489px;
}

@media (min-width: 768px) {
  .w-md-489px {
    width: 489px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-490px {
  width: 490px;
}

@media (min-width: 768px) {
  .w-md-490px {
    width: 490px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-491px {
  width: 491px;
}

@media (min-width: 768px) {
  .w-md-491px {
    width: 491px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-492px {
  width: 492px;
}

@media (min-width: 768px) {
  .w-md-492px {
    width: 492px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-493px {
  width: 493px;
}

@media (min-width: 768px) {
  .w-md-493px {
    width: 493px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-494px {
  width: 494px;
}

@media (min-width: 768px) {
  .w-md-494px {
    width: 494px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-495px {
  width: 495px;
}

@media (min-width: 768px) {
  .w-md-495px {
    width: 495px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-496px {
  width: 496px;
}

@media (min-width: 768px) {
  .w-md-496px {
    width: 496px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-497px {
  width: 497px;
}

@media (min-width: 768px) {
  .w-md-497px {
    width: 497px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-498px {
  width: 498px;
}

@media (min-width: 768px) {
  .w-md-498px {
    width: 498px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-499px {
  width: 499px;
}

@media (min-width: 768px) {
  .w-md-499px {
    width: 499px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-500px {
  width: 500px;
}

@media (min-width: 768px) {
  .w-md-500px {
    width: 500px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-501px {
  width: 501px;
}

@media (min-width: 768px) {
  .w-md-501px {
    width: 501px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-502px {
  width: 502px;
}

@media (min-width: 768px) {
  .w-md-502px {
    width: 502px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-503px {
  width: 503px;
}

@media (min-width: 768px) {
  .w-md-503px {
    width: 503px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-504px {
  width: 504px;
}

@media (min-width: 768px) {
  .w-md-504px {
    width: 504px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-505px {
  width: 505px;
}

@media (min-width: 768px) {
  .w-md-505px {
    width: 505px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-506px {
  width: 506px;
}

@media (min-width: 768px) {
  .w-md-506px {
    width: 506px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-507px {
  width: 507px;
}

@media (min-width: 768px) {
  .w-md-507px {
    width: 507px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-508px {
  width: 508px;
}

@media (min-width: 768px) {
  .w-md-508px {
    width: 508px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-509px {
  width: 509px;
}

@media (min-width: 768px) {
  .w-md-509px {
    width: 509px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-510px {
  width: 510px;
}

@media (min-width: 768px) {
  .w-md-510px {
    width: 510px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-511px {
  width: 511px;
}

@media (min-width: 768px) {
  .w-md-511px {
    width: 511px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-512px {
  width: 512px;
}

@media (min-width: 768px) {
  .w-md-512px {
    width: 512px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-513px {
  width: 513px;
}

@media (min-width: 768px) {
  .w-md-513px {
    width: 513px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-514px {
  width: 514px;
}

@media (min-width: 768px) {
  .w-md-514px {
    width: 514px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-515px {
  width: 515px;
}

@media (min-width: 768px) {
  .w-md-515px {
    width: 515px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-516px {
  width: 516px;
}

@media (min-width: 768px) {
  .w-md-516px {
    width: 516px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-517px {
  width: 517px;
}

@media (min-width: 768px) {
  .w-md-517px {
    width: 517px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-518px {
  width: 518px;
}

@media (min-width: 768px) {
  .w-md-518px {
    width: 518px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-519px {
  width: 519px;
}

@media (min-width: 768px) {
  .w-md-519px {
    width: 519px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-520px {
  width: 520px;
}

@media (min-width: 768px) {
  .w-md-520px {
    width: 520px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-521px {
  width: 521px;
}

@media (min-width: 768px) {
  .w-md-521px {
    width: 521px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-522px {
  width: 522px;
}

@media (min-width: 768px) {
  .w-md-522px {
    width: 522px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-523px {
  width: 523px;
}

@media (min-width: 768px) {
  .w-md-523px {
    width: 523px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-524px {
  width: 524px;
}

@media (min-width: 768px) {
  .w-md-524px {
    width: 524px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-525px {
  width: 525px;
}

@media (min-width: 768px) {
  .w-md-525px {
    width: 525px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-526px {
  width: 526px;
}

@media (min-width: 768px) {
  .w-md-526px {
    width: 526px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-527px {
  width: 527px;
}

@media (min-width: 768px) {
  .w-md-527px {
    width: 527px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-528px {
  width: 528px;
}

@media (min-width: 768px) {
  .w-md-528px {
    width: 528px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-529px {
  width: 529px;
}

@media (min-width: 768px) {
  .w-md-529px {
    width: 529px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-530px {
  width: 530px;
}

@media (min-width: 768px) {
  .w-md-530px {
    width: 530px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-531px {
  width: 531px;
}

@media (min-width: 768px) {
  .w-md-531px {
    width: 531px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-532px {
  width: 532px;
}

@media (min-width: 768px) {
  .w-md-532px {
    width: 532px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-533px {
  width: 533px;
}

@media (min-width: 768px) {
  .w-md-533px {
    width: 533px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-534px {
  width: 534px;
}

@media (min-width: 768px) {
  .w-md-534px {
    width: 534px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-535px {
  width: 535px;
}

@media (min-width: 768px) {
  .w-md-535px {
    width: 535px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-536px {
  width: 536px;
}

@media (min-width: 768px) {
  .w-md-536px {
    width: 536px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-537px {
  width: 537px;
}

@media (min-width: 768px) {
  .w-md-537px {
    width: 537px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-538px {
  width: 538px;
}

@media (min-width: 768px) {
  .w-md-538px {
    width: 538px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-539px {
  width: 539px;
}

@media (min-width: 768px) {
  .w-md-539px {
    width: 539px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-540px {
  width: 540px;
}

@media (min-width: 768px) {
  .w-md-540px {
    width: 540px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-541px {
  width: 541px;
}

@media (min-width: 768px) {
  .w-md-541px {
    width: 541px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-542px {
  width: 542px;
}

@media (min-width: 768px) {
  .w-md-542px {
    width: 542px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-543px {
  width: 543px;
}

@media (min-width: 768px) {
  .w-md-543px {
    width: 543px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-544px {
  width: 544px;
}

@media (min-width: 768px) {
  .w-md-544px {
    width: 544px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-545px {
  width: 545px;
}

@media (min-width: 768px) {
  .w-md-545px {
    width: 545px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-546px {
  width: 546px;
}

@media (min-width: 768px) {
  .w-md-546px {
    width: 546px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-547px {
  width: 547px;
}

@media (min-width: 768px) {
  .w-md-547px {
    width: 547px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-548px {
  width: 548px;
}

@media (min-width: 768px) {
  .w-md-548px {
    width: 548px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-549px {
  width: 549px;
}

@media (min-width: 768px) {
  .w-md-549px {
    width: 549px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-550px {
  width: 550px;
}

@media (min-width: 768px) {
  .w-md-550px {
    width: 550px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-551px {
  width: 551px;
}

@media (min-width: 768px) {
  .w-md-551px {
    width: 551px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-552px {
  width: 552px;
}

@media (min-width: 768px) {
  .w-md-552px {
    width: 552px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-553px {
  width: 553px;
}

@media (min-width: 768px) {
  .w-md-553px {
    width: 553px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-554px {
  width: 554px;
}

@media (min-width: 768px) {
  .w-md-554px {
    width: 554px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-555px {
  width: 555px;
}

@media (min-width: 768px) {
  .w-md-555px {
    width: 555px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-556px {
  width: 556px;
}

@media (min-width: 768px) {
  .w-md-556px {
    width: 556px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-557px {
  width: 557px;
}

@media (min-width: 768px) {
  .w-md-557px {
    width: 557px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-558px {
  width: 558px;
}

@media (min-width: 768px) {
  .w-md-558px {
    width: 558px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-559px {
  width: 559px;
}

@media (min-width: 768px) {
  .w-md-559px {
    width: 559px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-560px {
  width: 560px;
}

@media (min-width: 768px) {
  .w-md-560px {
    width: 560px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-561px {
  width: 561px;
}

@media (min-width: 768px) {
  .w-md-561px {
    width: 561px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-562px {
  width: 562px;
}

@media (min-width: 768px) {
  .w-md-562px {
    width: 562px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-563px {
  width: 563px;
}

@media (min-width: 768px) {
  .w-md-563px {
    width: 563px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-564px {
  width: 564px;
}

@media (min-width: 768px) {
  .w-md-564px {
    width: 564px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-565px {
  width: 565px;
}

@media (min-width: 768px) {
  .w-md-565px {
    width: 565px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-566px {
  width: 566px;
}

@media (min-width: 768px) {
  .w-md-566px {
    width: 566px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-567px {
  width: 567px;
}

@media (min-width: 768px) {
  .w-md-567px {
    width: 567px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-568px {
  width: 568px;
}

@media (min-width: 768px) {
  .w-md-568px {
    width: 568px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-569px {
  width: 569px;
}

@media (min-width: 768px) {
  .w-md-569px {
    width: 569px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-570px {
  width: 570px;
}

@media (min-width: 768px) {
  .w-md-570px {
    width: 570px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-571px {
  width: 571px;
}

@media (min-width: 768px) {
  .w-md-571px {
    width: 571px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-572px {
  width: 572px;
}

@media (min-width: 768px) {
  .w-md-572px {
    width: 572px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-573px {
  width: 573px;
}

@media (min-width: 768px) {
  .w-md-573px {
    width: 573px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-574px {
  width: 574px;
}

@media (min-width: 768px) {
  .w-md-574px {
    width: 574px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-575px {
  width: 575px;
}

@media (min-width: 768px) {
  .w-md-575px {
    width: 575px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-576px {
  width: 576px;
}

@media (min-width: 768px) {
  .w-md-576px {
    width: 576px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-577px {
  width: 577px;
}

@media (min-width: 768px) {
  .w-md-577px {
    width: 577px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-578px {
  width: 578px;
}

@media (min-width: 768px) {
  .w-md-578px {
    width: 578px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-579px {
  width: 579px;
}

@media (min-width: 768px) {
  .w-md-579px {
    width: 579px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-580px {
  width: 580px;
}

@media (min-width: 768px) {
  .w-md-580px {
    width: 580px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-581px {
  width: 581px;
}

@media (min-width: 768px) {
  .w-md-581px {
    width: 581px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-582px {
  width: 582px;
}

@media (min-width: 768px) {
  .w-md-582px {
    width: 582px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-583px {
  width: 583px;
}

@media (min-width: 768px) {
  .w-md-583px {
    width: 583px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-584px {
  width: 584px;
}

@media (min-width: 768px) {
  .w-md-584px {
    width: 584px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-585px {
  width: 585px;
}

@media (min-width: 768px) {
  .w-md-585px {
    width: 585px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-586px {
  width: 586px;
}

@media (min-width: 768px) {
  .w-md-586px {
    width: 586px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-587px {
  width: 587px;
}

@media (min-width: 768px) {
  .w-md-587px {
    width: 587px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-588px {
  width: 588px;
}

@media (min-width: 768px) {
  .w-md-588px {
    width: 588px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-589px {
  width: 589px;
}

@media (min-width: 768px) {
  .w-md-589px {
    width: 589px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-590px {
  width: 590px;
}

@media (min-width: 768px) {
  .w-md-590px {
    width: 590px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-591px {
  width: 591px;
}

@media (min-width: 768px) {
  .w-md-591px {
    width: 591px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-592px {
  width: 592px;
}

@media (min-width: 768px) {
  .w-md-592px {
    width: 592px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-593px {
  width: 593px;
}

@media (min-width: 768px) {
  .w-md-593px {
    width: 593px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-594px {
  width: 594px;
}

@media (min-width: 768px) {
  .w-md-594px {
    width: 594px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-595px {
  width: 595px;
}

@media (min-width: 768px) {
  .w-md-595px {
    width: 595px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-596px {
  width: 596px;
}

@media (min-width: 768px) {
  .w-md-596px {
    width: 596px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-597px {
  width: 597px;
}

@media (min-width: 768px) {
  .w-md-597px {
    width: 597px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-598px {
  width: 598px;
}

@media (min-width: 768px) {
  .w-md-598px {
    width: 598px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-599px {
  width: 599px;
}

@media (min-width: 768px) {
  .w-md-599px {
    width: 599px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-600px {
  width: 600px;
}

@media (min-width: 768px) {
  .w-md-600px {
    width: 600px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-601px {
  width: 601px;
}

@media (min-width: 768px) {
  .w-md-601px {
    width: 601px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-602px {
  width: 602px;
}

@media (min-width: 768px) {
  .w-md-602px {
    width: 602px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-603px {
  width: 603px;
}

@media (min-width: 768px) {
  .w-md-603px {
    width: 603px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-604px {
  width: 604px;
}

@media (min-width: 768px) {
  .w-md-604px {
    width: 604px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-605px {
  width: 605px;
}

@media (min-width: 768px) {
  .w-md-605px {
    width: 605px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-606px {
  width: 606px;
}

@media (min-width: 768px) {
  .w-md-606px {
    width: 606px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-607px {
  width: 607px;
}

@media (min-width: 768px) {
  .w-md-607px {
    width: 607px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-608px {
  width: 608px;
}

@media (min-width: 768px) {
  .w-md-608px {
    width: 608px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-609px {
  width: 609px;
}

@media (min-width: 768px) {
  .w-md-609px {
    width: 609px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-610px {
  width: 610px;
}

@media (min-width: 768px) {
  .w-md-610px {
    width: 610px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-611px {
  width: 611px;
}

@media (min-width: 768px) {
  .w-md-611px {
    width: 611px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-612px {
  width: 612px;
}

@media (min-width: 768px) {
  .w-md-612px {
    width: 612px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-613px {
  width: 613px;
}

@media (min-width: 768px) {
  .w-md-613px {
    width: 613px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-614px {
  width: 614px;
}

@media (min-width: 768px) {
  .w-md-614px {
    width: 614px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-615px {
  width: 615px;
}

@media (min-width: 768px) {
  .w-md-615px {
    width: 615px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-616px {
  width: 616px;
}

@media (min-width: 768px) {
  .w-md-616px {
    width: 616px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-617px {
  width: 617px;
}

@media (min-width: 768px) {
  .w-md-617px {
    width: 617px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-618px {
  width: 618px;
}

@media (min-width: 768px) {
  .w-md-618px {
    width: 618px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-619px {
  width: 619px;
}

@media (min-width: 768px) {
  .w-md-619px {
    width: 619px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-620px {
  width: 620px;
}

@media (min-width: 768px) {
  .w-md-620px {
    width: 620px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-621px {
  width: 621px;
}

@media (min-width: 768px) {
  .w-md-621px {
    width: 621px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-622px {
  width: 622px;
}

@media (min-width: 768px) {
  .w-md-622px {
    width: 622px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-623px {
  width: 623px;
}

@media (min-width: 768px) {
  .w-md-623px {
    width: 623px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-624px {
  width: 624px;
}

@media (min-width: 768px) {
  .w-md-624px {
    width: 624px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-625px {
  width: 625px;
}

@media (min-width: 768px) {
  .w-md-625px {
    width: 625px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-626px {
  width: 626px;
}

@media (min-width: 768px) {
  .w-md-626px {
    width: 626px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-627px {
  width: 627px;
}

@media (min-width: 768px) {
  .w-md-627px {
    width: 627px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-628px {
  width: 628px;
}

@media (min-width: 768px) {
  .w-md-628px {
    width: 628px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-629px {
  width: 629px;
}

@media (min-width: 768px) {
  .w-md-629px {
    width: 629px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-630px {
  width: 630px;
}

@media (min-width: 768px) {
  .w-md-630px {
    width: 630px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-631px {
  width: 631px;
}

@media (min-width: 768px) {
  .w-md-631px {
    width: 631px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-632px {
  width: 632px;
}

@media (min-width: 768px) {
  .w-md-632px {
    width: 632px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-633px {
  width: 633px;
}

@media (min-width: 768px) {
  .w-md-633px {
    width: 633px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-634px {
  width: 634px;
}

@media (min-width: 768px) {
  .w-md-634px {
    width: 634px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-635px {
  width: 635px;
}

@media (min-width: 768px) {
  .w-md-635px {
    width: 635px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-636px {
  width: 636px;
}

@media (min-width: 768px) {
  .w-md-636px {
    width: 636px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-637px {
  width: 637px;
}

@media (min-width: 768px) {
  .w-md-637px {
    width: 637px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-638px {
  width: 638px;
}

@media (min-width: 768px) {
  .w-md-638px {
    width: 638px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-639px {
  width: 639px;
}

@media (min-width: 768px) {
  .w-md-639px {
    width: 639px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-640px {
  width: 640px;
}

@media (min-width: 768px) {
  .w-md-640px {
    width: 640px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-641px {
  width: 641px;
}

@media (min-width: 768px) {
  .w-md-641px {
    width: 641px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-642px {
  width: 642px;
}

@media (min-width: 768px) {
  .w-md-642px {
    width: 642px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-643px {
  width: 643px;
}

@media (min-width: 768px) {
  .w-md-643px {
    width: 643px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-644px {
  width: 644px;
}

@media (min-width: 768px) {
  .w-md-644px {
    width: 644px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-645px {
  width: 645px;
}

@media (min-width: 768px) {
  .w-md-645px {
    width: 645px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-646px {
  width: 646px;
}

@media (min-width: 768px) {
  .w-md-646px {
    width: 646px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-647px {
  width: 647px;
}

@media (min-width: 768px) {
  .w-md-647px {
    width: 647px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-648px {
  width: 648px;
}

@media (min-width: 768px) {
  .w-md-648px {
    width: 648px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-649px {
  width: 649px;
}

@media (min-width: 768px) {
  .w-md-649px {
    width: 649px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-650px {
  width: 650px;
}

@media (min-width: 768px) {
  .w-md-650px {
    width: 650px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-651px {
  width: 651px;
}

@media (min-width: 768px) {
  .w-md-651px {
    width: 651px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-652px {
  width: 652px;
}

@media (min-width: 768px) {
  .w-md-652px {
    width: 652px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-653px {
  width: 653px;
}

@media (min-width: 768px) {
  .w-md-653px {
    width: 653px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-654px {
  width: 654px;
}

@media (min-width: 768px) {
  .w-md-654px {
    width: 654px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-655px {
  width: 655px;
}

@media (min-width: 768px) {
  .w-md-655px {
    width: 655px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-656px {
  width: 656px;
}

@media (min-width: 768px) {
  .w-md-656px {
    width: 656px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-657px {
  width: 657px;
}

@media (min-width: 768px) {
  .w-md-657px {
    width: 657px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-658px {
  width: 658px;
}

@media (min-width: 768px) {
  .w-md-658px {
    width: 658px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-659px {
  width: 659px;
}

@media (min-width: 768px) {
  .w-md-659px {
    width: 659px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-660px {
  width: 660px;
}

@media (min-width: 768px) {
  .w-md-660px {
    width: 660px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-661px {
  width: 661px;
}

@media (min-width: 768px) {
  .w-md-661px {
    width: 661px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-662px {
  width: 662px;
}

@media (min-width: 768px) {
  .w-md-662px {
    width: 662px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-663px {
  width: 663px;
}

@media (min-width: 768px) {
  .w-md-663px {
    width: 663px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-664px {
  width: 664px;
}

@media (min-width: 768px) {
  .w-md-664px {
    width: 664px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-665px {
  width: 665px;
}

@media (min-width: 768px) {
  .w-md-665px {
    width: 665px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-666px {
  width: 666px;
}

@media (min-width: 768px) {
  .w-md-666px {
    width: 666px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-667px {
  width: 667px;
}

@media (min-width: 768px) {
  .w-md-667px {
    width: 667px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-668px {
  width: 668px;
}

@media (min-width: 768px) {
  .w-md-668px {
    width: 668px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-669px {
  width: 669px;
}

@media (min-width: 768px) {
  .w-md-669px {
    width: 669px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-670px {
  width: 670px;
}

@media (min-width: 768px) {
  .w-md-670px {
    width: 670px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-671px {
  width: 671px;
}

@media (min-width: 768px) {
  .w-md-671px {
    width: 671px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-672px {
  width: 672px;
}

@media (min-width: 768px) {
  .w-md-672px {
    width: 672px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-673px {
  width: 673px;
}

@media (min-width: 768px) {
  .w-md-673px {
    width: 673px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-674px {
  width: 674px;
}

@media (min-width: 768px) {
  .w-md-674px {
    width: 674px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-675px {
  width: 675px;
}

@media (min-width: 768px) {
  .w-md-675px {
    width: 675px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-676px {
  width: 676px;
}

@media (min-width: 768px) {
  .w-md-676px {
    width: 676px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-677px {
  width: 677px;
}

@media (min-width: 768px) {
  .w-md-677px {
    width: 677px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-678px {
  width: 678px;
}

@media (min-width: 768px) {
  .w-md-678px {
    width: 678px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-679px {
  width: 679px;
}

@media (min-width: 768px) {
  .w-md-679px {
    width: 679px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-680px {
  width: 680px;
}

@media (min-width: 768px) {
  .w-md-680px {
    width: 680px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-681px {
  width: 681px;
}

@media (min-width: 768px) {
  .w-md-681px {
    width: 681px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-682px {
  width: 682px;
}

@media (min-width: 768px) {
  .w-md-682px {
    width: 682px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-683px {
  width: 683px;
}

@media (min-width: 768px) {
  .w-md-683px {
    width: 683px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-684px {
  width: 684px;
}

@media (min-width: 768px) {
  .w-md-684px {
    width: 684px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-685px {
  width: 685px;
}

@media (min-width: 768px) {
  .w-md-685px {
    width: 685px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-686px {
  width: 686px;
}

@media (min-width: 768px) {
  .w-md-686px {
    width: 686px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-687px {
  width: 687px;
}

@media (min-width: 768px) {
  .w-md-687px {
    width: 687px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-688px {
  width: 688px;
}

@media (min-width: 768px) {
  .w-md-688px {
    width: 688px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-689px {
  width: 689px;
}

@media (min-width: 768px) {
  .w-md-689px {
    width: 689px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-690px {
  width: 690px;
}

@media (min-width: 768px) {
  .w-md-690px {
    width: 690px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-691px {
  width: 691px;
}

@media (min-width: 768px) {
  .w-md-691px {
    width: 691px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-692px {
  width: 692px;
}

@media (min-width: 768px) {
  .w-md-692px {
    width: 692px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-693px {
  width: 693px;
}

@media (min-width: 768px) {
  .w-md-693px {
    width: 693px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-694px {
  width: 694px;
}

@media (min-width: 768px) {
  .w-md-694px {
    width: 694px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-695px {
  width: 695px;
}

@media (min-width: 768px) {
  .w-md-695px {
    width: 695px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-696px {
  width: 696px;
}

@media (min-width: 768px) {
  .w-md-696px {
    width: 696px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-697px {
  width: 697px;
}

@media (min-width: 768px) {
  .w-md-697px {
    width: 697px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-698px {
  width: 698px;
}

@media (min-width: 768px) {
  .w-md-698px {
    width: 698px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-699px {
  width: 699px;
}

@media (min-width: 768px) {
  .w-md-699px {
    width: 699px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-700px {
  width: 700px;
}

@media (min-width: 768px) {
  .w-md-700px {
    width: 700px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-701px {
  width: 701px;
}

@media (min-width: 768px) {
  .w-md-701px {
    width: 701px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-702px {
  width: 702px;
}

@media (min-width: 768px) {
  .w-md-702px {
    width: 702px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-703px {
  width: 703px;
}

@media (min-width: 768px) {
  .w-md-703px {
    width: 703px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-704px {
  width: 704px;
}

@media (min-width: 768px) {
  .w-md-704px {
    width: 704px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-705px {
  width: 705px;
}

@media (min-width: 768px) {
  .w-md-705px {
    width: 705px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-706px {
  width: 706px;
}

@media (min-width: 768px) {
  .w-md-706px {
    width: 706px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-707px {
  width: 707px;
}

@media (min-width: 768px) {
  .w-md-707px {
    width: 707px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-708px {
  width: 708px;
}

@media (min-width: 768px) {
  .w-md-708px {
    width: 708px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-709px {
  width: 709px;
}

@media (min-width: 768px) {
  .w-md-709px {
    width: 709px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-710px {
  width: 710px;
}

@media (min-width: 768px) {
  .w-md-710px {
    width: 710px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-711px {
  width: 711px;
}

@media (min-width: 768px) {
  .w-md-711px {
    width: 711px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-712px {
  width: 712px;
}

@media (min-width: 768px) {
  .w-md-712px {
    width: 712px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-713px {
  width: 713px;
}

@media (min-width: 768px) {
  .w-md-713px {
    width: 713px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-714px {
  width: 714px;
}

@media (min-width: 768px) {
  .w-md-714px {
    width: 714px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-715px {
  width: 715px;
}

@media (min-width: 768px) {
  .w-md-715px {
    width: 715px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-716px {
  width: 716px;
}

@media (min-width: 768px) {
  .w-md-716px {
    width: 716px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-717px {
  width: 717px;
}

@media (min-width: 768px) {
  .w-md-717px {
    width: 717px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-718px {
  width: 718px;
}

@media (min-width: 768px) {
  .w-md-718px {
    width: 718px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-719px {
  width: 719px;
}

@media (min-width: 768px) {
  .w-md-719px {
    width: 719px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-720px {
  width: 720px;
}

@media (min-width: 768px) {
  .w-md-720px {
    width: 720px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-721px {
  width: 721px;
}

@media (min-width: 768px) {
  .w-md-721px {
    width: 721px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-722px {
  width: 722px;
}

@media (min-width: 768px) {
  .w-md-722px {
    width: 722px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-723px {
  width: 723px;
}

@media (min-width: 768px) {
  .w-md-723px {
    width: 723px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-724px {
  width: 724px;
}

@media (min-width: 768px) {
  .w-md-724px {
    width: 724px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-725px {
  width: 725px;
}

@media (min-width: 768px) {
  .w-md-725px {
    width: 725px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-726px {
  width: 726px;
}

@media (min-width: 768px) {
  .w-md-726px {
    width: 726px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-727px {
  width: 727px;
}

@media (min-width: 768px) {
  .w-md-727px {
    width: 727px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-728px {
  width: 728px;
}

@media (min-width: 768px) {
  .w-md-728px {
    width: 728px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-729px {
  width: 729px;
}

@media (min-width: 768px) {
  .w-md-729px {
    width: 729px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-730px {
  width: 730px;
}

@media (min-width: 768px) {
  .w-md-730px {
    width: 730px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-731px {
  width: 731px;
}

@media (min-width: 768px) {
  .w-md-731px {
    width: 731px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-732px {
  width: 732px;
}

@media (min-width: 768px) {
  .w-md-732px {
    width: 732px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-733px {
  width: 733px;
}

@media (min-width: 768px) {
  .w-md-733px {
    width: 733px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-734px {
  width: 734px;
}

@media (min-width: 768px) {
  .w-md-734px {
    width: 734px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-735px {
  width: 735px;
}

@media (min-width: 768px) {
  .w-md-735px {
    width: 735px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-736px {
  width: 736px;
}

@media (min-width: 768px) {
  .w-md-736px {
    width: 736px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-737px {
  width: 737px;
}

@media (min-width: 768px) {
  .w-md-737px {
    width: 737px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-738px {
  width: 738px;
}

@media (min-width: 768px) {
  .w-md-738px {
    width: 738px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-739px {
  width: 739px;
}

@media (min-width: 768px) {
  .w-md-739px {
    width: 739px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-740px {
  width: 740px;
}

@media (min-width: 768px) {
  .w-md-740px {
    width: 740px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-741px {
  width: 741px;
}

@media (min-width: 768px) {
  .w-md-741px {
    width: 741px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-742px {
  width: 742px;
}

@media (min-width: 768px) {
  .w-md-742px {
    width: 742px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-743px {
  width: 743px;
}

@media (min-width: 768px) {
  .w-md-743px {
    width: 743px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-744px {
  width: 744px;
}

@media (min-width: 768px) {
  .w-md-744px {
    width: 744px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-745px {
  width: 745px;
}

@media (min-width: 768px) {
  .w-md-745px {
    width: 745px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-746px {
  width: 746px;
}

@media (min-width: 768px) {
  .w-md-746px {
    width: 746px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-747px {
  width: 747px;
}

@media (min-width: 768px) {
  .w-md-747px {
    width: 747px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-748px {
  width: 748px;
}

@media (min-width: 768px) {
  .w-md-748px {
    width: 748px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-749px {
  width: 749px;
}

@media (min-width: 768px) {
  .w-md-749px {
    width: 749px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-750px {
  width: 750px;
}

@media (min-width: 768px) {
  .w-md-750px {
    width: 750px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-751px {
  width: 751px;
}

@media (min-width: 768px) {
  .w-md-751px {
    width: 751px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-752px {
  width: 752px;
}

@media (min-width: 768px) {
  .w-md-752px {
    width: 752px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-753px {
  width: 753px;
}

@media (min-width: 768px) {
  .w-md-753px {
    width: 753px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-754px {
  width: 754px;
}

@media (min-width: 768px) {
  .w-md-754px {
    width: 754px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-755px {
  width: 755px;
}

@media (min-width: 768px) {
  .w-md-755px {
    width: 755px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-756px {
  width: 756px;
}

@media (min-width: 768px) {
  .w-md-756px {
    width: 756px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-757px {
  width: 757px;
}

@media (min-width: 768px) {
  .w-md-757px {
    width: 757px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-758px {
  width: 758px;
}

@media (min-width: 768px) {
  .w-md-758px {
    width: 758px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-759px {
  width: 759px;
}

@media (min-width: 768px) {
  .w-md-759px {
    width: 759px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-760px {
  width: 760px;
}

@media (min-width: 768px) {
  .w-md-760px {
    width: 760px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-761px {
  width: 761px;
}

@media (min-width: 768px) {
  .w-md-761px {
    width: 761px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-762px {
  width: 762px;
}

@media (min-width: 768px) {
  .w-md-762px {
    width: 762px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-763px {
  width: 763px;
}

@media (min-width: 768px) {
  .w-md-763px {
    width: 763px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-764px {
  width: 764px;
}

@media (min-width: 768px) {
  .w-md-764px {
    width: 764px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-765px {
  width: 765px;
}

@media (min-width: 768px) {
  .w-md-765px {
    width: 765px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-766px {
  width: 766px;
}

@media (min-width: 768px) {
  .w-md-766px {
    width: 766px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-767px {
  width: 767px;
}

@media (min-width: 768px) {
  .w-md-767px {
    width: 767px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-768px {
  width: 768px;
}

@media (min-width: 768px) {
  .w-md-768px {
    width: 768px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-769px {
  width: 769px;
}

@media (min-width: 768px) {
  .w-md-769px {
    width: 769px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-770px {
  width: 770px;
}

@media (min-width: 768px) {
  .w-md-770px {
    width: 770px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-771px {
  width: 771px;
}

@media (min-width: 768px) {
  .w-md-771px {
    width: 771px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-772px {
  width: 772px;
}

@media (min-width: 768px) {
  .w-md-772px {
    width: 772px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-773px {
  width: 773px;
}

@media (min-width: 768px) {
  .w-md-773px {
    width: 773px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-774px {
  width: 774px;
}

@media (min-width: 768px) {
  .w-md-774px {
    width: 774px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-775px {
  width: 775px;
}

@media (min-width: 768px) {
  .w-md-775px {
    width: 775px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-776px {
  width: 776px;
}

@media (min-width: 768px) {
  .w-md-776px {
    width: 776px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-777px {
  width: 777px;
}

@media (min-width: 768px) {
  .w-md-777px {
    width: 777px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-778px {
  width: 778px;
}

@media (min-width: 768px) {
  .w-md-778px {
    width: 778px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-779px {
  width: 779px;
}

@media (min-width: 768px) {
  .w-md-779px {
    width: 779px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-780px {
  width: 780px;
}

@media (min-width: 768px) {
  .w-md-780px {
    width: 780px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-781px {
  width: 781px;
}

@media (min-width: 768px) {
  .w-md-781px {
    width: 781px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-782px {
  width: 782px;
}

@media (min-width: 768px) {
  .w-md-782px {
    width: 782px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-783px {
  width: 783px;
}

@media (min-width: 768px) {
  .w-md-783px {
    width: 783px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-784px {
  width: 784px;
}

@media (min-width: 768px) {
  .w-md-784px {
    width: 784px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-785px {
  width: 785px;
}

@media (min-width: 768px) {
  .w-md-785px {
    width: 785px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-786px {
  width: 786px;
}

@media (min-width: 768px) {
  .w-md-786px {
    width: 786px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-787px {
  width: 787px;
}

@media (min-width: 768px) {
  .w-md-787px {
    width: 787px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-788px {
  width: 788px;
}

@media (min-width: 768px) {
  .w-md-788px {
    width: 788px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-789px {
  width: 789px;
}

@media (min-width: 768px) {
  .w-md-789px {
    width: 789px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-790px {
  width: 790px;
}

@media (min-width: 768px) {
  .w-md-790px {
    width: 790px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-791px {
  width: 791px;
}

@media (min-width: 768px) {
  .w-md-791px {
    width: 791px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-792px {
  width: 792px;
}

@media (min-width: 768px) {
  .w-md-792px {
    width: 792px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-793px {
  width: 793px;
}

@media (min-width: 768px) {
  .w-md-793px {
    width: 793px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-794px {
  width: 794px;
}

@media (min-width: 768px) {
  .w-md-794px {
    width: 794px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-795px {
  width: 795px;
}

@media (min-width: 768px) {
  .w-md-795px {
    width: 795px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-796px {
  width: 796px;
}

@media (min-width: 768px) {
  .w-md-796px {
    width: 796px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-797px {
  width: 797px;
}

@media (min-width: 768px) {
  .w-md-797px {
    width: 797px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-798px {
  width: 798px;
}

@media (min-width: 768px) {
  .w-md-798px {
    width: 798px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-799px {
  width: 799px;
}

@media (min-width: 768px) {
  .w-md-799px {
    width: 799px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-800px {
  width: 800px;
}

@media (min-width: 768px) {
  .w-md-800px {
    width: 800px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-801px {
  width: 801px;
}

@media (min-width: 768px) {
  .w-md-801px {
    width: 801px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-802px {
  width: 802px;
}

@media (min-width: 768px) {
  .w-md-802px {
    width: 802px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-803px {
  width: 803px;
}

@media (min-width: 768px) {
  .w-md-803px {
    width: 803px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-804px {
  width: 804px;
}

@media (min-width: 768px) {
  .w-md-804px {
    width: 804px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-805px {
  width: 805px;
}

@media (min-width: 768px) {
  .w-md-805px {
    width: 805px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-806px {
  width: 806px;
}

@media (min-width: 768px) {
  .w-md-806px {
    width: 806px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-807px {
  width: 807px;
}

@media (min-width: 768px) {
  .w-md-807px {
    width: 807px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-808px {
  width: 808px;
}

@media (min-width: 768px) {
  .w-md-808px {
    width: 808px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-809px {
  width: 809px;
}

@media (min-width: 768px) {
  .w-md-809px {
    width: 809px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-810px {
  width: 810px;
}

@media (min-width: 768px) {
  .w-md-810px {
    width: 810px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-811px {
  width: 811px;
}

@media (min-width: 768px) {
  .w-md-811px {
    width: 811px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-812px {
  width: 812px;
}

@media (min-width: 768px) {
  .w-md-812px {
    width: 812px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-813px {
  width: 813px;
}

@media (min-width: 768px) {
  .w-md-813px {
    width: 813px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-814px {
  width: 814px;
}

@media (min-width: 768px) {
  .w-md-814px {
    width: 814px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-815px {
  width: 815px;
}

@media (min-width: 768px) {
  .w-md-815px {
    width: 815px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-816px {
  width: 816px;
}

@media (min-width: 768px) {
  .w-md-816px {
    width: 816px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-817px {
  width: 817px;
}

@media (min-width: 768px) {
  .w-md-817px {
    width: 817px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-818px {
  width: 818px;
}

@media (min-width: 768px) {
  .w-md-818px {
    width: 818px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-819px {
  width: 819px;
}

@media (min-width: 768px) {
  .w-md-819px {
    width: 819px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-820px {
  width: 820px;
}

@media (min-width: 768px) {
  .w-md-820px {
    width: 820px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-821px {
  width: 821px;
}

@media (min-width: 768px) {
  .w-md-821px {
    width: 821px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-822px {
  width: 822px;
}

@media (min-width: 768px) {
  .w-md-822px {
    width: 822px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-823px {
  width: 823px;
}

@media (min-width: 768px) {
  .w-md-823px {
    width: 823px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-824px {
  width: 824px;
}

@media (min-width: 768px) {
  .w-md-824px {
    width: 824px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-825px {
  width: 825px;
}

@media (min-width: 768px) {
  .w-md-825px {
    width: 825px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-826px {
  width: 826px;
}

@media (min-width: 768px) {
  .w-md-826px {
    width: 826px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-827px {
  width: 827px;
}

@media (min-width: 768px) {
  .w-md-827px {
    width: 827px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-828px {
  width: 828px;
}

@media (min-width: 768px) {
  .w-md-828px {
    width: 828px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-829px {
  width: 829px;
}

@media (min-width: 768px) {
  .w-md-829px {
    width: 829px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-830px {
  width: 830px;
}

@media (min-width: 768px) {
  .w-md-830px {
    width: 830px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-831px {
  width: 831px;
}

@media (min-width: 768px) {
  .w-md-831px {
    width: 831px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-832px {
  width: 832px;
}

@media (min-width: 768px) {
  .w-md-832px {
    width: 832px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-833px {
  width: 833px;
}

@media (min-width: 768px) {
  .w-md-833px {
    width: 833px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-834px {
  width: 834px;
}

@media (min-width: 768px) {
  .w-md-834px {
    width: 834px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-835px {
  width: 835px;
}

@media (min-width: 768px) {
  .w-md-835px {
    width: 835px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-836px {
  width: 836px;
}

@media (min-width: 768px) {
  .w-md-836px {
    width: 836px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-837px {
  width: 837px;
}

@media (min-width: 768px) {
  .w-md-837px {
    width: 837px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-838px {
  width: 838px;
}

@media (min-width: 768px) {
  .w-md-838px {
    width: 838px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-839px {
  width: 839px;
}

@media (min-width: 768px) {
  .w-md-839px {
    width: 839px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-840px {
  width: 840px;
}

@media (min-width: 768px) {
  .w-md-840px {
    width: 840px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-841px {
  width: 841px;
}

@media (min-width: 768px) {
  .w-md-841px {
    width: 841px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-842px {
  width: 842px;
}

@media (min-width: 768px) {
  .w-md-842px {
    width: 842px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-843px {
  width: 843px;
}

@media (min-width: 768px) {
  .w-md-843px {
    width: 843px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-844px {
  width: 844px;
}

@media (min-width: 768px) {
  .w-md-844px {
    width: 844px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-845px {
  width: 845px;
}

@media (min-width: 768px) {
  .w-md-845px {
    width: 845px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-846px {
  width: 846px;
}

@media (min-width: 768px) {
  .w-md-846px {
    width: 846px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-847px {
  width: 847px;
}

@media (min-width: 768px) {
  .w-md-847px {
    width: 847px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-848px {
  width: 848px;
}

@media (min-width: 768px) {
  .w-md-848px {
    width: 848px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-849px {
  width: 849px;
}

@media (min-width: 768px) {
  .w-md-849px {
    width: 849px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-850px {
  width: 850px;
}

@media (min-width: 768px) {
  .w-md-850px {
    width: 850px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-851px {
  width: 851px;
}

@media (min-width: 768px) {
  .w-md-851px {
    width: 851px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-852px {
  width: 852px;
}

@media (min-width: 768px) {
  .w-md-852px {
    width: 852px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-853px {
  width: 853px;
}

@media (min-width: 768px) {
  .w-md-853px {
    width: 853px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-854px {
  width: 854px;
}

@media (min-width: 768px) {
  .w-md-854px {
    width: 854px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-855px {
  width: 855px;
}

@media (min-width: 768px) {
  .w-md-855px {
    width: 855px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-856px {
  width: 856px;
}

@media (min-width: 768px) {
  .w-md-856px {
    width: 856px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-857px {
  width: 857px;
}

@media (min-width: 768px) {
  .w-md-857px {
    width: 857px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-858px {
  width: 858px;
}

@media (min-width: 768px) {
  .w-md-858px {
    width: 858px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-859px {
  width: 859px;
}

@media (min-width: 768px) {
  .w-md-859px {
    width: 859px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-860px {
  width: 860px;
}

@media (min-width: 768px) {
  .w-md-860px {
    width: 860px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-861px {
  width: 861px;
}

@media (min-width: 768px) {
  .w-md-861px {
    width: 861px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-862px {
  width: 862px;
}

@media (min-width: 768px) {
  .w-md-862px {
    width: 862px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-863px {
  width: 863px;
}

@media (min-width: 768px) {
  .w-md-863px {
    width: 863px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-864px {
  width: 864px;
}

@media (min-width: 768px) {
  .w-md-864px {
    width: 864px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-865px {
  width: 865px;
}

@media (min-width: 768px) {
  .w-md-865px {
    width: 865px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-866px {
  width: 866px;
}

@media (min-width: 768px) {
  .w-md-866px {
    width: 866px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-867px {
  width: 867px;
}

@media (min-width: 768px) {
  .w-md-867px {
    width: 867px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-868px {
  width: 868px;
}

@media (min-width: 768px) {
  .w-md-868px {
    width: 868px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-869px {
  width: 869px;
}

@media (min-width: 768px) {
  .w-md-869px {
    width: 869px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-870px {
  width: 870px;
}

@media (min-width: 768px) {
  .w-md-870px {
    width: 870px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-871px {
  width: 871px;
}

@media (min-width: 768px) {
  .w-md-871px {
    width: 871px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-872px {
  width: 872px;
}

@media (min-width: 768px) {
  .w-md-872px {
    width: 872px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-873px {
  width: 873px;
}

@media (min-width: 768px) {
  .w-md-873px {
    width: 873px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-874px {
  width: 874px;
}

@media (min-width: 768px) {
  .w-md-874px {
    width: 874px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-875px {
  width: 875px;
}

@media (min-width: 768px) {
  .w-md-875px {
    width: 875px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-876px {
  width: 876px;
}

@media (min-width: 768px) {
  .w-md-876px {
    width: 876px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-877px {
  width: 877px;
}

@media (min-width: 768px) {
  .w-md-877px {
    width: 877px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-878px {
  width: 878px;
}

@media (min-width: 768px) {
  .w-md-878px {
    width: 878px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-879px {
  width: 879px;
}

@media (min-width: 768px) {
  .w-md-879px {
    width: 879px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-880px {
  width: 880px;
}

@media (min-width: 768px) {
  .w-md-880px {
    width: 880px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-881px {
  width: 881px;
}

@media (min-width: 768px) {
  .w-md-881px {
    width: 881px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-882px {
  width: 882px;
}

@media (min-width: 768px) {
  .w-md-882px {
    width: 882px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-883px {
  width: 883px;
}

@media (min-width: 768px) {
  .w-md-883px {
    width: 883px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-884px {
  width: 884px;
}

@media (min-width: 768px) {
  .w-md-884px {
    width: 884px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-885px {
  width: 885px;
}

@media (min-width: 768px) {
  .w-md-885px {
    width: 885px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-886px {
  width: 886px;
}

@media (min-width: 768px) {
  .w-md-886px {
    width: 886px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-887px {
  width: 887px;
}

@media (min-width: 768px) {
  .w-md-887px {
    width: 887px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-888px {
  width: 888px;
}

@media (min-width: 768px) {
  .w-md-888px {
    width: 888px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-889px {
  width: 889px;
}

@media (min-width: 768px) {
  .w-md-889px {
    width: 889px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-890px {
  width: 890px;
}

@media (min-width: 768px) {
  .w-md-890px {
    width: 890px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-891px {
  width: 891px;
}

@media (min-width: 768px) {
  .w-md-891px {
    width: 891px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-892px {
  width: 892px;
}

@media (min-width: 768px) {
  .w-md-892px {
    width: 892px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-893px {
  width: 893px;
}

@media (min-width: 768px) {
  .w-md-893px {
    width: 893px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-894px {
  width: 894px;
}

@media (min-width: 768px) {
  .w-md-894px {
    width: 894px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-895px {
  width: 895px;
}

@media (min-width: 768px) {
  .w-md-895px {
    width: 895px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-896px {
  width: 896px;
}

@media (min-width: 768px) {
  .w-md-896px {
    width: 896px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-897px {
  width: 897px;
}

@media (min-width: 768px) {
  .w-md-897px {
    width: 897px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-898px {
  width: 898px;
}

@media (min-width: 768px) {
  .w-md-898px {
    width: 898px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-899px {
  width: 899px;
}

@media (min-width: 768px) {
  .w-md-899px {
    width: 899px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-900px {
  width: 900px;
}

@media (min-width: 768px) {
  .w-md-900px {
    width: 900px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-901px {
  width: 901px;
}

@media (min-width: 768px) {
  .w-md-901px {
    width: 901px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-902px {
  width: 902px;
}

@media (min-width: 768px) {
  .w-md-902px {
    width: 902px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-903px {
  width: 903px;
}

@media (min-width: 768px) {
  .w-md-903px {
    width: 903px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-904px {
  width: 904px;
}

@media (min-width: 768px) {
  .w-md-904px {
    width: 904px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-905px {
  width: 905px;
}

@media (min-width: 768px) {
  .w-md-905px {
    width: 905px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-906px {
  width: 906px;
}

@media (min-width: 768px) {
  .w-md-906px {
    width: 906px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-907px {
  width: 907px;
}

@media (min-width: 768px) {
  .w-md-907px {
    width: 907px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-908px {
  width: 908px;
}

@media (min-width: 768px) {
  .w-md-908px {
    width: 908px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-909px {
  width: 909px;
}

@media (min-width: 768px) {
  .w-md-909px {
    width: 909px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-910px {
  width: 910px;
}

@media (min-width: 768px) {
  .w-md-910px {
    width: 910px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-911px {
  width: 911px;
}

@media (min-width: 768px) {
  .w-md-911px {
    width: 911px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-912px {
  width: 912px;
}

@media (min-width: 768px) {
  .w-md-912px {
    width: 912px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-913px {
  width: 913px;
}

@media (min-width: 768px) {
  .w-md-913px {
    width: 913px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-914px {
  width: 914px;
}

@media (min-width: 768px) {
  .w-md-914px {
    width: 914px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-915px {
  width: 915px;
}

@media (min-width: 768px) {
  .w-md-915px {
    width: 915px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-916px {
  width: 916px;
}

@media (min-width: 768px) {
  .w-md-916px {
    width: 916px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-917px {
  width: 917px;
}

@media (min-width: 768px) {
  .w-md-917px {
    width: 917px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-918px {
  width: 918px;
}

@media (min-width: 768px) {
  .w-md-918px {
    width: 918px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-919px {
  width: 919px;
}

@media (min-width: 768px) {
  .w-md-919px {
    width: 919px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-920px {
  width: 920px;
}

@media (min-width: 768px) {
  .w-md-920px {
    width: 920px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-921px {
  width: 921px;
}

@media (min-width: 768px) {
  .w-md-921px {
    width: 921px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-922px {
  width: 922px;
}

@media (min-width: 768px) {
  .w-md-922px {
    width: 922px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-923px {
  width: 923px;
}

@media (min-width: 768px) {
  .w-md-923px {
    width: 923px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-924px {
  width: 924px;
}

@media (min-width: 768px) {
  .w-md-924px {
    width: 924px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-925px {
  width: 925px;
}

@media (min-width: 768px) {
  .w-md-925px {
    width: 925px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-926px {
  width: 926px;
}

@media (min-width: 768px) {
  .w-md-926px {
    width: 926px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-927px {
  width: 927px;
}

@media (min-width: 768px) {
  .w-md-927px {
    width: 927px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-928px {
  width: 928px;
}

@media (min-width: 768px) {
  .w-md-928px {
    width: 928px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-929px {
  width: 929px;
}

@media (min-width: 768px) {
  .w-md-929px {
    width: 929px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-930px {
  width: 930px;
}

@media (min-width: 768px) {
  .w-md-930px {
    width: 930px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-931px {
  width: 931px;
}

@media (min-width: 768px) {
  .w-md-931px {
    width: 931px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-932px {
  width: 932px;
}

@media (min-width: 768px) {
  .w-md-932px {
    width: 932px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-933px {
  width: 933px;
}

@media (min-width: 768px) {
  .w-md-933px {
    width: 933px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-934px {
  width: 934px;
}

@media (min-width: 768px) {
  .w-md-934px {
    width: 934px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-935px {
  width: 935px;
}

@media (min-width: 768px) {
  .w-md-935px {
    width: 935px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-936px {
  width: 936px;
}

@media (min-width: 768px) {
  .w-md-936px {
    width: 936px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-937px {
  width: 937px;
}

@media (min-width: 768px) {
  .w-md-937px {
    width: 937px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-938px {
  width: 938px;
}

@media (min-width: 768px) {
  .w-md-938px {
    width: 938px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-939px {
  width: 939px;
}

@media (min-width: 768px) {
  .w-md-939px {
    width: 939px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-940px {
  width: 940px;
}

@media (min-width: 768px) {
  .w-md-940px {
    width: 940px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-941px {
  width: 941px;
}

@media (min-width: 768px) {
  .w-md-941px {
    width: 941px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-942px {
  width: 942px;
}

@media (min-width: 768px) {
  .w-md-942px {
    width: 942px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-943px {
  width: 943px;
}

@media (min-width: 768px) {
  .w-md-943px {
    width: 943px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-944px {
  width: 944px;
}

@media (min-width: 768px) {
  .w-md-944px {
    width: 944px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-945px {
  width: 945px;
}

@media (min-width: 768px) {
  .w-md-945px {
    width: 945px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-946px {
  width: 946px;
}

@media (min-width: 768px) {
  .w-md-946px {
    width: 946px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-947px {
  width: 947px;
}

@media (min-width: 768px) {
  .w-md-947px {
    width: 947px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-948px {
  width: 948px;
}

@media (min-width: 768px) {
  .w-md-948px {
    width: 948px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-949px {
  width: 949px;
}

@media (min-width: 768px) {
  .w-md-949px {
    width: 949px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-950px {
  width: 950px;
}

@media (min-width: 768px) {
  .w-md-950px {
    width: 950px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-951px {
  width: 951px;
}

@media (min-width: 768px) {
  .w-md-951px {
    width: 951px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-952px {
  width: 952px;
}

@media (min-width: 768px) {
  .w-md-952px {
    width: 952px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-953px {
  width: 953px;
}

@media (min-width: 768px) {
  .w-md-953px {
    width: 953px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-954px {
  width: 954px;
}

@media (min-width: 768px) {
  .w-md-954px {
    width: 954px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-955px {
  width: 955px;
}

@media (min-width: 768px) {
  .w-md-955px {
    width: 955px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-956px {
  width: 956px;
}

@media (min-width: 768px) {
  .w-md-956px {
    width: 956px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-957px {
  width: 957px;
}

@media (min-width: 768px) {
  .w-md-957px {
    width: 957px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-958px {
  width: 958px;
}

@media (min-width: 768px) {
  .w-md-958px {
    width: 958px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-959px {
  width: 959px;
}

@media (min-width: 768px) {
  .w-md-959px {
    width: 959px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-960px {
  width: 960px;
}

@media (min-width: 768px) {
  .w-md-960px {
    width: 960px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-961px {
  width: 961px;
}

@media (min-width: 768px) {
  .w-md-961px {
    width: 961px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-962px {
  width: 962px;
}

@media (min-width: 768px) {
  .w-md-962px {
    width: 962px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-963px {
  width: 963px;
}

@media (min-width: 768px) {
  .w-md-963px {
    width: 963px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-964px {
  width: 964px;
}

@media (min-width: 768px) {
  .w-md-964px {
    width: 964px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-965px {
  width: 965px;
}

@media (min-width: 768px) {
  .w-md-965px {
    width: 965px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-966px {
  width: 966px;
}

@media (min-width: 768px) {
  .w-md-966px {
    width: 966px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-967px {
  width: 967px;
}

@media (min-width: 768px) {
  .w-md-967px {
    width: 967px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-968px {
  width: 968px;
}

@media (min-width: 768px) {
  .w-md-968px {
    width: 968px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-969px {
  width: 969px;
}

@media (min-width: 768px) {
  .w-md-969px {
    width: 969px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-970px {
  width: 970px;
}

@media (min-width: 768px) {
  .w-md-970px {
    width: 970px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-971px {
  width: 971px;
}

@media (min-width: 768px) {
  .w-md-971px {
    width: 971px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-972px {
  width: 972px;
}

@media (min-width: 768px) {
  .w-md-972px {
    width: 972px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-973px {
  width: 973px;
}

@media (min-width: 768px) {
  .w-md-973px {
    width: 973px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-974px {
  width: 974px;
}

@media (min-width: 768px) {
  .w-md-974px {
    width: 974px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-975px {
  width: 975px;
}

@media (min-width: 768px) {
  .w-md-975px {
    width: 975px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-976px {
  width: 976px;
}

@media (min-width: 768px) {
  .w-md-976px {
    width: 976px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-977px {
  width: 977px;
}

@media (min-width: 768px) {
  .w-md-977px {
    width: 977px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-978px {
  width: 978px;
}

@media (min-width: 768px) {
  .w-md-978px {
    width: 978px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-979px {
  width: 979px;
}

@media (min-width: 768px) {
  .w-md-979px {
    width: 979px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-980px {
  width: 980px;
}

@media (min-width: 768px) {
  .w-md-980px {
    width: 980px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-981px {
  width: 981px;
}

@media (min-width: 768px) {
  .w-md-981px {
    width: 981px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-982px {
  width: 982px;
}

@media (min-width: 768px) {
  .w-md-982px {
    width: 982px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-983px {
  width: 983px;
}

@media (min-width: 768px) {
  .w-md-983px {
    width: 983px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-984px {
  width: 984px;
}

@media (min-width: 768px) {
  .w-md-984px {
    width: 984px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-985px {
  width: 985px;
}

@media (min-width: 768px) {
  .w-md-985px {
    width: 985px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-986px {
  width: 986px;
}

@media (min-width: 768px) {
  .w-md-986px {
    width: 986px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-987px {
  width: 987px;
}

@media (min-width: 768px) {
  .w-md-987px {
    width: 987px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-988px {
  width: 988px;
}

@media (min-width: 768px) {
  .w-md-988px {
    width: 988px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-989px {
  width: 989px;
}

@media (min-width: 768px) {
  .w-md-989px {
    width: 989px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-990px {
  width: 990px;
}

@media (min-width: 768px) {
  .w-md-990px {
    width: 990px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-991px {
  width: 991px;
}

@media (min-width: 768px) {
  .w-md-991px {
    width: 991px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-992px {
  width: 992px;
}

@media (min-width: 768px) {
  .w-md-992px {
    width: 992px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-993px {
  width: 993px;
}

@media (min-width: 768px) {
  .w-md-993px {
    width: 993px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-994px {
  width: 994px;
}

@media (min-width: 768px) {
  .w-md-994px {
    width: 994px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-995px {
  width: 995px;
}

@media (min-width: 768px) {
  .w-md-995px {
    width: 995px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-996px {
  width: 996px;
}

@media (min-width: 768px) {
  .w-md-996px {
    width: 996px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-997px {
  width: 997px;
}

@media (min-width: 768px) {
  .w-md-997px {
    width: 997px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-998px {
  width: 998px;
}

@media (min-width: 768px) {
  .w-md-998px {
    width: 998px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-999px {
  width: 999px;
}

@media (min-width: 768px) {
  .w-md-999px {
    width: 999px;
  }
  .w-md-auto {
    width: auto;
  }
}
.w-1000px {
  width: 1000px;
}

@media (min-width: 768px) {
  .w-md-1000px {
    width: 1000px;
  }
  .w-md-auto {
    width: auto;
  }
}
@media (min-width: 768px) {
  .mt-md-n1px {
    margin-top: -1px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n1px {
    margin-top: -1px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n1px {
    margin-top: -1px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n2px {
    margin-top: -2px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n2px {
    margin-top: -2px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n2px {
    margin-top: -2px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n3px {
    margin-top: -3px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n3px {
    margin-top: -3px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n3px {
    margin-top: -3px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n4px {
    margin-top: -4px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n4px {
    margin-top: -4px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n4px {
    margin-top: -4px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n5px {
    margin-top: -5px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n5px {
    margin-top: -5px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n5px {
    margin-top: -5px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n6px {
    margin-top: -6px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n6px {
    margin-top: -6px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n6px {
    margin-top: -6px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n7px {
    margin-top: -7px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n7px {
    margin-top: -7px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n7px {
    margin-top: -7px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n8px {
    margin-top: -8px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n8px {
    margin-top: -8px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n8px {
    margin-top: -8px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n9px {
    margin-top: -9px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n9px {
    margin-top: -9px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n9px {
    margin-top: -9px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n10px {
    margin-top: -10px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n10px {
    margin-top: -10px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n10px {
    margin-top: -10px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n11px {
    margin-top: -11px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n11px {
    margin-top: -11px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n11px {
    margin-top: -11px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n12px {
    margin-top: -12px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n12px {
    margin-top: -12px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n12px {
    margin-top: -12px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n13px {
    margin-top: -13px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n13px {
    margin-top: -13px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n13px {
    margin-top: -13px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n14px {
    margin-top: -14px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n14px {
    margin-top: -14px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n14px {
    margin-top: -14px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n15px {
    margin-top: -15px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n15px {
    margin-top: -15px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n15px {
    margin-top: -15px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n16px {
    margin-top: -16px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n16px {
    margin-top: -16px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n16px {
    margin-top: -16px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n17px {
    margin-top: -17px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n17px {
    margin-top: -17px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n17px {
    margin-top: -17px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n18px {
    margin-top: -18px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n18px {
    margin-top: -18px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n18px {
    margin-top: -18px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n19px {
    margin-top: -19px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n19px {
    margin-top: -19px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n19px {
    margin-top: -19px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n20px {
    margin-top: -20px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n20px {
    margin-top: -20px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n20px {
    margin-top: -20px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n21px {
    margin-top: -21px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n21px {
    margin-top: -21px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n21px {
    margin-top: -21px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n22px {
    margin-top: -22px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n22px {
    margin-top: -22px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n22px {
    margin-top: -22px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n23px {
    margin-top: -23px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n23px {
    margin-top: -23px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n23px {
    margin-top: -23px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n24px {
    margin-top: -24px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n24px {
    margin-top: -24px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n24px {
    margin-top: -24px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n25px {
    margin-top: -25px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n25px {
    margin-top: -25px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n25px {
    margin-top: -25px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n26px {
    margin-top: -26px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n26px {
    margin-top: -26px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n26px {
    margin-top: -26px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n27px {
    margin-top: -27px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n27px {
    margin-top: -27px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n27px {
    margin-top: -27px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n28px {
    margin-top: -28px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n28px {
    margin-top: -28px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n28px {
    margin-top: -28px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n29px {
    margin-top: -29px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n29px {
    margin-top: -29px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n29px {
    margin-top: -29px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n30px {
    margin-top: -30px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n30px {
    margin-top: -30px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n30px {
    margin-top: -30px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n31px {
    margin-top: -31px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n31px {
    margin-top: -31px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n31px {
    margin-top: -31px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n32px {
    margin-top: -32px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n32px {
    margin-top: -32px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n32px {
    margin-top: -32px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n33px {
    margin-top: -33px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n33px {
    margin-top: -33px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n33px {
    margin-top: -33px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n34px {
    margin-top: -34px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n34px {
    margin-top: -34px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n34px {
    margin-top: -34px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n35px {
    margin-top: -35px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n35px {
    margin-top: -35px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n35px {
    margin-top: -35px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n36px {
    margin-top: -36px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n36px {
    margin-top: -36px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n36px {
    margin-top: -36px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n37px {
    margin-top: -37px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n37px {
    margin-top: -37px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n37px {
    margin-top: -37px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n38px {
    margin-top: -38px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n38px {
    margin-top: -38px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n38px {
    margin-top: -38px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n39px {
    margin-top: -39px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n39px {
    margin-top: -39px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n39px {
    margin-top: -39px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n40px {
    margin-top: -40px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n40px {
    margin-top: -40px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n40px {
    margin-top: -40px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n41px {
    margin-top: -41px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n41px {
    margin-top: -41px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n41px {
    margin-top: -41px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n42px {
    margin-top: -42px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n42px {
    margin-top: -42px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n42px {
    margin-top: -42px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n43px {
    margin-top: -43px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n43px {
    margin-top: -43px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n43px {
    margin-top: -43px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n44px {
    margin-top: -44px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n44px {
    margin-top: -44px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n44px {
    margin-top: -44px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n45px {
    margin-top: -45px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n45px {
    margin-top: -45px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n45px {
    margin-top: -45px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n46px {
    margin-top: -46px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n46px {
    margin-top: -46px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n46px {
    margin-top: -46px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n47px {
    margin-top: -47px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n47px {
    margin-top: -47px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n47px {
    margin-top: -47px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n48px {
    margin-top: -48px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n48px {
    margin-top: -48px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n48px {
    margin-top: -48px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n49px {
    margin-top: -49px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n49px {
    margin-top: -49px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n49px {
    margin-top: -49px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n50px {
    margin-top: -50px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n50px {
    margin-top: -50px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n50px {
    margin-top: -50px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n51px {
    margin-top: -51px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n51px {
    margin-top: -51px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n51px {
    margin-top: -51px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n52px {
    margin-top: -52px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n52px {
    margin-top: -52px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n52px {
    margin-top: -52px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n53px {
    margin-top: -53px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n53px {
    margin-top: -53px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n53px {
    margin-top: -53px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n54px {
    margin-top: -54px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n54px {
    margin-top: -54px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n54px {
    margin-top: -54px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n55px {
    margin-top: -55px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n55px {
    margin-top: -55px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n55px {
    margin-top: -55px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n56px {
    margin-top: -56px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n56px {
    margin-top: -56px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n56px {
    margin-top: -56px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n57px {
    margin-top: -57px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n57px {
    margin-top: -57px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n57px {
    margin-top: -57px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n58px {
    margin-top: -58px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n58px {
    margin-top: -58px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n58px {
    margin-top: -58px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n59px {
    margin-top: -59px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n59px {
    margin-top: -59px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n59px {
    margin-top: -59px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n60px {
    margin-top: -60px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n60px {
    margin-top: -60px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n60px {
    margin-top: -60px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n61px {
    margin-top: -61px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n61px {
    margin-top: -61px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n61px {
    margin-top: -61px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n62px {
    margin-top: -62px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n62px {
    margin-top: -62px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n62px {
    margin-top: -62px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n63px {
    margin-top: -63px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n63px {
    margin-top: -63px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n63px {
    margin-top: -63px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n64px {
    margin-top: -64px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n64px {
    margin-top: -64px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n64px {
    margin-top: -64px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n65px {
    margin-top: -65px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n65px {
    margin-top: -65px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n65px {
    margin-top: -65px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n66px {
    margin-top: -66px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n66px {
    margin-top: -66px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n66px {
    margin-top: -66px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n67px {
    margin-top: -67px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n67px {
    margin-top: -67px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n67px {
    margin-top: -67px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n68px {
    margin-top: -68px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n68px {
    margin-top: -68px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n68px {
    margin-top: -68px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n69px {
    margin-top: -69px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n69px {
    margin-top: -69px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n69px {
    margin-top: -69px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n70px {
    margin-top: -70px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n70px {
    margin-top: -70px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n70px {
    margin-top: -70px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n71px {
    margin-top: -71px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n71px {
    margin-top: -71px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n71px {
    margin-top: -71px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n72px {
    margin-top: -72px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n72px {
    margin-top: -72px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n72px {
    margin-top: -72px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n73px {
    margin-top: -73px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n73px {
    margin-top: -73px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n73px {
    margin-top: -73px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n74px {
    margin-top: -74px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n74px {
    margin-top: -74px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n74px {
    margin-top: -74px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n75px {
    margin-top: -75px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n75px {
    margin-top: -75px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n75px {
    margin-top: -75px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n76px {
    margin-top: -76px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n76px {
    margin-top: -76px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n76px {
    margin-top: -76px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n77px {
    margin-top: -77px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n77px {
    margin-top: -77px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n77px {
    margin-top: -77px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n78px {
    margin-top: -78px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n78px {
    margin-top: -78px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n78px {
    margin-top: -78px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n79px {
    margin-top: -79px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n79px {
    margin-top: -79px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n79px {
    margin-top: -79px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n80px {
    margin-top: -80px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n80px {
    margin-top: -80px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n80px {
    margin-top: -80px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n81px {
    margin-top: -81px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n81px {
    margin-top: -81px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n81px {
    margin-top: -81px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n82px {
    margin-top: -82px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n82px {
    margin-top: -82px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n82px {
    margin-top: -82px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n83px {
    margin-top: -83px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n83px {
    margin-top: -83px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n83px {
    margin-top: -83px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n84px {
    margin-top: -84px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n84px {
    margin-top: -84px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n84px {
    margin-top: -84px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n85px {
    margin-top: -85px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n85px {
    margin-top: -85px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n85px {
    margin-top: -85px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n86px {
    margin-top: -86px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n86px {
    margin-top: -86px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n86px {
    margin-top: -86px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n87px {
    margin-top: -87px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n87px {
    margin-top: -87px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n87px {
    margin-top: -87px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n88px {
    margin-top: -88px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n88px {
    margin-top: -88px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n88px {
    margin-top: -88px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n89px {
    margin-top: -89px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n89px {
    margin-top: -89px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n89px {
    margin-top: -89px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n90px {
    margin-top: -90px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n90px {
    margin-top: -90px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n90px {
    margin-top: -90px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n91px {
    margin-top: -91px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n91px {
    margin-top: -91px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n91px {
    margin-top: -91px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n92px {
    margin-top: -92px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n92px {
    margin-top: -92px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n92px {
    margin-top: -92px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n93px {
    margin-top: -93px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n93px {
    margin-top: -93px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n93px {
    margin-top: -93px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n94px {
    margin-top: -94px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n94px {
    margin-top: -94px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n94px {
    margin-top: -94px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n95px {
    margin-top: -95px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n95px {
    margin-top: -95px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n95px {
    margin-top: -95px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n96px {
    margin-top: -96px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n96px {
    margin-top: -96px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n96px {
    margin-top: -96px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n97px {
    margin-top: -97px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n97px {
    margin-top: -97px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n97px {
    margin-top: -97px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n98px {
    margin-top: -98px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n98px {
    margin-top: -98px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n98px {
    margin-top: -98px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n99px {
    margin-top: -99px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n99px {
    margin-top: -99px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n99px {
    margin-top: -99px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n100px {
    margin-top: -100px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n100px {
    margin-top: -100px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n100px {
    margin-top: -100px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n101px {
    margin-top: -101px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n101px {
    margin-top: -101px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n101px {
    margin-top: -101px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n102px {
    margin-top: -102px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n102px {
    margin-top: -102px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n102px {
    margin-top: -102px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n103px {
    margin-top: -103px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n103px {
    margin-top: -103px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n103px {
    margin-top: -103px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n104px {
    margin-top: -104px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n104px {
    margin-top: -104px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n104px {
    margin-top: -104px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n105px {
    margin-top: -105px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n105px {
    margin-top: -105px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n105px {
    margin-top: -105px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n106px {
    margin-top: -106px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n106px {
    margin-top: -106px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n106px {
    margin-top: -106px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n107px {
    margin-top: -107px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n107px {
    margin-top: -107px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n107px {
    margin-top: -107px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n108px {
    margin-top: -108px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n108px {
    margin-top: -108px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n108px {
    margin-top: -108px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n109px {
    margin-top: -109px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n109px {
    margin-top: -109px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n109px {
    margin-top: -109px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n110px {
    margin-top: -110px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n110px {
    margin-top: -110px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n110px {
    margin-top: -110px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n111px {
    margin-top: -111px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n111px {
    margin-top: -111px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n111px {
    margin-top: -111px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n112px {
    margin-top: -112px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n112px {
    margin-top: -112px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n112px {
    margin-top: -112px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n113px {
    margin-top: -113px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n113px {
    margin-top: -113px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n113px {
    margin-top: -113px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n114px {
    margin-top: -114px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n114px {
    margin-top: -114px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n114px {
    margin-top: -114px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n115px {
    margin-top: -115px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n115px {
    margin-top: -115px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n115px {
    margin-top: -115px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n116px {
    margin-top: -116px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n116px {
    margin-top: -116px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n116px {
    margin-top: -116px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n117px {
    margin-top: -117px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n117px {
    margin-top: -117px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n117px {
    margin-top: -117px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n118px {
    margin-top: -118px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n118px {
    margin-top: -118px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n118px {
    margin-top: -118px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n119px {
    margin-top: -119px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n119px {
    margin-top: -119px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n119px {
    margin-top: -119px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n120px {
    margin-top: -120px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n120px {
    margin-top: -120px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n120px {
    margin-top: -120px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n121px {
    margin-top: -121px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n121px {
    margin-top: -121px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n121px {
    margin-top: -121px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n122px {
    margin-top: -122px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n122px {
    margin-top: -122px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n122px {
    margin-top: -122px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n123px {
    margin-top: -123px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n123px {
    margin-top: -123px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n123px {
    margin-top: -123px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n124px {
    margin-top: -124px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n124px {
    margin-top: -124px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n124px {
    margin-top: -124px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n125px {
    margin-top: -125px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n125px {
    margin-top: -125px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n125px {
    margin-top: -125px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n126px {
    margin-top: -126px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n126px {
    margin-top: -126px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n126px {
    margin-top: -126px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n127px {
    margin-top: -127px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n127px {
    margin-top: -127px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n127px {
    margin-top: -127px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n128px {
    margin-top: -128px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n128px {
    margin-top: -128px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n128px {
    margin-top: -128px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n129px {
    margin-top: -129px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n129px {
    margin-top: -129px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n129px {
    margin-top: -129px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n130px {
    margin-top: -130px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n130px {
    margin-top: -130px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n130px {
    margin-top: -130px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n131px {
    margin-top: -131px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n131px {
    margin-top: -131px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n131px {
    margin-top: -131px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n132px {
    margin-top: -132px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n132px {
    margin-top: -132px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n132px {
    margin-top: -132px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n133px {
    margin-top: -133px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n133px {
    margin-top: -133px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n133px {
    margin-top: -133px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n134px {
    margin-top: -134px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n134px {
    margin-top: -134px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n134px {
    margin-top: -134px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n135px {
    margin-top: -135px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n135px {
    margin-top: -135px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n135px {
    margin-top: -135px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n136px {
    margin-top: -136px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n136px {
    margin-top: -136px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n136px {
    margin-top: -136px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n137px {
    margin-top: -137px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n137px {
    margin-top: -137px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n137px {
    margin-top: -137px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n138px {
    margin-top: -138px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n138px {
    margin-top: -138px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n138px {
    margin-top: -138px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n139px {
    margin-top: -139px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n139px {
    margin-top: -139px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n139px {
    margin-top: -139px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n140px {
    margin-top: -140px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n140px {
    margin-top: -140px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n140px {
    margin-top: -140px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n141px {
    margin-top: -141px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n141px {
    margin-top: -141px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n141px {
    margin-top: -141px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n142px {
    margin-top: -142px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n142px {
    margin-top: -142px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n142px {
    margin-top: -142px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n143px {
    margin-top: -143px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n143px {
    margin-top: -143px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n143px {
    margin-top: -143px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n144px {
    margin-top: -144px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n144px {
    margin-top: -144px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n144px {
    margin-top: -144px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n145px {
    margin-top: -145px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n145px {
    margin-top: -145px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n145px {
    margin-top: -145px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n146px {
    margin-top: -146px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n146px {
    margin-top: -146px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n146px {
    margin-top: -146px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n147px {
    margin-top: -147px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n147px {
    margin-top: -147px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n147px {
    margin-top: -147px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n148px {
    margin-top: -148px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n148px {
    margin-top: -148px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n148px {
    margin-top: -148px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n149px {
    margin-top: -149px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n149px {
    margin-top: -149px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n149px {
    margin-top: -149px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n150px {
    margin-top: -150px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n150px {
    margin-top: -150px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n150px {
    margin-top: -150px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n151px {
    margin-top: -151px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n151px {
    margin-top: -151px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n151px {
    margin-top: -151px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n152px {
    margin-top: -152px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n152px {
    margin-top: -152px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n152px {
    margin-top: -152px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n153px {
    margin-top: -153px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n153px {
    margin-top: -153px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n153px {
    margin-top: -153px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n154px {
    margin-top: -154px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n154px {
    margin-top: -154px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n154px {
    margin-top: -154px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n155px {
    margin-top: -155px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n155px {
    margin-top: -155px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n155px {
    margin-top: -155px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n156px {
    margin-top: -156px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n156px {
    margin-top: -156px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n156px {
    margin-top: -156px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n157px {
    margin-top: -157px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n157px {
    margin-top: -157px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n157px {
    margin-top: -157px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n158px {
    margin-top: -158px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n158px {
    margin-top: -158px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n158px {
    margin-top: -158px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n159px {
    margin-top: -159px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n159px {
    margin-top: -159px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n159px {
    margin-top: -159px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n160px {
    margin-top: -160px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n160px {
    margin-top: -160px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n160px {
    margin-top: -160px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n161px {
    margin-top: -161px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n161px {
    margin-top: -161px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n161px {
    margin-top: -161px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n162px {
    margin-top: -162px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n162px {
    margin-top: -162px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n162px {
    margin-top: -162px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n163px {
    margin-top: -163px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n163px {
    margin-top: -163px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n163px {
    margin-top: -163px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n164px {
    margin-top: -164px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n164px {
    margin-top: -164px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n164px {
    margin-top: -164px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n165px {
    margin-top: -165px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n165px {
    margin-top: -165px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n165px {
    margin-top: -165px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n166px {
    margin-top: -166px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n166px {
    margin-top: -166px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n166px {
    margin-top: -166px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n167px {
    margin-top: -167px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n167px {
    margin-top: -167px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n167px {
    margin-top: -167px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n168px {
    margin-top: -168px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n168px {
    margin-top: -168px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n168px {
    margin-top: -168px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n169px {
    margin-top: -169px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n169px {
    margin-top: -169px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n169px {
    margin-top: -169px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n170px {
    margin-top: -170px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n170px {
    margin-top: -170px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n170px {
    margin-top: -170px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n171px {
    margin-top: -171px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n171px {
    margin-top: -171px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n171px {
    margin-top: -171px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n172px {
    margin-top: -172px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n172px {
    margin-top: -172px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n172px {
    margin-top: -172px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n173px {
    margin-top: -173px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n173px {
    margin-top: -173px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n173px {
    margin-top: -173px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n174px {
    margin-top: -174px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n174px {
    margin-top: -174px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n174px {
    margin-top: -174px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n175px {
    margin-top: -175px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n175px {
    margin-top: -175px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n175px {
    margin-top: -175px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n176px {
    margin-top: -176px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n176px {
    margin-top: -176px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n176px {
    margin-top: -176px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n177px {
    margin-top: -177px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n177px {
    margin-top: -177px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n177px {
    margin-top: -177px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n178px {
    margin-top: -178px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n178px {
    margin-top: -178px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n178px {
    margin-top: -178px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n179px {
    margin-top: -179px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n179px {
    margin-top: -179px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n179px {
    margin-top: -179px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n180px {
    margin-top: -180px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n180px {
    margin-top: -180px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n180px {
    margin-top: -180px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n181px {
    margin-top: -181px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n181px {
    margin-top: -181px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n181px {
    margin-top: -181px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n182px {
    margin-top: -182px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n182px {
    margin-top: -182px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n182px {
    margin-top: -182px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n183px {
    margin-top: -183px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n183px {
    margin-top: -183px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n183px {
    margin-top: -183px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n184px {
    margin-top: -184px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n184px {
    margin-top: -184px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n184px {
    margin-top: -184px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n185px {
    margin-top: -185px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n185px {
    margin-top: -185px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n185px {
    margin-top: -185px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n186px {
    margin-top: -186px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n186px {
    margin-top: -186px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n186px {
    margin-top: -186px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n187px {
    margin-top: -187px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n187px {
    margin-top: -187px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n187px {
    margin-top: -187px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n188px {
    margin-top: -188px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n188px {
    margin-top: -188px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n188px {
    margin-top: -188px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n189px {
    margin-top: -189px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n189px {
    margin-top: -189px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n189px {
    margin-top: -189px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n190px {
    margin-top: -190px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n190px {
    margin-top: -190px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n190px {
    margin-top: -190px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n191px {
    margin-top: -191px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n191px {
    margin-top: -191px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n191px {
    margin-top: -191px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n192px {
    margin-top: -192px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n192px {
    margin-top: -192px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n192px {
    margin-top: -192px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n193px {
    margin-top: -193px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n193px {
    margin-top: -193px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n193px {
    margin-top: -193px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n194px {
    margin-top: -194px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n194px {
    margin-top: -194px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n194px {
    margin-top: -194px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n195px {
    margin-top: -195px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n195px {
    margin-top: -195px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n195px {
    margin-top: -195px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n196px {
    margin-top: -196px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n196px {
    margin-top: -196px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n196px {
    margin-top: -196px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n197px {
    margin-top: -197px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n197px {
    margin-top: -197px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n197px {
    margin-top: -197px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n198px {
    margin-top: -198px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n198px {
    margin-top: -198px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n198px {
    margin-top: -198px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n199px {
    margin-top: -199px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n199px {
    margin-top: -199px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n199px {
    margin-top: -199px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n200px {
    margin-top: -200px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n200px {
    margin-top: -200px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n200px {
    margin-top: -200px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n201px {
    margin-top: -201px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n201px {
    margin-top: -201px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n201px {
    margin-top: -201px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n202px {
    margin-top: -202px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n202px {
    margin-top: -202px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n202px {
    margin-top: -202px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n203px {
    margin-top: -203px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n203px {
    margin-top: -203px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n203px {
    margin-top: -203px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n204px {
    margin-top: -204px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n204px {
    margin-top: -204px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n204px {
    margin-top: -204px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n205px {
    margin-top: -205px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n205px {
    margin-top: -205px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n205px {
    margin-top: -205px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n206px {
    margin-top: -206px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n206px {
    margin-top: -206px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n206px {
    margin-top: -206px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n207px {
    margin-top: -207px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n207px {
    margin-top: -207px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n207px {
    margin-top: -207px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n208px {
    margin-top: -208px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n208px {
    margin-top: -208px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n208px {
    margin-top: -208px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n209px {
    margin-top: -209px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n209px {
    margin-top: -209px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n209px {
    margin-top: -209px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n210px {
    margin-top: -210px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n210px {
    margin-top: -210px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n210px {
    margin-top: -210px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n211px {
    margin-top: -211px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n211px {
    margin-top: -211px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n211px {
    margin-top: -211px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n212px {
    margin-top: -212px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n212px {
    margin-top: -212px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n212px {
    margin-top: -212px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n213px {
    margin-top: -213px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n213px {
    margin-top: -213px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n213px {
    margin-top: -213px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n214px {
    margin-top: -214px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n214px {
    margin-top: -214px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n214px {
    margin-top: -214px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n215px {
    margin-top: -215px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n215px {
    margin-top: -215px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n215px {
    margin-top: -215px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n216px {
    margin-top: -216px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n216px {
    margin-top: -216px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n216px {
    margin-top: -216px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n217px {
    margin-top: -217px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n217px {
    margin-top: -217px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n217px {
    margin-top: -217px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n218px {
    margin-top: -218px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n218px {
    margin-top: -218px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n218px {
    margin-top: -218px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n219px {
    margin-top: -219px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n219px {
    margin-top: -219px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n219px {
    margin-top: -219px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n220px {
    margin-top: -220px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n220px {
    margin-top: -220px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n220px {
    margin-top: -220px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n221px {
    margin-top: -221px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n221px {
    margin-top: -221px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n221px {
    margin-top: -221px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n222px {
    margin-top: -222px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n222px {
    margin-top: -222px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n222px {
    margin-top: -222px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n223px {
    margin-top: -223px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n223px {
    margin-top: -223px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n223px {
    margin-top: -223px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n224px {
    margin-top: -224px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n224px {
    margin-top: -224px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n224px {
    margin-top: -224px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n225px {
    margin-top: -225px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n225px {
    margin-top: -225px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n225px {
    margin-top: -225px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n226px {
    margin-top: -226px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n226px {
    margin-top: -226px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n226px {
    margin-top: -226px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n227px {
    margin-top: -227px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n227px {
    margin-top: -227px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n227px {
    margin-top: -227px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n228px {
    margin-top: -228px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n228px {
    margin-top: -228px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n228px {
    margin-top: -228px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n229px {
    margin-top: -229px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n229px {
    margin-top: -229px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n229px {
    margin-top: -229px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n230px {
    margin-top: -230px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n230px {
    margin-top: -230px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n230px {
    margin-top: -230px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n231px {
    margin-top: -231px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n231px {
    margin-top: -231px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n231px {
    margin-top: -231px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n232px {
    margin-top: -232px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n232px {
    margin-top: -232px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n232px {
    margin-top: -232px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n233px {
    margin-top: -233px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n233px {
    margin-top: -233px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n233px {
    margin-top: -233px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n234px {
    margin-top: -234px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n234px {
    margin-top: -234px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n234px {
    margin-top: -234px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n235px {
    margin-top: -235px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n235px {
    margin-top: -235px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n235px {
    margin-top: -235px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n236px {
    margin-top: -236px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n236px {
    margin-top: -236px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n236px {
    margin-top: -236px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n237px {
    margin-top: -237px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n237px {
    margin-top: -237px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n237px {
    margin-top: -237px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n238px {
    margin-top: -238px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n238px {
    margin-top: -238px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n238px {
    margin-top: -238px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n239px {
    margin-top: -239px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n239px {
    margin-top: -239px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n239px {
    margin-top: -239px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n240px {
    margin-top: -240px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n240px {
    margin-top: -240px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n240px {
    margin-top: -240px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n241px {
    margin-top: -241px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n241px {
    margin-top: -241px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n241px {
    margin-top: -241px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n242px {
    margin-top: -242px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n242px {
    margin-top: -242px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n242px {
    margin-top: -242px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n243px {
    margin-top: -243px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n243px {
    margin-top: -243px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n243px {
    margin-top: -243px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n244px {
    margin-top: -244px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n244px {
    margin-top: -244px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n244px {
    margin-top: -244px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n245px {
    margin-top: -245px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n245px {
    margin-top: -245px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n245px {
    margin-top: -245px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n246px {
    margin-top: -246px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n246px {
    margin-top: -246px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n246px {
    margin-top: -246px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n247px {
    margin-top: -247px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n247px {
    margin-top: -247px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n247px {
    margin-top: -247px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n248px {
    margin-top: -248px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n248px {
    margin-top: -248px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n248px {
    margin-top: -248px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n249px {
    margin-top: -249px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n249px {
    margin-top: -249px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n249px {
    margin-top: -249px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n250px {
    margin-top: -250px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n250px {
    margin-top: -250px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n250px {
    margin-top: -250px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n251px {
    margin-top: -251px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n251px {
    margin-top: -251px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n251px {
    margin-top: -251px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n252px {
    margin-top: -252px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n252px {
    margin-top: -252px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n252px {
    margin-top: -252px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n253px {
    margin-top: -253px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n253px {
    margin-top: -253px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n253px {
    margin-top: -253px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n254px {
    margin-top: -254px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n254px {
    margin-top: -254px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n254px {
    margin-top: -254px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n255px {
    margin-top: -255px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n255px {
    margin-top: -255px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n255px {
    margin-top: -255px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n256px {
    margin-top: -256px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n256px {
    margin-top: -256px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n256px {
    margin-top: -256px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n257px {
    margin-top: -257px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n257px {
    margin-top: -257px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n257px {
    margin-top: -257px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n258px {
    margin-top: -258px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n258px {
    margin-top: -258px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n258px {
    margin-top: -258px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n259px {
    margin-top: -259px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n259px {
    margin-top: -259px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n259px {
    margin-top: -259px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n260px {
    margin-top: -260px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n260px {
    margin-top: -260px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n260px {
    margin-top: -260px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n261px {
    margin-top: -261px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n261px {
    margin-top: -261px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n261px {
    margin-top: -261px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n262px {
    margin-top: -262px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n262px {
    margin-top: -262px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n262px {
    margin-top: -262px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n263px {
    margin-top: -263px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n263px {
    margin-top: -263px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n263px {
    margin-top: -263px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n264px {
    margin-top: -264px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n264px {
    margin-top: -264px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n264px {
    margin-top: -264px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n265px {
    margin-top: -265px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n265px {
    margin-top: -265px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n265px {
    margin-top: -265px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n266px {
    margin-top: -266px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n266px {
    margin-top: -266px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n266px {
    margin-top: -266px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n267px {
    margin-top: -267px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n267px {
    margin-top: -267px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n267px {
    margin-top: -267px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n268px {
    margin-top: -268px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n268px {
    margin-top: -268px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n268px {
    margin-top: -268px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n269px {
    margin-top: -269px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n269px {
    margin-top: -269px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n269px {
    margin-top: -269px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n270px {
    margin-top: -270px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n270px {
    margin-top: -270px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n270px {
    margin-top: -270px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n271px {
    margin-top: -271px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n271px {
    margin-top: -271px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n271px {
    margin-top: -271px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n272px {
    margin-top: -272px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n272px {
    margin-top: -272px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n272px {
    margin-top: -272px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n273px {
    margin-top: -273px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n273px {
    margin-top: -273px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n273px {
    margin-top: -273px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n274px {
    margin-top: -274px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n274px {
    margin-top: -274px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n274px {
    margin-top: -274px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n275px {
    margin-top: -275px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n275px {
    margin-top: -275px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n275px {
    margin-top: -275px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n276px {
    margin-top: -276px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n276px {
    margin-top: -276px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n276px {
    margin-top: -276px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n277px {
    margin-top: -277px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n277px {
    margin-top: -277px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n277px {
    margin-top: -277px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n278px {
    margin-top: -278px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n278px {
    margin-top: -278px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n278px {
    margin-top: -278px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n279px {
    margin-top: -279px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n279px {
    margin-top: -279px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n279px {
    margin-top: -279px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n280px {
    margin-top: -280px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n280px {
    margin-top: -280px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n280px {
    margin-top: -280px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n281px {
    margin-top: -281px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n281px {
    margin-top: -281px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n281px {
    margin-top: -281px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n282px {
    margin-top: -282px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n282px {
    margin-top: -282px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n282px {
    margin-top: -282px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n283px {
    margin-top: -283px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n283px {
    margin-top: -283px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n283px {
    margin-top: -283px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n284px {
    margin-top: -284px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n284px {
    margin-top: -284px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n284px {
    margin-top: -284px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n285px {
    margin-top: -285px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n285px {
    margin-top: -285px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n285px {
    margin-top: -285px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n286px {
    margin-top: -286px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n286px {
    margin-top: -286px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n286px {
    margin-top: -286px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n287px {
    margin-top: -287px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n287px {
    margin-top: -287px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n287px {
    margin-top: -287px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n288px {
    margin-top: -288px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n288px {
    margin-top: -288px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n288px {
    margin-top: -288px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n289px {
    margin-top: -289px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n289px {
    margin-top: -289px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n289px {
    margin-top: -289px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n290px {
    margin-top: -290px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n290px {
    margin-top: -290px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n290px {
    margin-top: -290px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n291px {
    margin-top: -291px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n291px {
    margin-top: -291px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n291px {
    margin-top: -291px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n292px {
    margin-top: -292px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n292px {
    margin-top: -292px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n292px {
    margin-top: -292px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n293px {
    margin-top: -293px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n293px {
    margin-top: -293px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n293px {
    margin-top: -293px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n294px {
    margin-top: -294px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n294px {
    margin-top: -294px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n294px {
    margin-top: -294px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n295px {
    margin-top: -295px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n295px {
    margin-top: -295px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n295px {
    margin-top: -295px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n296px {
    margin-top: -296px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n296px {
    margin-top: -296px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n296px {
    margin-top: -296px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n297px {
    margin-top: -297px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n297px {
    margin-top: -297px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n297px {
    margin-top: -297px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n298px {
    margin-top: -298px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n298px {
    margin-top: -298px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n298px {
    margin-top: -298px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n299px {
    margin-top: -299px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n299px {
    margin-top: -299px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n299px {
    margin-top: -299px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n300px {
    margin-top: -300px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n300px {
    margin-top: -300px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n300px {
    margin-top: -300px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n301px {
    margin-top: -301px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n301px {
    margin-top: -301px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n301px {
    margin-top: -301px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n302px {
    margin-top: -302px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n302px {
    margin-top: -302px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n302px {
    margin-top: -302px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n303px {
    margin-top: -303px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n303px {
    margin-top: -303px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n303px {
    margin-top: -303px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n304px {
    margin-top: -304px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n304px {
    margin-top: -304px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n304px {
    margin-top: -304px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n305px {
    margin-top: -305px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n305px {
    margin-top: -305px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n305px {
    margin-top: -305px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n306px {
    margin-top: -306px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n306px {
    margin-top: -306px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n306px {
    margin-top: -306px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n307px {
    margin-top: -307px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n307px {
    margin-top: -307px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n307px {
    margin-top: -307px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n308px {
    margin-top: -308px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n308px {
    margin-top: -308px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n308px {
    margin-top: -308px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n309px {
    margin-top: -309px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n309px {
    margin-top: -309px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n309px {
    margin-top: -309px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n310px {
    margin-top: -310px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n310px {
    margin-top: -310px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n310px {
    margin-top: -310px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n311px {
    margin-top: -311px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n311px {
    margin-top: -311px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n311px {
    margin-top: -311px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n312px {
    margin-top: -312px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n312px {
    margin-top: -312px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n312px {
    margin-top: -312px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n313px {
    margin-top: -313px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n313px {
    margin-top: -313px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n313px {
    margin-top: -313px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n314px {
    margin-top: -314px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n314px {
    margin-top: -314px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n314px {
    margin-top: -314px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n315px {
    margin-top: -315px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n315px {
    margin-top: -315px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n315px {
    margin-top: -315px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n316px {
    margin-top: -316px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n316px {
    margin-top: -316px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n316px {
    margin-top: -316px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n317px {
    margin-top: -317px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n317px {
    margin-top: -317px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n317px {
    margin-top: -317px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n318px {
    margin-top: -318px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n318px {
    margin-top: -318px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n318px {
    margin-top: -318px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n319px {
    margin-top: -319px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n319px {
    margin-top: -319px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n319px {
    margin-top: -319px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n320px {
    margin-top: -320px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n320px {
    margin-top: -320px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n320px {
    margin-top: -320px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n321px {
    margin-top: -321px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n321px {
    margin-top: -321px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n321px {
    margin-top: -321px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n322px {
    margin-top: -322px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n322px {
    margin-top: -322px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n322px {
    margin-top: -322px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n323px {
    margin-top: -323px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n323px {
    margin-top: -323px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n323px {
    margin-top: -323px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n324px {
    margin-top: -324px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n324px {
    margin-top: -324px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n324px {
    margin-top: -324px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n325px {
    margin-top: -325px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n325px {
    margin-top: -325px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n325px {
    margin-top: -325px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n326px {
    margin-top: -326px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n326px {
    margin-top: -326px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n326px {
    margin-top: -326px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n327px {
    margin-top: -327px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n327px {
    margin-top: -327px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n327px {
    margin-top: -327px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n328px {
    margin-top: -328px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n328px {
    margin-top: -328px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n328px {
    margin-top: -328px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n329px {
    margin-top: -329px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n329px {
    margin-top: -329px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n329px {
    margin-top: -329px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n330px {
    margin-top: -330px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n330px {
    margin-top: -330px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n330px {
    margin-top: -330px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n331px {
    margin-top: -331px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n331px {
    margin-top: -331px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n331px {
    margin-top: -331px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n332px {
    margin-top: -332px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n332px {
    margin-top: -332px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n332px {
    margin-top: -332px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n333px {
    margin-top: -333px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n333px {
    margin-top: -333px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n333px {
    margin-top: -333px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n334px {
    margin-top: -334px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n334px {
    margin-top: -334px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n334px {
    margin-top: -334px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n335px {
    margin-top: -335px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n335px {
    margin-top: -335px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n335px {
    margin-top: -335px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n336px {
    margin-top: -336px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n336px {
    margin-top: -336px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n336px {
    margin-top: -336px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n337px {
    margin-top: -337px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n337px {
    margin-top: -337px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n337px {
    margin-top: -337px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n338px {
    margin-top: -338px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n338px {
    margin-top: -338px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n338px {
    margin-top: -338px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n339px {
    margin-top: -339px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n339px {
    margin-top: -339px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n339px {
    margin-top: -339px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n340px {
    margin-top: -340px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n340px {
    margin-top: -340px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n340px {
    margin-top: -340px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n341px {
    margin-top: -341px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n341px {
    margin-top: -341px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n341px {
    margin-top: -341px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n342px {
    margin-top: -342px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n342px {
    margin-top: -342px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n342px {
    margin-top: -342px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n343px {
    margin-top: -343px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n343px {
    margin-top: -343px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n343px {
    margin-top: -343px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n344px {
    margin-top: -344px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n344px {
    margin-top: -344px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n344px {
    margin-top: -344px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n345px {
    margin-top: -345px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n345px {
    margin-top: -345px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n345px {
    margin-top: -345px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n346px {
    margin-top: -346px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n346px {
    margin-top: -346px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n346px {
    margin-top: -346px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n347px {
    margin-top: -347px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n347px {
    margin-top: -347px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n347px {
    margin-top: -347px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n348px {
    margin-top: -348px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n348px {
    margin-top: -348px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n348px {
    margin-top: -348px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n349px {
    margin-top: -349px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n349px {
    margin-top: -349px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n349px {
    margin-top: -349px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n350px {
    margin-top: -350px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n350px {
    margin-top: -350px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n350px {
    margin-top: -350px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n351px {
    margin-top: -351px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n351px {
    margin-top: -351px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n351px {
    margin-top: -351px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n352px {
    margin-top: -352px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n352px {
    margin-top: -352px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n352px {
    margin-top: -352px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n353px {
    margin-top: -353px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n353px {
    margin-top: -353px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n353px {
    margin-top: -353px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n354px {
    margin-top: -354px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n354px {
    margin-top: -354px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n354px {
    margin-top: -354px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n355px {
    margin-top: -355px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n355px {
    margin-top: -355px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n355px {
    margin-top: -355px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n356px {
    margin-top: -356px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n356px {
    margin-top: -356px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n356px {
    margin-top: -356px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n357px {
    margin-top: -357px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n357px {
    margin-top: -357px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n357px {
    margin-top: -357px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n358px {
    margin-top: -358px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n358px {
    margin-top: -358px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n358px {
    margin-top: -358px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n359px {
    margin-top: -359px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n359px {
    margin-top: -359px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n359px {
    margin-top: -359px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n360px {
    margin-top: -360px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n360px {
    margin-top: -360px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n360px {
    margin-top: -360px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n361px {
    margin-top: -361px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n361px {
    margin-top: -361px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n361px {
    margin-top: -361px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n362px {
    margin-top: -362px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n362px {
    margin-top: -362px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n362px {
    margin-top: -362px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n363px {
    margin-top: -363px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n363px {
    margin-top: -363px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n363px {
    margin-top: -363px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n364px {
    margin-top: -364px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n364px {
    margin-top: -364px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n364px {
    margin-top: -364px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n365px {
    margin-top: -365px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n365px {
    margin-top: -365px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n365px {
    margin-top: -365px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n366px {
    margin-top: -366px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n366px {
    margin-top: -366px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n366px {
    margin-top: -366px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n367px {
    margin-top: -367px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n367px {
    margin-top: -367px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n367px {
    margin-top: -367px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n368px {
    margin-top: -368px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n368px {
    margin-top: -368px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n368px {
    margin-top: -368px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n369px {
    margin-top: -369px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n369px {
    margin-top: -369px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n369px {
    margin-top: -369px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n370px {
    margin-top: -370px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n370px {
    margin-top: -370px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n370px {
    margin-top: -370px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n371px {
    margin-top: -371px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n371px {
    margin-top: -371px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n371px {
    margin-top: -371px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n372px {
    margin-top: -372px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n372px {
    margin-top: -372px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n372px {
    margin-top: -372px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n373px {
    margin-top: -373px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n373px {
    margin-top: -373px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n373px {
    margin-top: -373px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n374px {
    margin-top: -374px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n374px {
    margin-top: -374px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n374px {
    margin-top: -374px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n375px {
    margin-top: -375px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n375px {
    margin-top: -375px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n375px {
    margin-top: -375px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n376px {
    margin-top: -376px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n376px {
    margin-top: -376px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n376px {
    margin-top: -376px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n377px {
    margin-top: -377px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n377px {
    margin-top: -377px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n377px {
    margin-top: -377px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n378px {
    margin-top: -378px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n378px {
    margin-top: -378px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n378px {
    margin-top: -378px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n379px {
    margin-top: -379px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n379px {
    margin-top: -379px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n379px {
    margin-top: -379px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n380px {
    margin-top: -380px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n380px {
    margin-top: -380px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n380px {
    margin-top: -380px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n381px {
    margin-top: -381px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n381px {
    margin-top: -381px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n381px {
    margin-top: -381px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n382px {
    margin-top: -382px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n382px {
    margin-top: -382px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n382px {
    margin-top: -382px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n383px {
    margin-top: -383px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n383px {
    margin-top: -383px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n383px {
    margin-top: -383px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n384px {
    margin-top: -384px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n384px {
    margin-top: -384px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n384px {
    margin-top: -384px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n385px {
    margin-top: -385px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n385px {
    margin-top: -385px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n385px {
    margin-top: -385px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n386px {
    margin-top: -386px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n386px {
    margin-top: -386px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n386px {
    margin-top: -386px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n387px {
    margin-top: -387px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n387px {
    margin-top: -387px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n387px {
    margin-top: -387px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n388px {
    margin-top: -388px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n388px {
    margin-top: -388px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n388px {
    margin-top: -388px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n389px {
    margin-top: -389px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n389px {
    margin-top: -389px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n389px {
    margin-top: -389px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n390px {
    margin-top: -390px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n390px {
    margin-top: -390px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n390px {
    margin-top: -390px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n391px {
    margin-top: -391px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n391px {
    margin-top: -391px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n391px {
    margin-top: -391px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n392px {
    margin-top: -392px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n392px {
    margin-top: -392px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n392px {
    margin-top: -392px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n393px {
    margin-top: -393px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n393px {
    margin-top: -393px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n393px {
    margin-top: -393px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n394px {
    margin-top: -394px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n394px {
    margin-top: -394px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n394px {
    margin-top: -394px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n395px {
    margin-top: -395px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n395px {
    margin-top: -395px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n395px {
    margin-top: -395px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n396px {
    margin-top: -396px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n396px {
    margin-top: -396px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n396px {
    margin-top: -396px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n397px {
    margin-top: -397px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n397px {
    margin-top: -397px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n397px {
    margin-top: -397px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n398px {
    margin-top: -398px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n398px {
    margin-top: -398px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n398px {
    margin-top: -398px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n399px {
    margin-top: -399px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n399px {
    margin-top: -399px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n399px {
    margin-top: -399px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n400px {
    margin-top: -400px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n400px {
    margin-top: -400px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n400px {
    margin-top: -400px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n401px {
    margin-top: -401px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n401px {
    margin-top: -401px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n401px {
    margin-top: -401px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n402px {
    margin-top: -402px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n402px {
    margin-top: -402px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n402px {
    margin-top: -402px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n403px {
    margin-top: -403px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n403px {
    margin-top: -403px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n403px {
    margin-top: -403px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n404px {
    margin-top: -404px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n404px {
    margin-top: -404px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n404px {
    margin-top: -404px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n405px {
    margin-top: -405px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n405px {
    margin-top: -405px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n405px {
    margin-top: -405px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n406px {
    margin-top: -406px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n406px {
    margin-top: -406px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n406px {
    margin-top: -406px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n407px {
    margin-top: -407px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n407px {
    margin-top: -407px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n407px {
    margin-top: -407px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n408px {
    margin-top: -408px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n408px {
    margin-top: -408px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n408px {
    margin-top: -408px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n409px {
    margin-top: -409px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n409px {
    margin-top: -409px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n409px {
    margin-top: -409px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n410px {
    margin-top: -410px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n410px {
    margin-top: -410px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n410px {
    margin-top: -410px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n411px {
    margin-top: -411px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n411px {
    margin-top: -411px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n411px {
    margin-top: -411px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n412px {
    margin-top: -412px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n412px {
    margin-top: -412px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n412px {
    margin-top: -412px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n413px {
    margin-top: -413px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n413px {
    margin-top: -413px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n413px {
    margin-top: -413px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n414px {
    margin-top: -414px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n414px {
    margin-top: -414px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n414px {
    margin-top: -414px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n415px {
    margin-top: -415px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n415px {
    margin-top: -415px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n415px {
    margin-top: -415px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n416px {
    margin-top: -416px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n416px {
    margin-top: -416px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n416px {
    margin-top: -416px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n417px {
    margin-top: -417px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n417px {
    margin-top: -417px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n417px {
    margin-top: -417px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n418px {
    margin-top: -418px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n418px {
    margin-top: -418px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n418px {
    margin-top: -418px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n419px {
    margin-top: -419px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n419px {
    margin-top: -419px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n419px {
    margin-top: -419px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n420px {
    margin-top: -420px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n420px {
    margin-top: -420px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n420px {
    margin-top: -420px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n421px {
    margin-top: -421px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n421px {
    margin-top: -421px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n421px {
    margin-top: -421px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n422px {
    margin-top: -422px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n422px {
    margin-top: -422px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n422px {
    margin-top: -422px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n423px {
    margin-top: -423px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n423px {
    margin-top: -423px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n423px {
    margin-top: -423px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n424px {
    margin-top: -424px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n424px {
    margin-top: -424px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n424px {
    margin-top: -424px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n425px {
    margin-top: -425px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n425px {
    margin-top: -425px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n425px {
    margin-top: -425px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n426px {
    margin-top: -426px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n426px {
    margin-top: -426px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n426px {
    margin-top: -426px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n427px {
    margin-top: -427px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n427px {
    margin-top: -427px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n427px {
    margin-top: -427px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n428px {
    margin-top: -428px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n428px {
    margin-top: -428px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n428px {
    margin-top: -428px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n429px {
    margin-top: -429px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n429px {
    margin-top: -429px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n429px {
    margin-top: -429px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n430px {
    margin-top: -430px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n430px {
    margin-top: -430px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n430px {
    margin-top: -430px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n431px {
    margin-top: -431px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n431px {
    margin-top: -431px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n431px {
    margin-top: -431px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n432px {
    margin-top: -432px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n432px {
    margin-top: -432px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n432px {
    margin-top: -432px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n433px {
    margin-top: -433px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n433px {
    margin-top: -433px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n433px {
    margin-top: -433px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n434px {
    margin-top: -434px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n434px {
    margin-top: -434px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n434px {
    margin-top: -434px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n435px {
    margin-top: -435px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n435px {
    margin-top: -435px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n435px {
    margin-top: -435px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n436px {
    margin-top: -436px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n436px {
    margin-top: -436px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n436px {
    margin-top: -436px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n437px {
    margin-top: -437px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n437px {
    margin-top: -437px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n437px {
    margin-top: -437px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n438px {
    margin-top: -438px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n438px {
    margin-top: -438px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n438px {
    margin-top: -438px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n439px {
    margin-top: -439px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n439px {
    margin-top: -439px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n439px {
    margin-top: -439px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n440px {
    margin-top: -440px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n440px {
    margin-top: -440px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n440px {
    margin-top: -440px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n441px {
    margin-top: -441px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n441px {
    margin-top: -441px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n441px {
    margin-top: -441px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n442px {
    margin-top: -442px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n442px {
    margin-top: -442px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n442px {
    margin-top: -442px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n443px {
    margin-top: -443px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n443px {
    margin-top: -443px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n443px {
    margin-top: -443px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n444px {
    margin-top: -444px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n444px {
    margin-top: -444px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n444px {
    margin-top: -444px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n445px {
    margin-top: -445px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n445px {
    margin-top: -445px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n445px {
    margin-top: -445px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n446px {
    margin-top: -446px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n446px {
    margin-top: -446px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n446px {
    margin-top: -446px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n447px {
    margin-top: -447px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n447px {
    margin-top: -447px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n447px {
    margin-top: -447px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n448px {
    margin-top: -448px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n448px {
    margin-top: -448px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n448px {
    margin-top: -448px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n449px {
    margin-top: -449px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n449px {
    margin-top: -449px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n449px {
    margin-top: -449px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n450px {
    margin-top: -450px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n450px {
    margin-top: -450px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n450px {
    margin-top: -450px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n451px {
    margin-top: -451px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n451px {
    margin-top: -451px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n451px {
    margin-top: -451px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n452px {
    margin-top: -452px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n452px {
    margin-top: -452px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n452px {
    margin-top: -452px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n453px {
    margin-top: -453px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n453px {
    margin-top: -453px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n453px {
    margin-top: -453px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n454px {
    margin-top: -454px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n454px {
    margin-top: -454px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n454px {
    margin-top: -454px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n455px {
    margin-top: -455px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n455px {
    margin-top: -455px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n455px {
    margin-top: -455px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n456px {
    margin-top: -456px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n456px {
    margin-top: -456px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n456px {
    margin-top: -456px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n457px {
    margin-top: -457px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n457px {
    margin-top: -457px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n457px {
    margin-top: -457px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n458px {
    margin-top: -458px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n458px {
    margin-top: -458px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n458px {
    margin-top: -458px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n459px {
    margin-top: -459px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n459px {
    margin-top: -459px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n459px {
    margin-top: -459px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n460px {
    margin-top: -460px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n460px {
    margin-top: -460px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n460px {
    margin-top: -460px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n461px {
    margin-top: -461px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n461px {
    margin-top: -461px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n461px {
    margin-top: -461px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n462px {
    margin-top: -462px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n462px {
    margin-top: -462px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n462px {
    margin-top: -462px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n463px {
    margin-top: -463px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n463px {
    margin-top: -463px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n463px {
    margin-top: -463px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n464px {
    margin-top: -464px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n464px {
    margin-top: -464px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n464px {
    margin-top: -464px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n465px {
    margin-top: -465px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n465px {
    margin-top: -465px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n465px {
    margin-top: -465px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n466px {
    margin-top: -466px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n466px {
    margin-top: -466px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n466px {
    margin-top: -466px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n467px {
    margin-top: -467px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n467px {
    margin-top: -467px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n467px {
    margin-top: -467px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n468px {
    margin-top: -468px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n468px {
    margin-top: -468px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n468px {
    margin-top: -468px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n469px {
    margin-top: -469px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n469px {
    margin-top: -469px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n469px {
    margin-top: -469px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n470px {
    margin-top: -470px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n470px {
    margin-top: -470px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n470px {
    margin-top: -470px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n471px {
    margin-top: -471px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n471px {
    margin-top: -471px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n471px {
    margin-top: -471px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n472px {
    margin-top: -472px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n472px {
    margin-top: -472px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n472px {
    margin-top: -472px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n473px {
    margin-top: -473px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n473px {
    margin-top: -473px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n473px {
    margin-top: -473px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n474px {
    margin-top: -474px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n474px {
    margin-top: -474px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n474px {
    margin-top: -474px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n475px {
    margin-top: -475px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n475px {
    margin-top: -475px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n475px {
    margin-top: -475px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n476px {
    margin-top: -476px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n476px {
    margin-top: -476px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n476px {
    margin-top: -476px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n477px {
    margin-top: -477px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n477px {
    margin-top: -477px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n477px {
    margin-top: -477px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n478px {
    margin-top: -478px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n478px {
    margin-top: -478px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n478px {
    margin-top: -478px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n479px {
    margin-top: -479px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n479px {
    margin-top: -479px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n479px {
    margin-top: -479px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n480px {
    margin-top: -480px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n480px {
    margin-top: -480px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n480px {
    margin-top: -480px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n481px {
    margin-top: -481px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n481px {
    margin-top: -481px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n481px {
    margin-top: -481px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n482px {
    margin-top: -482px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n482px {
    margin-top: -482px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n482px {
    margin-top: -482px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n483px {
    margin-top: -483px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n483px {
    margin-top: -483px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n483px {
    margin-top: -483px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n484px {
    margin-top: -484px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n484px {
    margin-top: -484px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n484px {
    margin-top: -484px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n485px {
    margin-top: -485px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n485px {
    margin-top: -485px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n485px {
    margin-top: -485px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n486px {
    margin-top: -486px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n486px {
    margin-top: -486px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n486px {
    margin-top: -486px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n487px {
    margin-top: -487px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n487px {
    margin-top: -487px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n487px {
    margin-top: -487px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n488px {
    margin-top: -488px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n488px {
    margin-top: -488px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n488px {
    margin-top: -488px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n489px {
    margin-top: -489px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n489px {
    margin-top: -489px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n489px {
    margin-top: -489px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n490px {
    margin-top: -490px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n490px {
    margin-top: -490px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n490px {
    margin-top: -490px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n491px {
    margin-top: -491px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n491px {
    margin-top: -491px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n491px {
    margin-top: -491px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n492px {
    margin-top: -492px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n492px {
    margin-top: -492px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n492px {
    margin-top: -492px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n493px {
    margin-top: -493px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n493px {
    margin-top: -493px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n493px {
    margin-top: -493px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n494px {
    margin-top: -494px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n494px {
    margin-top: -494px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n494px {
    margin-top: -494px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n495px {
    margin-top: -495px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n495px {
    margin-top: -495px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n495px {
    margin-top: -495px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n496px {
    margin-top: -496px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n496px {
    margin-top: -496px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n496px {
    margin-top: -496px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n497px {
    margin-top: -497px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n497px {
    margin-top: -497px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n497px {
    margin-top: -497px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n498px {
    margin-top: -498px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n498px {
    margin-top: -498px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n498px {
    margin-top: -498px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n499px {
    margin-top: -499px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n499px {
    margin-top: -499px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n499px {
    margin-top: -499px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n500px {
    margin-top: -500px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n500px {
    margin-top: -500px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n500px {
    margin-top: -500px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n501px {
    margin-top: -501px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n501px {
    margin-top: -501px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n501px {
    margin-top: -501px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n502px {
    margin-top: -502px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n502px {
    margin-top: -502px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n502px {
    margin-top: -502px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n503px {
    margin-top: -503px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n503px {
    margin-top: -503px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n503px {
    margin-top: -503px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n504px {
    margin-top: -504px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n504px {
    margin-top: -504px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n504px {
    margin-top: -504px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n505px {
    margin-top: -505px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n505px {
    margin-top: -505px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n505px {
    margin-top: -505px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n506px {
    margin-top: -506px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n506px {
    margin-top: -506px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n506px {
    margin-top: -506px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n507px {
    margin-top: -507px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n507px {
    margin-top: -507px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n507px {
    margin-top: -507px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n508px {
    margin-top: -508px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n508px {
    margin-top: -508px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n508px {
    margin-top: -508px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n509px {
    margin-top: -509px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n509px {
    margin-top: -509px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n509px {
    margin-top: -509px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n510px {
    margin-top: -510px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n510px {
    margin-top: -510px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n510px {
    margin-top: -510px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n511px {
    margin-top: -511px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n511px {
    margin-top: -511px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n511px {
    margin-top: -511px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n512px {
    margin-top: -512px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n512px {
    margin-top: -512px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n512px {
    margin-top: -512px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n513px {
    margin-top: -513px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n513px {
    margin-top: -513px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n513px {
    margin-top: -513px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n514px {
    margin-top: -514px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n514px {
    margin-top: -514px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n514px {
    margin-top: -514px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n515px {
    margin-top: -515px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n515px {
    margin-top: -515px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n515px {
    margin-top: -515px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n516px {
    margin-top: -516px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n516px {
    margin-top: -516px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n516px {
    margin-top: -516px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n517px {
    margin-top: -517px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n517px {
    margin-top: -517px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n517px {
    margin-top: -517px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n518px {
    margin-top: -518px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n518px {
    margin-top: -518px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n518px {
    margin-top: -518px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n519px {
    margin-top: -519px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n519px {
    margin-top: -519px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n519px {
    margin-top: -519px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n520px {
    margin-top: -520px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n520px {
    margin-top: -520px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n520px {
    margin-top: -520px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n521px {
    margin-top: -521px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n521px {
    margin-top: -521px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n521px {
    margin-top: -521px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n522px {
    margin-top: -522px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n522px {
    margin-top: -522px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n522px {
    margin-top: -522px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n523px {
    margin-top: -523px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n523px {
    margin-top: -523px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n523px {
    margin-top: -523px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n524px {
    margin-top: -524px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n524px {
    margin-top: -524px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n524px {
    margin-top: -524px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n525px {
    margin-top: -525px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n525px {
    margin-top: -525px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n525px {
    margin-top: -525px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n526px {
    margin-top: -526px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n526px {
    margin-top: -526px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n526px {
    margin-top: -526px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n527px {
    margin-top: -527px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n527px {
    margin-top: -527px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n527px {
    margin-top: -527px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n528px {
    margin-top: -528px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n528px {
    margin-top: -528px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n528px {
    margin-top: -528px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n529px {
    margin-top: -529px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n529px {
    margin-top: -529px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n529px {
    margin-top: -529px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n530px {
    margin-top: -530px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n530px {
    margin-top: -530px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n530px {
    margin-top: -530px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n531px {
    margin-top: -531px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n531px {
    margin-top: -531px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n531px {
    margin-top: -531px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n532px {
    margin-top: -532px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n532px {
    margin-top: -532px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n532px {
    margin-top: -532px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n533px {
    margin-top: -533px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n533px {
    margin-top: -533px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n533px {
    margin-top: -533px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n534px {
    margin-top: -534px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n534px {
    margin-top: -534px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n534px {
    margin-top: -534px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n535px {
    margin-top: -535px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n535px {
    margin-top: -535px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n535px {
    margin-top: -535px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n536px {
    margin-top: -536px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n536px {
    margin-top: -536px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n536px {
    margin-top: -536px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n537px {
    margin-top: -537px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n537px {
    margin-top: -537px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n537px {
    margin-top: -537px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n538px {
    margin-top: -538px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n538px {
    margin-top: -538px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n538px {
    margin-top: -538px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n539px {
    margin-top: -539px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n539px {
    margin-top: -539px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n539px {
    margin-top: -539px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n540px {
    margin-top: -540px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n540px {
    margin-top: -540px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n540px {
    margin-top: -540px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n541px {
    margin-top: -541px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n541px {
    margin-top: -541px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n541px {
    margin-top: -541px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n542px {
    margin-top: -542px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n542px {
    margin-top: -542px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n542px {
    margin-top: -542px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n543px {
    margin-top: -543px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n543px {
    margin-top: -543px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n543px {
    margin-top: -543px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n544px {
    margin-top: -544px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n544px {
    margin-top: -544px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n544px {
    margin-top: -544px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n545px {
    margin-top: -545px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n545px {
    margin-top: -545px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n545px {
    margin-top: -545px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n546px {
    margin-top: -546px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n546px {
    margin-top: -546px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n546px {
    margin-top: -546px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n547px {
    margin-top: -547px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n547px {
    margin-top: -547px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n547px {
    margin-top: -547px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n548px {
    margin-top: -548px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n548px {
    margin-top: -548px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n548px {
    margin-top: -548px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n549px {
    margin-top: -549px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n549px {
    margin-top: -549px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n549px {
    margin-top: -549px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n550px {
    margin-top: -550px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n550px {
    margin-top: -550px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n550px {
    margin-top: -550px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n551px {
    margin-top: -551px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n551px {
    margin-top: -551px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n551px {
    margin-top: -551px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n552px {
    margin-top: -552px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n552px {
    margin-top: -552px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n552px {
    margin-top: -552px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n553px {
    margin-top: -553px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n553px {
    margin-top: -553px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n553px {
    margin-top: -553px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n554px {
    margin-top: -554px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n554px {
    margin-top: -554px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n554px {
    margin-top: -554px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n555px {
    margin-top: -555px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n555px {
    margin-top: -555px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n555px {
    margin-top: -555px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n556px {
    margin-top: -556px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n556px {
    margin-top: -556px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n556px {
    margin-top: -556px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n557px {
    margin-top: -557px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n557px {
    margin-top: -557px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n557px {
    margin-top: -557px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n558px {
    margin-top: -558px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n558px {
    margin-top: -558px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n558px {
    margin-top: -558px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n559px {
    margin-top: -559px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n559px {
    margin-top: -559px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n559px {
    margin-top: -559px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n560px {
    margin-top: -560px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n560px {
    margin-top: -560px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n560px {
    margin-top: -560px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n561px {
    margin-top: -561px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n561px {
    margin-top: -561px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n561px {
    margin-top: -561px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n562px {
    margin-top: -562px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n562px {
    margin-top: -562px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n562px {
    margin-top: -562px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n563px {
    margin-top: -563px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n563px {
    margin-top: -563px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n563px {
    margin-top: -563px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n564px {
    margin-top: -564px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n564px {
    margin-top: -564px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n564px {
    margin-top: -564px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n565px {
    margin-top: -565px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n565px {
    margin-top: -565px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n565px {
    margin-top: -565px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n566px {
    margin-top: -566px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n566px {
    margin-top: -566px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n566px {
    margin-top: -566px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n567px {
    margin-top: -567px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n567px {
    margin-top: -567px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n567px {
    margin-top: -567px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n568px {
    margin-top: -568px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n568px {
    margin-top: -568px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n568px {
    margin-top: -568px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n569px {
    margin-top: -569px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n569px {
    margin-top: -569px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n569px {
    margin-top: -569px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n570px {
    margin-top: -570px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n570px {
    margin-top: -570px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n570px {
    margin-top: -570px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n571px {
    margin-top: -571px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n571px {
    margin-top: -571px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n571px {
    margin-top: -571px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n572px {
    margin-top: -572px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n572px {
    margin-top: -572px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n572px {
    margin-top: -572px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n573px {
    margin-top: -573px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n573px {
    margin-top: -573px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n573px {
    margin-top: -573px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n574px {
    margin-top: -574px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n574px {
    margin-top: -574px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n574px {
    margin-top: -574px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n575px {
    margin-top: -575px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n575px {
    margin-top: -575px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n575px {
    margin-top: -575px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n576px {
    margin-top: -576px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n576px {
    margin-top: -576px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n576px {
    margin-top: -576px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n577px {
    margin-top: -577px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n577px {
    margin-top: -577px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n577px {
    margin-top: -577px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n578px {
    margin-top: -578px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n578px {
    margin-top: -578px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n578px {
    margin-top: -578px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n579px {
    margin-top: -579px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n579px {
    margin-top: -579px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n579px {
    margin-top: -579px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n580px {
    margin-top: -580px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n580px {
    margin-top: -580px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n580px {
    margin-top: -580px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n581px {
    margin-top: -581px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n581px {
    margin-top: -581px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n581px {
    margin-top: -581px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n582px {
    margin-top: -582px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n582px {
    margin-top: -582px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n582px {
    margin-top: -582px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n583px {
    margin-top: -583px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n583px {
    margin-top: -583px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n583px {
    margin-top: -583px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n584px {
    margin-top: -584px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n584px {
    margin-top: -584px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n584px {
    margin-top: -584px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n585px {
    margin-top: -585px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n585px {
    margin-top: -585px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n585px {
    margin-top: -585px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n586px {
    margin-top: -586px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n586px {
    margin-top: -586px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n586px {
    margin-top: -586px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n587px {
    margin-top: -587px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n587px {
    margin-top: -587px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n587px {
    margin-top: -587px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n588px {
    margin-top: -588px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n588px {
    margin-top: -588px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n588px {
    margin-top: -588px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n589px {
    margin-top: -589px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n589px {
    margin-top: -589px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n589px {
    margin-top: -589px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n590px {
    margin-top: -590px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n590px {
    margin-top: -590px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n590px {
    margin-top: -590px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n591px {
    margin-top: -591px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n591px {
    margin-top: -591px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n591px {
    margin-top: -591px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n592px {
    margin-top: -592px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n592px {
    margin-top: -592px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n592px {
    margin-top: -592px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n593px {
    margin-top: -593px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n593px {
    margin-top: -593px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n593px {
    margin-top: -593px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n594px {
    margin-top: -594px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n594px {
    margin-top: -594px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n594px {
    margin-top: -594px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n595px {
    margin-top: -595px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n595px {
    margin-top: -595px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n595px {
    margin-top: -595px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n596px {
    margin-top: -596px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n596px {
    margin-top: -596px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n596px {
    margin-top: -596px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n597px {
    margin-top: -597px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n597px {
    margin-top: -597px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n597px {
    margin-top: -597px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n598px {
    margin-top: -598px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n598px {
    margin-top: -598px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n598px {
    margin-top: -598px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n599px {
    margin-top: -599px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n599px {
    margin-top: -599px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n599px {
    margin-top: -599px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n600px {
    margin-top: -600px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n600px {
    margin-top: -600px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n600px {
    margin-top: -600px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n601px {
    margin-top: -601px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n601px {
    margin-top: -601px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n601px {
    margin-top: -601px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n602px {
    margin-top: -602px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n602px {
    margin-top: -602px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n602px {
    margin-top: -602px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n603px {
    margin-top: -603px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n603px {
    margin-top: -603px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n603px {
    margin-top: -603px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n604px {
    margin-top: -604px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n604px {
    margin-top: -604px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n604px {
    margin-top: -604px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n605px {
    margin-top: -605px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n605px {
    margin-top: -605px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n605px {
    margin-top: -605px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n606px {
    margin-top: -606px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n606px {
    margin-top: -606px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n606px {
    margin-top: -606px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n607px {
    margin-top: -607px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n607px {
    margin-top: -607px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n607px {
    margin-top: -607px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n608px {
    margin-top: -608px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n608px {
    margin-top: -608px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n608px {
    margin-top: -608px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n609px {
    margin-top: -609px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n609px {
    margin-top: -609px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n609px {
    margin-top: -609px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n610px {
    margin-top: -610px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n610px {
    margin-top: -610px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n610px {
    margin-top: -610px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n611px {
    margin-top: -611px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n611px {
    margin-top: -611px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n611px {
    margin-top: -611px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n612px {
    margin-top: -612px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n612px {
    margin-top: -612px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n612px {
    margin-top: -612px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n613px {
    margin-top: -613px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n613px {
    margin-top: -613px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n613px {
    margin-top: -613px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n614px {
    margin-top: -614px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n614px {
    margin-top: -614px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n614px {
    margin-top: -614px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n615px {
    margin-top: -615px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n615px {
    margin-top: -615px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n615px {
    margin-top: -615px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n616px {
    margin-top: -616px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n616px {
    margin-top: -616px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n616px {
    margin-top: -616px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n617px {
    margin-top: -617px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n617px {
    margin-top: -617px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n617px {
    margin-top: -617px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n618px {
    margin-top: -618px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n618px {
    margin-top: -618px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n618px {
    margin-top: -618px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n619px {
    margin-top: -619px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n619px {
    margin-top: -619px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n619px {
    margin-top: -619px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n620px {
    margin-top: -620px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n620px {
    margin-top: -620px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n620px {
    margin-top: -620px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n621px {
    margin-top: -621px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n621px {
    margin-top: -621px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n621px {
    margin-top: -621px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n622px {
    margin-top: -622px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n622px {
    margin-top: -622px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n622px {
    margin-top: -622px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n623px {
    margin-top: -623px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n623px {
    margin-top: -623px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n623px {
    margin-top: -623px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n624px {
    margin-top: -624px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n624px {
    margin-top: -624px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n624px {
    margin-top: -624px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n625px {
    margin-top: -625px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n625px {
    margin-top: -625px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n625px {
    margin-top: -625px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n626px {
    margin-top: -626px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n626px {
    margin-top: -626px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n626px {
    margin-top: -626px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n627px {
    margin-top: -627px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n627px {
    margin-top: -627px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n627px {
    margin-top: -627px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n628px {
    margin-top: -628px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n628px {
    margin-top: -628px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n628px {
    margin-top: -628px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n629px {
    margin-top: -629px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n629px {
    margin-top: -629px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n629px {
    margin-top: -629px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n630px {
    margin-top: -630px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n630px {
    margin-top: -630px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n630px {
    margin-top: -630px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n631px {
    margin-top: -631px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n631px {
    margin-top: -631px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n631px {
    margin-top: -631px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n632px {
    margin-top: -632px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n632px {
    margin-top: -632px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n632px {
    margin-top: -632px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n633px {
    margin-top: -633px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n633px {
    margin-top: -633px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n633px {
    margin-top: -633px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n634px {
    margin-top: -634px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n634px {
    margin-top: -634px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n634px {
    margin-top: -634px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n635px {
    margin-top: -635px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n635px {
    margin-top: -635px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n635px {
    margin-top: -635px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n636px {
    margin-top: -636px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n636px {
    margin-top: -636px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n636px {
    margin-top: -636px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n637px {
    margin-top: -637px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n637px {
    margin-top: -637px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n637px {
    margin-top: -637px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n638px {
    margin-top: -638px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n638px {
    margin-top: -638px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n638px {
    margin-top: -638px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n639px {
    margin-top: -639px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n639px {
    margin-top: -639px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n639px {
    margin-top: -639px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n640px {
    margin-top: -640px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n640px {
    margin-top: -640px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n640px {
    margin-top: -640px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n641px {
    margin-top: -641px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n641px {
    margin-top: -641px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n641px {
    margin-top: -641px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n642px {
    margin-top: -642px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n642px {
    margin-top: -642px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n642px {
    margin-top: -642px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n643px {
    margin-top: -643px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n643px {
    margin-top: -643px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n643px {
    margin-top: -643px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n644px {
    margin-top: -644px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n644px {
    margin-top: -644px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n644px {
    margin-top: -644px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n645px {
    margin-top: -645px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n645px {
    margin-top: -645px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n645px {
    margin-top: -645px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n646px {
    margin-top: -646px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n646px {
    margin-top: -646px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n646px {
    margin-top: -646px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n647px {
    margin-top: -647px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n647px {
    margin-top: -647px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n647px {
    margin-top: -647px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n648px {
    margin-top: -648px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n648px {
    margin-top: -648px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n648px {
    margin-top: -648px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n649px {
    margin-top: -649px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n649px {
    margin-top: -649px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n649px {
    margin-top: -649px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n650px {
    margin-top: -650px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n650px {
    margin-top: -650px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n650px {
    margin-top: -650px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n651px {
    margin-top: -651px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n651px {
    margin-top: -651px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n651px {
    margin-top: -651px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n652px {
    margin-top: -652px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n652px {
    margin-top: -652px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n652px {
    margin-top: -652px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n653px {
    margin-top: -653px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n653px {
    margin-top: -653px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n653px {
    margin-top: -653px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n654px {
    margin-top: -654px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n654px {
    margin-top: -654px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n654px {
    margin-top: -654px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n655px {
    margin-top: -655px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n655px {
    margin-top: -655px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n655px {
    margin-top: -655px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n656px {
    margin-top: -656px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n656px {
    margin-top: -656px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n656px {
    margin-top: -656px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n657px {
    margin-top: -657px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n657px {
    margin-top: -657px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n657px {
    margin-top: -657px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n658px {
    margin-top: -658px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n658px {
    margin-top: -658px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n658px {
    margin-top: -658px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n659px {
    margin-top: -659px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n659px {
    margin-top: -659px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n659px {
    margin-top: -659px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n660px {
    margin-top: -660px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n660px {
    margin-top: -660px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n660px {
    margin-top: -660px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n661px {
    margin-top: -661px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n661px {
    margin-top: -661px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n661px {
    margin-top: -661px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n662px {
    margin-top: -662px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n662px {
    margin-top: -662px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n662px {
    margin-top: -662px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n663px {
    margin-top: -663px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n663px {
    margin-top: -663px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n663px {
    margin-top: -663px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n664px {
    margin-top: -664px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n664px {
    margin-top: -664px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n664px {
    margin-top: -664px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n665px {
    margin-top: -665px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n665px {
    margin-top: -665px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n665px {
    margin-top: -665px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n666px {
    margin-top: -666px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n666px {
    margin-top: -666px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n666px {
    margin-top: -666px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n667px {
    margin-top: -667px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n667px {
    margin-top: -667px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n667px {
    margin-top: -667px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n668px {
    margin-top: -668px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n668px {
    margin-top: -668px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n668px {
    margin-top: -668px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n669px {
    margin-top: -669px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n669px {
    margin-top: -669px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n669px {
    margin-top: -669px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n670px {
    margin-top: -670px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n670px {
    margin-top: -670px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n670px {
    margin-top: -670px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n671px {
    margin-top: -671px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n671px {
    margin-top: -671px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n671px {
    margin-top: -671px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n672px {
    margin-top: -672px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n672px {
    margin-top: -672px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n672px {
    margin-top: -672px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n673px {
    margin-top: -673px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n673px {
    margin-top: -673px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n673px {
    margin-top: -673px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n674px {
    margin-top: -674px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n674px {
    margin-top: -674px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n674px {
    margin-top: -674px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n675px {
    margin-top: -675px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n675px {
    margin-top: -675px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n675px {
    margin-top: -675px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n676px {
    margin-top: -676px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n676px {
    margin-top: -676px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n676px {
    margin-top: -676px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n677px {
    margin-top: -677px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n677px {
    margin-top: -677px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n677px {
    margin-top: -677px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n678px {
    margin-top: -678px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n678px {
    margin-top: -678px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n678px {
    margin-top: -678px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n679px {
    margin-top: -679px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n679px {
    margin-top: -679px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n679px {
    margin-top: -679px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n680px {
    margin-top: -680px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n680px {
    margin-top: -680px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n680px {
    margin-top: -680px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n681px {
    margin-top: -681px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n681px {
    margin-top: -681px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n681px {
    margin-top: -681px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n682px {
    margin-top: -682px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n682px {
    margin-top: -682px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n682px {
    margin-top: -682px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n683px {
    margin-top: -683px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n683px {
    margin-top: -683px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n683px {
    margin-top: -683px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n684px {
    margin-top: -684px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n684px {
    margin-top: -684px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n684px {
    margin-top: -684px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n685px {
    margin-top: -685px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n685px {
    margin-top: -685px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n685px {
    margin-top: -685px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n686px {
    margin-top: -686px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n686px {
    margin-top: -686px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n686px {
    margin-top: -686px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n687px {
    margin-top: -687px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n687px {
    margin-top: -687px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n687px {
    margin-top: -687px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n688px {
    margin-top: -688px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n688px {
    margin-top: -688px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n688px {
    margin-top: -688px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n689px {
    margin-top: -689px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n689px {
    margin-top: -689px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n689px {
    margin-top: -689px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n690px {
    margin-top: -690px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n690px {
    margin-top: -690px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n690px {
    margin-top: -690px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n691px {
    margin-top: -691px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n691px {
    margin-top: -691px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n691px {
    margin-top: -691px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n692px {
    margin-top: -692px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n692px {
    margin-top: -692px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n692px {
    margin-top: -692px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n693px {
    margin-top: -693px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n693px {
    margin-top: -693px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n693px {
    margin-top: -693px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n694px {
    margin-top: -694px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n694px {
    margin-top: -694px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n694px {
    margin-top: -694px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n695px {
    margin-top: -695px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n695px {
    margin-top: -695px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n695px {
    margin-top: -695px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n696px {
    margin-top: -696px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n696px {
    margin-top: -696px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n696px {
    margin-top: -696px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n697px {
    margin-top: -697px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n697px {
    margin-top: -697px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n697px {
    margin-top: -697px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n698px {
    margin-top: -698px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n698px {
    margin-top: -698px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n698px {
    margin-top: -698px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n699px {
    margin-top: -699px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n699px {
    margin-top: -699px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n699px {
    margin-top: -699px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n700px {
    margin-top: -700px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n700px {
    margin-top: -700px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n700px {
    margin-top: -700px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n701px {
    margin-top: -701px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n701px {
    margin-top: -701px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n701px {
    margin-top: -701px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n702px {
    margin-top: -702px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n702px {
    margin-top: -702px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n702px {
    margin-top: -702px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n703px {
    margin-top: -703px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n703px {
    margin-top: -703px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n703px {
    margin-top: -703px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n704px {
    margin-top: -704px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n704px {
    margin-top: -704px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n704px {
    margin-top: -704px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n705px {
    margin-top: -705px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n705px {
    margin-top: -705px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n705px {
    margin-top: -705px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n706px {
    margin-top: -706px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n706px {
    margin-top: -706px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n706px {
    margin-top: -706px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n707px {
    margin-top: -707px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n707px {
    margin-top: -707px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n707px {
    margin-top: -707px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n708px {
    margin-top: -708px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n708px {
    margin-top: -708px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n708px {
    margin-top: -708px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n709px {
    margin-top: -709px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n709px {
    margin-top: -709px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n709px {
    margin-top: -709px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n710px {
    margin-top: -710px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n710px {
    margin-top: -710px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n710px {
    margin-top: -710px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n711px {
    margin-top: -711px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n711px {
    margin-top: -711px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n711px {
    margin-top: -711px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n712px {
    margin-top: -712px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n712px {
    margin-top: -712px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n712px {
    margin-top: -712px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n713px {
    margin-top: -713px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n713px {
    margin-top: -713px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n713px {
    margin-top: -713px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n714px {
    margin-top: -714px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n714px {
    margin-top: -714px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n714px {
    margin-top: -714px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n715px {
    margin-top: -715px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n715px {
    margin-top: -715px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n715px {
    margin-top: -715px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n716px {
    margin-top: -716px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n716px {
    margin-top: -716px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n716px {
    margin-top: -716px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n717px {
    margin-top: -717px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n717px {
    margin-top: -717px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n717px {
    margin-top: -717px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n718px {
    margin-top: -718px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n718px {
    margin-top: -718px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n718px {
    margin-top: -718px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n719px {
    margin-top: -719px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n719px {
    margin-top: -719px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n719px {
    margin-top: -719px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n720px {
    margin-top: -720px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n720px {
    margin-top: -720px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n720px {
    margin-top: -720px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n721px {
    margin-top: -721px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n721px {
    margin-top: -721px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n721px {
    margin-top: -721px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n722px {
    margin-top: -722px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n722px {
    margin-top: -722px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n722px {
    margin-top: -722px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n723px {
    margin-top: -723px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n723px {
    margin-top: -723px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n723px {
    margin-top: -723px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n724px {
    margin-top: -724px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n724px {
    margin-top: -724px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n724px {
    margin-top: -724px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n725px {
    margin-top: -725px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n725px {
    margin-top: -725px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n725px {
    margin-top: -725px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n726px {
    margin-top: -726px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n726px {
    margin-top: -726px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n726px {
    margin-top: -726px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n727px {
    margin-top: -727px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n727px {
    margin-top: -727px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n727px {
    margin-top: -727px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n728px {
    margin-top: -728px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n728px {
    margin-top: -728px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n728px {
    margin-top: -728px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n729px {
    margin-top: -729px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n729px {
    margin-top: -729px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n729px {
    margin-top: -729px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n730px {
    margin-top: -730px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n730px {
    margin-top: -730px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n730px {
    margin-top: -730px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n731px {
    margin-top: -731px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n731px {
    margin-top: -731px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n731px {
    margin-top: -731px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n732px {
    margin-top: -732px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n732px {
    margin-top: -732px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n732px {
    margin-top: -732px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n733px {
    margin-top: -733px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n733px {
    margin-top: -733px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n733px {
    margin-top: -733px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n734px {
    margin-top: -734px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n734px {
    margin-top: -734px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n734px {
    margin-top: -734px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n735px {
    margin-top: -735px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n735px {
    margin-top: -735px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n735px {
    margin-top: -735px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n736px {
    margin-top: -736px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n736px {
    margin-top: -736px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n736px {
    margin-top: -736px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n737px {
    margin-top: -737px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n737px {
    margin-top: -737px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n737px {
    margin-top: -737px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n738px {
    margin-top: -738px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n738px {
    margin-top: -738px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n738px {
    margin-top: -738px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n739px {
    margin-top: -739px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n739px {
    margin-top: -739px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n739px {
    margin-top: -739px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n740px {
    margin-top: -740px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n740px {
    margin-top: -740px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n740px {
    margin-top: -740px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n741px {
    margin-top: -741px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n741px {
    margin-top: -741px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n741px {
    margin-top: -741px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n742px {
    margin-top: -742px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n742px {
    margin-top: -742px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n742px {
    margin-top: -742px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n743px {
    margin-top: -743px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n743px {
    margin-top: -743px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n743px {
    margin-top: -743px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n744px {
    margin-top: -744px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n744px {
    margin-top: -744px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n744px {
    margin-top: -744px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n745px {
    margin-top: -745px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n745px {
    margin-top: -745px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n745px {
    margin-top: -745px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n746px {
    margin-top: -746px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n746px {
    margin-top: -746px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n746px {
    margin-top: -746px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n747px {
    margin-top: -747px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n747px {
    margin-top: -747px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n747px {
    margin-top: -747px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n748px {
    margin-top: -748px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n748px {
    margin-top: -748px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n748px {
    margin-top: -748px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n749px {
    margin-top: -749px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n749px {
    margin-top: -749px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n749px {
    margin-top: -749px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n750px {
    margin-top: -750px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n750px {
    margin-top: -750px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n750px {
    margin-top: -750px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n751px {
    margin-top: -751px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n751px {
    margin-top: -751px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n751px {
    margin-top: -751px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n752px {
    margin-top: -752px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n752px {
    margin-top: -752px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n752px {
    margin-top: -752px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n753px {
    margin-top: -753px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n753px {
    margin-top: -753px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n753px {
    margin-top: -753px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n754px {
    margin-top: -754px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n754px {
    margin-top: -754px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n754px {
    margin-top: -754px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n755px {
    margin-top: -755px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n755px {
    margin-top: -755px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n755px {
    margin-top: -755px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n756px {
    margin-top: -756px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n756px {
    margin-top: -756px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n756px {
    margin-top: -756px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n757px {
    margin-top: -757px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n757px {
    margin-top: -757px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n757px {
    margin-top: -757px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n758px {
    margin-top: -758px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n758px {
    margin-top: -758px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n758px {
    margin-top: -758px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n759px {
    margin-top: -759px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n759px {
    margin-top: -759px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n759px {
    margin-top: -759px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n760px {
    margin-top: -760px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n760px {
    margin-top: -760px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n760px {
    margin-top: -760px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n761px {
    margin-top: -761px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n761px {
    margin-top: -761px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n761px {
    margin-top: -761px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n762px {
    margin-top: -762px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n762px {
    margin-top: -762px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n762px {
    margin-top: -762px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n763px {
    margin-top: -763px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n763px {
    margin-top: -763px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n763px {
    margin-top: -763px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n764px {
    margin-top: -764px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n764px {
    margin-top: -764px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n764px {
    margin-top: -764px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n765px {
    margin-top: -765px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n765px {
    margin-top: -765px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n765px {
    margin-top: -765px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n766px {
    margin-top: -766px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n766px {
    margin-top: -766px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n766px {
    margin-top: -766px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n767px {
    margin-top: -767px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n767px {
    margin-top: -767px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n767px {
    margin-top: -767px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n768px {
    margin-top: -768px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n768px {
    margin-top: -768px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n768px {
    margin-top: -768px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n769px {
    margin-top: -769px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n769px {
    margin-top: -769px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n769px {
    margin-top: -769px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n770px {
    margin-top: -770px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n770px {
    margin-top: -770px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n770px {
    margin-top: -770px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n771px {
    margin-top: -771px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n771px {
    margin-top: -771px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n771px {
    margin-top: -771px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n772px {
    margin-top: -772px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n772px {
    margin-top: -772px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n772px {
    margin-top: -772px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n773px {
    margin-top: -773px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n773px {
    margin-top: -773px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n773px {
    margin-top: -773px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n774px {
    margin-top: -774px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n774px {
    margin-top: -774px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n774px {
    margin-top: -774px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n775px {
    margin-top: -775px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n775px {
    margin-top: -775px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n775px {
    margin-top: -775px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n776px {
    margin-top: -776px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n776px {
    margin-top: -776px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n776px {
    margin-top: -776px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n777px {
    margin-top: -777px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n777px {
    margin-top: -777px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n777px {
    margin-top: -777px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n778px {
    margin-top: -778px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n778px {
    margin-top: -778px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n778px {
    margin-top: -778px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n779px {
    margin-top: -779px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n779px {
    margin-top: -779px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n779px {
    margin-top: -779px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n780px {
    margin-top: -780px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n780px {
    margin-top: -780px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n780px {
    margin-top: -780px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n781px {
    margin-top: -781px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n781px {
    margin-top: -781px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n781px {
    margin-top: -781px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n782px {
    margin-top: -782px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n782px {
    margin-top: -782px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n782px {
    margin-top: -782px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n783px {
    margin-top: -783px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n783px {
    margin-top: -783px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n783px {
    margin-top: -783px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n784px {
    margin-top: -784px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n784px {
    margin-top: -784px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n784px {
    margin-top: -784px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n785px {
    margin-top: -785px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n785px {
    margin-top: -785px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n785px {
    margin-top: -785px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n786px {
    margin-top: -786px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n786px {
    margin-top: -786px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n786px {
    margin-top: -786px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n787px {
    margin-top: -787px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n787px {
    margin-top: -787px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n787px {
    margin-top: -787px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n788px {
    margin-top: -788px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n788px {
    margin-top: -788px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n788px {
    margin-top: -788px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n789px {
    margin-top: -789px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n789px {
    margin-top: -789px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n789px {
    margin-top: -789px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n790px {
    margin-top: -790px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n790px {
    margin-top: -790px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n790px {
    margin-top: -790px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n791px {
    margin-top: -791px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n791px {
    margin-top: -791px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n791px {
    margin-top: -791px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n792px {
    margin-top: -792px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n792px {
    margin-top: -792px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n792px {
    margin-top: -792px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n793px {
    margin-top: -793px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n793px {
    margin-top: -793px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n793px {
    margin-top: -793px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n794px {
    margin-top: -794px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n794px {
    margin-top: -794px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n794px {
    margin-top: -794px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n795px {
    margin-top: -795px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n795px {
    margin-top: -795px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n795px {
    margin-top: -795px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n796px {
    margin-top: -796px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n796px {
    margin-top: -796px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n796px {
    margin-top: -796px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n797px {
    margin-top: -797px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n797px {
    margin-top: -797px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n797px {
    margin-top: -797px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n798px {
    margin-top: -798px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n798px {
    margin-top: -798px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n798px {
    margin-top: -798px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n799px {
    margin-top: -799px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n799px {
    margin-top: -799px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n799px {
    margin-top: -799px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n800px {
    margin-top: -800px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n800px {
    margin-top: -800px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n800px {
    margin-top: -800px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n801px {
    margin-top: -801px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n801px {
    margin-top: -801px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n801px {
    margin-top: -801px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n802px {
    margin-top: -802px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n802px {
    margin-top: -802px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n802px {
    margin-top: -802px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n803px {
    margin-top: -803px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n803px {
    margin-top: -803px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n803px {
    margin-top: -803px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n804px {
    margin-top: -804px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n804px {
    margin-top: -804px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n804px {
    margin-top: -804px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n805px {
    margin-top: -805px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n805px {
    margin-top: -805px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n805px {
    margin-top: -805px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n806px {
    margin-top: -806px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n806px {
    margin-top: -806px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n806px {
    margin-top: -806px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n807px {
    margin-top: -807px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n807px {
    margin-top: -807px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n807px {
    margin-top: -807px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n808px {
    margin-top: -808px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n808px {
    margin-top: -808px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n808px {
    margin-top: -808px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n809px {
    margin-top: -809px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n809px {
    margin-top: -809px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n809px {
    margin-top: -809px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n810px {
    margin-top: -810px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n810px {
    margin-top: -810px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n810px {
    margin-top: -810px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n811px {
    margin-top: -811px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n811px {
    margin-top: -811px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n811px {
    margin-top: -811px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n812px {
    margin-top: -812px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n812px {
    margin-top: -812px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n812px {
    margin-top: -812px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n813px {
    margin-top: -813px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n813px {
    margin-top: -813px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n813px {
    margin-top: -813px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n814px {
    margin-top: -814px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n814px {
    margin-top: -814px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n814px {
    margin-top: -814px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n815px {
    margin-top: -815px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n815px {
    margin-top: -815px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n815px {
    margin-top: -815px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n816px {
    margin-top: -816px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n816px {
    margin-top: -816px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n816px {
    margin-top: -816px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n817px {
    margin-top: -817px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n817px {
    margin-top: -817px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n817px {
    margin-top: -817px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n818px {
    margin-top: -818px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n818px {
    margin-top: -818px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n818px {
    margin-top: -818px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n819px {
    margin-top: -819px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n819px {
    margin-top: -819px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n819px {
    margin-top: -819px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n820px {
    margin-top: -820px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n820px {
    margin-top: -820px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n820px {
    margin-top: -820px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n821px {
    margin-top: -821px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n821px {
    margin-top: -821px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n821px {
    margin-top: -821px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n822px {
    margin-top: -822px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n822px {
    margin-top: -822px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n822px {
    margin-top: -822px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n823px {
    margin-top: -823px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n823px {
    margin-top: -823px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n823px {
    margin-top: -823px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n824px {
    margin-top: -824px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n824px {
    margin-top: -824px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n824px {
    margin-top: -824px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n825px {
    margin-top: -825px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n825px {
    margin-top: -825px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n825px {
    margin-top: -825px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n826px {
    margin-top: -826px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n826px {
    margin-top: -826px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n826px {
    margin-top: -826px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n827px {
    margin-top: -827px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n827px {
    margin-top: -827px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n827px {
    margin-top: -827px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n828px {
    margin-top: -828px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n828px {
    margin-top: -828px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n828px {
    margin-top: -828px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n829px {
    margin-top: -829px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n829px {
    margin-top: -829px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n829px {
    margin-top: -829px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n830px {
    margin-top: -830px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n830px {
    margin-top: -830px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n830px {
    margin-top: -830px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n831px {
    margin-top: -831px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n831px {
    margin-top: -831px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n831px {
    margin-top: -831px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n832px {
    margin-top: -832px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n832px {
    margin-top: -832px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n832px {
    margin-top: -832px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n833px {
    margin-top: -833px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n833px {
    margin-top: -833px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n833px {
    margin-top: -833px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n834px {
    margin-top: -834px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n834px {
    margin-top: -834px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n834px {
    margin-top: -834px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n835px {
    margin-top: -835px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n835px {
    margin-top: -835px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n835px {
    margin-top: -835px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n836px {
    margin-top: -836px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n836px {
    margin-top: -836px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n836px {
    margin-top: -836px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n837px {
    margin-top: -837px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n837px {
    margin-top: -837px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n837px {
    margin-top: -837px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n838px {
    margin-top: -838px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n838px {
    margin-top: -838px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n838px {
    margin-top: -838px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n839px {
    margin-top: -839px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n839px {
    margin-top: -839px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n839px {
    margin-top: -839px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n840px {
    margin-top: -840px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n840px {
    margin-top: -840px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n840px {
    margin-top: -840px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n841px {
    margin-top: -841px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n841px {
    margin-top: -841px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n841px {
    margin-top: -841px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n842px {
    margin-top: -842px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n842px {
    margin-top: -842px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n842px {
    margin-top: -842px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n843px {
    margin-top: -843px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n843px {
    margin-top: -843px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n843px {
    margin-top: -843px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n844px {
    margin-top: -844px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n844px {
    margin-top: -844px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n844px {
    margin-top: -844px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n845px {
    margin-top: -845px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n845px {
    margin-top: -845px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n845px {
    margin-top: -845px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n846px {
    margin-top: -846px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n846px {
    margin-top: -846px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n846px {
    margin-top: -846px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n847px {
    margin-top: -847px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n847px {
    margin-top: -847px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n847px {
    margin-top: -847px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n848px {
    margin-top: -848px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n848px {
    margin-top: -848px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n848px {
    margin-top: -848px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n849px {
    margin-top: -849px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n849px {
    margin-top: -849px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n849px {
    margin-top: -849px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n850px {
    margin-top: -850px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n850px {
    margin-top: -850px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n850px {
    margin-top: -850px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n851px {
    margin-top: -851px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n851px {
    margin-top: -851px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n851px {
    margin-top: -851px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n852px {
    margin-top: -852px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n852px {
    margin-top: -852px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n852px {
    margin-top: -852px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n853px {
    margin-top: -853px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n853px {
    margin-top: -853px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n853px {
    margin-top: -853px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n854px {
    margin-top: -854px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n854px {
    margin-top: -854px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n854px {
    margin-top: -854px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n855px {
    margin-top: -855px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n855px {
    margin-top: -855px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n855px {
    margin-top: -855px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n856px {
    margin-top: -856px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n856px {
    margin-top: -856px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n856px {
    margin-top: -856px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n857px {
    margin-top: -857px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n857px {
    margin-top: -857px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n857px {
    margin-top: -857px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n858px {
    margin-top: -858px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n858px {
    margin-top: -858px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n858px {
    margin-top: -858px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n859px {
    margin-top: -859px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n859px {
    margin-top: -859px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n859px {
    margin-top: -859px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n860px {
    margin-top: -860px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n860px {
    margin-top: -860px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n860px {
    margin-top: -860px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n861px {
    margin-top: -861px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n861px {
    margin-top: -861px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n861px {
    margin-top: -861px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n862px {
    margin-top: -862px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n862px {
    margin-top: -862px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n862px {
    margin-top: -862px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n863px {
    margin-top: -863px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n863px {
    margin-top: -863px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n863px {
    margin-top: -863px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n864px {
    margin-top: -864px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n864px {
    margin-top: -864px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n864px {
    margin-top: -864px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n865px {
    margin-top: -865px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n865px {
    margin-top: -865px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n865px {
    margin-top: -865px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n866px {
    margin-top: -866px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n866px {
    margin-top: -866px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n866px {
    margin-top: -866px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n867px {
    margin-top: -867px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n867px {
    margin-top: -867px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n867px {
    margin-top: -867px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n868px {
    margin-top: -868px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n868px {
    margin-top: -868px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n868px {
    margin-top: -868px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n869px {
    margin-top: -869px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n869px {
    margin-top: -869px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n869px {
    margin-top: -869px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n870px {
    margin-top: -870px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n870px {
    margin-top: -870px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n870px {
    margin-top: -870px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n871px {
    margin-top: -871px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n871px {
    margin-top: -871px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n871px {
    margin-top: -871px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n872px {
    margin-top: -872px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n872px {
    margin-top: -872px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n872px {
    margin-top: -872px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n873px {
    margin-top: -873px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n873px {
    margin-top: -873px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n873px {
    margin-top: -873px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n874px {
    margin-top: -874px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n874px {
    margin-top: -874px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n874px {
    margin-top: -874px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n875px {
    margin-top: -875px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n875px {
    margin-top: -875px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n875px {
    margin-top: -875px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n876px {
    margin-top: -876px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n876px {
    margin-top: -876px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n876px {
    margin-top: -876px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n877px {
    margin-top: -877px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n877px {
    margin-top: -877px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n877px {
    margin-top: -877px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n878px {
    margin-top: -878px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n878px {
    margin-top: -878px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n878px {
    margin-top: -878px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n879px {
    margin-top: -879px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n879px {
    margin-top: -879px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n879px {
    margin-top: -879px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n880px {
    margin-top: -880px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n880px {
    margin-top: -880px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n880px {
    margin-top: -880px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n881px {
    margin-top: -881px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n881px {
    margin-top: -881px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n881px {
    margin-top: -881px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n882px {
    margin-top: -882px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n882px {
    margin-top: -882px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n882px {
    margin-top: -882px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n883px {
    margin-top: -883px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n883px {
    margin-top: -883px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n883px {
    margin-top: -883px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n884px {
    margin-top: -884px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n884px {
    margin-top: -884px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n884px {
    margin-top: -884px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n885px {
    margin-top: -885px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n885px {
    margin-top: -885px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n885px {
    margin-top: -885px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n886px {
    margin-top: -886px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n886px {
    margin-top: -886px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n886px {
    margin-top: -886px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n887px {
    margin-top: -887px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n887px {
    margin-top: -887px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n887px {
    margin-top: -887px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n888px {
    margin-top: -888px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n888px {
    margin-top: -888px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n888px {
    margin-top: -888px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n889px {
    margin-top: -889px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n889px {
    margin-top: -889px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n889px {
    margin-top: -889px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n890px {
    margin-top: -890px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n890px {
    margin-top: -890px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n890px {
    margin-top: -890px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n891px {
    margin-top: -891px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n891px {
    margin-top: -891px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n891px {
    margin-top: -891px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n892px {
    margin-top: -892px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n892px {
    margin-top: -892px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n892px {
    margin-top: -892px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n893px {
    margin-top: -893px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n893px {
    margin-top: -893px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n893px {
    margin-top: -893px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n894px {
    margin-top: -894px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n894px {
    margin-top: -894px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n894px {
    margin-top: -894px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n895px {
    margin-top: -895px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n895px {
    margin-top: -895px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n895px {
    margin-top: -895px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n896px {
    margin-top: -896px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n896px {
    margin-top: -896px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n896px {
    margin-top: -896px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n897px {
    margin-top: -897px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n897px {
    margin-top: -897px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n897px {
    margin-top: -897px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n898px {
    margin-top: -898px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n898px {
    margin-top: -898px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n898px {
    margin-top: -898px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n899px {
    margin-top: -899px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n899px {
    margin-top: -899px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n899px {
    margin-top: -899px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n900px {
    margin-top: -900px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n900px {
    margin-top: -900px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n900px {
    margin-top: -900px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n901px {
    margin-top: -901px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n901px {
    margin-top: -901px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n901px {
    margin-top: -901px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n902px {
    margin-top: -902px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n902px {
    margin-top: -902px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n902px {
    margin-top: -902px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n903px {
    margin-top: -903px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n903px {
    margin-top: -903px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n903px {
    margin-top: -903px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n904px {
    margin-top: -904px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n904px {
    margin-top: -904px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n904px {
    margin-top: -904px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n905px {
    margin-top: -905px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n905px {
    margin-top: -905px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n905px {
    margin-top: -905px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n906px {
    margin-top: -906px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n906px {
    margin-top: -906px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n906px {
    margin-top: -906px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n907px {
    margin-top: -907px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n907px {
    margin-top: -907px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n907px {
    margin-top: -907px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n908px {
    margin-top: -908px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n908px {
    margin-top: -908px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n908px {
    margin-top: -908px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n909px {
    margin-top: -909px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n909px {
    margin-top: -909px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n909px {
    margin-top: -909px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n910px {
    margin-top: -910px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n910px {
    margin-top: -910px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n910px {
    margin-top: -910px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n911px {
    margin-top: -911px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n911px {
    margin-top: -911px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n911px {
    margin-top: -911px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n912px {
    margin-top: -912px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n912px {
    margin-top: -912px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n912px {
    margin-top: -912px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n913px {
    margin-top: -913px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n913px {
    margin-top: -913px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n913px {
    margin-top: -913px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n914px {
    margin-top: -914px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n914px {
    margin-top: -914px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n914px {
    margin-top: -914px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n915px {
    margin-top: -915px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n915px {
    margin-top: -915px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n915px {
    margin-top: -915px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n916px {
    margin-top: -916px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n916px {
    margin-top: -916px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n916px {
    margin-top: -916px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n917px {
    margin-top: -917px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n917px {
    margin-top: -917px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n917px {
    margin-top: -917px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n918px {
    margin-top: -918px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n918px {
    margin-top: -918px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n918px {
    margin-top: -918px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n919px {
    margin-top: -919px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n919px {
    margin-top: -919px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n919px {
    margin-top: -919px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n920px {
    margin-top: -920px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n920px {
    margin-top: -920px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n920px {
    margin-top: -920px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n921px {
    margin-top: -921px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n921px {
    margin-top: -921px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n921px {
    margin-top: -921px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n922px {
    margin-top: -922px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n922px {
    margin-top: -922px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n922px {
    margin-top: -922px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n923px {
    margin-top: -923px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n923px {
    margin-top: -923px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n923px {
    margin-top: -923px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n924px {
    margin-top: -924px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n924px {
    margin-top: -924px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n924px {
    margin-top: -924px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n925px {
    margin-top: -925px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n925px {
    margin-top: -925px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n925px {
    margin-top: -925px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n926px {
    margin-top: -926px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n926px {
    margin-top: -926px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n926px {
    margin-top: -926px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n927px {
    margin-top: -927px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n927px {
    margin-top: -927px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n927px {
    margin-top: -927px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n928px {
    margin-top: -928px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n928px {
    margin-top: -928px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n928px {
    margin-top: -928px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n929px {
    margin-top: -929px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n929px {
    margin-top: -929px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n929px {
    margin-top: -929px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n930px {
    margin-top: -930px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n930px {
    margin-top: -930px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n930px {
    margin-top: -930px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n931px {
    margin-top: -931px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n931px {
    margin-top: -931px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n931px {
    margin-top: -931px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n932px {
    margin-top: -932px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n932px {
    margin-top: -932px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n932px {
    margin-top: -932px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n933px {
    margin-top: -933px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n933px {
    margin-top: -933px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n933px {
    margin-top: -933px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n934px {
    margin-top: -934px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n934px {
    margin-top: -934px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n934px {
    margin-top: -934px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n935px {
    margin-top: -935px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n935px {
    margin-top: -935px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n935px {
    margin-top: -935px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n936px {
    margin-top: -936px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n936px {
    margin-top: -936px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n936px {
    margin-top: -936px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n937px {
    margin-top: -937px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n937px {
    margin-top: -937px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n937px {
    margin-top: -937px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n938px {
    margin-top: -938px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n938px {
    margin-top: -938px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n938px {
    margin-top: -938px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n939px {
    margin-top: -939px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n939px {
    margin-top: -939px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n939px {
    margin-top: -939px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n940px {
    margin-top: -940px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n940px {
    margin-top: -940px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n940px {
    margin-top: -940px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n941px {
    margin-top: -941px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n941px {
    margin-top: -941px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n941px {
    margin-top: -941px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n942px {
    margin-top: -942px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n942px {
    margin-top: -942px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n942px {
    margin-top: -942px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n943px {
    margin-top: -943px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n943px {
    margin-top: -943px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n943px {
    margin-top: -943px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n944px {
    margin-top: -944px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n944px {
    margin-top: -944px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n944px {
    margin-top: -944px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n945px {
    margin-top: -945px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n945px {
    margin-top: -945px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n945px {
    margin-top: -945px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n946px {
    margin-top: -946px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n946px {
    margin-top: -946px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n946px {
    margin-top: -946px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n947px {
    margin-top: -947px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n947px {
    margin-top: -947px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n947px {
    margin-top: -947px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n948px {
    margin-top: -948px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n948px {
    margin-top: -948px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n948px {
    margin-top: -948px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n949px {
    margin-top: -949px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n949px {
    margin-top: -949px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n949px {
    margin-top: -949px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n950px {
    margin-top: -950px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n950px {
    margin-top: -950px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n950px {
    margin-top: -950px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n951px {
    margin-top: -951px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n951px {
    margin-top: -951px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n951px {
    margin-top: -951px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n952px {
    margin-top: -952px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n952px {
    margin-top: -952px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n952px {
    margin-top: -952px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n953px {
    margin-top: -953px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n953px {
    margin-top: -953px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n953px {
    margin-top: -953px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n954px {
    margin-top: -954px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n954px {
    margin-top: -954px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n954px {
    margin-top: -954px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n955px {
    margin-top: -955px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n955px {
    margin-top: -955px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n955px {
    margin-top: -955px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n956px {
    margin-top: -956px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n956px {
    margin-top: -956px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n956px {
    margin-top: -956px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n957px {
    margin-top: -957px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n957px {
    margin-top: -957px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n957px {
    margin-top: -957px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n958px {
    margin-top: -958px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n958px {
    margin-top: -958px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n958px {
    margin-top: -958px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n959px {
    margin-top: -959px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n959px {
    margin-top: -959px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n959px {
    margin-top: -959px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n960px {
    margin-top: -960px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n960px {
    margin-top: -960px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n960px {
    margin-top: -960px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n961px {
    margin-top: -961px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n961px {
    margin-top: -961px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n961px {
    margin-top: -961px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n962px {
    margin-top: -962px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n962px {
    margin-top: -962px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n962px {
    margin-top: -962px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n963px {
    margin-top: -963px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n963px {
    margin-top: -963px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n963px {
    margin-top: -963px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n964px {
    margin-top: -964px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n964px {
    margin-top: -964px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n964px {
    margin-top: -964px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n965px {
    margin-top: -965px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n965px {
    margin-top: -965px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n965px {
    margin-top: -965px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n966px {
    margin-top: -966px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n966px {
    margin-top: -966px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n966px {
    margin-top: -966px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n967px {
    margin-top: -967px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n967px {
    margin-top: -967px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n967px {
    margin-top: -967px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n968px {
    margin-top: -968px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n968px {
    margin-top: -968px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n968px {
    margin-top: -968px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n969px {
    margin-top: -969px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n969px {
    margin-top: -969px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n969px {
    margin-top: -969px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n970px {
    margin-top: -970px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n970px {
    margin-top: -970px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n970px {
    margin-top: -970px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n971px {
    margin-top: -971px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n971px {
    margin-top: -971px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n971px {
    margin-top: -971px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n972px {
    margin-top: -972px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n972px {
    margin-top: -972px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n972px {
    margin-top: -972px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n973px {
    margin-top: -973px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n973px {
    margin-top: -973px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n973px {
    margin-top: -973px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n974px {
    margin-top: -974px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n974px {
    margin-top: -974px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n974px {
    margin-top: -974px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n975px {
    margin-top: -975px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n975px {
    margin-top: -975px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n975px {
    margin-top: -975px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n976px {
    margin-top: -976px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n976px {
    margin-top: -976px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n976px {
    margin-top: -976px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n977px {
    margin-top: -977px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n977px {
    margin-top: -977px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n977px {
    margin-top: -977px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n978px {
    margin-top: -978px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n978px {
    margin-top: -978px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n978px {
    margin-top: -978px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n979px {
    margin-top: -979px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n979px {
    margin-top: -979px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n979px {
    margin-top: -979px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n980px {
    margin-top: -980px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n980px {
    margin-top: -980px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n980px {
    margin-top: -980px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n981px {
    margin-top: -981px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n981px {
    margin-top: -981px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n981px {
    margin-top: -981px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n982px {
    margin-top: -982px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n982px {
    margin-top: -982px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n982px {
    margin-top: -982px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n983px {
    margin-top: -983px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n983px {
    margin-top: -983px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n983px {
    margin-top: -983px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n984px {
    margin-top: -984px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n984px {
    margin-top: -984px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n984px {
    margin-top: -984px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n985px {
    margin-top: -985px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n985px {
    margin-top: -985px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n985px {
    margin-top: -985px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n986px {
    margin-top: -986px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n986px {
    margin-top: -986px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n986px {
    margin-top: -986px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n987px {
    margin-top: -987px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n987px {
    margin-top: -987px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n987px {
    margin-top: -987px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n988px {
    margin-top: -988px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n988px {
    margin-top: -988px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n988px {
    margin-top: -988px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n989px {
    margin-top: -989px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n989px {
    margin-top: -989px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n989px {
    margin-top: -989px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n990px {
    margin-top: -990px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n990px {
    margin-top: -990px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n990px {
    margin-top: -990px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n991px {
    margin-top: -991px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n991px {
    margin-top: -991px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n991px {
    margin-top: -991px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n992px {
    margin-top: -992px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n992px {
    margin-top: -992px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n992px {
    margin-top: -992px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n993px {
    margin-top: -993px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n993px {
    margin-top: -993px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n993px {
    margin-top: -993px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n994px {
    margin-top: -994px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n994px {
    margin-top: -994px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n994px {
    margin-top: -994px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n995px {
    margin-top: -995px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n995px {
    margin-top: -995px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n995px {
    margin-top: -995px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n996px {
    margin-top: -996px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n996px {
    margin-top: -996px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n996px {
    margin-top: -996px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n997px {
    margin-top: -997px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n997px {
    margin-top: -997px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n997px {
    margin-top: -997px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n998px {
    margin-top: -998px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n998px {
    margin-top: -998px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n998px {
    margin-top: -998px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n999px {
    margin-top: -999px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n999px {
    margin-top: -999px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n999px {
    margin-top: -999px !important;
  }
}
@media (min-width: 768px) {
  .mt-md-n1000px {
    margin-top: -1000px !important;
  }
}
@media (min-width: 992px) {
  .mt-lg-n1000px {
    margin-top: -1000px !important;
  }
}
@media (min-width: 1200px) {
  .mt-xl-n1000px {
    margin-top: -1000px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n1px {
    margin-bottom: -1px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n2px {
    margin-bottom: -2px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n3px {
    margin-bottom: -3px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n4px {
    margin-bottom: -4px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n5px {
    margin-bottom: -5px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n6px {
    margin-bottom: -6px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n7px {
    margin-bottom: -7px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n8px {
    margin-bottom: -8px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n9px {
    margin-bottom: -9px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n10px {
    margin-bottom: -10px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n11px {
    margin-bottom: -11px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n12px {
    margin-bottom: -12px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n13px {
    margin-bottom: -13px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n14px {
    margin-bottom: -14px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n15px {
    margin-bottom: -15px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n16px {
    margin-bottom: -16px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n17px {
    margin-bottom: -17px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n18px {
    margin-bottom: -18px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n19px {
    margin-bottom: -19px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n20px {
    margin-bottom: -20px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n21px {
    margin-bottom: -21px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n22px {
    margin-bottom: -22px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n23px {
    margin-bottom: -23px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n24px {
    margin-bottom: -24px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n25px {
    margin-bottom: -25px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n26px {
    margin-bottom: -26px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n27px {
    margin-bottom: -27px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n28px {
    margin-bottom: -28px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n29px {
    margin-bottom: -29px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n30px {
    margin-bottom: -30px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n31px {
    margin-bottom: -31px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n32px {
    margin-bottom: -32px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n33px {
    margin-bottom: -33px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n34px {
    margin-bottom: -34px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n35px {
    margin-bottom: -35px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n36px {
    margin-bottom: -36px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n37px {
    margin-bottom: -37px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n38px {
    margin-bottom: -38px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n39px {
    margin-bottom: -39px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n40px {
    margin-bottom: -40px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n41px {
    margin-bottom: -41px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n42px {
    margin-bottom: -42px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n43px {
    margin-bottom: -43px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n44px {
    margin-bottom: -44px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n45px {
    margin-bottom: -45px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n46px {
    margin-bottom: -46px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n47px {
    margin-bottom: -47px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n48px {
    margin-bottom: -48px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n49px {
    margin-bottom: -49px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n50px {
    margin-bottom: -50px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n51px {
    margin-bottom: -51px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n52px {
    margin-bottom: -52px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n53px {
    margin-bottom: -53px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n54px {
    margin-bottom: -54px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n55px {
    margin-bottom: -55px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n56px {
    margin-bottom: -56px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n57px {
    margin-bottom: -57px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n58px {
    margin-bottom: -58px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n59px {
    margin-bottom: -59px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n60px {
    margin-bottom: -60px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n61px {
    margin-bottom: -61px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n62px {
    margin-bottom: -62px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n63px {
    margin-bottom: -63px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n64px {
    margin-bottom: -64px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n65px {
    margin-bottom: -65px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n66px {
    margin-bottom: -66px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n67px {
    margin-bottom: -67px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n68px {
    margin-bottom: -68px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n69px {
    margin-bottom: -69px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n70px {
    margin-bottom: -70px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n71px {
    margin-bottom: -71px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n72px {
    margin-bottom: -72px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n73px {
    margin-bottom: -73px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n74px {
    margin-bottom: -74px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n75px {
    margin-bottom: -75px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n76px {
    margin-bottom: -76px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n77px {
    margin-bottom: -77px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n78px {
    margin-bottom: -78px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n79px {
    margin-bottom: -79px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n80px {
    margin-bottom: -80px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n81px {
    margin-bottom: -81px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n82px {
    margin-bottom: -82px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n83px {
    margin-bottom: -83px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n84px {
    margin-bottom: -84px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n85px {
    margin-bottom: -85px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n86px {
    margin-bottom: -86px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n87px {
    margin-bottom: -87px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n88px {
    margin-bottom: -88px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n89px {
    margin-bottom: -89px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n90px {
    margin-bottom: -90px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n91px {
    margin-bottom: -91px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n92px {
    margin-bottom: -92px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n93px {
    margin-bottom: -93px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n94px {
    margin-bottom: -94px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n95px {
    margin-bottom: -95px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n96px {
    margin-bottom: -96px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n97px {
    margin-bottom: -97px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n98px {
    margin-bottom: -98px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n99px {
    margin-bottom: -99px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n100px {
    margin-bottom: -100px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n101px {
    margin-bottom: -101px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n102px {
    margin-bottom: -102px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n103px {
    margin-bottom: -103px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n104px {
    margin-bottom: -104px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n105px {
    margin-bottom: -105px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n106px {
    margin-bottom: -106px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n107px {
    margin-bottom: -107px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n108px {
    margin-bottom: -108px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n109px {
    margin-bottom: -109px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n110px {
    margin-bottom: -110px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n111px {
    margin-bottom: -111px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n112px {
    margin-bottom: -112px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n113px {
    margin-bottom: -113px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n114px {
    margin-bottom: -114px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n115px {
    margin-bottom: -115px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n116px {
    margin-bottom: -116px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n117px {
    margin-bottom: -117px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n118px {
    margin-bottom: -118px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n119px {
    margin-bottom: -119px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n120px {
    margin-bottom: -120px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n121px {
    margin-bottom: -121px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n122px {
    margin-bottom: -122px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n123px {
    margin-bottom: -123px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n124px {
    margin-bottom: -124px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n125px {
    margin-bottom: -125px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n126px {
    margin-bottom: -126px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n127px {
    margin-bottom: -127px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n128px {
    margin-bottom: -128px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n129px {
    margin-bottom: -129px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n130px {
    margin-bottom: -130px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n131px {
    margin-bottom: -131px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n132px {
    margin-bottom: -132px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n133px {
    margin-bottom: -133px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n134px {
    margin-bottom: -134px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n135px {
    margin-bottom: -135px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n136px {
    margin-bottom: -136px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n137px {
    margin-bottom: -137px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n138px {
    margin-bottom: -138px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n139px {
    margin-bottom: -139px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n140px {
    margin-bottom: -140px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n141px {
    margin-bottom: -141px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n142px {
    margin-bottom: -142px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n143px {
    margin-bottom: -143px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n144px {
    margin-bottom: -144px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n145px {
    margin-bottom: -145px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n146px {
    margin-bottom: -146px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n147px {
    margin-bottom: -147px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n148px {
    margin-bottom: -148px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n149px {
    margin-bottom: -149px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n150px {
    margin-bottom: -150px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n151px {
    margin-bottom: -151px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n152px {
    margin-bottom: -152px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n153px {
    margin-bottom: -153px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n154px {
    margin-bottom: -154px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n155px {
    margin-bottom: -155px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n156px {
    margin-bottom: -156px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n157px {
    margin-bottom: -157px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n158px {
    margin-bottom: -158px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n159px {
    margin-bottom: -159px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n160px {
    margin-bottom: -160px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n161px {
    margin-bottom: -161px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n162px {
    margin-bottom: -162px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n163px {
    margin-bottom: -163px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n164px {
    margin-bottom: -164px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n165px {
    margin-bottom: -165px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n166px {
    margin-bottom: -166px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n167px {
    margin-bottom: -167px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n168px {
    margin-bottom: -168px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n169px {
    margin-bottom: -169px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n170px {
    margin-bottom: -170px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n171px {
    margin-bottom: -171px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n172px {
    margin-bottom: -172px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n173px {
    margin-bottom: -173px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n174px {
    margin-bottom: -174px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n175px {
    margin-bottom: -175px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n176px {
    margin-bottom: -176px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n177px {
    margin-bottom: -177px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n178px {
    margin-bottom: -178px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n179px {
    margin-bottom: -179px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n180px {
    margin-bottom: -180px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n181px {
    margin-bottom: -181px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n182px {
    margin-bottom: -182px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n183px {
    margin-bottom: -183px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n184px {
    margin-bottom: -184px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n185px {
    margin-bottom: -185px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n186px {
    margin-bottom: -186px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n187px {
    margin-bottom: -187px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n188px {
    margin-bottom: -188px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n189px {
    margin-bottom: -189px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n190px {
    margin-bottom: -190px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n191px {
    margin-bottom: -191px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n192px {
    margin-bottom: -192px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n193px {
    margin-bottom: -193px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n194px {
    margin-bottom: -194px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n195px {
    margin-bottom: -195px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n196px {
    margin-bottom: -196px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n197px {
    margin-bottom: -197px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n198px {
    margin-bottom: -198px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n199px {
    margin-bottom: -199px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n200px {
    margin-bottom: -200px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n201px {
    margin-bottom: -201px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n202px {
    margin-bottom: -202px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n203px {
    margin-bottom: -203px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n204px {
    margin-bottom: -204px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n205px {
    margin-bottom: -205px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n206px {
    margin-bottom: -206px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n207px {
    margin-bottom: -207px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n208px {
    margin-bottom: -208px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n209px {
    margin-bottom: -209px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n210px {
    margin-bottom: -210px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n211px {
    margin-bottom: -211px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n212px {
    margin-bottom: -212px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n213px {
    margin-bottom: -213px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n214px {
    margin-bottom: -214px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n215px {
    margin-bottom: -215px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n216px {
    margin-bottom: -216px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n217px {
    margin-bottom: -217px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n218px {
    margin-bottom: -218px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n219px {
    margin-bottom: -219px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n220px {
    margin-bottom: -220px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n221px {
    margin-bottom: -221px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n222px {
    margin-bottom: -222px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n223px {
    margin-bottom: -223px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n224px {
    margin-bottom: -224px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n225px {
    margin-bottom: -225px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n226px {
    margin-bottom: -226px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n227px {
    margin-bottom: -227px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n228px {
    margin-bottom: -228px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n229px {
    margin-bottom: -229px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n230px {
    margin-bottom: -230px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n231px {
    margin-bottom: -231px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n232px {
    margin-bottom: -232px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n233px {
    margin-bottom: -233px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n234px {
    margin-bottom: -234px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n235px {
    margin-bottom: -235px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n236px {
    margin-bottom: -236px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n237px {
    margin-bottom: -237px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n238px {
    margin-bottom: -238px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n239px {
    margin-bottom: -239px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n240px {
    margin-bottom: -240px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n241px {
    margin-bottom: -241px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n242px {
    margin-bottom: -242px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n243px {
    margin-bottom: -243px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n244px {
    margin-bottom: -244px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n245px {
    margin-bottom: -245px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n246px {
    margin-bottom: -246px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n247px {
    margin-bottom: -247px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n248px {
    margin-bottom: -248px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n249px {
    margin-bottom: -249px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n250px {
    margin-bottom: -250px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n251px {
    margin-bottom: -251px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n252px {
    margin-bottom: -252px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n253px {
    margin-bottom: -253px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n254px {
    margin-bottom: -254px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n255px {
    margin-bottom: -255px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n256px {
    margin-bottom: -256px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n257px {
    margin-bottom: -257px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n258px {
    margin-bottom: -258px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n259px {
    margin-bottom: -259px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n260px {
    margin-bottom: -260px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n261px {
    margin-bottom: -261px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n262px {
    margin-bottom: -262px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n263px {
    margin-bottom: -263px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n264px {
    margin-bottom: -264px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n265px {
    margin-bottom: -265px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n266px {
    margin-bottom: -266px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n267px {
    margin-bottom: -267px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n268px {
    margin-bottom: -268px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n269px {
    margin-bottom: -269px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n270px {
    margin-bottom: -270px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n271px {
    margin-bottom: -271px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n272px {
    margin-bottom: -272px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n273px {
    margin-bottom: -273px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n274px {
    margin-bottom: -274px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n275px {
    margin-bottom: -275px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n276px {
    margin-bottom: -276px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n277px {
    margin-bottom: -277px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n278px {
    margin-bottom: -278px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n279px {
    margin-bottom: -279px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n280px {
    margin-bottom: -280px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n281px {
    margin-bottom: -281px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n282px {
    margin-bottom: -282px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n283px {
    margin-bottom: -283px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n284px {
    margin-bottom: -284px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n285px {
    margin-bottom: -285px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n286px {
    margin-bottom: -286px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n287px {
    margin-bottom: -287px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n288px {
    margin-bottom: -288px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n289px {
    margin-bottom: -289px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n290px {
    margin-bottom: -290px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n291px {
    margin-bottom: -291px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n292px {
    margin-bottom: -292px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n293px {
    margin-bottom: -293px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n294px {
    margin-bottom: -294px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n295px {
    margin-bottom: -295px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n296px {
    margin-bottom: -296px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n297px {
    margin-bottom: -297px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n298px {
    margin-bottom: -298px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n299px {
    margin-bottom: -299px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n300px {
    margin-bottom: -300px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n301px {
    margin-bottom: -301px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n302px {
    margin-bottom: -302px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n303px {
    margin-bottom: -303px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n304px {
    margin-bottom: -304px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n305px {
    margin-bottom: -305px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n306px {
    margin-bottom: -306px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n307px {
    margin-bottom: -307px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n308px {
    margin-bottom: -308px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n309px {
    margin-bottom: -309px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n310px {
    margin-bottom: -310px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n311px {
    margin-bottom: -311px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n312px {
    margin-bottom: -312px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n313px {
    margin-bottom: -313px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n314px {
    margin-bottom: -314px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n315px {
    margin-bottom: -315px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n316px {
    margin-bottom: -316px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n317px {
    margin-bottom: -317px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n318px {
    margin-bottom: -318px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n319px {
    margin-bottom: -319px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n320px {
    margin-bottom: -320px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n321px {
    margin-bottom: -321px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n322px {
    margin-bottom: -322px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n323px {
    margin-bottom: -323px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n324px {
    margin-bottom: -324px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n325px {
    margin-bottom: -325px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n326px {
    margin-bottom: -326px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n327px {
    margin-bottom: -327px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n328px {
    margin-bottom: -328px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n329px {
    margin-bottom: -329px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n330px {
    margin-bottom: -330px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n331px {
    margin-bottom: -331px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n332px {
    margin-bottom: -332px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n333px {
    margin-bottom: -333px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n334px {
    margin-bottom: -334px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n335px {
    margin-bottom: -335px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n336px {
    margin-bottom: -336px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n337px {
    margin-bottom: -337px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n338px {
    margin-bottom: -338px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n339px {
    margin-bottom: -339px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n340px {
    margin-bottom: -340px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n341px {
    margin-bottom: -341px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n342px {
    margin-bottom: -342px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n343px {
    margin-bottom: -343px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n344px {
    margin-bottom: -344px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n345px {
    margin-bottom: -345px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n346px {
    margin-bottom: -346px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n347px {
    margin-bottom: -347px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n348px {
    margin-bottom: -348px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n349px {
    margin-bottom: -349px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n350px {
    margin-bottom: -350px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n351px {
    margin-bottom: -351px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n352px {
    margin-bottom: -352px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n353px {
    margin-bottom: -353px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n354px {
    margin-bottom: -354px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n355px {
    margin-bottom: -355px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n356px {
    margin-bottom: -356px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n357px {
    margin-bottom: -357px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n358px {
    margin-bottom: -358px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n359px {
    margin-bottom: -359px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n360px {
    margin-bottom: -360px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n361px {
    margin-bottom: -361px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n362px {
    margin-bottom: -362px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n363px {
    margin-bottom: -363px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n364px {
    margin-bottom: -364px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n365px {
    margin-bottom: -365px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n366px {
    margin-bottom: -366px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n367px {
    margin-bottom: -367px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n368px {
    margin-bottom: -368px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n369px {
    margin-bottom: -369px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n370px {
    margin-bottom: -370px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n371px {
    margin-bottom: -371px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n372px {
    margin-bottom: -372px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n373px {
    margin-bottom: -373px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n374px {
    margin-bottom: -374px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n375px {
    margin-bottom: -375px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n376px {
    margin-bottom: -376px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n377px {
    margin-bottom: -377px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n378px {
    margin-bottom: -378px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n379px {
    margin-bottom: -379px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n380px {
    margin-bottom: -380px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n381px {
    margin-bottom: -381px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n382px {
    margin-bottom: -382px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n383px {
    margin-bottom: -383px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n384px {
    margin-bottom: -384px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n385px {
    margin-bottom: -385px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n386px {
    margin-bottom: -386px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n387px {
    margin-bottom: -387px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n388px {
    margin-bottom: -388px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n389px {
    margin-bottom: -389px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n390px {
    margin-bottom: -390px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n391px {
    margin-bottom: -391px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n392px {
    margin-bottom: -392px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n393px {
    margin-bottom: -393px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n394px {
    margin-bottom: -394px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n395px {
    margin-bottom: -395px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n396px {
    margin-bottom: -396px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n397px {
    margin-bottom: -397px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n398px {
    margin-bottom: -398px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n399px {
    margin-bottom: -399px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n400px {
    margin-bottom: -400px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n401px {
    margin-bottom: -401px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n402px {
    margin-bottom: -402px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n403px {
    margin-bottom: -403px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n404px {
    margin-bottom: -404px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n405px {
    margin-bottom: -405px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n406px {
    margin-bottom: -406px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n407px {
    margin-bottom: -407px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n408px {
    margin-bottom: -408px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n409px {
    margin-bottom: -409px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n410px {
    margin-bottom: -410px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n411px {
    margin-bottom: -411px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n412px {
    margin-bottom: -412px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n413px {
    margin-bottom: -413px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n414px {
    margin-bottom: -414px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n415px {
    margin-bottom: -415px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n416px {
    margin-bottom: -416px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n417px {
    margin-bottom: -417px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n418px {
    margin-bottom: -418px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n419px {
    margin-bottom: -419px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n420px {
    margin-bottom: -420px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n421px {
    margin-bottom: -421px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n422px {
    margin-bottom: -422px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n423px {
    margin-bottom: -423px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n424px {
    margin-bottom: -424px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n425px {
    margin-bottom: -425px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n426px {
    margin-bottom: -426px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n427px {
    margin-bottom: -427px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n428px {
    margin-bottom: -428px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n429px {
    margin-bottom: -429px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n430px {
    margin-bottom: -430px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n431px {
    margin-bottom: -431px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n432px {
    margin-bottom: -432px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n433px {
    margin-bottom: -433px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n434px {
    margin-bottom: -434px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n435px {
    margin-bottom: -435px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n436px {
    margin-bottom: -436px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n437px {
    margin-bottom: -437px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n438px {
    margin-bottom: -438px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n439px {
    margin-bottom: -439px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n440px {
    margin-bottom: -440px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n441px {
    margin-bottom: -441px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n442px {
    margin-bottom: -442px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n443px {
    margin-bottom: -443px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n444px {
    margin-bottom: -444px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n445px {
    margin-bottom: -445px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n446px {
    margin-bottom: -446px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n447px {
    margin-bottom: -447px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n448px {
    margin-bottom: -448px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n449px {
    margin-bottom: -449px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n450px {
    margin-bottom: -450px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n451px {
    margin-bottom: -451px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n452px {
    margin-bottom: -452px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n453px {
    margin-bottom: -453px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n454px {
    margin-bottom: -454px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n455px {
    margin-bottom: -455px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n456px {
    margin-bottom: -456px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n457px {
    margin-bottom: -457px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n458px {
    margin-bottom: -458px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n459px {
    margin-bottom: -459px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n460px {
    margin-bottom: -460px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n461px {
    margin-bottom: -461px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n462px {
    margin-bottom: -462px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n463px {
    margin-bottom: -463px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n464px {
    margin-bottom: -464px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n465px {
    margin-bottom: -465px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n466px {
    margin-bottom: -466px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n467px {
    margin-bottom: -467px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n468px {
    margin-bottom: -468px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n469px {
    margin-bottom: -469px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n470px {
    margin-bottom: -470px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n471px {
    margin-bottom: -471px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n472px {
    margin-bottom: -472px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n473px {
    margin-bottom: -473px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n474px {
    margin-bottom: -474px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n475px {
    margin-bottom: -475px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n476px {
    margin-bottom: -476px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n477px {
    margin-bottom: -477px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n478px {
    margin-bottom: -478px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n479px {
    margin-bottom: -479px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n480px {
    margin-bottom: -480px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n481px {
    margin-bottom: -481px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n482px {
    margin-bottom: -482px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n483px {
    margin-bottom: -483px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n484px {
    margin-bottom: -484px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n485px {
    margin-bottom: -485px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n486px {
    margin-bottom: -486px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n487px {
    margin-bottom: -487px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n488px {
    margin-bottom: -488px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n489px {
    margin-bottom: -489px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n490px {
    margin-bottom: -490px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n491px {
    margin-bottom: -491px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n492px {
    margin-bottom: -492px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n493px {
    margin-bottom: -493px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n494px {
    margin-bottom: -494px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n495px {
    margin-bottom: -495px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n496px {
    margin-bottom: -496px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n497px {
    margin-bottom: -497px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n498px {
    margin-bottom: -498px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n499px {
    margin-bottom: -499px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n500px {
    margin-bottom: -500px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n501px {
    margin-bottom: -501px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n502px {
    margin-bottom: -502px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n503px {
    margin-bottom: -503px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n504px {
    margin-bottom: -504px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n505px {
    margin-bottom: -505px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n506px {
    margin-bottom: -506px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n507px {
    margin-bottom: -507px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n508px {
    margin-bottom: -508px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n509px {
    margin-bottom: -509px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n510px {
    margin-bottom: -510px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n511px {
    margin-bottom: -511px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n512px {
    margin-bottom: -512px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n513px {
    margin-bottom: -513px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n514px {
    margin-bottom: -514px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n515px {
    margin-bottom: -515px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n516px {
    margin-bottom: -516px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n517px {
    margin-bottom: -517px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n518px {
    margin-bottom: -518px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n519px {
    margin-bottom: -519px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n520px {
    margin-bottom: -520px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n521px {
    margin-bottom: -521px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n522px {
    margin-bottom: -522px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n523px {
    margin-bottom: -523px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n524px {
    margin-bottom: -524px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n525px {
    margin-bottom: -525px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n526px {
    margin-bottom: -526px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n527px {
    margin-bottom: -527px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n528px {
    margin-bottom: -528px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n529px {
    margin-bottom: -529px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n530px {
    margin-bottom: -530px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n531px {
    margin-bottom: -531px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n532px {
    margin-bottom: -532px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n533px {
    margin-bottom: -533px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n534px {
    margin-bottom: -534px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n535px {
    margin-bottom: -535px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n536px {
    margin-bottom: -536px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n537px {
    margin-bottom: -537px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n538px {
    margin-bottom: -538px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n539px {
    margin-bottom: -539px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n540px {
    margin-bottom: -540px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n541px {
    margin-bottom: -541px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n542px {
    margin-bottom: -542px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n543px {
    margin-bottom: -543px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n544px {
    margin-bottom: -544px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n545px {
    margin-bottom: -545px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n546px {
    margin-bottom: -546px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n547px {
    margin-bottom: -547px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n548px {
    margin-bottom: -548px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n549px {
    margin-bottom: -549px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n550px {
    margin-bottom: -550px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n551px {
    margin-bottom: -551px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n552px {
    margin-bottom: -552px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n553px {
    margin-bottom: -553px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n554px {
    margin-bottom: -554px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n555px {
    margin-bottom: -555px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n556px {
    margin-bottom: -556px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n557px {
    margin-bottom: -557px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n558px {
    margin-bottom: -558px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n559px {
    margin-bottom: -559px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n560px {
    margin-bottom: -560px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n561px {
    margin-bottom: -561px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n562px {
    margin-bottom: -562px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n563px {
    margin-bottom: -563px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n564px {
    margin-bottom: -564px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n565px {
    margin-bottom: -565px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n566px {
    margin-bottom: -566px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n567px {
    margin-bottom: -567px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n568px {
    margin-bottom: -568px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n569px {
    margin-bottom: -569px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n570px {
    margin-bottom: -570px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n571px {
    margin-bottom: -571px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n572px {
    margin-bottom: -572px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n573px {
    margin-bottom: -573px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n574px {
    margin-bottom: -574px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n575px {
    margin-bottom: -575px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n576px {
    margin-bottom: -576px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n577px {
    margin-bottom: -577px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n578px {
    margin-bottom: -578px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n579px {
    margin-bottom: -579px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n580px {
    margin-bottom: -580px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n581px {
    margin-bottom: -581px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n582px {
    margin-bottom: -582px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n583px {
    margin-bottom: -583px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n584px {
    margin-bottom: -584px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n585px {
    margin-bottom: -585px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n586px {
    margin-bottom: -586px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n587px {
    margin-bottom: -587px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n588px {
    margin-bottom: -588px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n589px {
    margin-bottom: -589px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n590px {
    margin-bottom: -590px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n591px {
    margin-bottom: -591px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n592px {
    margin-bottom: -592px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n593px {
    margin-bottom: -593px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n594px {
    margin-bottom: -594px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n595px {
    margin-bottom: -595px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n596px {
    margin-bottom: -596px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n597px {
    margin-bottom: -597px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n598px {
    margin-bottom: -598px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n599px {
    margin-bottom: -599px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n600px {
    margin-bottom: -600px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n601px {
    margin-bottom: -601px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n602px {
    margin-bottom: -602px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n603px {
    margin-bottom: -603px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n604px {
    margin-bottom: -604px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n605px {
    margin-bottom: -605px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n606px {
    margin-bottom: -606px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n607px {
    margin-bottom: -607px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n608px {
    margin-bottom: -608px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n609px {
    margin-bottom: -609px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n610px {
    margin-bottom: -610px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n611px {
    margin-bottom: -611px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n612px {
    margin-bottom: -612px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n613px {
    margin-bottom: -613px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n614px {
    margin-bottom: -614px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n615px {
    margin-bottom: -615px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n616px {
    margin-bottom: -616px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n617px {
    margin-bottom: -617px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n618px {
    margin-bottom: -618px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n619px {
    margin-bottom: -619px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n620px {
    margin-bottom: -620px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n621px {
    margin-bottom: -621px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n622px {
    margin-bottom: -622px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n623px {
    margin-bottom: -623px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n624px {
    margin-bottom: -624px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n625px {
    margin-bottom: -625px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n626px {
    margin-bottom: -626px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n627px {
    margin-bottom: -627px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n628px {
    margin-bottom: -628px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n629px {
    margin-bottom: -629px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n630px {
    margin-bottom: -630px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n631px {
    margin-bottom: -631px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n632px {
    margin-bottom: -632px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n633px {
    margin-bottom: -633px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n634px {
    margin-bottom: -634px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n635px {
    margin-bottom: -635px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n636px {
    margin-bottom: -636px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n637px {
    margin-bottom: -637px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n638px {
    margin-bottom: -638px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n639px {
    margin-bottom: -639px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n640px {
    margin-bottom: -640px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n641px {
    margin-bottom: -641px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n642px {
    margin-bottom: -642px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n643px {
    margin-bottom: -643px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n644px {
    margin-bottom: -644px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n645px {
    margin-bottom: -645px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n646px {
    margin-bottom: -646px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n647px {
    margin-bottom: -647px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n648px {
    margin-bottom: -648px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n649px {
    margin-bottom: -649px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n650px {
    margin-bottom: -650px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n651px {
    margin-bottom: -651px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n652px {
    margin-bottom: -652px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n653px {
    margin-bottom: -653px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n654px {
    margin-bottom: -654px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n655px {
    margin-bottom: -655px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n656px {
    margin-bottom: -656px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n657px {
    margin-bottom: -657px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n658px {
    margin-bottom: -658px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n659px {
    margin-bottom: -659px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n660px {
    margin-bottom: -660px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n661px {
    margin-bottom: -661px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n662px {
    margin-bottom: -662px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n663px {
    margin-bottom: -663px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n664px {
    margin-bottom: -664px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n665px {
    margin-bottom: -665px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n666px {
    margin-bottom: -666px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n667px {
    margin-bottom: -667px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n668px {
    margin-bottom: -668px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n669px {
    margin-bottom: -669px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n670px {
    margin-bottom: -670px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n671px {
    margin-bottom: -671px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n672px {
    margin-bottom: -672px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n673px {
    margin-bottom: -673px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n674px {
    margin-bottom: -674px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n675px {
    margin-bottom: -675px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n676px {
    margin-bottom: -676px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n677px {
    margin-bottom: -677px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n678px {
    margin-bottom: -678px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n679px {
    margin-bottom: -679px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n680px {
    margin-bottom: -680px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n681px {
    margin-bottom: -681px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n682px {
    margin-bottom: -682px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n683px {
    margin-bottom: -683px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n684px {
    margin-bottom: -684px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n685px {
    margin-bottom: -685px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n686px {
    margin-bottom: -686px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n687px {
    margin-bottom: -687px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n688px {
    margin-bottom: -688px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n689px {
    margin-bottom: -689px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n690px {
    margin-bottom: -690px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n691px {
    margin-bottom: -691px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n692px {
    margin-bottom: -692px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n693px {
    margin-bottom: -693px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n694px {
    margin-bottom: -694px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n695px {
    margin-bottom: -695px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n696px {
    margin-bottom: -696px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n697px {
    margin-bottom: -697px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n698px {
    margin-bottom: -698px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n699px {
    margin-bottom: -699px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n700px {
    margin-bottom: -700px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n701px {
    margin-bottom: -701px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n702px {
    margin-bottom: -702px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n703px {
    margin-bottom: -703px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n704px {
    margin-bottom: -704px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n705px {
    margin-bottom: -705px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n706px {
    margin-bottom: -706px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n707px {
    margin-bottom: -707px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n708px {
    margin-bottom: -708px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n709px {
    margin-bottom: -709px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n710px {
    margin-bottom: -710px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n711px {
    margin-bottom: -711px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n712px {
    margin-bottom: -712px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n713px {
    margin-bottom: -713px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n714px {
    margin-bottom: -714px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n715px {
    margin-bottom: -715px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n716px {
    margin-bottom: -716px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n717px {
    margin-bottom: -717px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n718px {
    margin-bottom: -718px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n719px {
    margin-bottom: -719px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n720px {
    margin-bottom: -720px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n721px {
    margin-bottom: -721px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n722px {
    margin-bottom: -722px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n723px {
    margin-bottom: -723px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n724px {
    margin-bottom: -724px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n725px {
    margin-bottom: -725px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n726px {
    margin-bottom: -726px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n727px {
    margin-bottom: -727px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n728px {
    margin-bottom: -728px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n729px {
    margin-bottom: -729px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n730px {
    margin-bottom: -730px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n731px {
    margin-bottom: -731px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n732px {
    margin-bottom: -732px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n733px {
    margin-bottom: -733px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n734px {
    margin-bottom: -734px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n735px {
    margin-bottom: -735px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n736px {
    margin-bottom: -736px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n737px {
    margin-bottom: -737px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n738px {
    margin-bottom: -738px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n739px {
    margin-bottom: -739px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n740px {
    margin-bottom: -740px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n741px {
    margin-bottom: -741px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n742px {
    margin-bottom: -742px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n743px {
    margin-bottom: -743px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n744px {
    margin-bottom: -744px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n745px {
    margin-bottom: -745px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n746px {
    margin-bottom: -746px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n747px {
    margin-bottom: -747px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n748px {
    margin-bottom: -748px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n749px {
    margin-bottom: -749px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n750px {
    margin-bottom: -750px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n751px {
    margin-bottom: -751px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n752px {
    margin-bottom: -752px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n753px {
    margin-bottom: -753px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n754px {
    margin-bottom: -754px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n755px {
    margin-bottom: -755px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n756px {
    margin-bottom: -756px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n757px {
    margin-bottom: -757px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n758px {
    margin-bottom: -758px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n759px {
    margin-bottom: -759px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n760px {
    margin-bottom: -760px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n761px {
    margin-bottom: -761px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n762px {
    margin-bottom: -762px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n763px {
    margin-bottom: -763px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n764px {
    margin-bottom: -764px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n765px {
    margin-bottom: -765px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n766px {
    margin-bottom: -766px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n767px {
    margin-bottom: -767px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n768px {
    margin-bottom: -768px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n769px {
    margin-bottom: -769px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n770px {
    margin-bottom: -770px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n771px {
    margin-bottom: -771px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n772px {
    margin-bottom: -772px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n773px {
    margin-bottom: -773px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n774px {
    margin-bottom: -774px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n775px {
    margin-bottom: -775px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n776px {
    margin-bottom: -776px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n777px {
    margin-bottom: -777px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n778px {
    margin-bottom: -778px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n779px {
    margin-bottom: -779px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n780px {
    margin-bottom: -780px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n781px {
    margin-bottom: -781px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n782px {
    margin-bottom: -782px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n783px {
    margin-bottom: -783px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n784px {
    margin-bottom: -784px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n785px {
    margin-bottom: -785px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n786px {
    margin-bottom: -786px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n787px {
    margin-bottom: -787px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n788px {
    margin-bottom: -788px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n789px {
    margin-bottom: -789px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n790px {
    margin-bottom: -790px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n791px {
    margin-bottom: -791px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n792px {
    margin-bottom: -792px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n793px {
    margin-bottom: -793px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n794px {
    margin-bottom: -794px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n795px {
    margin-bottom: -795px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n796px {
    margin-bottom: -796px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n797px {
    margin-bottom: -797px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n798px {
    margin-bottom: -798px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n799px {
    margin-bottom: -799px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n800px {
    margin-bottom: -800px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n801px {
    margin-bottom: -801px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n802px {
    margin-bottom: -802px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n803px {
    margin-bottom: -803px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n804px {
    margin-bottom: -804px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n805px {
    margin-bottom: -805px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n806px {
    margin-bottom: -806px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n807px {
    margin-bottom: -807px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n808px {
    margin-bottom: -808px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n809px {
    margin-bottom: -809px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n810px {
    margin-bottom: -810px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n811px {
    margin-bottom: -811px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n812px {
    margin-bottom: -812px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n813px {
    margin-bottom: -813px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n814px {
    margin-bottom: -814px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n815px {
    margin-bottom: -815px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n816px {
    margin-bottom: -816px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n817px {
    margin-bottom: -817px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n818px {
    margin-bottom: -818px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n819px {
    margin-bottom: -819px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n820px {
    margin-bottom: -820px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n821px {
    margin-bottom: -821px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n822px {
    margin-bottom: -822px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n823px {
    margin-bottom: -823px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n824px {
    margin-bottom: -824px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n825px {
    margin-bottom: -825px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n826px {
    margin-bottom: -826px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n827px {
    margin-bottom: -827px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n828px {
    margin-bottom: -828px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n829px {
    margin-bottom: -829px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n830px {
    margin-bottom: -830px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n831px {
    margin-bottom: -831px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n832px {
    margin-bottom: -832px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n833px {
    margin-bottom: -833px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n834px {
    margin-bottom: -834px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n835px {
    margin-bottom: -835px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n836px {
    margin-bottom: -836px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n837px {
    margin-bottom: -837px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n838px {
    margin-bottom: -838px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n839px {
    margin-bottom: -839px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n840px {
    margin-bottom: -840px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n841px {
    margin-bottom: -841px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n842px {
    margin-bottom: -842px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n843px {
    margin-bottom: -843px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n844px {
    margin-bottom: -844px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n845px {
    margin-bottom: -845px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n846px {
    margin-bottom: -846px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n847px {
    margin-bottom: -847px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n848px {
    margin-bottom: -848px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n849px {
    margin-bottom: -849px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n850px {
    margin-bottom: -850px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n851px {
    margin-bottom: -851px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n852px {
    margin-bottom: -852px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n853px {
    margin-bottom: -853px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n854px {
    margin-bottom: -854px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n855px {
    margin-bottom: -855px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n856px {
    margin-bottom: -856px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n857px {
    margin-bottom: -857px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n858px {
    margin-bottom: -858px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n859px {
    margin-bottom: -859px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n860px {
    margin-bottom: -860px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n861px {
    margin-bottom: -861px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n862px {
    margin-bottom: -862px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n863px {
    margin-bottom: -863px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n864px {
    margin-bottom: -864px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n865px {
    margin-bottom: -865px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n866px {
    margin-bottom: -866px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n867px {
    margin-bottom: -867px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n868px {
    margin-bottom: -868px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n869px {
    margin-bottom: -869px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n870px {
    margin-bottom: -870px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n871px {
    margin-bottom: -871px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n872px {
    margin-bottom: -872px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n873px {
    margin-bottom: -873px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n874px {
    margin-bottom: -874px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n875px {
    margin-bottom: -875px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n876px {
    margin-bottom: -876px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n877px {
    margin-bottom: -877px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n878px {
    margin-bottom: -878px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n879px {
    margin-bottom: -879px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n880px {
    margin-bottom: -880px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n881px {
    margin-bottom: -881px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n882px {
    margin-bottom: -882px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n883px {
    margin-bottom: -883px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n884px {
    margin-bottom: -884px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n885px {
    margin-bottom: -885px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n886px {
    margin-bottom: -886px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n887px {
    margin-bottom: -887px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n888px {
    margin-bottom: -888px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n889px {
    margin-bottom: -889px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n890px {
    margin-bottom: -890px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n891px {
    margin-bottom: -891px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n892px {
    margin-bottom: -892px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n893px {
    margin-bottom: -893px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n894px {
    margin-bottom: -894px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n895px {
    margin-bottom: -895px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n896px {
    margin-bottom: -896px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n897px {
    margin-bottom: -897px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n898px {
    margin-bottom: -898px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n899px {
    margin-bottom: -899px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n900px {
    margin-bottom: -900px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n901px {
    margin-bottom: -901px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n902px {
    margin-bottom: -902px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n903px {
    margin-bottom: -903px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n904px {
    margin-bottom: -904px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n905px {
    margin-bottom: -905px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n906px {
    margin-bottom: -906px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n907px {
    margin-bottom: -907px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n908px {
    margin-bottom: -908px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n909px {
    margin-bottom: -909px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n910px {
    margin-bottom: -910px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n911px {
    margin-bottom: -911px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n912px {
    margin-bottom: -912px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n913px {
    margin-bottom: -913px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n914px {
    margin-bottom: -914px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n915px {
    margin-bottom: -915px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n916px {
    margin-bottom: -916px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n917px {
    margin-bottom: -917px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n918px {
    margin-bottom: -918px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n919px {
    margin-bottom: -919px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n920px {
    margin-bottom: -920px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n921px {
    margin-bottom: -921px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n922px {
    margin-bottom: -922px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n923px {
    margin-bottom: -923px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n924px {
    margin-bottom: -924px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n925px {
    margin-bottom: -925px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n926px {
    margin-bottom: -926px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n927px {
    margin-bottom: -927px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n928px {
    margin-bottom: -928px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n929px {
    margin-bottom: -929px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n930px {
    margin-bottom: -930px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n931px {
    margin-bottom: -931px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n932px {
    margin-bottom: -932px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n933px {
    margin-bottom: -933px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n934px {
    margin-bottom: -934px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n935px {
    margin-bottom: -935px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n936px {
    margin-bottom: -936px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n937px {
    margin-bottom: -937px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n938px {
    margin-bottom: -938px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n939px {
    margin-bottom: -939px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n940px {
    margin-bottom: -940px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n941px {
    margin-bottom: -941px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n942px {
    margin-bottom: -942px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n943px {
    margin-bottom: -943px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n944px {
    margin-bottom: -944px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n945px {
    margin-bottom: -945px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n946px {
    margin-bottom: -946px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n947px {
    margin-bottom: -947px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n948px {
    margin-bottom: -948px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n949px {
    margin-bottom: -949px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n950px {
    margin-bottom: -950px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n951px {
    margin-bottom: -951px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n952px {
    margin-bottom: -952px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n953px {
    margin-bottom: -953px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n954px {
    margin-bottom: -954px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n955px {
    margin-bottom: -955px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n956px {
    margin-bottom: -956px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n957px {
    margin-bottom: -957px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n958px {
    margin-bottom: -958px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n959px {
    margin-bottom: -959px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n960px {
    margin-bottom: -960px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n961px {
    margin-bottom: -961px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n962px {
    margin-bottom: -962px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n963px {
    margin-bottom: -963px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n964px {
    margin-bottom: -964px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n965px {
    margin-bottom: -965px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n966px {
    margin-bottom: -966px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n967px {
    margin-bottom: -967px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n968px {
    margin-bottom: -968px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n969px {
    margin-bottom: -969px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n970px {
    margin-bottom: -970px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n971px {
    margin-bottom: -971px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n972px {
    margin-bottom: -972px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n973px {
    margin-bottom: -973px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n974px {
    margin-bottom: -974px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n975px {
    margin-bottom: -975px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n976px {
    margin-bottom: -976px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n977px {
    margin-bottom: -977px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n978px {
    margin-bottom: -978px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n979px {
    margin-bottom: -979px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n980px {
    margin-bottom: -980px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n981px {
    margin-bottom: -981px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n982px {
    margin-bottom: -982px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n983px {
    margin-bottom: -983px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n984px {
    margin-bottom: -984px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n985px {
    margin-bottom: -985px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n986px {
    margin-bottom: -986px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n987px {
    margin-bottom: -987px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n988px {
    margin-bottom: -988px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n989px {
    margin-bottom: -989px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n990px {
    margin-bottom: -990px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n991px {
    margin-bottom: -991px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n992px {
    margin-bottom: -992px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n993px {
    margin-bottom: -993px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n994px {
    margin-bottom: -994px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n995px {
    margin-bottom: -995px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n996px {
    margin-bottom: -996px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n997px {
    margin-bottom: -997px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n998px {
    margin-bottom: -998px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n999px {
    margin-bottom: -999px !important;
  }
}
@media (min-width: 768px) {
  .mb-md-n1000px {
    margin-bottom: -1000px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n1px {
    margin-left: -1px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n2px {
    margin-left: -2px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n3px {
    margin-left: -3px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n4px {
    margin-left: -4px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n5px {
    margin-left: -5px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n6px {
    margin-left: -6px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n7px {
    margin-left: -7px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n8px {
    margin-left: -8px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n9px {
    margin-left: -9px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n10px {
    margin-left: -10px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n11px {
    margin-left: -11px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n12px {
    margin-left: -12px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n13px {
    margin-left: -13px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n14px {
    margin-left: -14px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n15px {
    margin-left: -15px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n16px {
    margin-left: -16px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n17px {
    margin-left: -17px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n18px {
    margin-left: -18px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n19px {
    margin-left: -19px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n20px {
    margin-left: -20px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n21px {
    margin-left: -21px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n22px {
    margin-left: -22px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n23px {
    margin-left: -23px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n24px {
    margin-left: -24px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n25px {
    margin-left: -25px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n26px {
    margin-left: -26px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n27px {
    margin-left: -27px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n28px {
    margin-left: -28px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n29px {
    margin-left: -29px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n30px {
    margin-left: -30px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n31px {
    margin-left: -31px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n32px {
    margin-left: -32px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n33px {
    margin-left: -33px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n34px {
    margin-left: -34px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n35px {
    margin-left: -35px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n36px {
    margin-left: -36px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n37px {
    margin-left: -37px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n38px {
    margin-left: -38px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n39px {
    margin-left: -39px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n40px {
    margin-left: -40px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n41px {
    margin-left: -41px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n42px {
    margin-left: -42px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n43px {
    margin-left: -43px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n44px {
    margin-left: -44px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n45px {
    margin-left: -45px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n46px {
    margin-left: -46px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n47px {
    margin-left: -47px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n48px {
    margin-left: -48px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n49px {
    margin-left: -49px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n50px {
    margin-left: -50px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n51px {
    margin-left: -51px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n52px {
    margin-left: -52px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n53px {
    margin-left: -53px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n54px {
    margin-left: -54px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n55px {
    margin-left: -55px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n56px {
    margin-left: -56px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n57px {
    margin-left: -57px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n58px {
    margin-left: -58px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n59px {
    margin-left: -59px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n60px {
    margin-left: -60px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n61px {
    margin-left: -61px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n62px {
    margin-left: -62px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n63px {
    margin-left: -63px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n64px {
    margin-left: -64px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n65px {
    margin-left: -65px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n66px {
    margin-left: -66px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n67px {
    margin-left: -67px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n68px {
    margin-left: -68px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n69px {
    margin-left: -69px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n70px {
    margin-left: -70px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n71px {
    margin-left: -71px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n72px {
    margin-left: -72px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n73px {
    margin-left: -73px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n74px {
    margin-left: -74px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n75px {
    margin-left: -75px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n76px {
    margin-left: -76px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n77px {
    margin-left: -77px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n78px {
    margin-left: -78px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n79px {
    margin-left: -79px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n80px {
    margin-left: -80px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n81px {
    margin-left: -81px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n82px {
    margin-left: -82px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n83px {
    margin-left: -83px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n84px {
    margin-left: -84px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n85px {
    margin-left: -85px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n86px {
    margin-left: -86px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n87px {
    margin-left: -87px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n88px {
    margin-left: -88px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n89px {
    margin-left: -89px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n90px {
    margin-left: -90px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n91px {
    margin-left: -91px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n92px {
    margin-left: -92px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n93px {
    margin-left: -93px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n94px {
    margin-left: -94px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n95px {
    margin-left: -95px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n96px {
    margin-left: -96px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n97px {
    margin-left: -97px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n98px {
    margin-left: -98px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n99px {
    margin-left: -99px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n100px {
    margin-left: -100px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n101px {
    margin-left: -101px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n102px {
    margin-left: -102px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n103px {
    margin-left: -103px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n104px {
    margin-left: -104px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n105px {
    margin-left: -105px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n106px {
    margin-left: -106px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n107px {
    margin-left: -107px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n108px {
    margin-left: -108px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n109px {
    margin-left: -109px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n110px {
    margin-left: -110px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n111px {
    margin-left: -111px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n112px {
    margin-left: -112px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n113px {
    margin-left: -113px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n114px {
    margin-left: -114px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n115px {
    margin-left: -115px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n116px {
    margin-left: -116px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n117px {
    margin-left: -117px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n118px {
    margin-left: -118px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n119px {
    margin-left: -119px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n120px {
    margin-left: -120px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n121px {
    margin-left: -121px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n122px {
    margin-left: -122px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n123px {
    margin-left: -123px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n124px {
    margin-left: -124px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n125px {
    margin-left: -125px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n126px {
    margin-left: -126px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n127px {
    margin-left: -127px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n128px {
    margin-left: -128px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n129px {
    margin-left: -129px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n130px {
    margin-left: -130px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n131px {
    margin-left: -131px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n132px {
    margin-left: -132px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n133px {
    margin-left: -133px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n134px {
    margin-left: -134px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n135px {
    margin-left: -135px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n136px {
    margin-left: -136px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n137px {
    margin-left: -137px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n138px {
    margin-left: -138px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n139px {
    margin-left: -139px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n140px {
    margin-left: -140px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n141px {
    margin-left: -141px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n142px {
    margin-left: -142px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n143px {
    margin-left: -143px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n144px {
    margin-left: -144px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n145px {
    margin-left: -145px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n146px {
    margin-left: -146px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n147px {
    margin-left: -147px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n148px {
    margin-left: -148px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n149px {
    margin-left: -149px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n150px {
    margin-left: -150px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n151px {
    margin-left: -151px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n152px {
    margin-left: -152px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n153px {
    margin-left: -153px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n154px {
    margin-left: -154px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n155px {
    margin-left: -155px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n156px {
    margin-left: -156px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n157px {
    margin-left: -157px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n158px {
    margin-left: -158px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n159px {
    margin-left: -159px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n160px {
    margin-left: -160px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n161px {
    margin-left: -161px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n162px {
    margin-left: -162px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n163px {
    margin-left: -163px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n164px {
    margin-left: -164px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n165px {
    margin-left: -165px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n166px {
    margin-left: -166px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n167px {
    margin-left: -167px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n168px {
    margin-left: -168px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n169px {
    margin-left: -169px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n170px {
    margin-left: -170px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n171px {
    margin-left: -171px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n172px {
    margin-left: -172px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n173px {
    margin-left: -173px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n174px {
    margin-left: -174px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n175px {
    margin-left: -175px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n176px {
    margin-left: -176px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n177px {
    margin-left: -177px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n178px {
    margin-left: -178px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n179px {
    margin-left: -179px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n180px {
    margin-left: -180px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n181px {
    margin-left: -181px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n182px {
    margin-left: -182px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n183px {
    margin-left: -183px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n184px {
    margin-left: -184px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n185px {
    margin-left: -185px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n186px {
    margin-left: -186px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n187px {
    margin-left: -187px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n188px {
    margin-left: -188px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n189px {
    margin-left: -189px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n190px {
    margin-left: -190px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n191px {
    margin-left: -191px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n192px {
    margin-left: -192px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n193px {
    margin-left: -193px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n194px {
    margin-left: -194px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n195px {
    margin-left: -195px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n196px {
    margin-left: -196px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n197px {
    margin-left: -197px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n198px {
    margin-left: -198px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n199px {
    margin-left: -199px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n200px {
    margin-left: -200px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n201px {
    margin-left: -201px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n202px {
    margin-left: -202px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n203px {
    margin-left: -203px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n204px {
    margin-left: -204px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n205px {
    margin-left: -205px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n206px {
    margin-left: -206px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n207px {
    margin-left: -207px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n208px {
    margin-left: -208px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n209px {
    margin-left: -209px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n210px {
    margin-left: -210px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n211px {
    margin-left: -211px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n212px {
    margin-left: -212px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n213px {
    margin-left: -213px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n214px {
    margin-left: -214px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n215px {
    margin-left: -215px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n216px {
    margin-left: -216px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n217px {
    margin-left: -217px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n218px {
    margin-left: -218px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n219px {
    margin-left: -219px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n220px {
    margin-left: -220px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n221px {
    margin-left: -221px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n222px {
    margin-left: -222px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n223px {
    margin-left: -223px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n224px {
    margin-left: -224px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n225px {
    margin-left: -225px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n226px {
    margin-left: -226px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n227px {
    margin-left: -227px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n228px {
    margin-left: -228px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n229px {
    margin-left: -229px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n230px {
    margin-left: -230px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n231px {
    margin-left: -231px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n232px {
    margin-left: -232px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n233px {
    margin-left: -233px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n234px {
    margin-left: -234px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n235px {
    margin-left: -235px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n236px {
    margin-left: -236px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n237px {
    margin-left: -237px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n238px {
    margin-left: -238px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n239px {
    margin-left: -239px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n240px {
    margin-left: -240px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n241px {
    margin-left: -241px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n242px {
    margin-left: -242px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n243px {
    margin-left: -243px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n244px {
    margin-left: -244px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n245px {
    margin-left: -245px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n246px {
    margin-left: -246px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n247px {
    margin-left: -247px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n248px {
    margin-left: -248px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n249px {
    margin-left: -249px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n250px {
    margin-left: -250px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n251px {
    margin-left: -251px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n252px {
    margin-left: -252px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n253px {
    margin-left: -253px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n254px {
    margin-left: -254px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n255px {
    margin-left: -255px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n256px {
    margin-left: -256px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n257px {
    margin-left: -257px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n258px {
    margin-left: -258px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n259px {
    margin-left: -259px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n260px {
    margin-left: -260px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n261px {
    margin-left: -261px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n262px {
    margin-left: -262px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n263px {
    margin-left: -263px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n264px {
    margin-left: -264px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n265px {
    margin-left: -265px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n266px {
    margin-left: -266px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n267px {
    margin-left: -267px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n268px {
    margin-left: -268px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n269px {
    margin-left: -269px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n270px {
    margin-left: -270px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n271px {
    margin-left: -271px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n272px {
    margin-left: -272px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n273px {
    margin-left: -273px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n274px {
    margin-left: -274px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n275px {
    margin-left: -275px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n276px {
    margin-left: -276px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n277px {
    margin-left: -277px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n278px {
    margin-left: -278px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n279px {
    margin-left: -279px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n280px {
    margin-left: -280px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n281px {
    margin-left: -281px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n282px {
    margin-left: -282px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n283px {
    margin-left: -283px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n284px {
    margin-left: -284px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n285px {
    margin-left: -285px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n286px {
    margin-left: -286px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n287px {
    margin-left: -287px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n288px {
    margin-left: -288px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n289px {
    margin-left: -289px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n290px {
    margin-left: -290px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n291px {
    margin-left: -291px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n292px {
    margin-left: -292px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n293px {
    margin-left: -293px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n294px {
    margin-left: -294px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n295px {
    margin-left: -295px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n296px {
    margin-left: -296px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n297px {
    margin-left: -297px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n298px {
    margin-left: -298px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n299px {
    margin-left: -299px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n300px {
    margin-left: -300px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n301px {
    margin-left: -301px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n302px {
    margin-left: -302px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n303px {
    margin-left: -303px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n304px {
    margin-left: -304px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n305px {
    margin-left: -305px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n306px {
    margin-left: -306px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n307px {
    margin-left: -307px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n308px {
    margin-left: -308px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n309px {
    margin-left: -309px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n310px {
    margin-left: -310px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n311px {
    margin-left: -311px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n312px {
    margin-left: -312px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n313px {
    margin-left: -313px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n314px {
    margin-left: -314px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n315px {
    margin-left: -315px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n316px {
    margin-left: -316px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n317px {
    margin-left: -317px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n318px {
    margin-left: -318px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n319px {
    margin-left: -319px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n320px {
    margin-left: -320px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n321px {
    margin-left: -321px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n322px {
    margin-left: -322px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n323px {
    margin-left: -323px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n324px {
    margin-left: -324px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n325px {
    margin-left: -325px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n326px {
    margin-left: -326px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n327px {
    margin-left: -327px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n328px {
    margin-left: -328px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n329px {
    margin-left: -329px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n330px {
    margin-left: -330px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n331px {
    margin-left: -331px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n332px {
    margin-left: -332px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n333px {
    margin-left: -333px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n334px {
    margin-left: -334px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n335px {
    margin-left: -335px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n336px {
    margin-left: -336px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n337px {
    margin-left: -337px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n338px {
    margin-left: -338px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n339px {
    margin-left: -339px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n340px {
    margin-left: -340px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n341px {
    margin-left: -341px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n342px {
    margin-left: -342px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n343px {
    margin-left: -343px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n344px {
    margin-left: -344px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n345px {
    margin-left: -345px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n346px {
    margin-left: -346px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n347px {
    margin-left: -347px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n348px {
    margin-left: -348px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n349px {
    margin-left: -349px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n350px {
    margin-left: -350px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n351px {
    margin-left: -351px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n352px {
    margin-left: -352px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n353px {
    margin-left: -353px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n354px {
    margin-left: -354px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n355px {
    margin-left: -355px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n356px {
    margin-left: -356px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n357px {
    margin-left: -357px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n358px {
    margin-left: -358px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n359px {
    margin-left: -359px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n360px {
    margin-left: -360px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n361px {
    margin-left: -361px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n362px {
    margin-left: -362px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n363px {
    margin-left: -363px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n364px {
    margin-left: -364px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n365px {
    margin-left: -365px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n366px {
    margin-left: -366px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n367px {
    margin-left: -367px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n368px {
    margin-left: -368px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n369px {
    margin-left: -369px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n370px {
    margin-left: -370px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n371px {
    margin-left: -371px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n372px {
    margin-left: -372px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n373px {
    margin-left: -373px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n374px {
    margin-left: -374px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n375px {
    margin-left: -375px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n376px {
    margin-left: -376px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n377px {
    margin-left: -377px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n378px {
    margin-left: -378px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n379px {
    margin-left: -379px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n380px {
    margin-left: -380px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n381px {
    margin-left: -381px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n382px {
    margin-left: -382px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n383px {
    margin-left: -383px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n384px {
    margin-left: -384px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n385px {
    margin-left: -385px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n386px {
    margin-left: -386px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n387px {
    margin-left: -387px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n388px {
    margin-left: -388px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n389px {
    margin-left: -389px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n390px {
    margin-left: -390px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n391px {
    margin-left: -391px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n392px {
    margin-left: -392px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n393px {
    margin-left: -393px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n394px {
    margin-left: -394px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n395px {
    margin-left: -395px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n396px {
    margin-left: -396px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n397px {
    margin-left: -397px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n398px {
    margin-left: -398px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n399px {
    margin-left: -399px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n400px {
    margin-left: -400px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n401px {
    margin-left: -401px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n402px {
    margin-left: -402px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n403px {
    margin-left: -403px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n404px {
    margin-left: -404px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n405px {
    margin-left: -405px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n406px {
    margin-left: -406px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n407px {
    margin-left: -407px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n408px {
    margin-left: -408px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n409px {
    margin-left: -409px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n410px {
    margin-left: -410px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n411px {
    margin-left: -411px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n412px {
    margin-left: -412px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n413px {
    margin-left: -413px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n414px {
    margin-left: -414px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n415px {
    margin-left: -415px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n416px {
    margin-left: -416px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n417px {
    margin-left: -417px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n418px {
    margin-left: -418px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n419px {
    margin-left: -419px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n420px {
    margin-left: -420px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n421px {
    margin-left: -421px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n422px {
    margin-left: -422px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n423px {
    margin-left: -423px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n424px {
    margin-left: -424px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n425px {
    margin-left: -425px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n426px {
    margin-left: -426px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n427px {
    margin-left: -427px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n428px {
    margin-left: -428px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n429px {
    margin-left: -429px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n430px {
    margin-left: -430px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n431px {
    margin-left: -431px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n432px {
    margin-left: -432px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n433px {
    margin-left: -433px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n434px {
    margin-left: -434px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n435px {
    margin-left: -435px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n436px {
    margin-left: -436px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n437px {
    margin-left: -437px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n438px {
    margin-left: -438px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n439px {
    margin-left: -439px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n440px {
    margin-left: -440px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n441px {
    margin-left: -441px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n442px {
    margin-left: -442px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n443px {
    margin-left: -443px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n444px {
    margin-left: -444px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n445px {
    margin-left: -445px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n446px {
    margin-left: -446px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n447px {
    margin-left: -447px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n448px {
    margin-left: -448px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n449px {
    margin-left: -449px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n450px {
    margin-left: -450px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n451px {
    margin-left: -451px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n452px {
    margin-left: -452px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n453px {
    margin-left: -453px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n454px {
    margin-left: -454px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n455px {
    margin-left: -455px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n456px {
    margin-left: -456px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n457px {
    margin-left: -457px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n458px {
    margin-left: -458px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n459px {
    margin-left: -459px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n460px {
    margin-left: -460px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n461px {
    margin-left: -461px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n462px {
    margin-left: -462px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n463px {
    margin-left: -463px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n464px {
    margin-left: -464px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n465px {
    margin-left: -465px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n466px {
    margin-left: -466px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n467px {
    margin-left: -467px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n468px {
    margin-left: -468px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n469px {
    margin-left: -469px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n470px {
    margin-left: -470px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n471px {
    margin-left: -471px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n472px {
    margin-left: -472px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n473px {
    margin-left: -473px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n474px {
    margin-left: -474px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n475px {
    margin-left: -475px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n476px {
    margin-left: -476px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n477px {
    margin-left: -477px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n478px {
    margin-left: -478px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n479px {
    margin-left: -479px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n480px {
    margin-left: -480px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n481px {
    margin-left: -481px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n482px {
    margin-left: -482px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n483px {
    margin-left: -483px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n484px {
    margin-left: -484px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n485px {
    margin-left: -485px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n486px {
    margin-left: -486px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n487px {
    margin-left: -487px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n488px {
    margin-left: -488px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n489px {
    margin-left: -489px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n490px {
    margin-left: -490px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n491px {
    margin-left: -491px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n492px {
    margin-left: -492px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n493px {
    margin-left: -493px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n494px {
    margin-left: -494px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n495px {
    margin-left: -495px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n496px {
    margin-left: -496px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n497px {
    margin-left: -497px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n498px {
    margin-left: -498px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n499px {
    margin-left: -499px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n500px {
    margin-left: -500px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n501px {
    margin-left: -501px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n502px {
    margin-left: -502px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n503px {
    margin-left: -503px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n504px {
    margin-left: -504px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n505px {
    margin-left: -505px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n506px {
    margin-left: -506px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n507px {
    margin-left: -507px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n508px {
    margin-left: -508px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n509px {
    margin-left: -509px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n510px {
    margin-left: -510px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n511px {
    margin-left: -511px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n512px {
    margin-left: -512px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n513px {
    margin-left: -513px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n514px {
    margin-left: -514px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n515px {
    margin-left: -515px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n516px {
    margin-left: -516px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n517px {
    margin-left: -517px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n518px {
    margin-left: -518px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n519px {
    margin-left: -519px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n520px {
    margin-left: -520px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n521px {
    margin-left: -521px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n522px {
    margin-left: -522px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n523px {
    margin-left: -523px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n524px {
    margin-left: -524px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n525px {
    margin-left: -525px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n526px {
    margin-left: -526px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n527px {
    margin-left: -527px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n528px {
    margin-left: -528px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n529px {
    margin-left: -529px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n530px {
    margin-left: -530px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n531px {
    margin-left: -531px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n532px {
    margin-left: -532px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n533px {
    margin-left: -533px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n534px {
    margin-left: -534px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n535px {
    margin-left: -535px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n536px {
    margin-left: -536px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n537px {
    margin-left: -537px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n538px {
    margin-left: -538px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n539px {
    margin-left: -539px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n540px {
    margin-left: -540px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n541px {
    margin-left: -541px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n542px {
    margin-left: -542px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n543px {
    margin-left: -543px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n544px {
    margin-left: -544px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n545px {
    margin-left: -545px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n546px {
    margin-left: -546px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n547px {
    margin-left: -547px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n548px {
    margin-left: -548px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n549px {
    margin-left: -549px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n550px {
    margin-left: -550px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n551px {
    margin-left: -551px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n552px {
    margin-left: -552px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n553px {
    margin-left: -553px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n554px {
    margin-left: -554px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n555px {
    margin-left: -555px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n556px {
    margin-left: -556px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n557px {
    margin-left: -557px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n558px {
    margin-left: -558px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n559px {
    margin-left: -559px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n560px {
    margin-left: -560px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n561px {
    margin-left: -561px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n562px {
    margin-left: -562px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n563px {
    margin-left: -563px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n564px {
    margin-left: -564px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n565px {
    margin-left: -565px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n566px {
    margin-left: -566px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n567px {
    margin-left: -567px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n568px {
    margin-left: -568px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n569px {
    margin-left: -569px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n570px {
    margin-left: -570px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n571px {
    margin-left: -571px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n572px {
    margin-left: -572px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n573px {
    margin-left: -573px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n574px {
    margin-left: -574px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n575px {
    margin-left: -575px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n576px {
    margin-left: -576px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n577px {
    margin-left: -577px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n578px {
    margin-left: -578px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n579px {
    margin-left: -579px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n580px {
    margin-left: -580px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n581px {
    margin-left: -581px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n582px {
    margin-left: -582px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n583px {
    margin-left: -583px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n584px {
    margin-left: -584px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n585px {
    margin-left: -585px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n586px {
    margin-left: -586px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n587px {
    margin-left: -587px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n588px {
    margin-left: -588px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n589px {
    margin-left: -589px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n590px {
    margin-left: -590px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n591px {
    margin-left: -591px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n592px {
    margin-left: -592px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n593px {
    margin-left: -593px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n594px {
    margin-left: -594px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n595px {
    margin-left: -595px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n596px {
    margin-left: -596px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n597px {
    margin-left: -597px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n598px {
    margin-left: -598px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n599px {
    margin-left: -599px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n600px {
    margin-left: -600px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n601px {
    margin-left: -601px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n602px {
    margin-left: -602px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n603px {
    margin-left: -603px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n604px {
    margin-left: -604px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n605px {
    margin-left: -605px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n606px {
    margin-left: -606px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n607px {
    margin-left: -607px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n608px {
    margin-left: -608px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n609px {
    margin-left: -609px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n610px {
    margin-left: -610px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n611px {
    margin-left: -611px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n612px {
    margin-left: -612px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n613px {
    margin-left: -613px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n614px {
    margin-left: -614px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n615px {
    margin-left: -615px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n616px {
    margin-left: -616px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n617px {
    margin-left: -617px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n618px {
    margin-left: -618px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n619px {
    margin-left: -619px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n620px {
    margin-left: -620px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n621px {
    margin-left: -621px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n622px {
    margin-left: -622px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n623px {
    margin-left: -623px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n624px {
    margin-left: -624px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n625px {
    margin-left: -625px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n626px {
    margin-left: -626px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n627px {
    margin-left: -627px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n628px {
    margin-left: -628px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n629px {
    margin-left: -629px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n630px {
    margin-left: -630px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n631px {
    margin-left: -631px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n632px {
    margin-left: -632px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n633px {
    margin-left: -633px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n634px {
    margin-left: -634px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n635px {
    margin-left: -635px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n636px {
    margin-left: -636px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n637px {
    margin-left: -637px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n638px {
    margin-left: -638px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n639px {
    margin-left: -639px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n640px {
    margin-left: -640px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n641px {
    margin-left: -641px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n642px {
    margin-left: -642px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n643px {
    margin-left: -643px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n644px {
    margin-left: -644px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n645px {
    margin-left: -645px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n646px {
    margin-left: -646px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n647px {
    margin-left: -647px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n648px {
    margin-left: -648px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n649px {
    margin-left: -649px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n650px {
    margin-left: -650px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n651px {
    margin-left: -651px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n652px {
    margin-left: -652px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n653px {
    margin-left: -653px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n654px {
    margin-left: -654px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n655px {
    margin-left: -655px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n656px {
    margin-left: -656px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n657px {
    margin-left: -657px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n658px {
    margin-left: -658px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n659px {
    margin-left: -659px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n660px {
    margin-left: -660px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n661px {
    margin-left: -661px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n662px {
    margin-left: -662px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n663px {
    margin-left: -663px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n664px {
    margin-left: -664px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n665px {
    margin-left: -665px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n666px {
    margin-left: -666px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n667px {
    margin-left: -667px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n668px {
    margin-left: -668px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n669px {
    margin-left: -669px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n670px {
    margin-left: -670px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n671px {
    margin-left: -671px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n672px {
    margin-left: -672px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n673px {
    margin-left: -673px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n674px {
    margin-left: -674px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n675px {
    margin-left: -675px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n676px {
    margin-left: -676px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n677px {
    margin-left: -677px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n678px {
    margin-left: -678px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n679px {
    margin-left: -679px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n680px {
    margin-left: -680px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n681px {
    margin-left: -681px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n682px {
    margin-left: -682px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n683px {
    margin-left: -683px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n684px {
    margin-left: -684px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n685px {
    margin-left: -685px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n686px {
    margin-left: -686px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n687px {
    margin-left: -687px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n688px {
    margin-left: -688px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n689px {
    margin-left: -689px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n690px {
    margin-left: -690px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n691px {
    margin-left: -691px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n692px {
    margin-left: -692px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n693px {
    margin-left: -693px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n694px {
    margin-left: -694px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n695px {
    margin-left: -695px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n696px {
    margin-left: -696px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n697px {
    margin-left: -697px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n698px {
    margin-left: -698px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n699px {
    margin-left: -699px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n700px {
    margin-left: -700px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n701px {
    margin-left: -701px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n702px {
    margin-left: -702px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n703px {
    margin-left: -703px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n704px {
    margin-left: -704px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n705px {
    margin-left: -705px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n706px {
    margin-left: -706px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n707px {
    margin-left: -707px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n708px {
    margin-left: -708px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n709px {
    margin-left: -709px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n710px {
    margin-left: -710px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n711px {
    margin-left: -711px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n712px {
    margin-left: -712px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n713px {
    margin-left: -713px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n714px {
    margin-left: -714px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n715px {
    margin-left: -715px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n716px {
    margin-left: -716px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n717px {
    margin-left: -717px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n718px {
    margin-left: -718px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n719px {
    margin-left: -719px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n720px {
    margin-left: -720px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n721px {
    margin-left: -721px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n722px {
    margin-left: -722px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n723px {
    margin-left: -723px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n724px {
    margin-left: -724px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n725px {
    margin-left: -725px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n726px {
    margin-left: -726px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n727px {
    margin-left: -727px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n728px {
    margin-left: -728px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n729px {
    margin-left: -729px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n730px {
    margin-left: -730px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n731px {
    margin-left: -731px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n732px {
    margin-left: -732px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n733px {
    margin-left: -733px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n734px {
    margin-left: -734px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n735px {
    margin-left: -735px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n736px {
    margin-left: -736px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n737px {
    margin-left: -737px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n738px {
    margin-left: -738px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n739px {
    margin-left: -739px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n740px {
    margin-left: -740px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n741px {
    margin-left: -741px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n742px {
    margin-left: -742px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n743px {
    margin-left: -743px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n744px {
    margin-left: -744px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n745px {
    margin-left: -745px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n746px {
    margin-left: -746px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n747px {
    margin-left: -747px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n748px {
    margin-left: -748px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n749px {
    margin-left: -749px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n750px {
    margin-left: -750px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n751px {
    margin-left: -751px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n752px {
    margin-left: -752px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n753px {
    margin-left: -753px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n754px {
    margin-left: -754px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n755px {
    margin-left: -755px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n756px {
    margin-left: -756px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n757px {
    margin-left: -757px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n758px {
    margin-left: -758px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n759px {
    margin-left: -759px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n760px {
    margin-left: -760px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n761px {
    margin-left: -761px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n762px {
    margin-left: -762px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n763px {
    margin-left: -763px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n764px {
    margin-left: -764px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n765px {
    margin-left: -765px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n766px {
    margin-left: -766px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n767px {
    margin-left: -767px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n768px {
    margin-left: -768px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n769px {
    margin-left: -769px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n770px {
    margin-left: -770px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n771px {
    margin-left: -771px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n772px {
    margin-left: -772px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n773px {
    margin-left: -773px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n774px {
    margin-left: -774px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n775px {
    margin-left: -775px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n776px {
    margin-left: -776px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n777px {
    margin-left: -777px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n778px {
    margin-left: -778px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n779px {
    margin-left: -779px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n780px {
    margin-left: -780px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n781px {
    margin-left: -781px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n782px {
    margin-left: -782px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n783px {
    margin-left: -783px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n784px {
    margin-left: -784px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n785px {
    margin-left: -785px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n786px {
    margin-left: -786px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n787px {
    margin-left: -787px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n788px {
    margin-left: -788px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n789px {
    margin-left: -789px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n790px {
    margin-left: -790px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n791px {
    margin-left: -791px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n792px {
    margin-left: -792px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n793px {
    margin-left: -793px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n794px {
    margin-left: -794px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n795px {
    margin-left: -795px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n796px {
    margin-left: -796px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n797px {
    margin-left: -797px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n798px {
    margin-left: -798px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n799px {
    margin-left: -799px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n800px {
    margin-left: -800px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n801px {
    margin-left: -801px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n802px {
    margin-left: -802px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n803px {
    margin-left: -803px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n804px {
    margin-left: -804px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n805px {
    margin-left: -805px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n806px {
    margin-left: -806px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n807px {
    margin-left: -807px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n808px {
    margin-left: -808px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n809px {
    margin-left: -809px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n810px {
    margin-left: -810px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n811px {
    margin-left: -811px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n812px {
    margin-left: -812px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n813px {
    margin-left: -813px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n814px {
    margin-left: -814px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n815px {
    margin-left: -815px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n816px {
    margin-left: -816px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n817px {
    margin-left: -817px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n818px {
    margin-left: -818px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n819px {
    margin-left: -819px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n820px {
    margin-left: -820px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n821px {
    margin-left: -821px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n822px {
    margin-left: -822px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n823px {
    margin-left: -823px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n824px {
    margin-left: -824px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n825px {
    margin-left: -825px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n826px {
    margin-left: -826px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n827px {
    margin-left: -827px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n828px {
    margin-left: -828px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n829px {
    margin-left: -829px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n830px {
    margin-left: -830px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n831px {
    margin-left: -831px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n832px {
    margin-left: -832px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n833px {
    margin-left: -833px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n834px {
    margin-left: -834px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n835px {
    margin-left: -835px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n836px {
    margin-left: -836px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n837px {
    margin-left: -837px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n838px {
    margin-left: -838px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n839px {
    margin-left: -839px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n840px {
    margin-left: -840px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n841px {
    margin-left: -841px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n842px {
    margin-left: -842px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n843px {
    margin-left: -843px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n844px {
    margin-left: -844px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n845px {
    margin-left: -845px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n846px {
    margin-left: -846px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n847px {
    margin-left: -847px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n848px {
    margin-left: -848px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n849px {
    margin-left: -849px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n850px {
    margin-left: -850px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n851px {
    margin-left: -851px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n852px {
    margin-left: -852px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n853px {
    margin-left: -853px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n854px {
    margin-left: -854px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n855px {
    margin-left: -855px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n856px {
    margin-left: -856px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n857px {
    margin-left: -857px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n858px {
    margin-left: -858px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n859px {
    margin-left: -859px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n860px {
    margin-left: -860px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n861px {
    margin-left: -861px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n862px {
    margin-left: -862px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n863px {
    margin-left: -863px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n864px {
    margin-left: -864px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n865px {
    margin-left: -865px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n866px {
    margin-left: -866px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n867px {
    margin-left: -867px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n868px {
    margin-left: -868px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n869px {
    margin-left: -869px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n870px {
    margin-left: -870px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n871px {
    margin-left: -871px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n872px {
    margin-left: -872px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n873px {
    margin-left: -873px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n874px {
    margin-left: -874px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n875px {
    margin-left: -875px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n876px {
    margin-left: -876px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n877px {
    margin-left: -877px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n878px {
    margin-left: -878px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n879px {
    margin-left: -879px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n880px {
    margin-left: -880px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n881px {
    margin-left: -881px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n882px {
    margin-left: -882px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n883px {
    margin-left: -883px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n884px {
    margin-left: -884px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n885px {
    margin-left: -885px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n886px {
    margin-left: -886px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n887px {
    margin-left: -887px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n888px {
    margin-left: -888px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n889px {
    margin-left: -889px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n890px {
    margin-left: -890px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n891px {
    margin-left: -891px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n892px {
    margin-left: -892px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n893px {
    margin-left: -893px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n894px {
    margin-left: -894px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n895px {
    margin-left: -895px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n896px {
    margin-left: -896px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n897px {
    margin-left: -897px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n898px {
    margin-left: -898px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n899px {
    margin-left: -899px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n900px {
    margin-left: -900px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n901px {
    margin-left: -901px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n902px {
    margin-left: -902px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n903px {
    margin-left: -903px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n904px {
    margin-left: -904px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n905px {
    margin-left: -905px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n906px {
    margin-left: -906px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n907px {
    margin-left: -907px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n908px {
    margin-left: -908px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n909px {
    margin-left: -909px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n910px {
    margin-left: -910px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n911px {
    margin-left: -911px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n912px {
    margin-left: -912px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n913px {
    margin-left: -913px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n914px {
    margin-left: -914px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n915px {
    margin-left: -915px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n916px {
    margin-left: -916px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n917px {
    margin-left: -917px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n918px {
    margin-left: -918px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n919px {
    margin-left: -919px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n920px {
    margin-left: -920px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n921px {
    margin-left: -921px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n922px {
    margin-left: -922px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n923px {
    margin-left: -923px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n924px {
    margin-left: -924px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n925px {
    margin-left: -925px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n926px {
    margin-left: -926px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n927px {
    margin-left: -927px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n928px {
    margin-left: -928px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n929px {
    margin-left: -929px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n930px {
    margin-left: -930px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n931px {
    margin-left: -931px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n932px {
    margin-left: -932px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n933px {
    margin-left: -933px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n934px {
    margin-left: -934px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n935px {
    margin-left: -935px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n936px {
    margin-left: -936px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n937px {
    margin-left: -937px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n938px {
    margin-left: -938px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n939px {
    margin-left: -939px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n940px {
    margin-left: -940px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n941px {
    margin-left: -941px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n942px {
    margin-left: -942px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n943px {
    margin-left: -943px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n944px {
    margin-left: -944px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n945px {
    margin-left: -945px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n946px {
    margin-left: -946px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n947px {
    margin-left: -947px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n948px {
    margin-left: -948px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n949px {
    margin-left: -949px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n950px {
    margin-left: -950px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n951px {
    margin-left: -951px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n952px {
    margin-left: -952px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n953px {
    margin-left: -953px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n954px {
    margin-left: -954px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n955px {
    margin-left: -955px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n956px {
    margin-left: -956px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n957px {
    margin-left: -957px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n958px {
    margin-left: -958px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n959px {
    margin-left: -959px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n960px {
    margin-left: -960px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n961px {
    margin-left: -961px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n962px {
    margin-left: -962px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n963px {
    margin-left: -963px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n964px {
    margin-left: -964px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n965px {
    margin-left: -965px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n966px {
    margin-left: -966px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n967px {
    margin-left: -967px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n968px {
    margin-left: -968px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n969px {
    margin-left: -969px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n970px {
    margin-left: -970px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n971px {
    margin-left: -971px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n972px {
    margin-left: -972px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n973px {
    margin-left: -973px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n974px {
    margin-left: -974px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n975px {
    margin-left: -975px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n976px {
    margin-left: -976px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n977px {
    margin-left: -977px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n978px {
    margin-left: -978px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n979px {
    margin-left: -979px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n980px {
    margin-left: -980px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n981px {
    margin-left: -981px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n982px {
    margin-left: -982px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n983px {
    margin-left: -983px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n984px {
    margin-left: -984px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n985px {
    margin-left: -985px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n986px {
    margin-left: -986px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n987px {
    margin-left: -987px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n988px {
    margin-left: -988px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n989px {
    margin-left: -989px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n990px {
    margin-left: -990px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n991px {
    margin-left: -991px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n992px {
    margin-left: -992px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n993px {
    margin-left: -993px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n994px {
    margin-left: -994px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n995px {
    margin-left: -995px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n996px {
    margin-left: -996px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n997px {
    margin-left: -997px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n998px {
    margin-left: -998px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n999px {
    margin-left: -999px !important;
  }
}
@media (min-width: 768px) {
  .ms-md-n1000px {
    margin-left: -1000px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n1px {
    margin-right: -1px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n2px {
    margin-right: -2px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n3px {
    margin-right: -3px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n4px {
    margin-right: -4px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n5px {
    margin-right: -5px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n6px {
    margin-right: -6px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n7px {
    margin-right: -7px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n8px {
    margin-right: -8px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n9px {
    margin-right: -9px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n10px {
    margin-right: -10px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n11px {
    margin-right: -11px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n12px {
    margin-right: -12px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n13px {
    margin-right: -13px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n14px {
    margin-right: -14px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n15px {
    margin-right: -15px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n16px {
    margin-right: -16px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n17px {
    margin-right: -17px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n18px {
    margin-right: -18px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n19px {
    margin-right: -19px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n20px {
    margin-right: -20px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n21px {
    margin-right: -21px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n22px {
    margin-right: -22px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n23px {
    margin-right: -23px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n24px {
    margin-right: -24px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n25px {
    margin-right: -25px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n26px {
    margin-right: -26px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n27px {
    margin-right: -27px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n28px {
    margin-right: -28px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n29px {
    margin-right: -29px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n30px {
    margin-right: -30px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n31px {
    margin-right: -31px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n32px {
    margin-right: -32px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n33px {
    margin-right: -33px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n34px {
    margin-right: -34px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n35px {
    margin-right: -35px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n36px {
    margin-right: -36px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n37px {
    margin-right: -37px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n38px {
    margin-right: -38px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n39px {
    margin-right: -39px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n40px {
    margin-right: -40px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n41px {
    margin-right: -41px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n42px {
    margin-right: -42px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n43px {
    margin-right: -43px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n44px {
    margin-right: -44px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n45px {
    margin-right: -45px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n46px {
    margin-right: -46px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n47px {
    margin-right: -47px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n48px {
    margin-right: -48px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n49px {
    margin-right: -49px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n50px {
    margin-right: -50px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n51px {
    margin-right: -51px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n52px {
    margin-right: -52px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n53px {
    margin-right: -53px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n54px {
    margin-right: -54px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n55px {
    margin-right: -55px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n56px {
    margin-right: -56px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n57px {
    margin-right: -57px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n58px {
    margin-right: -58px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n59px {
    margin-right: -59px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n60px {
    margin-right: -60px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n61px {
    margin-right: -61px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n62px {
    margin-right: -62px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n63px {
    margin-right: -63px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n64px {
    margin-right: -64px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n65px {
    margin-right: -65px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n66px {
    margin-right: -66px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n67px {
    margin-right: -67px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n68px {
    margin-right: -68px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n69px {
    margin-right: -69px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n70px {
    margin-right: -70px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n71px {
    margin-right: -71px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n72px {
    margin-right: -72px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n73px {
    margin-right: -73px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n74px {
    margin-right: -74px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n75px {
    margin-right: -75px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n76px {
    margin-right: -76px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n77px {
    margin-right: -77px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n78px {
    margin-right: -78px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n79px {
    margin-right: -79px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n80px {
    margin-right: -80px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n81px {
    margin-right: -81px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n82px {
    margin-right: -82px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n83px {
    margin-right: -83px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n84px {
    margin-right: -84px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n85px {
    margin-right: -85px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n86px {
    margin-right: -86px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n87px {
    margin-right: -87px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n88px {
    margin-right: -88px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n89px {
    margin-right: -89px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n90px {
    margin-right: -90px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n91px {
    margin-right: -91px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n92px {
    margin-right: -92px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n93px {
    margin-right: -93px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n94px {
    margin-right: -94px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n95px {
    margin-right: -95px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n96px {
    margin-right: -96px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n97px {
    margin-right: -97px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n98px {
    margin-right: -98px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n99px {
    margin-right: -99px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n100px {
    margin-right: -100px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n101px {
    margin-right: -101px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n102px {
    margin-right: -102px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n103px {
    margin-right: -103px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n104px {
    margin-right: -104px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n105px {
    margin-right: -105px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n106px {
    margin-right: -106px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n107px {
    margin-right: -107px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n108px {
    margin-right: -108px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n109px {
    margin-right: -109px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n110px {
    margin-right: -110px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n111px {
    margin-right: -111px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n112px {
    margin-right: -112px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n113px {
    margin-right: -113px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n114px {
    margin-right: -114px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n115px {
    margin-right: -115px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n116px {
    margin-right: -116px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n117px {
    margin-right: -117px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n118px {
    margin-right: -118px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n119px {
    margin-right: -119px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n120px {
    margin-right: -120px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n121px {
    margin-right: -121px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n122px {
    margin-right: -122px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n123px {
    margin-right: -123px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n124px {
    margin-right: -124px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n125px {
    margin-right: -125px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n126px {
    margin-right: -126px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n127px {
    margin-right: -127px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n128px {
    margin-right: -128px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n129px {
    margin-right: -129px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n130px {
    margin-right: -130px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n131px {
    margin-right: -131px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n132px {
    margin-right: -132px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n133px {
    margin-right: -133px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n134px {
    margin-right: -134px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n135px {
    margin-right: -135px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n136px {
    margin-right: -136px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n137px {
    margin-right: -137px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n138px {
    margin-right: -138px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n139px {
    margin-right: -139px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n140px {
    margin-right: -140px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n141px {
    margin-right: -141px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n142px {
    margin-right: -142px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n143px {
    margin-right: -143px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n144px {
    margin-right: -144px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n145px {
    margin-right: -145px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n146px {
    margin-right: -146px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n147px {
    margin-right: -147px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n148px {
    margin-right: -148px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n149px {
    margin-right: -149px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n150px {
    margin-right: -150px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n151px {
    margin-right: -151px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n152px {
    margin-right: -152px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n153px {
    margin-right: -153px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n154px {
    margin-right: -154px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n155px {
    margin-right: -155px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n156px {
    margin-right: -156px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n157px {
    margin-right: -157px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n158px {
    margin-right: -158px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n159px {
    margin-right: -159px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n160px {
    margin-right: -160px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n161px {
    margin-right: -161px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n162px {
    margin-right: -162px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n163px {
    margin-right: -163px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n164px {
    margin-right: -164px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n165px {
    margin-right: -165px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n166px {
    margin-right: -166px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n167px {
    margin-right: -167px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n168px {
    margin-right: -168px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n169px {
    margin-right: -169px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n170px {
    margin-right: -170px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n171px {
    margin-right: -171px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n172px {
    margin-right: -172px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n173px {
    margin-right: -173px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n174px {
    margin-right: -174px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n175px {
    margin-right: -175px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n176px {
    margin-right: -176px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n177px {
    margin-right: -177px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n178px {
    margin-right: -178px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n179px {
    margin-right: -179px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n180px {
    margin-right: -180px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n181px {
    margin-right: -181px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n182px {
    margin-right: -182px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n183px {
    margin-right: -183px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n184px {
    margin-right: -184px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n185px {
    margin-right: -185px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n186px {
    margin-right: -186px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n187px {
    margin-right: -187px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n188px {
    margin-right: -188px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n189px {
    margin-right: -189px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n190px {
    margin-right: -190px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n191px {
    margin-right: -191px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n192px {
    margin-right: -192px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n193px {
    margin-right: -193px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n194px {
    margin-right: -194px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n195px {
    margin-right: -195px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n196px {
    margin-right: -196px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n197px {
    margin-right: -197px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n198px {
    margin-right: -198px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n199px {
    margin-right: -199px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n200px {
    margin-right: -200px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n201px {
    margin-right: -201px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n202px {
    margin-right: -202px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n203px {
    margin-right: -203px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n204px {
    margin-right: -204px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n205px {
    margin-right: -205px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n206px {
    margin-right: -206px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n207px {
    margin-right: -207px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n208px {
    margin-right: -208px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n209px {
    margin-right: -209px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n210px {
    margin-right: -210px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n211px {
    margin-right: -211px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n212px {
    margin-right: -212px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n213px {
    margin-right: -213px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n214px {
    margin-right: -214px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n215px {
    margin-right: -215px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n216px {
    margin-right: -216px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n217px {
    margin-right: -217px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n218px {
    margin-right: -218px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n219px {
    margin-right: -219px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n220px {
    margin-right: -220px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n221px {
    margin-right: -221px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n222px {
    margin-right: -222px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n223px {
    margin-right: -223px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n224px {
    margin-right: -224px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n225px {
    margin-right: -225px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n226px {
    margin-right: -226px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n227px {
    margin-right: -227px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n228px {
    margin-right: -228px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n229px {
    margin-right: -229px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n230px {
    margin-right: -230px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n231px {
    margin-right: -231px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n232px {
    margin-right: -232px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n233px {
    margin-right: -233px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n234px {
    margin-right: -234px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n235px {
    margin-right: -235px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n236px {
    margin-right: -236px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n237px {
    margin-right: -237px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n238px {
    margin-right: -238px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n239px {
    margin-right: -239px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n240px {
    margin-right: -240px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n241px {
    margin-right: -241px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n242px {
    margin-right: -242px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n243px {
    margin-right: -243px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n244px {
    margin-right: -244px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n245px {
    margin-right: -245px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n246px {
    margin-right: -246px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n247px {
    margin-right: -247px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n248px {
    margin-right: -248px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n249px {
    margin-right: -249px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n250px {
    margin-right: -250px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n251px {
    margin-right: -251px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n252px {
    margin-right: -252px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n253px {
    margin-right: -253px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n254px {
    margin-right: -254px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n255px {
    margin-right: -255px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n256px {
    margin-right: -256px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n257px {
    margin-right: -257px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n258px {
    margin-right: -258px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n259px {
    margin-right: -259px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n260px {
    margin-right: -260px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n261px {
    margin-right: -261px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n262px {
    margin-right: -262px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n263px {
    margin-right: -263px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n264px {
    margin-right: -264px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n265px {
    margin-right: -265px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n266px {
    margin-right: -266px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n267px {
    margin-right: -267px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n268px {
    margin-right: -268px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n269px {
    margin-right: -269px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n270px {
    margin-right: -270px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n271px {
    margin-right: -271px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n272px {
    margin-right: -272px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n273px {
    margin-right: -273px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n274px {
    margin-right: -274px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n275px {
    margin-right: -275px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n276px {
    margin-right: -276px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n277px {
    margin-right: -277px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n278px {
    margin-right: -278px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n279px {
    margin-right: -279px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n280px {
    margin-right: -280px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n281px {
    margin-right: -281px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n282px {
    margin-right: -282px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n283px {
    margin-right: -283px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n284px {
    margin-right: -284px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n285px {
    margin-right: -285px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n286px {
    margin-right: -286px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n287px {
    margin-right: -287px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n288px {
    margin-right: -288px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n289px {
    margin-right: -289px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n290px {
    margin-right: -290px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n291px {
    margin-right: -291px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n292px {
    margin-right: -292px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n293px {
    margin-right: -293px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n294px {
    margin-right: -294px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n295px {
    margin-right: -295px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n296px {
    margin-right: -296px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n297px {
    margin-right: -297px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n298px {
    margin-right: -298px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n299px {
    margin-right: -299px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n300px {
    margin-right: -300px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n301px {
    margin-right: -301px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n302px {
    margin-right: -302px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n303px {
    margin-right: -303px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n304px {
    margin-right: -304px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n305px {
    margin-right: -305px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n306px {
    margin-right: -306px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n307px {
    margin-right: -307px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n308px {
    margin-right: -308px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n309px {
    margin-right: -309px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n310px {
    margin-right: -310px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n311px {
    margin-right: -311px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n312px {
    margin-right: -312px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n313px {
    margin-right: -313px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n314px {
    margin-right: -314px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n315px {
    margin-right: -315px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n316px {
    margin-right: -316px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n317px {
    margin-right: -317px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n318px {
    margin-right: -318px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n319px {
    margin-right: -319px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n320px {
    margin-right: -320px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n321px {
    margin-right: -321px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n322px {
    margin-right: -322px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n323px {
    margin-right: -323px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n324px {
    margin-right: -324px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n325px {
    margin-right: -325px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n326px {
    margin-right: -326px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n327px {
    margin-right: -327px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n328px {
    margin-right: -328px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n329px {
    margin-right: -329px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n330px {
    margin-right: -330px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n331px {
    margin-right: -331px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n332px {
    margin-right: -332px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n333px {
    margin-right: -333px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n334px {
    margin-right: -334px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n335px {
    margin-right: -335px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n336px {
    margin-right: -336px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n337px {
    margin-right: -337px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n338px {
    margin-right: -338px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n339px {
    margin-right: -339px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n340px {
    margin-right: -340px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n341px {
    margin-right: -341px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n342px {
    margin-right: -342px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n343px {
    margin-right: -343px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n344px {
    margin-right: -344px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n345px {
    margin-right: -345px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n346px {
    margin-right: -346px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n347px {
    margin-right: -347px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n348px {
    margin-right: -348px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n349px {
    margin-right: -349px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n350px {
    margin-right: -350px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n351px {
    margin-right: -351px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n352px {
    margin-right: -352px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n353px {
    margin-right: -353px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n354px {
    margin-right: -354px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n355px {
    margin-right: -355px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n356px {
    margin-right: -356px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n357px {
    margin-right: -357px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n358px {
    margin-right: -358px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n359px {
    margin-right: -359px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n360px {
    margin-right: -360px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n361px {
    margin-right: -361px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n362px {
    margin-right: -362px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n363px {
    margin-right: -363px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n364px {
    margin-right: -364px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n365px {
    margin-right: -365px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n366px {
    margin-right: -366px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n367px {
    margin-right: -367px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n368px {
    margin-right: -368px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n369px {
    margin-right: -369px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n370px {
    margin-right: -370px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n371px {
    margin-right: -371px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n372px {
    margin-right: -372px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n373px {
    margin-right: -373px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n374px {
    margin-right: -374px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n375px {
    margin-right: -375px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n376px {
    margin-right: -376px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n377px {
    margin-right: -377px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n378px {
    margin-right: -378px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n379px {
    margin-right: -379px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n380px {
    margin-right: -380px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n381px {
    margin-right: -381px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n382px {
    margin-right: -382px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n383px {
    margin-right: -383px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n384px {
    margin-right: -384px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n385px {
    margin-right: -385px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n386px {
    margin-right: -386px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n387px {
    margin-right: -387px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n388px {
    margin-right: -388px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n389px {
    margin-right: -389px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n390px {
    margin-right: -390px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n391px {
    margin-right: -391px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n392px {
    margin-right: -392px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n393px {
    margin-right: -393px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n394px {
    margin-right: -394px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n395px {
    margin-right: -395px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n396px {
    margin-right: -396px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n397px {
    margin-right: -397px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n398px {
    margin-right: -398px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n399px {
    margin-right: -399px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n400px {
    margin-right: -400px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n401px {
    margin-right: -401px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n402px {
    margin-right: -402px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n403px {
    margin-right: -403px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n404px {
    margin-right: -404px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n405px {
    margin-right: -405px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n406px {
    margin-right: -406px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n407px {
    margin-right: -407px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n408px {
    margin-right: -408px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n409px {
    margin-right: -409px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n410px {
    margin-right: -410px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n411px {
    margin-right: -411px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n412px {
    margin-right: -412px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n413px {
    margin-right: -413px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n414px {
    margin-right: -414px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n415px {
    margin-right: -415px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n416px {
    margin-right: -416px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n417px {
    margin-right: -417px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n418px {
    margin-right: -418px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n419px {
    margin-right: -419px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n420px {
    margin-right: -420px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n421px {
    margin-right: -421px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n422px {
    margin-right: -422px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n423px {
    margin-right: -423px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n424px {
    margin-right: -424px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n425px {
    margin-right: -425px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n426px {
    margin-right: -426px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n427px {
    margin-right: -427px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n428px {
    margin-right: -428px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n429px {
    margin-right: -429px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n430px {
    margin-right: -430px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n431px {
    margin-right: -431px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n432px {
    margin-right: -432px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n433px {
    margin-right: -433px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n434px {
    margin-right: -434px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n435px {
    margin-right: -435px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n436px {
    margin-right: -436px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n437px {
    margin-right: -437px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n438px {
    margin-right: -438px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n439px {
    margin-right: -439px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n440px {
    margin-right: -440px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n441px {
    margin-right: -441px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n442px {
    margin-right: -442px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n443px {
    margin-right: -443px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n444px {
    margin-right: -444px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n445px {
    margin-right: -445px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n446px {
    margin-right: -446px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n447px {
    margin-right: -447px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n448px {
    margin-right: -448px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n449px {
    margin-right: -449px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n450px {
    margin-right: -450px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n451px {
    margin-right: -451px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n452px {
    margin-right: -452px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n453px {
    margin-right: -453px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n454px {
    margin-right: -454px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n455px {
    margin-right: -455px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n456px {
    margin-right: -456px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n457px {
    margin-right: -457px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n458px {
    margin-right: -458px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n459px {
    margin-right: -459px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n460px {
    margin-right: -460px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n461px {
    margin-right: -461px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n462px {
    margin-right: -462px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n463px {
    margin-right: -463px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n464px {
    margin-right: -464px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n465px {
    margin-right: -465px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n466px {
    margin-right: -466px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n467px {
    margin-right: -467px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n468px {
    margin-right: -468px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n469px {
    margin-right: -469px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n470px {
    margin-right: -470px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n471px {
    margin-right: -471px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n472px {
    margin-right: -472px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n473px {
    margin-right: -473px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n474px {
    margin-right: -474px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n475px {
    margin-right: -475px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n476px {
    margin-right: -476px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n477px {
    margin-right: -477px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n478px {
    margin-right: -478px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n479px {
    margin-right: -479px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n480px {
    margin-right: -480px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n481px {
    margin-right: -481px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n482px {
    margin-right: -482px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n483px {
    margin-right: -483px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n484px {
    margin-right: -484px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n485px {
    margin-right: -485px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n486px {
    margin-right: -486px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n487px {
    margin-right: -487px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n488px {
    margin-right: -488px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n489px {
    margin-right: -489px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n490px {
    margin-right: -490px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n491px {
    margin-right: -491px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n492px {
    margin-right: -492px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n493px {
    margin-right: -493px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n494px {
    margin-right: -494px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n495px {
    margin-right: -495px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n496px {
    margin-right: -496px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n497px {
    margin-right: -497px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n498px {
    margin-right: -498px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n499px {
    margin-right: -499px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n500px {
    margin-right: -500px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n501px {
    margin-right: -501px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n502px {
    margin-right: -502px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n503px {
    margin-right: -503px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n504px {
    margin-right: -504px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n505px {
    margin-right: -505px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n506px {
    margin-right: -506px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n507px {
    margin-right: -507px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n508px {
    margin-right: -508px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n509px {
    margin-right: -509px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n510px {
    margin-right: -510px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n511px {
    margin-right: -511px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n512px {
    margin-right: -512px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n513px {
    margin-right: -513px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n514px {
    margin-right: -514px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n515px {
    margin-right: -515px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n516px {
    margin-right: -516px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n517px {
    margin-right: -517px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n518px {
    margin-right: -518px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n519px {
    margin-right: -519px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n520px {
    margin-right: -520px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n521px {
    margin-right: -521px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n522px {
    margin-right: -522px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n523px {
    margin-right: -523px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n524px {
    margin-right: -524px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n525px {
    margin-right: -525px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n526px {
    margin-right: -526px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n527px {
    margin-right: -527px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n528px {
    margin-right: -528px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n529px {
    margin-right: -529px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n530px {
    margin-right: -530px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n531px {
    margin-right: -531px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n532px {
    margin-right: -532px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n533px {
    margin-right: -533px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n534px {
    margin-right: -534px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n535px {
    margin-right: -535px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n536px {
    margin-right: -536px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n537px {
    margin-right: -537px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n538px {
    margin-right: -538px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n539px {
    margin-right: -539px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n540px {
    margin-right: -540px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n541px {
    margin-right: -541px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n542px {
    margin-right: -542px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n543px {
    margin-right: -543px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n544px {
    margin-right: -544px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n545px {
    margin-right: -545px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n546px {
    margin-right: -546px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n547px {
    margin-right: -547px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n548px {
    margin-right: -548px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n549px {
    margin-right: -549px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n550px {
    margin-right: -550px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n551px {
    margin-right: -551px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n552px {
    margin-right: -552px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n553px {
    margin-right: -553px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n554px {
    margin-right: -554px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n555px {
    margin-right: -555px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n556px {
    margin-right: -556px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n557px {
    margin-right: -557px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n558px {
    margin-right: -558px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n559px {
    margin-right: -559px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n560px {
    margin-right: -560px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n561px {
    margin-right: -561px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n562px {
    margin-right: -562px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n563px {
    margin-right: -563px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n564px {
    margin-right: -564px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n565px {
    margin-right: -565px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n566px {
    margin-right: -566px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n567px {
    margin-right: -567px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n568px {
    margin-right: -568px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n569px {
    margin-right: -569px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n570px {
    margin-right: -570px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n571px {
    margin-right: -571px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n572px {
    margin-right: -572px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n573px {
    margin-right: -573px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n574px {
    margin-right: -574px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n575px {
    margin-right: -575px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n576px {
    margin-right: -576px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n577px {
    margin-right: -577px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n578px {
    margin-right: -578px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n579px {
    margin-right: -579px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n580px {
    margin-right: -580px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n581px {
    margin-right: -581px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n582px {
    margin-right: -582px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n583px {
    margin-right: -583px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n584px {
    margin-right: -584px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n585px {
    margin-right: -585px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n586px {
    margin-right: -586px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n587px {
    margin-right: -587px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n588px {
    margin-right: -588px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n589px {
    margin-right: -589px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n590px {
    margin-right: -590px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n591px {
    margin-right: -591px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n592px {
    margin-right: -592px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n593px {
    margin-right: -593px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n594px {
    margin-right: -594px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n595px {
    margin-right: -595px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n596px {
    margin-right: -596px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n597px {
    margin-right: -597px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n598px {
    margin-right: -598px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n599px {
    margin-right: -599px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n600px {
    margin-right: -600px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n601px {
    margin-right: -601px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n602px {
    margin-right: -602px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n603px {
    margin-right: -603px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n604px {
    margin-right: -604px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n605px {
    margin-right: -605px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n606px {
    margin-right: -606px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n607px {
    margin-right: -607px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n608px {
    margin-right: -608px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n609px {
    margin-right: -609px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n610px {
    margin-right: -610px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n611px {
    margin-right: -611px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n612px {
    margin-right: -612px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n613px {
    margin-right: -613px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n614px {
    margin-right: -614px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n615px {
    margin-right: -615px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n616px {
    margin-right: -616px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n617px {
    margin-right: -617px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n618px {
    margin-right: -618px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n619px {
    margin-right: -619px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n620px {
    margin-right: -620px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n621px {
    margin-right: -621px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n622px {
    margin-right: -622px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n623px {
    margin-right: -623px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n624px {
    margin-right: -624px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n625px {
    margin-right: -625px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n626px {
    margin-right: -626px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n627px {
    margin-right: -627px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n628px {
    margin-right: -628px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n629px {
    margin-right: -629px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n630px {
    margin-right: -630px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n631px {
    margin-right: -631px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n632px {
    margin-right: -632px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n633px {
    margin-right: -633px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n634px {
    margin-right: -634px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n635px {
    margin-right: -635px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n636px {
    margin-right: -636px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n637px {
    margin-right: -637px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n638px {
    margin-right: -638px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n639px {
    margin-right: -639px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n640px {
    margin-right: -640px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n641px {
    margin-right: -641px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n642px {
    margin-right: -642px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n643px {
    margin-right: -643px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n644px {
    margin-right: -644px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n645px {
    margin-right: -645px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n646px {
    margin-right: -646px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n647px {
    margin-right: -647px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n648px {
    margin-right: -648px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n649px {
    margin-right: -649px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n650px {
    margin-right: -650px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n651px {
    margin-right: -651px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n652px {
    margin-right: -652px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n653px {
    margin-right: -653px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n654px {
    margin-right: -654px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n655px {
    margin-right: -655px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n656px {
    margin-right: -656px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n657px {
    margin-right: -657px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n658px {
    margin-right: -658px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n659px {
    margin-right: -659px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n660px {
    margin-right: -660px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n661px {
    margin-right: -661px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n662px {
    margin-right: -662px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n663px {
    margin-right: -663px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n664px {
    margin-right: -664px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n665px {
    margin-right: -665px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n666px {
    margin-right: -666px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n667px {
    margin-right: -667px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n668px {
    margin-right: -668px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n669px {
    margin-right: -669px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n670px {
    margin-right: -670px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n671px {
    margin-right: -671px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n672px {
    margin-right: -672px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n673px {
    margin-right: -673px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n674px {
    margin-right: -674px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n675px {
    margin-right: -675px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n676px {
    margin-right: -676px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n677px {
    margin-right: -677px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n678px {
    margin-right: -678px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n679px {
    margin-right: -679px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n680px {
    margin-right: -680px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n681px {
    margin-right: -681px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n682px {
    margin-right: -682px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n683px {
    margin-right: -683px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n684px {
    margin-right: -684px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n685px {
    margin-right: -685px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n686px {
    margin-right: -686px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n687px {
    margin-right: -687px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n688px {
    margin-right: -688px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n689px {
    margin-right: -689px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n690px {
    margin-right: -690px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n691px {
    margin-right: -691px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n692px {
    margin-right: -692px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n693px {
    margin-right: -693px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n694px {
    margin-right: -694px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n695px {
    margin-right: -695px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n696px {
    margin-right: -696px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n697px {
    margin-right: -697px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n698px {
    margin-right: -698px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n699px {
    margin-right: -699px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n700px {
    margin-right: -700px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n701px {
    margin-right: -701px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n702px {
    margin-right: -702px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n703px {
    margin-right: -703px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n704px {
    margin-right: -704px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n705px {
    margin-right: -705px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n706px {
    margin-right: -706px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n707px {
    margin-right: -707px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n708px {
    margin-right: -708px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n709px {
    margin-right: -709px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n710px {
    margin-right: -710px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n711px {
    margin-right: -711px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n712px {
    margin-right: -712px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n713px {
    margin-right: -713px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n714px {
    margin-right: -714px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n715px {
    margin-right: -715px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n716px {
    margin-right: -716px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n717px {
    margin-right: -717px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n718px {
    margin-right: -718px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n719px {
    margin-right: -719px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n720px {
    margin-right: -720px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n721px {
    margin-right: -721px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n722px {
    margin-right: -722px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n723px {
    margin-right: -723px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n724px {
    margin-right: -724px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n725px {
    margin-right: -725px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n726px {
    margin-right: -726px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n727px {
    margin-right: -727px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n728px {
    margin-right: -728px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n729px {
    margin-right: -729px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n730px {
    margin-right: -730px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n731px {
    margin-right: -731px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n732px {
    margin-right: -732px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n733px {
    margin-right: -733px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n734px {
    margin-right: -734px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n735px {
    margin-right: -735px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n736px {
    margin-right: -736px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n737px {
    margin-right: -737px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n738px {
    margin-right: -738px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n739px {
    margin-right: -739px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n740px {
    margin-right: -740px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n741px {
    margin-right: -741px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n742px {
    margin-right: -742px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n743px {
    margin-right: -743px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n744px {
    margin-right: -744px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n745px {
    margin-right: -745px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n746px {
    margin-right: -746px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n747px {
    margin-right: -747px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n748px {
    margin-right: -748px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n749px {
    margin-right: -749px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n750px {
    margin-right: -750px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n751px {
    margin-right: -751px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n752px {
    margin-right: -752px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n753px {
    margin-right: -753px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n754px {
    margin-right: -754px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n755px {
    margin-right: -755px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n756px {
    margin-right: -756px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n757px {
    margin-right: -757px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n758px {
    margin-right: -758px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n759px {
    margin-right: -759px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n760px {
    margin-right: -760px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n761px {
    margin-right: -761px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n762px {
    margin-right: -762px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n763px {
    margin-right: -763px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n764px {
    margin-right: -764px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n765px {
    margin-right: -765px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n766px {
    margin-right: -766px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n767px {
    margin-right: -767px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n768px {
    margin-right: -768px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n769px {
    margin-right: -769px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n770px {
    margin-right: -770px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n771px {
    margin-right: -771px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n772px {
    margin-right: -772px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n773px {
    margin-right: -773px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n774px {
    margin-right: -774px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n775px {
    margin-right: -775px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n776px {
    margin-right: -776px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n777px {
    margin-right: -777px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n778px {
    margin-right: -778px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n779px {
    margin-right: -779px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n780px {
    margin-right: -780px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n781px {
    margin-right: -781px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n782px {
    margin-right: -782px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n783px {
    margin-right: -783px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n784px {
    margin-right: -784px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n785px {
    margin-right: -785px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n786px {
    margin-right: -786px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n787px {
    margin-right: -787px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n788px {
    margin-right: -788px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n789px {
    margin-right: -789px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n790px {
    margin-right: -790px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n791px {
    margin-right: -791px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n792px {
    margin-right: -792px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n793px {
    margin-right: -793px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n794px {
    margin-right: -794px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n795px {
    margin-right: -795px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n796px {
    margin-right: -796px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n797px {
    margin-right: -797px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n798px {
    margin-right: -798px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n799px {
    margin-right: -799px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n800px {
    margin-right: -800px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n801px {
    margin-right: -801px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n802px {
    margin-right: -802px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n803px {
    margin-right: -803px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n804px {
    margin-right: -804px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n805px {
    margin-right: -805px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n806px {
    margin-right: -806px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n807px {
    margin-right: -807px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n808px {
    margin-right: -808px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n809px {
    margin-right: -809px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n810px {
    margin-right: -810px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n811px {
    margin-right: -811px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n812px {
    margin-right: -812px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n813px {
    margin-right: -813px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n814px {
    margin-right: -814px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n815px {
    margin-right: -815px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n816px {
    margin-right: -816px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n817px {
    margin-right: -817px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n818px {
    margin-right: -818px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n819px {
    margin-right: -819px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n820px {
    margin-right: -820px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n821px {
    margin-right: -821px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n822px {
    margin-right: -822px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n823px {
    margin-right: -823px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n824px {
    margin-right: -824px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n825px {
    margin-right: -825px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n826px {
    margin-right: -826px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n827px {
    margin-right: -827px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n828px {
    margin-right: -828px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n829px {
    margin-right: -829px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n830px {
    margin-right: -830px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n831px {
    margin-right: -831px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n832px {
    margin-right: -832px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n833px {
    margin-right: -833px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n834px {
    margin-right: -834px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n835px {
    margin-right: -835px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n836px {
    margin-right: -836px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n837px {
    margin-right: -837px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n838px {
    margin-right: -838px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n839px {
    margin-right: -839px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n840px {
    margin-right: -840px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n841px {
    margin-right: -841px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n842px {
    margin-right: -842px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n843px {
    margin-right: -843px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n844px {
    margin-right: -844px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n845px {
    margin-right: -845px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n846px {
    margin-right: -846px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n847px {
    margin-right: -847px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n848px {
    margin-right: -848px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n849px {
    margin-right: -849px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n850px {
    margin-right: -850px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n851px {
    margin-right: -851px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n852px {
    margin-right: -852px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n853px {
    margin-right: -853px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n854px {
    margin-right: -854px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n855px {
    margin-right: -855px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n856px {
    margin-right: -856px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n857px {
    margin-right: -857px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n858px {
    margin-right: -858px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n859px {
    margin-right: -859px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n860px {
    margin-right: -860px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n861px {
    margin-right: -861px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n862px {
    margin-right: -862px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n863px {
    margin-right: -863px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n864px {
    margin-right: -864px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n865px {
    margin-right: -865px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n866px {
    margin-right: -866px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n867px {
    margin-right: -867px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n868px {
    margin-right: -868px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n869px {
    margin-right: -869px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n870px {
    margin-right: -870px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n871px {
    margin-right: -871px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n872px {
    margin-right: -872px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n873px {
    margin-right: -873px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n874px {
    margin-right: -874px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n875px {
    margin-right: -875px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n876px {
    margin-right: -876px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n877px {
    margin-right: -877px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n878px {
    margin-right: -878px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n879px {
    margin-right: -879px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n880px {
    margin-right: -880px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n881px {
    margin-right: -881px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n882px {
    margin-right: -882px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n883px {
    margin-right: -883px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n884px {
    margin-right: -884px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n885px {
    margin-right: -885px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n886px {
    margin-right: -886px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n887px {
    margin-right: -887px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n888px {
    margin-right: -888px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n889px {
    margin-right: -889px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n890px {
    margin-right: -890px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n891px {
    margin-right: -891px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n892px {
    margin-right: -892px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n893px {
    margin-right: -893px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n894px {
    margin-right: -894px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n895px {
    margin-right: -895px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n896px {
    margin-right: -896px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n897px {
    margin-right: -897px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n898px {
    margin-right: -898px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n899px {
    margin-right: -899px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n900px {
    margin-right: -900px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n901px {
    margin-right: -901px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n902px {
    margin-right: -902px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n903px {
    margin-right: -903px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n904px {
    margin-right: -904px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n905px {
    margin-right: -905px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n906px {
    margin-right: -906px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n907px {
    margin-right: -907px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n908px {
    margin-right: -908px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n909px {
    margin-right: -909px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n910px {
    margin-right: -910px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n911px {
    margin-right: -911px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n912px {
    margin-right: -912px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n913px {
    margin-right: -913px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n914px {
    margin-right: -914px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n915px {
    margin-right: -915px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n916px {
    margin-right: -916px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n917px {
    margin-right: -917px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n918px {
    margin-right: -918px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n919px {
    margin-right: -919px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n920px {
    margin-right: -920px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n921px {
    margin-right: -921px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n922px {
    margin-right: -922px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n923px {
    margin-right: -923px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n924px {
    margin-right: -924px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n925px {
    margin-right: -925px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n926px {
    margin-right: -926px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n927px {
    margin-right: -927px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n928px {
    margin-right: -928px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n929px {
    margin-right: -929px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n930px {
    margin-right: -930px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n931px {
    margin-right: -931px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n932px {
    margin-right: -932px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n933px {
    margin-right: -933px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n934px {
    margin-right: -934px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n935px {
    margin-right: -935px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n936px {
    margin-right: -936px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n937px {
    margin-right: -937px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n938px {
    margin-right: -938px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n939px {
    margin-right: -939px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n940px {
    margin-right: -940px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n941px {
    margin-right: -941px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n942px {
    margin-right: -942px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n943px {
    margin-right: -943px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n944px {
    margin-right: -944px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n945px {
    margin-right: -945px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n946px {
    margin-right: -946px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n947px {
    margin-right: -947px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n948px {
    margin-right: -948px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n949px {
    margin-right: -949px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n950px {
    margin-right: -950px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n951px {
    margin-right: -951px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n952px {
    margin-right: -952px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n953px {
    margin-right: -953px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n954px {
    margin-right: -954px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n955px {
    margin-right: -955px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n956px {
    margin-right: -956px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n957px {
    margin-right: -957px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n958px {
    margin-right: -958px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n959px {
    margin-right: -959px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n960px {
    margin-right: -960px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n961px {
    margin-right: -961px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n962px {
    margin-right: -962px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n963px {
    margin-right: -963px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n964px {
    margin-right: -964px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n965px {
    margin-right: -965px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n966px {
    margin-right: -966px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n967px {
    margin-right: -967px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n968px {
    margin-right: -968px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n969px {
    margin-right: -969px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n970px {
    margin-right: -970px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n971px {
    margin-right: -971px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n972px {
    margin-right: -972px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n973px {
    margin-right: -973px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n974px {
    margin-right: -974px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n975px {
    margin-right: -975px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n976px {
    margin-right: -976px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n977px {
    margin-right: -977px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n978px {
    margin-right: -978px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n979px {
    margin-right: -979px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n980px {
    margin-right: -980px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n981px {
    margin-right: -981px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n982px {
    margin-right: -982px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n983px {
    margin-right: -983px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n984px {
    margin-right: -984px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n985px {
    margin-right: -985px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n986px {
    margin-right: -986px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n987px {
    margin-right: -987px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n988px {
    margin-right: -988px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n989px {
    margin-right: -989px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n990px {
    margin-right: -990px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n991px {
    margin-right: -991px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n992px {
    margin-right: -992px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n993px {
    margin-right: -993px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n994px {
    margin-right: -994px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n995px {
    margin-right: -995px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n996px {
    margin-right: -996px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n997px {
    margin-right: -997px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n998px {
    margin-right: -998px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n999px {
    margin-right: -999px !important;
  }
}
@media (min-width: 768px) {
  .me-md-n1000px {
    margin-right: -1000px !important;
  }
}
.fs-1px {
  font-size: 1px;
}

.fs-2px {
  font-size: 2px;
}

.fs-3px {
  font-size: 3px;
}

.fs-4px {
  font-size: 4px;
}

.fs-5px {
  font-size: 5px;
}

.fs-6px {
  font-size: 6px;
}

.fs-7px {
  font-size: 7px;
}

.fs-8px {
  font-size: 8px;
}

.fs-9px {
  font-size: 9px;
}

.fs-10px {
  font-size: 10px;
}

.fs-11px {
  font-size: 11px;
}

.fs-12px {
  font-size: 12px;
}

.fs-13px {
  font-size: 13px;
}

.fs-14px {
  font-size: 14px;
}

.fs-15px {
  font-size: 15px;
}

.fs-16px {
  font-size: 16px;
}

.fs-17px {
  font-size: 17px;
}

.fs-18px {
  font-size: 18px;
}

.fs-19px {
  font-size: 19px;
}

.fs-20px {
  font-size: 20px;
}

.fs-21px {
  font-size: 21px;
}

.fs-22px {
  font-size: 22px;
}

.fs-23px {
  font-size: 23px;
}

.fs-24px {
  font-size: 24px;
}

.fs-25px {
  font-size: 25px;
}

.fs-26px {
  font-size: 26px;
}

.fs-27px {
  font-size: 27px;
}

.fs-28px {
  font-size: 28px;
}

.fs-29px {
  font-size: 29px;
}

.fs-30px {
  font-size: 30px;
}

.fs-31px {
  font-size: 31px;
}

.fs-32px {
  font-size: 32px;
}

.fs-33px {
  font-size: 33px;
}

.fs-34px {
  font-size: 34px;
}

.fs-35px {
  font-size: 35px;
}

.fs-36px {
  font-size: 36px;
}

.fs-37px {
  font-size: 37px;
}

.fs-38px {
  font-size: 38px;
}

.fs-39px {
  font-size: 39px;
}

.fs-40px {
  font-size: 40px;
}

.textShadow-default {
  text-shadow: 0 0 8px rgba(0, 0, 0, 0.9);
}

.clamp-1 {
  display: -webkit-box;
  -webkit-box-orient: vertical;
  overflow: hidden;
  -webkit-line-clamp: 1;
}

.clamp-2 {
  display: -webkit-box;
  -webkit-box-orient: vertical;
  overflow: hidden;
  -webkit-line-clamp: 2;
}

.clamp-3 {
  display: -webkit-box;
  -webkit-box-orient: vertical;
  overflow: hidden;
  -webkit-line-clamp: 3;
}

.clamp-4 {
  display: -webkit-box;
  -webkit-box-orient: vertical;
  overflow: hidden;
  -webkit-line-clamp: 4;
}

.clamp-5 {
  display: -webkit-box;
  -webkit-box-orient: vertical;
  overflow: hidden;
  -webkit-line-clamp: 5;
}

.z-index-1000 {
  z-index: 1000;
}

.z-index-1001 {
  z-index: 1001;
}

.z-index-1002 {
  z-index: 1002;
}

.z-index-1003 {
  z-index: 1003;
}

.z-index-1004 {
  z-index: 1004;
}

.z-index-1005 {
  z-index: 1005;
}

.z-index-1006 {
  z-index: 1006;
}

.z-index-1007 {
  z-index: 1007;
}

.z-index-1008 {
  z-index: 1008;
}

.z-index-1009 {
  z-index: 1009;
}

.z-index-1010 {
  z-index: 1010;
}

.z-index-1011 {
  z-index: 1011;
}

.z-index-1012 {
  z-index: 1012;
}

.z-index-1013 {
  z-index: 1013;
}

.z-index-1014 {
  z-index: 1014;
}

.z-index-1015 {
  z-index: 1015;
}

.z-index-1016 {
  z-index: 1016;
}

.z-index-1017 {
  z-index: 1017;
}

.z-index-1018 {
  z-index: 1018;
}

.z-index-1019 {
  z-index: 1019;
}

.z-index-1020 {
  z-index: 1020;
}

.z-index-1021 {
  z-index: 1021;
}

.z-index-1022 {
  z-index: 1022;
}

.z-index-1023 {
  z-index: 1023;
}

.z-index-1024 {
  z-index: 1024;
}

.z-index-1025 {
  z-index: 1025;
}

.z-index-1026 {
  z-index: 1026;
}

.z-index-1027 {
  z-index: 1027;
}

.z-index-1028 {
  z-index: 1028;
}

.z-index-1029 {
  z-index: 1029;
}

.z-index-1030 {
  z-index: 1030;
}

.z-index-1031 {
  z-index: 1031;
}

.z-index-1032 {
  z-index: 1032;
}

.z-index-1033 {
  z-index: 1033;
}

.z-index-1034 {
  z-index: 1034;
}

.z-index-1035 {
  z-index: 1035;
}

.z-index-1036 {
  z-index: 1036;
}

.z-index-1037 {
  z-index: 1037;
}

.z-index-1038 {
  z-index: 1038;
}

.z-index-1039 {
  z-index: 1039;
}

.z-index-1040 {
  z-index: 1040;
}

.z-index-1041 {
  z-index: 1041;
}

.z-index-1042 {
  z-index: 1042;
}

.z-index-1043 {
  z-index: 1043;
}

.z-index-1044 {
  z-index: 1044;
}

.z-index-1045 {
  z-index: 1045;
}

.z-index-1046 {
  z-index: 1046;
}

.z-index-1047 {
  z-index: 1047;
}

.z-index-1048 {
  z-index: 1048;
}

.z-index-1049 {
  z-index: 1049;
}

.z-index-1050 {
  z-index: 1050;
}

.z-index-1051 {
  z-index: 1051;
}

.z-index-1052 {
  z-index: 1052;
}

.z-index-1053 {
  z-index: 1053;
}

.z-index-1054 {
  z-index: 1054;
}

.z-index-1055 {
  z-index: 1055;
}

.z-index-1056 {
  z-index: 1056;
}

.z-index-1057 {
  z-index: 1057;
}

.z-index-1058 {
  z-index: 1058;
}

.z-index-1059 {
  z-index: 1059;
}

.z-index-1060 {
  z-index: 1060;
}

.z-index-1061 {
  z-index: 1061;
}

.z-index-1062 {
  z-index: 1062;
}

.z-index-1063 {
  z-index: 1063;
}

.z-index-1064 {
  z-index: 1064;
}

.z-index-1065 {
  z-index: 1065;
}

.z-index-1066 {
  z-index: 1066;
}

.z-index-1067 {
  z-index: 1067;
}

.z-index-1068 {
  z-index: 1068;
}

.z-index-1069 {
  z-index: 1069;
}

.z-index-1070 {
  z-index: 1070;
}

.z-index-1071 {
  z-index: 1071;
}

.z-index-1072 {
  z-index: 1072;
}

.z-index-1073 {
  z-index: 1073;
}

.z-index-1074 {
  z-index: 1074;
}

.z-index-1075 {
  z-index: 1075;
}

.z-index-1076 {
  z-index: 1076;
}

.z-index-1077 {
  z-index: 1077;
}

.z-index-1078 {
  z-index: 1078;
}

.z-index-1079 {
  z-index: 1079;
}

.z-index-1080 {
  z-index: 1080;
}

.z-index-1081 {
  z-index: 1081;
}

.z-index-1082 {
  z-index: 1082;
}

.z-index-1083 {
  z-index: 1083;
}

.z-index-1084 {
  z-index: 1084;
}

.z-index-1085 {
  z-index: 1085;
}

.z-index-1086 {
  z-index: 1086;
}

.z-index-1087 {
  z-index: 1087;
}

.z-index-1088 {
  z-index: 1088;
}

.z-index-1089 {
  z-index: 1089;
}

.z-index-1090 {
  z-index: 1090;
}

.opacity-01 {
  opacity: 0.1;
}

.opacity-02 {
  opacity: 0.2;
}

.opacity-03 {
  opacity: 0.3;
}

.opacity-04 {
  opacity: 0.4;
}

.opacity-05 {
  opacity: 0.5;
}

.opacity-06 {
  opacity: 0.6;
}

.opacity-07 {
  opacity: 0.7;
}

.opacity-08 {
  opacity: 0.8;
}

.opacity-09 {
  opacity: 0.9;
}

.pt-1p {
  padding-top: 1%;
}

.pt-2p {
  padding-top: 2%;
}

.pt-3p {
  padding-top: 3%;
}

.pt-4p {
  padding-top: 4%;
}

.pt-5p {
  padding-top: 5%;
}

.pt-6p {
  padding-top: 6%;
}

.pt-7p {
  padding-top: 7%;
}

.pt-8p {
  padding-top: 8%;
}

.pt-9p {
  padding-top: 9%;
}

.pt-10p {
  padding-top: 10%;
}

.pt-11p {
  padding-top: 11%;
}

.pt-12p {
  padding-top: 12%;
}

.pt-13p {
  padding-top: 13%;
}

.pt-14p {
  padding-top: 14%;
}

.pt-15p {
  padding-top: 15%;
}

.pt-16p {
  padding-top: 16%;
}

.pt-17p {
  padding-top: 17%;
}

.pt-18p {
  padding-top: 18%;
}

.pt-19p {
  padding-top: 19%;
}

.pt-20p {
  padding-top: 20%;
}

.pt-21p {
  padding-top: 21%;
}

.pt-22p {
  padding-top: 22%;
}

.pt-23p {
  padding-top: 23%;
}

.pt-24p {
  padding-top: 24%;
}

.pt-25p {
  padding-top: 25%;
}

.pt-26p {
  padding-top: 26%;
}

.pt-27p {
  padding-top: 27%;
}

.pt-28p {
  padding-top: 28%;
}

.pt-29p {
  padding-top: 29%;
}

.pt-30p {
  padding-top: 30%;
}

.pt-31p {
  padding-top: 31%;
}

.pt-32p {
  padding-top: 32%;
}

.pt-33p {
  padding-top: 33%;
}

.pt-34p {
  padding-top: 34%;
}

.pt-35p {
  padding-top: 35%;
}

.pt-36p {
  padding-top: 36%;
}

.pt-37p {
  padding-top: 37%;
}

.pt-38p {
  padding-top: 38%;
}

.pt-39p {
  padding-top: 39%;
}

.pt-40p {
  padding-top: 40%;
}

.pt-41p {
  padding-top: 41%;
}

.pt-42p {
  padding-top: 42%;
}

.pt-43p {
  padding-top: 43%;
}

.pt-44p {
  padding-top: 44%;
}

.pt-45p {
  padding-top: 45%;
}

.pt-46p {
  padding-top: 46%;
}

.pt-47p {
  padding-top: 47%;
}

.pt-48p {
  padding-top: 48%;
}

.pt-49p {
  padding-top: 49%;
}

.pt-50p {
  padding-top: 50%;
}

.pt-51p {
  padding-top: 51%;
}

.pt-52p {
  padding-top: 52%;
}

.pt-53p {
  padding-top: 53%;
}

.pt-54p {
  padding-top: 54%;
}

.pt-55p {
  padding-top: 55%;
}

.pt-56p {
  padding-top: 56%;
}

.pt-57p {
  padding-top: 57%;
}

.pt-58p {
  padding-top: 58%;
}

.pt-59p {
  padding-top: 59%;
}

.pt-60p {
  padding-top: 60%;
}

.pt-61p {
  padding-top: 61%;
}

.pt-62p {
  padding-top: 62%;
}

.pt-63p {
  padding-top: 63%;
}

.pt-64p {
  padding-top: 64%;
}

.pt-65p {
  padding-top: 65%;
}

.pt-66p {
  padding-top: 66%;
}

.pt-67p {
  padding-top: 67%;
}

.pt-68p {
  padding-top: 68%;
}

.pt-69p {
  padding-top: 69%;
}

.pt-70p {
  padding-top: 70%;
}

.pt-71p {
  padding-top: 71%;
}

.pt-72p {
  padding-top: 72%;
}

.pt-73p {
  padding-top: 73%;
}

.pt-74p {
  padding-top: 74%;
}

.pt-75p {
  padding-top: 75%;
}

.pt-76p {
  padding-top: 76%;
}

.pt-77p {
  padding-top: 77%;
}

.pt-78p {
  padding-top: 78%;
}

.pt-79p {
  padding-top: 79%;
}

.pt-80p {
  padding-top: 80%;
}

.pt-81p {
  padding-top: 81%;
}

.pt-82p {
  padding-top: 82%;
}

.pt-83p {
  padding-top: 83%;
}

.pt-84p {
  padding-top: 84%;
}

.pt-85p {
  padding-top: 85%;
}

.pt-86p {
  padding-top: 86%;
}

.pt-87p {
  padding-top: 87%;
}

.pt-88p {
  padding-top: 88%;
}

.pt-89p {
  padding-top: 89%;
}

.pt-90p {
  padding-top: 90%;
}

.pt-91p {
  padding-top: 91%;
}

.pt-92p {
  padding-top: 92%;
}

.pt-93p {
  padding-top: 93%;
}

.pt-94p {
  padding-top: 94%;
}

.pt-95p {
  padding-top: 95%;
}

.pt-96p {
  padding-top: 96%;
}

.pt-97p {
  padding-top: 97%;
}

.pt-98p {
  padding-top: 98%;
}

.pt-99p {
  padding-top: 99%;
}

.pt-100p {
  padding-top: 100%;
}

main {
  max-width: 500px;
  margin: 20px;
  padding: 20px;
  background: rgba(255, 255, 255, 0.8);
  border-radius: 10px;
}

.header-line:before, .header-line:after {
  content: "";
}

@media (min-width: 768px) {
  .header-line.start:before {
    right: auto !important;
  }
  .header-line.end:before {
    left: auto !important;
  }
  .header-line:after {
    width: 100%;
  }
}